{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "07d8a55f-d48e-48f8-803b-4094a8664be8",
          "code": "98967-40-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=98967-40-9",
          "code_system": "CAS",
          "references": [
            "fc15a25d-2110-4951-b030-8ddbfc4a9638",
            "622bd78a-1ebf-44f4-bd09-45fb79785d7c"
          ]
        },
        {
          "uuid": "c4a595ae-8c22-4389-aee0-0d88e05b5d63",
          "code": "C472634",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67472634",
          "code_system": "MESH",
          "references": [
            "fc15a25d-2110-4951-b030-8ddbfc4a9638"
          ]
        },
        {
          "uuid": "5dd10577-8098-4e90-bcb0-d5ce94297f9a",
          "code": "129016",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2395",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "fc15a25d-2110-4951-b030-8ddbfc4a9638"
          ]
        },
        {
          "uuid": "2fe328e3-5d3a-4ba2-8d7b-0db0852e8b56",
          "code": "m5442",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5442?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "fc15a25d-2110-4951-b030-8ddbfc4a9638"
          ]
        },
        {
          "uuid": "1b6fa25d-24da-4558-b7cb-1bbda3f57c77",
          "code": "91759",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91759",
          "code_system": "PUBCHEM",
          "references": [
            "fc15a25d-2110-4951-b030-8ddbfc4a9638"
          ]
        },
        {
          "uuid": "1d0bab48-a356-ce1b-98f5-3e58b67b6e13",
          "code": "DTXSID4032615",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4032615",
          "code_system": "EPA CompTox",
          "references": [
            "9b3b8629-6a4f-ce5e-d79c-1bdc97ed8599"
          ]
        },
        {
          "uuid": "3daf0a44-ba0d-4d81-a9cf-60ae366b8937",
          "code": "X89F0S6LW8",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "49c58f32-8a83-063f-ff43-d6dbdd65400f",
          "code": "flumetsulam",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/flumetsulam.html",
          "code_system": "ALANWOOD",
          "references": [
            "b0030e74-f111-b068-8bd7-101c54d0ae84"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "8443ee3f-b9fd-4401-809a-a9ec31abd9c2",
          "name": "2',6'-DIFLUORO-5-METHYL(1,2,4)TRIAZOLO(1,5-A)PYRIMIDINE-2-SULFONANILIDE",
          "stdName": "2',6'-DIFLUORO-5-METHYL(1,2,4)TRIAZOLO(1,5-A)PYRIMIDINE-2-SULFONANILIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bee70136-5219-49dc-8deb-d2fa8546eb7a",
            "340046fc-64a8-45d1-8c04-342b5c92f8c2"
          ],
          "display_name": false
        },
        {
          "uuid": "b3d67b06-59b7-474d-8114-3b14170340c4",
          "name": "BROADSTRIKE (DOW AGROSCI.)",
          "stdName": "BROADSTRIKE (DOW AGROSCI.)",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b32bfa39-f492-48b9-8325-726adf1f660d",
            "a27dc2ee-79e2-4dfd-8cf3-06a52c318ffb"
          ],
          "display_name": false
        },
        {
          "uuid": "7eef428b-ed39-43c0-8dd8-9169fa0d03d7",
          "name": "DE-498",
          "stdName": "DE-498",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b32bfa39-f492-48b9-8325-726adf1f660d",
            "a27dc2ee-79e2-4dfd-8cf3-06a52c318ffb"
          ],
          "display_name": false
        },
        {
          "uuid": "7958cee6-b0bf-42e8-8410-cf6b900a529a",
          "name": "FLUMETSULAM",
          "stdName": "FLUMETSULAM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "219544ca-03bc-4619-aaa2-b15e0ac78759",
            "7cb663a6-2173-4692-9b91-cb2578b70575",
            "b32bfa39-f492-48b9-8325-726adf1f660d",
            "527ff400-4a0b-47b9-900a-e067498073a8"
          ],
          "display_name": true
        },
        {
          "uuid": "22c39f31-e8e5-4ce1-a4a8-48b8ffc61f6b",
          "name": "FLUMETSULAM [MI]",
          "stdName": "FLUMETSULAM [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "219544ca-03bc-4619-aaa2-b15e0ac78759",
            "b32bfa39-f492-48b9-8325-726adf1f660d"
          ],
          "display_name": false
        },
        {
          "uuid": "f7234a08-3432-458a-b405-8a1d2989a742",
          "name": "N-(2,6-DIFLUOROPHENYL)-5-METHYL(1,2,4)TRIAZOLO(1,5-A)PYRIMIDINE-2-SULFONAMIDE",
          "stdName": "N-(2,6-DIFLUOROPHENYL)-5-METHYL(1,2,4)TRIAZOLO(1,5-A)PYRIMIDINE-2-SULFONAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9c3c5d44-380c-4d22-bb59-bc4f4663f0f6",
            "340046fc-64a8-45d1-8c04-342b5c92f8c2"
          ],
          "display_name": false
        },
        {
          "uuid": "63708dfd-158d-4ef8-8dbe-ba33226fd019",
          "name": "PYTHON (DOW AGROSCI.)",
          "stdName": "PYTHON (DOW AGROSCI.)",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b32bfa39-f492-48b9-8325-726adf1f660d",
            "a27dc2ee-79e2-4dfd-8cf3-06a52c318ffb"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "527ff400-4a0b-47b9-900a-e067498073a8",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "340046fc-64a8-45d1-8c04-342b5c92f8c2",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9c3c5d44-380c-4d22-bb59-bc4f4663f0f6",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bee70136-5219-49dc-8deb-d2fa8546eb7a",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "219544ca-03bc-4619-aaa2-b15e0ac78759",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b32bfa39-f492-48b9-8325-726adf1f660d",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a27dc2ee-79e2-4dfd-8cf3-06a52c318ffb",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fc15a25d-2110-4951-b030-8ddbfc4a9638",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390960000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5b1b549f-76dc-4840-a7ab-c6229ebacc51",
          "citation": "SRS import [X89F0S6LW8]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=X89F0S6LW8",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390960000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "94575453-a05d-47a2-8aa4-d18292c981c7",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7cb663a6-2173-4692-9b91-cb2578b70575",
          "citation": "FLUMETSULAM [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9b3b8629-6a4f-ce5e-d79c-1bdc97ed8599",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=98967-40-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b0030e74-f111-b068-8bd7-101c54d0ae84",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "622bd78a-1ebf-44f4-bd09-45fb79785d7c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9af8af14-1a56-464e-ad46-7e4d3017af45",
          "id": "9af8af14-1a56-464e-ad46-7e4d3017af45",
          "molfile": "\n  Marvin  01132108032D          \n\n 22 24  0  0  0  0            999 V2000\n   10.5553   -4.0148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7303   -4.0148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3242   -3.2952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5052   -3.2952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0823   -3.9984    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1841   -3.9984    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1841   -4.8593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8479   -5.3767    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4885   -4.7132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3174   -4.7132    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4690   -5.3971    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0551   -4.6867    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8782   -6.1122    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7538   -5.8109    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7531   -5.2325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7531   -4.4074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4620   -3.9587    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0388   -3.9974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3310   -4.4074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3310   -5.2325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0388   -5.6475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0388   -6.4677    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 10  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  9  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n 11  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  2  0  0  0  0\n 14 11  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 21 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 16 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\nM  END",
          "smiles": "Cc1ccn2c(n1)nc(n2)S(=O)(=O)Nc3c(cccc3F)F",
          "formula": "C12H9F2N5O2S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "fb6fd765-c5e4-424d-a31a-b9f17b3593ca"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "325.2955",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "bd3cc307-8296-40ff-b06c-b59d06a4ac78",
      "version": "4",
      "structure": {
        "id": "0b9f9f6b-6a42-4a39-ba2c-363814800271",
        "molfile": "\n  Marvin  01132100512D          \n\n 22 24  0  0  0  0            999 V2000\n    5.4620   -3.9587    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7531   -4.4074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0388   -3.9974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3310   -4.4074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3310   -5.2325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0388   -5.6475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0388   -6.4677    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7531   -5.2325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7538   -5.8109    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4690   -5.3971    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0551   -4.6867    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8782   -6.1122    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1841   -4.8593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8479   -5.3767    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4885   -4.7132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3174   -4.7132    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7303   -4.0148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5553   -4.0148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3242   -3.2952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5052   -3.2952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0823   -3.9984    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1841   -3.9984    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  8  2  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  2  0  0  0  0\n 10 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 15  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 13  2  0  0  0  0\nM  END",
        "smiles": "Cc1ccn2c(n1)nc(n2)S(=O)(=O)Nc3c(cccc3F)F",
        "formula": "C12H9F2N5O2S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "325.2955",
        "optical_activity": "NONE",
        "references": [
          "94575453-a05d-47a2-8aa4-d18292c981c7",
          "5b1b549f-76dc-4840-a7ab-c6229ebacc51"
        ],
        "stereo_centers": 0
      },
      "unii": "X89F0S6LW8"
    }
  ]
}