{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6aba170c-3dc0-4af0-b740-4a09f2d47e76",
          "code": "138506-45-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=138506-45-3",
          "code_system": "CAS",
          "references": [
            "1936fc9f-65e5-4b4f-afa8-8cc655adbdcd",
            "a3f25c1a-e5f6-40f0-9c88-d9f1de3b0c80"
          ]
        },
        {
          "uuid": "89501c80-dbca-4ffd-9017-3aa56d1db206",
          "code": "C534452",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67534452",
          "code_system": "MESH",
          "references": [
            "1936fc9f-65e5-4b4f-afa8-8cc655adbdcd"
          ]
        },
        {
          "uuid": "0d7f7f2b-857c-42a4-9e4b-7bde974c2e35",
          "code": "6993",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=6993",
          "code_system": "INN",
          "references": [
            "1936fc9f-65e5-4b4f-afa8-8cc655adbdcd"
          ]
        },
        {
          "uuid": "a14c70a4-dccb-4121-8626-f94b994d80d2",
          "code": "C76886",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C76886",
          "code_system": "NCI_THESAURUS",
          "references": [
            "1936fc9f-65e5-4b4f-afa8-8cc655adbdcd"
          ]
        },
        {
          "uuid": "db8cee69-99db-4419-a3ad-cdca83f0ecf1",
          "code": "SUB09823MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "1936fc9f-65e5-4b4f-afa8-8cc655adbdcd"
          ]
        },
        {
          "uuid": "51fa39ba-7dec-4534-9fe3-3e0b19236147",
          "code": "CHEMBL2106955",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2106955",
          "code_system": "ChEMBL",
          "references": [
            "1936fc9f-65e5-4b4f-afa8-8cc655adbdcd"
          ]
        },
        {
          "uuid": "3ae86718-f329-4398-8aea-22f0dd2cbc6a",
          "code": "3047843",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3047843",
          "code_system": "PUBCHEM",
          "references": [
            "1936fc9f-65e5-4b4f-afa8-8cc655adbdcd"
          ]
        },
        {
          "uuid": "09776c1b-5647-be2e-c636-149a6a9e3193",
          "code": "C78284",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Integumentary System",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C78284",
          "code_system": "NCI_THESAURUS",
          "references": [
            "0f136538-039a-ce1e-a22e-5ad56e632425"
          ]
        },
        {
          "uuid": "4ed19e89-098a-4823-a3c3-03cb2211702f",
          "code": "X7D2GSX1C1",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8dce0214-524e-f022-0969-eb66494c1cdf",
          "code": "100000081943",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "bb6b4b95-773d-3564-3ab5-9676e05d9788"
          ]
        },
        {
          "uuid": "489b50bb-44f4-441e-af0f-3e103fe90d44",
          "code": "DTXSID20160695",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20160695",
          "code_system": "EPA CompTox",
          "references": [
            "94ccba09-7429-9293-36f9-b1fe798fa282"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "8de82033-1acc-483e-a1f3-fede412a2442",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "ba70dd80-dbc4-4680-b19a-5a3e4190af37",
            "refuuid": "3f35bca1-3992-47a8-8c62-090e0fc36502",
            "name": "PIDOBENZONE",
            "unii": "X7D2GSX1C1",
            "linking_id": "X7D2GSX1C1",
            "ref_pname": "PIDOBENZONE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d54bc5d5-5003-44be-90e6-5726aa7d4b50",
          "name": "5-OXO-L-PROLINE,P-HYDROXYPHENYL ESTER",
          "stdName": "5-OXO-L-PROLINE,P-HYDROXYPHENYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f62b2bf-6e1c-4eeb-aa01-4508dec93343"
          ],
          "display_name": false
        },
        {
          "uuid": "2af88216-737f-40d5-a512-155ce72414f6",
          "name": "PIDOBENZONE",
          "stdName": "PIDOBENZONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f62b2bf-6e1c-4eeb-aa01-4508dec93343",
            "68b44490-e8f3-4b47-aa11-b96214914109",
            "10c19dc6-78e1-4059-bd38-545bff7f545a",
            "64723a2b-6558-4e61-ae9e-48555a2328e6",
            "56abac45-aa3c-4361-a19c-394442ef3560",
            "3bf445d2-218f-4534-b3e0-00a2d2f47105",
            "d3f640f5-3b50-4759-8049-9a3cbd42ab38",
            "36b8e0d1-cc51-4d87-9524-4cb93666ebcb"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "7ee7fcb1-99f0-4fda-9718-b387f0d5b5b2",
              "name_org": "INN"
            },
            {
              "uuid": "a0048e2a-c531-4705-aa6f-bafa050c72e4",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "e958e24e-b4c0-eb95-a30f-0327f3910177",
          "name": "Pidobenzone [WHO-DD]",
          "stdName": "PIDOBENZONE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7e1d46c1-bffa-61cf-7a78-fae3777eb745"
          ],
          "display_name": false
        },
        {
          "uuid": "0db10643-40c4-4000-b76c-dc69ffaa6301",
          "name": "pidobenzone [INN]",
          "stdName": "PIDOBENZONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3bf445d2-218f-4534-b3e0-00a2d2f47105"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "77a35e78-5c04-4036-b95f-1ab7b4d482ee",
          "citation": "ACD 8.0",
          "doc_type": "ACD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2f62b2bf-6e1c-4eeb-aa01-4508dec93343",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3bf445d2-218f-4534-b3e0-00a2d2f47105",
          "citation": "INN Proposed List 68",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL68.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "36b8e0d1-cc51-4d87-9524-4cb93666ebcb",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "68b44490-e8f3-4b47-aa11-b96214914109",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "64723a2b-6558-4e61-ae9e-48555a2328e6",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1936fc9f-65e5-4b4f-afa8-8cc655adbdcd",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389952000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1953e986-623d-4f76-abc8-8e150b211c17",
          "citation": "SRS import [X7D2GSX1C1]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=X7D2GSX1C1",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389952000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d3f640f5-3b50-4759-8049-9a3cbd42ab38",
          "citation": "PIDOBENZONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "56abac45-aa3c-4361-a19c-394442ef3560",
          "citation": "PIDOBENZONE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "10c19dc6-78e1-4059-bd38-545bff7f545a",
          "citation": "PIDOBENZONE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "eeda87bd-6bde-ea9d-3e46-35046d861451",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=138506-45-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0f136538-039a-ce1e-a22e-5ad56e632425",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "a3f25c1a-e5f6-40f0-9c88-d9f1de3b0c80",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7e1d46c1-bffa-61cf-7a78-fae3777eb745",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "94ccba09-7429-9293-36f9-b1fe798fa282",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "bb6b4b95-773d-3564-3ab5-9676e05d9788",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d1e20cd1-5148-4b2d-aca6-3afc11cace74",
          "id": "d1e20cd1-5148-4b2d-aca6-3afc11cace74",
          "molfile": "\n  Marvin  01132110512D          \n\n 16 17  0  0  1  0            999 V2000\n    0.8699   -1.3718    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    1.3548   -0.7044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1395   -0.9593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1395   -1.7843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8069   -2.2692    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3548   -2.0393    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0449   -1.3718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3676   -0.6574    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3676   -2.0863    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1926   -2.0863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6051   -2.8008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4301   -2.8008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8426   -2.0863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6676   -2.0863    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4301   -1.3718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6051   -1.3718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  6  1  0  0  0  0\n  1  7  1  6  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 16  2  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  2  0  0  0  0\n 15 16  1  0  0  0  0\nM  END",
          "smiles": "c1cc(ccc1O)OC(=O)[C@@H]2CCC(=O)N2",
          "formula": "C11H11NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ae7346f6-7260-4b60-adde-17aabb642026"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "221.2098",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3f35bca1-3992-47a8-8c62-090e0fc36502",
      "version": "11",
      "structure": {
        "id": "caca5eda-4f1e-4dec-b803-bbbc073fc3b7",
        "molfile": "\n  Marvin  01132110282D          \n\n 16 17  0  0  1  0            999 V2000\n    0.0449   -1.3718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3548   -2.0393    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8699   -1.3718    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    1.3548   -0.7044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1395   -0.9593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1395   -1.7843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3676   -0.6574    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3676   -2.0863    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8069   -2.2692    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1926   -2.0863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6051   -2.8008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4301   -2.8008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8426   -2.0863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4301   -1.3718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6051   -1.3718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6676   -2.0863    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  1  1  6  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  2  6  1  0  0  0  0\n  1  7  2  0  0  0  0\n  1  8  1  0  0  0  0\n  6  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 10 15  2  0  0  0  0\n 13 16  1  0  0  0  0\n  8 10  1  0  0  0  0\nM  END",
        "smiles": "c1cc(ccc1O)OC(=O)[C@@H]2CCC(=O)N2",
        "formula": "C11H11NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "221.2098",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "2f62b2bf-6e1c-4eeb-aa01-4508dec93343",
          "1953e986-623d-4f76-abc8-8e150b211c17",
          "3bf445d2-218f-4534-b3e0-00a2d2f47105"
        ],
        "stereo_centers": 1
      },
      "unii": "X7D2GSX1C1"
    }
  ]
}