{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "902317e2-8b5f-4ad0-b869-f2e13e353684",
          "code": "131320-42-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=131320-42-8",
          "code_system": "CAS",
          "references": [
            "5cb8a957-ef02-4dee-aeb1-913aaf58d7d9",
            "8e9a043d-d1e9-486b-8031-d97628c41c20"
          ]
        },
        {
          "uuid": "2543b900-f5ab-4618-8ada-1ab028e29452",
          "code": "11603163",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11603163",
          "code_system": "PUBCHEM",
          "references": [
            "5cb8a957-ef02-4dee-aeb1-913aaf58d7d9"
          ]
        },
        {
          "uuid": "0740938d-f572-403a-a438-6fda2c35f287",
          "code": "X788F9M554",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "27c4c2e7-9d24-8725-af38-59ad92090feb",
          "code": "84001",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:84001",
          "code_system": "CHEBI",
          "references": [
            "9b10cbeb-5625-36ff-95ad-aa886ac3250b"
          ]
        },
        {
          "uuid": "6cbd55e3-95cc-c623-eec9-3676df847acf",
          "code": "DTXSID601033614",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID601033614",
          "code_system": "EPA CompTox",
          "references": [
            "9b10cbeb-5625-36ff-95ad-aa886ac3250b"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "97f90304-46dd-4f07-916a-e866cac3bd90",
          "name": "(-)-TETRACONAZOLE",
          "stdName": "(-)-TETRACONAZOLE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7c9eb8ae-68d8-4e22-95d1-5a6b17daf9a8",
            "1ce96d7d-12aa-4ce2-b7c2-2c1a4fc0d302"
          ],
          "display_name": false
        },
        {
          "uuid": "09a9f052-2a09-46a0-a6a1-18b492b2adc0",
          "name": "1H-1,2,4-TRIAZOLE, 1-((2S)-2-(2,4-DICHLOROPHENYL)-3-(1,1,2,2-TETRAFLUOROETHOXY)PROPYL)-",
          "stdName": "1H-1,2,4-TRIAZOLE, 1-((2S)-2-(2,4-DICHLOROPHENYL)-3-(1,1,2,2-TETRAFLUOROETHOXY)PROPYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7c9eb8ae-68d8-4e22-95d1-5a6b17daf9a8",
            "1ce96d7d-12aa-4ce2-b7c2-2c1a4fc0d302"
          ],
          "display_name": false
        },
        {
          "uuid": "f2d3dfff-2cc8-4778-97f4-59aaed07b2df",
          "name": "S-(-)-TETRACONAZOLE",
          "stdName": "S-(-)-TETRACONAZOLE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7c9eb8ae-68d8-4e22-95d1-5a6b17daf9a8",
            "1ce96d7d-12aa-4ce2-b7c2-2c1a4fc0d302"
          ],
          "display_name": false
        },
        {
          "uuid": "55e609ab-668d-4c95-8bb2-709588fe9866",
          "name": "TETRACONAZOLE, (-)-",
          "stdName": "TETRACONAZOLE, (-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7c9eb8ae-68d8-4e22-95d1-5a6b17daf9a8",
            "e9fcfeaf-1ba3-4f99-8223-6870785b8f9c"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "e9fcfeaf-1ba3-4f99-8223-6870785b8f9c",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7c9eb8ae-68d8-4e22-95d1-5a6b17daf9a8",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ce96d7d-12aa-4ce2-b7c2-2c1a4fc0d302",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5cb8a957-ef02-4dee-aeb1-913aaf58d7d9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392178000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3dc4ee09-088b-4339-8aa2-3c7eed971634",
          "citation": "SRS import [X788F9M554]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=X788F9M554",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392178000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9b10cbeb-5625-36ff-95ad-aa886ac3250b",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "8e9a043d-d1e9-486b-8031-d97628c41c20",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ab47f6a1-9761-4b4d-90b0-6f7edaa62f24",
          "id": "ab47f6a1-9761-4b4d-90b0-6f7edaa62f24",
          "molfile": "\n  Marvin  01132108532D          \n\n 23 24  0  0  1  0            999 V2000\n   10.5048   -7.5342    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   10.5048   -8.3592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7903   -8.7717    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7903   -9.5967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2300  -10.2634    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9934   -9.3832    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5048  -10.0092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5048  -10.8342    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2192   -9.5967    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7903   -7.1217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0758   -7.5342    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9933   -8.3552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1860   -8.5296    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7718   -7.8148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3246   -7.2011    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2192   -7.1217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2162   -6.3030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9272   -5.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6467   -6.3012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3606   -5.8877    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   12.6462   -7.1271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9323   -7.5389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9297   -8.3639    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 10  1  6  0  0  0\n  1 16  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  4  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 11 15  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 17 16  1  0  0  0  0\n 16 22  2  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 19  2  0  0  0  0\n 22 21  1  0  0  0  0\n 22 23  1  0  0  0  0\nM  END",
          "smiles": "c1cc([C@@H](Cn2cncn2)COC(C(F)F)(F)F)c(cc1Cl)Cl",
          "formula": "C13H11Cl2F4N3O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "36bd125b-0569-44d9-a6e9-0296c60641a2"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "372.1459",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5056637a-062c-4230-85c6-18c0c53a7bda",
      "version": "4",
      "structure": {
        "id": "b75b6249-d3aa-4ce3-bbe6-96a122f63ceb",
        "molfile": "\n  Marvin  01132109292D          \n\n 23 24  0  0  1  0            999 V2000\n   10.5048   -7.5342    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   11.2192   -7.1217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9323   -7.5389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6462   -7.1271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6467   -6.3012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9272   -5.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2162   -6.3030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3606   -5.8877    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   11.9297   -8.3639    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   10.5048   -8.3592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7903   -8.7717    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7903   -9.5967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2300  -10.2634    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5048  -10.0092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5048  -10.8342    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2192   -9.5967    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9934   -9.3832    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7903   -7.1217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0758   -7.5342    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3246   -7.2011    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7718   -7.8148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1860   -8.5296    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9933   -8.3552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  2  1  0  0  0  0\n  5  8  1  0  0  0  0\n  3  9  1  0  0  0  0\n  1 10  1  6  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 12 17  1  0  0  0  0\n  1 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 23 19  1  0  0  0  0\nM  END",
        "smiles": "c1cc([C@@H](Cn2cncn2)COC(C(F)F)(F)F)c(cc1Cl)Cl",
        "formula": "C13H11Cl2F4N3O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "372.1459",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "1ce96d7d-12aa-4ce2-b7c2-2c1a4fc0d302",
          "3dc4ee09-088b-4339-8aa2-3c7eed971634"
        ],
        "stereo_centers": 1
      },
      "unii": "X788F9M554"
    }
  ]
}