{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "9eedd04c-589a-4638-9991-899d368c502d", "code": "1628709-76-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1628709-76-1", "code_system": "CAS", "references": [ "8951b96d-e819-414c-9f27-41b838315bec", "66819af6-5461-4ca9-b610-517666561290" ] }, { "uuid": "b4344eb9-2d67-4109-b24b-71a6f84508a0", "code": "91864530", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91864530", "code_system": "PUBCHEM", "references": [ "8951b96d-e819-414c-9f27-41b838315bec" ] }, { "uuid": "89844cd6-7199-4684-b308-fb45a09e76c7", "code": "X70B1I735D", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "b6b61e04-5ab3-4426-b87d-fccb2d65cc36", "name": "ARGINYLSPIROSTENOL", "stdName": "ARGINYLSPIROSTENOL", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "cb200276-ba18-44de-8143-5692ea74eec8", "d9ba4735-8d61-42f3-997e-fd1876e4ad2f" ], "display_name": false }, { "uuid": "c9541613-5195-47f4-bd9f-b82ecdc1a7e8", "name": "DIOSGENIN ARGININATE", "stdName": "DIOSGENIN ARGININATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "cb200276-ba18-44de-8143-5692ea74eec8", "d9ba4735-8d61-42f3-997e-fd1876e4ad2f", "50f663fb-ea7e-4fb9-8f59-e9306c56d6a8" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "3daab1c7-6261-4aa6-a02f-f25c988b7444", "name_org": "INCI" } ] }, { "uuid": "83ab5afe-f57a-4d78-a9a2-70496f662466", "name": "L-ARGININE, (3.BETA.,25R)-SPIROST-5-EN-3-YL ESTER", "stdName": "L-ARGININE, (3.BETA.,25R)-SPIROST-5-EN-3-YL ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "dc9a0fbc-b890-4583-99cd-eeddcfd6f1d8", "d9ba4735-8d61-42f3-997e-fd1876e4ad2f" ], "display_name": false } ], "references": [ { "uuid": "cb200276-ba18-44de-8143-5692ea74eec8", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "d9ba4735-8d61-42f3-997e-fd1876e4ad2f", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "dc9a0fbc-b890-4583-99cd-eeddcfd6f1d8", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8951b96d-e819-414c-9f27-41b838315bec", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393367000, "tags": [ "NOMEN" ] }, { "uuid": "ca5f7d99-8fb2-4407-b156-413f7ac8dc50", "citation": "SRS import [X70B1I735D]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=X70B1I735D", "doc_type": "SRS", "public_domain": true, "document_date": 1493393367000, "tags": [ "NOMEN" ] }, { "uuid": "50f663fb-ea7e-4fb9-8f59-e9306c56d6a8", "citation": "DIOSGENIN ARGININATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "66819af6-5461-4ca9-b610-517666561290", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "fa5c9565-f645-4d25-ab2c-b11da9b36ea6", "id": "fa5c9565-f645-4d25-ab2c-b11da9b36ea6", "molfile": "\n Marvin 01132112582D \n\n 41 46 0 0 1 0 999 V2000\n 11.1054 -9.8851 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 11.0802 -10.7096 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4038 -9.4509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6772 -9.8414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9757 -9.4072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2489 -9.7977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5474 -9.3636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5726 -8.5390 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8207 -9.7541 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8321 -9.4945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8573 -8.6699 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5337 -9.9287 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2603 -9.5381 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 13.2856 -8.7136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0122 -8.3231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7138 -8.7572 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 14.7390 -7.9326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6886 -9.5819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9618 -9.9723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3901 -10.0160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1168 -9.6255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1421 -8.8008 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 16.8687 -8.4104 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 17.6452 -8.6892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1503 -8.0368 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 18.9422 -7.8060 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.9675 -6.9815 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 19.7105 -7.3398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.3924 -6.8756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.3313 -6.0528 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 21.0132 -5.5886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5882 -5.6945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.9063 -6.1588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1910 -6.7026 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 17.9602 -5.9106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6859 -7.3550 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 16.8940 -7.5858 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 17.0052 -6.7684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1924 -7.1517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4657 -7.5422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4405 -8.3667 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 1 2 1 1 0 0 0\n 1 3 1 0 0 0 0\n 10 1 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 7 2 0 0 0 0\n 11 10 2 0 0 0 0\n 10 12 1 0 0 0 0\n 13 12 1 1 0 0 0\n 13 14 1 0 0 0 0\n 13 19 1 0 0 0 0\n 14 15 1 0 0 0 0\n 16 15 1 0 0 0 0\n 16 17 1 1 0 0 0\n 16 18 1 0 0 0 0\n 41 16 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 18 2 0 0 0 0\n 20 21 1 0 0 0 0\n 22 21 1 6 0 0 0\n 23 22 1 0 0 0 0\n 22 41 1 0 0 0 0\n 23 24 1 1 0 0 0\n 37 23 1 0 0 0 0\n 25 24 1 1 0 0 0\n 25 26 1 0 0 0 0\n 36 25 1 0 0 0 0\n 27 26 1 6 0 0 0\n 27 28 1 0 0 0 0\n 27 33 1 0 0 0 0\n 34 27 1 0 0 0 0\n 29 28 1 0 0 0 0\n 30 29 1 0 0 0 0\n 30 31 1 6 0 0 0\n 30 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 34 35 1 0 0 0 0\n 36 34 1 1 0 0 0\n 36 37 1 0 0 0 0\n 37 38 1 1 0 0 0\n 37 39 1 0 0 0 0\n 40 39 1 0 0 0 0\n 41 40 1 1 0 0 0\nM END", "smiles": "C[C@@H]1CC[C@@]2(C(C)[C@H]3[C@H](C[C@H]4[C@@H]5CC=C6C[C@H](CC[C@]6(C)[C@H]5CC[C@@]43C)OC(=O)[C@H](CCCNC(=N)N)N)O2)OC1", "formula": "C33H54N4O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "90a48121-c634-4c47-9c1e-54030c6b9efd" }, "defined_stereo": 11, "ez_centers": 0, "molecular_weight": "570.8075", "optical_activity": "UNSPECIFIED", "stereo_centers": 12 } ], "definition_level": "COMPLETE", "uuid": "11413d8d-8215-4de9-b10e-6592a5ae30eb", "version": "3", "structure": { "id": "21ff3d8d-53c0-47cf-a862-8ccb2316c651", "molfile": "\n Marvin 01132101552D \n\n 46 51 0 0 1 0 999 V2000\n 17.0052 -6.7684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.8940 -7.5858 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 16.8687 -8.4104 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 16.9299 -9.2331 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1421 -8.8008 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 16.1672 -7.9763 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1168 -9.6255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3901 -10.0160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6886 -9.5819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7138 -8.7572 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 14.0122 -8.3231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2856 -8.7136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2603 -9.5381 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 12.5337 -9.9287 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8321 -9.4945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1054 -9.8851 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 10.4038 -9.4509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6772 -9.8414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9757 -9.4072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2489 -9.7977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5474 -9.3636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5726 -8.5390 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8207 -9.7541 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0802 -10.7096 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8573 -8.6699 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9618 -9.9723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7390 -7.9326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4405 -8.3667 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 15.4153 -9.1913 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4657 -7.5422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1924 -7.1517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6452 -8.6892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1503 -8.0368 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 18.6146 -8.7188 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 18.9422 -7.8060 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.9675 -6.9815 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 18.1910 -6.7026 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 17.6859 -7.3550 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 17.2216 -6.6730 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 17.9602 -5.9106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.9063 -6.1588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5882 -5.6945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.3313 -6.0528 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 21.0132 -5.5886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.3924 -6.8756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.7105 -7.3398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 1 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 6 0 0 0\n 5 3 1 0 0 0 0\n 5 6 1 1 0 0 0\n 7 5 1 0 0 0 0\n 8 7 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 1 1 0 0 0\n 15 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 22 21 2 0 0 0 0\n 23 21 1 0 0 0 0\n 16 24 1 1 0 0 0\n 25 15 2 0 0 0 0\n 26 9 1 0 0 0 0\n 13 26 1 0 0 0 0\n 10 27 1 1 0 0 0\n 10 28 1 0 0 0 0\n 5 28 1 0 0 0 0\n 28 29 1 6 0 0 0\n 28 30 1 0 0 0 0\n 31 2 1 0 0 0 0\n 30 31 1 0 0 0 0\n 32 3 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 1 6 0 0 0\n 35 33 1 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 37 38 1 0 0 0 0\n 33 38 1 0 0 0 0\n 38 2 1 0 0 0 0\n 38 39 1 6 0 0 0\n 37 40 1 6 0 0 0\n 36 41 1 6 0 0 0\n 42 41 1 0 0 0 0\n 43 42 1 0 0 0 0\n 43 44 1 6 0 0 0\n 43 45 1 0 0 0 0\n 45 46 1 0 0 0 0\n 46 36 1 0 0 0 0\nM END", "smiles": "C[C@@H]1CC[C@@]2([C@@H](C)[C@@]3([H])[C@]([H])(C[C@@]4([H])[C@]5([H])CC=C6C[C@H](CC[C@]6(C)[C@@]5([H])CC[C@@]43C)OC(=O)[C@H](CCCNC(=N)N)N)O2)OC1", "formula": "C33H54N4O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 12, "ez_centers": 0, "molecular_weight": "570.8075", "optical_activity": "UNSPECIFIED", "references": [ "ca5f7d99-8fb2-4407-b156-413f7ac8dc50", "dc9a0fbc-b890-4583-99cd-eeddcfd6f1d8" ], "stereo_centers": 12 }, "unii": "X70B1I735D" } ] }