{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "dc850156-6966-4465-8f20-3244b3a91e5d",
          "code": "MDMB-CHMICA",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/MDMB-CHMICA",
          "code_system": "WIKIPEDIA",
          "references": [
            "ec92b9a6-8702-9473-b37d-84b15f51e20c",
            "93b584b8-e34e-6fe0-1a70-fbc6175d08c1"
          ]
        },
        {
          "uuid": "82089ff6-9fcf-4b1e-b6b3-383000d238a8",
          "code": "1971007-95-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1971007-95-0",
          "code_system": "CAS",
          "references": [
            "93b584b8-e34e-6fe0-1a70-fbc6175d08c1"
          ]
        },
        {
          "uuid": "9e9316eb-902f-905f-b885-625b3696ad5a",
          "code": "125181404",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/125181404",
          "code_system": "PUBCHEM",
          "references": [
            "e5e91ca7-96cb-4735-441c-70c804bfe46b"
          ]
        },
        {
          "uuid": "96fa960f-187c-4525-89bf-1341019d65f7",
          "code": "7042",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule I. |Hallucinogenic substances",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "9fab1054-c614-30a9-4870-6355ac21f81d"
          ]
        },
        {
          "uuid": "098b8323-28a8-43e0-b2bb-5c0d505d9592",
          "code": "X6JI7EA6EJ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e3a410d5-2181-b363-fb2e-4ee938657ba5",
          "code": "Designer-drugs-MDMB-CHMICA",
          "comments": "Wikipedia|List of designer drugs|Synthetic cannabinoids|Indole based",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_designer_drugs",
          "code_system": "WIKIPEDIA",
          "references": [
            "9e6593da-7aa1-8beb-c508-716a7e00977c"
          ]
        },
        {
          "uuid": "1dfd50e5-d42c-370f-bc99-3b0ccf8a5bb0",
          "code": "DTXSID701009993",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID701009993",
          "code_system": "EPA CompTox",
          "references": [
            "9e6593da-7aa1-8beb-c508-716a7e00977c"
          ]
        },
        {
          "uuid": "75ef08a7-b6af-320e-57a3-2f574aec5e95",
          "code": "100000169916",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "663a2b9d-46d8-200a-ce9a-7453c15f7212"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "ec92b9a6-8702-9473-b37d-84b15f51e20c",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "93b584b8-e34e-6fe0-1a70-fbc6175d08c1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "788bd3a8-ebba-4a99-aaaa-a1599926c212",
          "citation": "Franz, Florian, et al. \"Phase I metabolism of the highly potent synthetic cannabinoid MDMB‐CHMICA and detection in human urine samples.\" Drug Testing and Analysis 9.5 (2017): 744-753.",
          "url": "https://analyticalsciencejournals.onlinelibrary.wiley.com/doi/pdf/10.1002/dta.2049?casa_token=vGVC48uLPMcAAAAA:BlGHYlXyxnu7PASIViSGbWpks24wOmqvXXne2Y93LIPQddov_w0sCAV3u3NRIEQ_0BhBYX5QFHhfQNk",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e5e91ca7-96cb-4735-441c-70c804bfe46b",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "9fab1054-c614-30a9-4870-6355ac21f81d",
          "citation": "e-CFR data is current as of February 7, 2020",
          "doc_type": "CFR",
          "public_domain": true
        },
        {
          "uuid": "c20350d9-bd01-4644-8acb-153e29c8c3f1",
          "citation": "Schoeder, Clara T., et al. \"Pharmacological evaluation of new constituents of “Spice”: synthetic cannabinoids based on indole, indazole, benzimidazole and carbazole scaffolds.\" Forensic toxicology 36.2 (2018): 385-403.",
          "url": "https://link.springer.com/article/10.1007/s11419-018-0415-z",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "9e6593da-7aa1-8beb-c508-716a7e00977c",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "663a2b9d-46d8-200a-ce9a-7453c15f7212",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "bfedbb70-11d1-2a9f-a1f0-ebcc8279726b",
          "id": "bfedbb70-11d1-2a9f-a1f0-ebcc8279726b",
          "molfile": "\n  Marvin  01132109552D          \n\n 28 30  0  0  1  0            999 V2000\n   15.5522   -6.3979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0673   -5.7304    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2423   -5.7304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9873   -4.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6547   -4.4609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3223   -4.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6547   -3.6359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9403   -3.2234    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9403   -2.3984    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   14.6547   -1.9859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3693   -2.3984    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0837   -1.9859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6547   -1.1609    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2259   -1.9859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5113   -2.3984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5113   -1.5734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2259   -1.1609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3693   -3.2234    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1804   -4.7743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6284   -5.3874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8833   -6.1721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6903   -6.3435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3726   -6.3117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7082   -5.5580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.5288   -5.4717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.0137   -6.1392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.6781   -6.8929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.8577   -6.9791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 23  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  6  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3 22  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4 19  1  0  0  0  0\n  6  5  2  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 18  2  0  0  0  0\n  9  8  1  1  0  0  0\n  9 10  1  0  0  0  0\n  9 14  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 13  2  0  0  0  0\n 11 12  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 14 17  1  0  0  0  0\n 19 20  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  2  0  0  0  0\n 23 24  1  0  0  0  0\n 23 28  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 27  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(C)[C@@H](C(=O)OC)NC(=O)c1cn(CC2CCCCC2)c3ccccc13",
          "formula": "C23H32N2O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3ae05680-9945-48f1-93b5-61d763eb5f89"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "384.5127",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d48efc6f-823d-4dd8-a7d1-6229eabff8a2",
      "version": "14",
      "structure": {
        "id": "3d23b8c0-be94-8be7-f621-d87831326031",
        "molfile": "L-Valine, N-[[1-(cyclohexylmethyl)-1H-indol-3-yl]carbonyl]-3-methyl-, methyl ...\n  Marvin  01132103142D          \n\n 28 30  0  0  1  0            999 V2000\n   15.5522   -6.3979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0673   -5.7304    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2423   -5.7304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9873   -4.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6547   -4.4609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3223   -4.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6547   -3.6359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9403   -3.2234    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9403   -2.3984    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   14.6547   -1.9859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3693   -2.3984    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0837   -1.9859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6547   -1.1609    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2259   -1.9859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5113   -2.3984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5113   -1.5734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2259   -1.1609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3693   -3.2234    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1804   -4.7743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6284   -5.3874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8833   -6.1721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6903   -6.3435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3726   -6.3117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7082   -5.5580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.5288   -5.4717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.0137   -6.1392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.6781   -6.8929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.8577   -6.9791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  2  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  1  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 10 13  2  0  0  0  0\n  9 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 14 17  1  0  0  0  0\n  7 18  2  0  0  0  0\n  4 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n  3 22  2  0  0  0  0\n  1 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 27  1  0  0  0  0\n 23 28  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(C)[C@@H](C(=O)OC)NC(=O)c1cn(CC2CCCCC2)c3ccccc13",
        "formula": "C23H32N2O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "384.5127",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "93b584b8-e34e-6fe0-1a70-fbc6175d08c1"
        ],
        "stereo_centers": 1
      },
      "unii": "X6JI7EA6EJ",
      "relationships": [
        {
          "uuid": "1545c85d-ef01-49f8-b769-40bd946f29d7",
          "amount": {
            "uuid": "38221ce2-9c57-4d4c-8640-a2e2fab47cc6",
            "average": 0.222,
            "high": 0.256,
            "low": 0.188,
            "units": "NANOMOLAR"
          },
          "qualification": "Ki",
          "type": "TARGET->AGONIST",
          "related_substance": {
            "uuid": "8c580e14-51b8-4e66-a879-a564eb8f4c61",
            "refuuid": "4da43617-82f9-4e30-b375-4d59d4f6fe58",
            "name": "CANNABINOID RECEPTOR 2",
            "unii": "SKEU5X23RI",
            "linking_id": "SKEU5X23RI",
            "ref_pname": "CANNABINOID RECEPTOR 2",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "05aa85d0-7fa0-4ec7-a8a6-a7f2de896448",
          "amount": {
            "uuid": "41ccb0e8-d326-4b7a-ba2a-2d05844f0cb9",
            "average": 0.135,
            "high": 0.163,
            "low": 0.107,
            "units": "NANOMOLAR"
          },
          "qualification": "Ki",
          "type": "TARGET->AGONIST",
          "related_substance": {
            "uuid": "f8056a58-9b5d-491f-ae9b-6e95bd13c1b5",
            "refuuid": "72b773c6-8217-42c9-82c1-8f9104a414b4",
            "name": "CANNABINOID RECEPTOR 1",
            "unii": "NJ1Q2Q7LO5",
            "linking_id": "NJ1Q2Q7LO5",
            "ref_pname": "CANNABINOID RECEPTOR 1",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ad302e32-070f-4f44-9452-a8b74f786072",
          "amount": {
            "uuid": "f25078a6-ee45-4155-9628-f16920fc249b"
          },
          "type": "ACTIVE MOIETY",
          "references": [
            "c20350d9-bd01-4644-8acb-153e29c8c3f1"
          ],
          "related_substance": {
            "uuid": "729e9ded-0710-46b1-b9ce-a6344716eacb",
            "refuuid": "d48efc6f-823d-4dd8-a7d1-6229eabff8a2",
            "name": "MDMB-CHMICA",
            "unii": "X6JI7EA6EJ",
            "linking_id": "X6JI7EA6EJ",
            "ref_pname": "MDMB-CHMICA",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7511579c-14b3-4fa0-8a77-914fb3134afe",
          "amount": {
            "uuid": "c151f643-7845-44ed-b0be-8700abf07027"
          },
          "type": "METABOLITE->PARENT",
          "references": [
            "788bd3a8-ebba-4a99-aaaa-a1599926c212"
          ],
          "related_substance": {
            "uuid": "16c97681-2052-4da4-a8f4-889cd49db55b",
            "refuuid": "0b825f4e-62b3-4690-b397-8781683e27e6",
            "name": "MDMB-CHMICA METABOLITE M-30",
            "unii": "565TTU3EGT",
            "linking_id": "565TTU3EGT",
            "ref_pname": "MDMB-CHMICA METABOLITE M-30",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "7519e566-addf-4dee-aed2-6a2968bbe9a6",
          "name": "L-VALINE, N-((1-(CYCLOHEXYLMETHYL)-1H-INDOL-3-YL)CARBONYL)-3-METHYL-, METHYL ESTER",
          "stdName": "L-VALINE, N-((1-(CYCLOHEXYLMETHYL)-1H-INDOL-3-YL)CARBONYL)-3-METHYL-, METHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93b584b8-e34e-6fe0-1a70-fbc6175d08c1"
          ],
          "display_name": false
        },
        {
          "uuid": "5cf7afc2-3418-4505-b860-923b1f98ee35",
          "name": "MDMB-CHMICA",
          "stdName": "MDMB-CHMICA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93b584b8-e34e-6fe0-1a70-fbc6175d08c1"
          ],
          "display_name": true
        },
        {
          "uuid": "03557733-27e0-6ef1-24b8-8ba0148cb20c",
          "name": "METHYL 2-(1-(CYCLOHEXYLMETHYL)-1H-INDOLE-3-CARBOXAMIDO)-3,3-DIMETHYLBUTANOATE, (S)-",
          "stdName": "METHYL 2-(1-(CYCLOHEXYLMETHYL)-1H-INDOLE-3-CARBOXAMIDO)-3,3-DIMETHYLBUTANOATE, (S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9fab1054-c614-30a9-4870-6355ac21f81d"
          ],
          "display_name": false
        },
        {
          "uuid": "e6793473-d570-02fd-086a-720151ada17d",
          "name": "MMB-CHMINACA",
          "stdName": "MMB-CHMINACA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9fab1054-c614-30a9-4870-6355ac21f81d"
          ],
          "display_name": false
        }
      ],
      "modifications": {
        "uuid": "cc7a450c-39f5-46f0-8948-d9c7baa8c00d"
      }
    }
  ]
}