{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "19bd6ddf-ced6-4369-8639-e949df366e79",
          "code": "32388-55-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=32388-55-9",
          "code_system": "CAS",
          "references": [
            "f0f83132-c3b0-41e2-9cbf-88ca57c20bf5",
            "bf77e491-b2da-4c45-b64e-11c276553125"
          ]
        },
        {
          "uuid": "8c932e76-002c-44c9-b2d8-b5680fa1b4f6",
          "code": "SCCS/1459/11",
          "comments": "EC-SCCS|OPINION ON FRAGRANCE ALLERGENS IN COSMETIC PRODUCTS|FRAGRANCE|ESTABLISHED CONTACT ALLERGEN IN HUMANS|LEVEL OF IMPORTANCE ++ OUT OF ++++",
          "type": "PRIMARY",
          "url": "http://ec.europa.eu/health/scientific_committees/consumer_safety/docs/sccs_o_102.pdf",
          "code_system": "EC SCIENTIFIC COMMITTEE ON CONSUMER SAFETY OPINION",
          "references": [
            "f0f83132-c3b0-41e2-9cbf-88ca57c20bf5"
          ]
        },
        {
          "uuid": "dbed6c31-85f3-40ba-91c6-4e35e169e1b8",
          "code": "251-020-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.046.367",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f0f83132-c3b0-41e2-9cbf-88ca57c20bf5"
          ]
        },
        {
          "uuid": "868206c7-53d1-44a1-b556-16f62a96b923",
          "code": "16220111",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/16220111",
          "code_system": "PUBCHEM",
          "references": [
            "f0f83132-c3b0-41e2-9cbf-88ca57c20bf5"
          ]
        },
        {
          "uuid": "37498b6f-5775-4161-baac-d1f86d6a1eaa",
          "code": "DTXSID4029353",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4029353",
          "code_system": "EPA CompTox",
          "references": [
            "aaeaebdb-978e-db47-bec1-862e590074da"
          ]
        },
        {
          "uuid": "ccfe5316-487c-b0ff-b0c6-db5ad9eae47f",
          "code": "2289006",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2289006/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "3e62a15e-ef6f-e3d2-d72f-d53e8c32248f"
          ]
        },
        {
          "uuid": "7f50f887-0094-4907-a822-a8fc077a320e",
          "code": "X6I62755AK",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "cf2b9f4b-f995-d80b-96d1-a5732b666b81",
          "code": "X6I62755AK",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=X6I62755AK",
          "code_system": "DAILYMED",
          "references": [
            "68f68af7-0197-9881-a099-f280de464094"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "72521c99-ca8d-4865-b4bd-be72846c16a9",
          "name": "1-CEDR-8-EN-9-YLETHANONE",
          "stdName": "1-CEDR-8-EN-9-YLETHANONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "818d6d86-6336-4b5c-8a10-04067ed82c55",
            "57195ebf-e93f-47aa-8021-b1fe73400671"
          ],
          "display_name": false
        },
        {
          "uuid": "61eed8d9-dbd5-4f7f-8bf8-64310b1957c3",
          "name": "ACETYL CEDRENE",
          "stdName": "ACETYL CEDRENE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "45572982-cfd4-4a3b-ad8d-7c952c59a277",
            "57195ebf-e93f-47aa-8021-b1fe73400671"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "7754706b-f178-44d9-9515-9e09538313ea",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "bf6ab0f1-32f6-4497-a1ce-779ea79b1374",
          "name": "ACETYL-.ALPHA.-CEDRENE",
          "stdName": "ACETYL-.ALPHA.-CEDRENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "046a97e1-409d-4596-954c-8f9c71bad029",
            "57195ebf-e93f-47aa-8021-b1fe73400671"
          ],
          "display_name": false
        },
        {
          "uuid": "8460579a-a9a4-488b-b357-f8b24409bd46",
          "name": "ACETYLCEDRENE",
          "stdName": "ACETYLCEDRENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "046a97e1-409d-4596-954c-8f9c71bad029",
            "57195ebf-e93f-47aa-8021-b1fe73400671"
          ],
          "display_name": false
        },
        {
          "uuid": "1bbea613-c2ac-461c-95a3-22eec7a1d280",
          "name": "ETHANONE, 1-((3R,3AR,7R,8AS)-2,3,4,7,8,8A-HEXAHYDRO-3,6,8,8-TETRAMETHYL-1H-3A,7-METHANOAZULEN-5-YL)-",
          "stdName": "ETHANONE, 1-((3R,3AR,7R,8AS)-2,3,4,7,8,8A-HEXAHYDRO-3,6,8,8-TETRAMETHYL-1H-3A,7-METHANOAZULEN-5-YL)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "046a97e1-409d-4596-954c-8f9c71bad029",
            "57195ebf-e93f-47aa-8021-b1fe73400671"
          ],
          "display_name": false
        },
        {
          "uuid": "6fcabf2b-593e-46ea-9938-3ea27da48fa4",
          "name": "ETHANONE, 1-(2,3,4,7,8,8A-HEXAHYDRO-3,6,8,8-TETRAMETHYL-1H-3A,7-METHANOAZULEN-5-YL)-, (3R-(3.ALPHA.,3A.BETA.,7.BETA.,8A.ALPHA.))-",
          "stdName": "ETHANONE, 1-(2,3,4,7,8,8A-HEXAHYDRO-3,6,8,8-TETRAMETHYL-1H-3A,7-METHANOAZULEN-5-YL)-, (3R-(3.ALPHA.,3A.BETA.,7.BETA.,8A.ALPHA.))-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "046a97e1-409d-4596-954c-8f9c71bad029",
            "57195ebf-e93f-47aa-8021-b1fe73400671"
          ],
          "display_name": false
        },
        {
          "uuid": "8681172e-79ee-4ece-aab6-1b06163d9d94",
          "name": "LIXETONE",
          "stdName": "LIXETONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "046a97e1-409d-4596-954c-8f9c71bad029",
            "57195ebf-e93f-47aa-8021-b1fe73400671"
          ],
          "display_name": false
        },
        {
          "uuid": "be413026-15a9-4b75-b7c3-acfacb641a8d",
          "name": "VERTOFIX",
          "stdName": "VERTOFIX",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "046a97e1-409d-4596-954c-8f9c71bad029",
            "57195ebf-e93f-47aa-8021-b1fe73400671"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "45572982-cfd4-4a3b-ad8d-7c952c59a277",
          "citation": "HFF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "57195ebf-e93f-47aa-8021-b1fe73400671",
          "citation": "HANDBOOK OF FLAVORS & FRAGRANCES",
          "doc_type": "HANDBOOK OF FLAVORS & FRAGRANCES",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "046a97e1-409d-4596-954c-8f9c71bad029",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "818d6d86-6336-4b5c-8a10-04067ed82c55",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f0f83132-c3b0-41e2-9cbf-88ca57c20bf5",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391416000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ca3f4bd9-644b-41ed-9ad5-817b116c6005",
          "citation": "SRS import [X6I62755AK]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=X6I62755AK",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391416000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aaeaebdb-978e-db47-bec1-862e590074da",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=32388-55-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3e62a15e-ef6f-e3d2-d72f-d53e8c32248f",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "bf77e491-b2da-4c45-b64e-11c276553125",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "68f68af7-0197-9881-a099-f280de464094",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2ff746d5-ac8d-4f81-be44-65f14690ff49",
          "id": "2ff746d5-ac8d-4f81-be44-65f14690ff49",
          "molfile": "\n  Marvin  01132102342D          \n\n 18 20  0  0  1  0            999 V2000\n   14.4056   -8.8176    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   14.6605   -8.0330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8905   -9.4850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4056  -10.1525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6210   -9.8975    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   12.9760  -10.4119    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   13.5371  -11.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7328  -11.2003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1716  -10.2283    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   12.5637   -9.2319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6210   -9.0725    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   12.9760   -8.5581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1716   -8.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6573   -8.0967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8415   -8.2197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9587   -7.3287    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8137   -9.4850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9887   -9.4850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 11  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n 11  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  9  6  1  6  0  0  0\n  9 10  1  0  0  0  0\n  9 17  1  0  0  0  0\n 11 10  1  1  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 13 17  2  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
          "smiles": "C[C@@H]1CC[C@H]2C(C)(C)[C@H]3C[C@@]12CC(=C3C)C(=O)C",
          "formula": "C17H26O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b4e5c48d-28f6-4831-a6b7-9f2453e6426d"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "246.3884",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "dae78d5e-372f-477f-b2a2-27566de6c1f0",
      "version": "9",
      "structure": {
        "id": "0bffc559-cfd7-49ac-9c62-497c443eb95b",
        "molfile": "\n  Marvin  01132100522D          \n\n 19 21  0  0  1  0            999 V2000\n   11.6573   -8.0967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8415   -8.2197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4056  -10.1525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8905   -9.4850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4056   -8.8176    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   13.6210   -9.0725    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   12.9760   -8.5581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1716   -8.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8137   -9.4850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1716  -10.2283    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   12.9760  -10.4119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6210   -9.8975    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   12.5637   -9.2319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5371  -11.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7328  -11.2003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9887   -9.4850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6605   -8.0330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9587   -7.3287    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9070  -10.6714    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n  3 12  1  0  0  0  0\n  6 12  1  0  0  0  0\n  6 13  1  1  0  0  0\n 10 13  1  1  0  0  0\n 11 14  1  0  0  0  0\n 11 15  1  0  0  0  0\n  9 16  1  0  0  0  0\n  5 17  1  6  0  0  0\n  1  8  1  0  0  0  0\n  1 18  2  0  0  0  0\n 12 19  1  6  0  0  0\nM  END",
        "smiles": "C[C@@H]1CC[C@@]2([H])C(C)(C)[C@H]3C[C@@]12CC(=C3C)C(=O)C",
        "formula": "C17H26O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "246.3884",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "046a97e1-409d-4596-954c-8f9c71bad029",
          "ca3f4bd9-644b-41ed-9ad5-817b116c6005"
        ],
        "stereo_centers": 4
      },
      "unii": "X6I62755AK"
    }
  ]
}