{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8ef7f551-2d5f-4961-8486-f7813bc26804",
          "code": "7790-76-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=7790-76-3",
          "code_system": "CAS",
          "references": [
            "3b5eb11c-5984-407b-b4ce-60f1dab77ad6",
            "04c1698c-e77d-41ab-996e-bc861c8d149b"
          ]
        },
        {
          "uuid": "bfaff223-f40e-4a7a-9f24-2b08eb456962",
          "code": "C75639",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C75639",
          "code_system": "NCI_THESAURUS",
          "references": [
            "3b5eb11c-5984-407b-b4ce-60f1dab77ad6"
          ]
        },
        {
          "uuid": "8a0004e3-cb7f-4957-bc93-a794ad19bf68",
          "code": "D002131",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68002131",
          "code_system": "MESH",
          "references": [
            "3b5eb11c-5984-407b-b4ce-60f1dab77ad6"
          ]
        },
        {
          "uuid": "18f87366-d85c-4403-ab33-c54833cf34b3",
          "code": "CALCIUM PYROPHOSPHATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Calcium_pyrophosphate",
          "code_system": "WIKIPEDIA",
          "references": [
            "3b5eb11c-5984-407b-b4ce-60f1dab77ad6"
          ]
        },
        {
          "uuid": "fdb1d0ca-97fb-4fb1-b210-06b9fc1899d7",
          "code": "m2971",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2971?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "3b5eb11c-5984-407b-b4ce-60f1dab77ad6"
          ]
        },
        {
          "uuid": "67d4d7fb-48de-47fa-a377-69845593708c",
          "code": "1362901",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1362901/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "3b5eb11c-5984-407b-b4ce-60f1dab77ad6"
          ]
        },
        {
          "uuid": "8e5ec0cd-fbb6-489a-b498-043faff5a2a0",
          "code": "SUB13197MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "3b5eb11c-5984-407b-b4ce-60f1dab77ad6"
          ]
        },
        {
          "uuid": "fa768fdb-88b9-4550-a784-e7eaf7be1df6",
          "code": "232-221-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.029.292",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "3b5eb11c-5984-407b-b4ce-60f1dab77ad6"
          ]
        },
        {
          "uuid": "8660d41d-1a7c-4ad9-b48e-ad6907a46732",
          "code": "24632",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/24632",
          "code_system": "PUBCHEM",
          "references": [
            "3b5eb11c-5984-407b-b4ce-60f1dab77ad6"
          ]
        },
        {
          "uuid": "2ee75184-67a8-158f-7fa9-1b44a60352f7",
          "code": "1435",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1435",
          "code_system": "HSDB",
          "references": [
            "a6802b32-b8f0-f3f5-e1d6-31059fae2270"
          ]
        },
        {
          "uuid": "45550029-9b75-c4c8-cd44-a374413712a5",
          "code": "DTXSID50872512",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50872512",
          "code_system": "EPA CompTox",
          "references": [
            "994111dd-da9f-3244-bcc3-bf7b4e8d5110"
          ]
        },
        {
          "uuid": "5d41cb89-a380-f1b1-9c86-88594c91a133",
          "code": "C45678",
          "comments": "Industrial Aid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C45678",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d61e86d4-dc04-2588-ba6e-dc4aab1ef784"
          ]
        },
        {
          "uuid": "b28ee602-6eed-4c1d-8ae1-ccacd1c88a24",
          "code": "X69NU20D19",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a00e957b-29ef-cbb5-e117-4a77b9cbcd15",
          "code": "32598",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:32598",
          "code_system": "CHEBI",
          "references": [
            "d61e86d4-dc04-2588-ba6e-dc4aab1ef784"
          ]
        },
        {
          "uuid": "8416527b-6ea4-c155-6bde-1888a875c12c",
          "code": "X69NU20D19",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=X69NU20D19",
          "code_system": "DAILYMED",
          "references": [
            "50e3e6c3-d5f7-ea6e-4631-34177fbb243c"
          ]
        },
        {
          "uuid": "e247682a-53e3-c297-ae6d-25118b1523b3",
          "code": "100000076613",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "16d831c5-8ffe-94f1-9709-0b2e2aea0f9b"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "c516a3c7-282f-4f3b-8389-209239e3eb16",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "fb1f2c7e-2c48-462e-bb7c-5ee1a6e4b383",
            "refuuid": "029170db-4e11-45b3-bc18-f9a60e80427a",
            "name": "PYROPHOSPHORIC ACID",
            "unii": "4E862E7GRQ",
            "linking_id": "4E862E7GRQ",
            "ref_pname": "PYROPHOSPHORIC ACID",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f490b4b0-24cb-4f07-a7c7-86f22f2e97a4",
          "name": "CALCIUM DIPHOSPHATE",
          "stdName": "CALCIUM DIPHOSPHATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ae2f48ee-8e2e-4a81-8a0f-bc99b1db782a",
            "c99540da-1609-493a-99f2-d070360cb338"
          ],
          "display_name": false
        },
        {
          "uuid": "b08bdd3b-4c9d-46cd-9e60-4b3fd6939762",
          "name": "CALCIUM PYROPHOSPHATE",
          "stdName": "CALCIUM PYROPHOSPHATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fde7f405-17c8-43b4-b768-6456280efe94",
            "5369bcf3-b22d-4d0f-8bc4-8a1121b7717a",
            "43b2af12-bee9-47e2-a5f6-cb552dc6198e",
            "171b1986-b264-4bf6-b3dd-cf2c4896b80a",
            "0041a243-7253-4dbf-bae5-58db9193f083",
            "ae2f48ee-8e2e-4a81-8a0f-bc99b1db782a",
            "131fa044-6df0-4f69-9880-1c08c8924d0d",
            "95e0246d-391d-44b6-8388-1f71c27cdd94",
            "acec794b-5ae8-48db-987e-49f461d029b9",
            "70ccd7e6-76e8-448b-a0f1-61eb0b92ed5a",
            "8cdf4f27-b9cf-460d-9ba6-05edc9cb78f0",
            "bc9448bc-9fd0-4a1a-95a1-38b47c5cea1d",
            "f0f9346e-184f-43d2-b6ea-17de67235ff6"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "3e1a6757-6c26-4129-97ac-2a72a286a7e7",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "909fe3af-25d3-473c-a7cc-389f40d2fa32",
          "name": "CALCIUM PYROPHOSPHATE [FCC]",
          "stdName": "CALCIUM PYROPHOSPHATE [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0041a243-7253-4dbf-bae5-58db9193f083",
            "f0f9346e-184f-43d2-b6ea-17de67235ff6"
          ],
          "display_name": false
        },
        {
          "uuid": "71056e07-ed07-4b7c-9ac3-53ae73e22b55",
          "name": "CALCIUM PYROPHOSPHATE [HSDB]",
          "stdName": "CALCIUM PYROPHOSPHATE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "131fa044-6df0-4f69-9880-1c08c8924d0d",
            "f0f9346e-184f-43d2-b6ea-17de67235ff6"
          ],
          "display_name": false
        },
        {
          "uuid": "09a17d98-97f1-451e-8acc-dfaca37d972d",
          "name": "CALCIUM PYROPHOSPHATE [II]",
          "stdName": "CALCIUM PYROPHOSPHATE [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ae2f48ee-8e2e-4a81-8a0f-bc99b1db782a"
          ],
          "display_name": false
        },
        {
          "uuid": "bd8eb6d7-2bf4-496e-b1d7-64edc1bcfd87",
          "name": "CALCIUM PYROPHOSPHATE [MI]",
          "stdName": "CALCIUM PYROPHOSPHATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "acec794b-5ae8-48db-987e-49f461d029b9",
            "f0f9346e-184f-43d2-b6ea-17de67235ff6"
          ],
          "display_name": false
        },
        {
          "uuid": "d89489d5-32c0-8b0a-278c-809688e6b548",
          "name": "Calcium pyrophosphate [WHO-DD]",
          "stdName": "CALCIUM PYROPHOSPHATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b0c39831-c620-9f34-aa11-09d48ea6e15e"
          ],
          "display_name": false
        },
        {
          "uuid": "fd640716-a542-42d8-bd75-cf8a6f06ece0",
          "name": "DICALCIUM PYROPHOSPHATE",
          "stdName": "DICALCIUM PYROPHOSPHATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ae2f48ee-8e2e-4a81-8a0f-bc99b1db782a"
          ],
          "display_name": false
        },
        {
          "uuid": "7a537bee-1d6c-4b3e-84d5-a6744e65f604",
          "name": "DIPHOSPHORIC ACID, CALCIUM SALT (1:2)",
          "stdName": "DIPHOSPHORIC ACID, CALCIUM SALT (1:2)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ae2f48ee-8e2e-4a81-8a0f-bc99b1db782a",
            "c99540da-1609-493a-99f2-d070360cb338"
          ],
          "display_name": false
        },
        {
          "uuid": "d652a114-dbf4-4bdd-b897-b0c27864d4a8",
          "name": "DIPHOSPHORIC ACID, DICALCIUM",
          "stdName": "DIPHOSPHORIC ACID, DICALCIUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93926589-4a83-4a9a-a1de-65ba91c3743b"
          ],
          "display_name": false
        },
        {
          "uuid": "dbff1f31-2cbc-42d7-849b-14212bda0879",
          "name": "PYROPHOSPHORIC ACID, CALCIUM SALT (1:2)",
          "stdName": "PYROPHOSPHORIC ACID, CALCIUM SALT (1:2)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ae2f48ee-8e2e-4a81-8a0f-bc99b1db782a",
            "c99540da-1609-493a-99f2-d070360cb338"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ae2f48ee-8e2e-4a81-8a0f-bc99b1db782a",
          "citation": "ChemIDPlus 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "93926589-4a83-4a9a-a1de-65ba91c3743b",
          "citation": "USP Dictionary 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c99540da-1609-493a-99f2-d070360cb338",
          "citation": "STN 2007",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "acec794b-5ae8-48db-987e-49f461d029b9",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f0f9346e-184f-43d2-b6ea-17de67235ff6",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "95e0246d-391d-44b6-8388-1f71c27cdd94",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0041a243-7253-4dbf-bae5-58db9193f083",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "131fa044-6df0-4f69-9880-1c08c8924d0d",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8cdf4f27-b9cf-460d-9ba6-05edc9cb78f0",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3b5eb11c-5984-407b-b4ce-60f1dab77ad6",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389681000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "539ec4a1-4c27-4995-bd1e-149981e24690",
          "citation": "SRS import [X69NU20D19]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=X69NU20D19",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389681000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf044cce-e194-4f10-bc21-fc940c84a33b",
          "citation": "ChemIDplus 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "43b2af12-bee9-47e2-a5f6-cb552dc6198e",
          "citation": "CALCIUM PYROPHOSPHATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "70ccd7e6-76e8-448b-a0f1-61eb0b92ed5a",
          "citation": "CALCIUM PYROPHOSPHATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fde7f405-17c8-43b4-b768-6456280efe94",
          "citation": "CALCIUM PYROPHOSPHATE [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "171b1986-b264-4bf6-b3dd-cf2c4896b80a",
          "citation": "CALCIUM PYROPHOSPHATE [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bc9448bc-9fd0-4a1a-95a1-38b47c5cea1d",
          "citation": "CALCIUM PYROPHOSPHATE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5369bcf3-b22d-4d0f-8bc4-8a1121b7717a",
          "citation": "CALCIUM PYROPHOSPHATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a6802b32-b8f0-f3f5-e1d6-31059fae2270",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+7790-76-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "994111dd-da9f-3244-bcc3-bf7b4e8d5110",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=7790-76-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d61e86d4-dc04-2588-ba6e-dc4aab1ef784",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "50e3e6c3-d5f7-ea6e-4631-34177fbb243c",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "b0c39831-c620-9f34-aa11-09d48ea6e15e",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "04c1698c-e77d-41ab-996e-bc861c8d149b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "16d831c5-8ffe-94f1-9709-0b2e2aea0f9b",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4cf41b1c-e66a-451a-b101-234b347522f7",
          "id": "4cf41b1c-e66a-451a-b101-234b347522f7",
          "molfile": "\n  Marvin  01132104012D          \n\n  1  0  0  0  0  0            999 V2000\n    5.9527   -1.4301    0.0000 Ca  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Ca+2]",
          "formula": "Ca",
          "atropisomerism": "No",
          "charge": 2,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "0c7d52d1-fda2-4727-9cff-0dbb80534a87"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "40.078",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "8c4e482b-9be0-4fb2-a3a5-499f5c230b0a",
          "id": "8c4e482b-9be0-4fb2-a3a5-499f5c230b0a",
          "molfile": "\n  Marvin  01132107172D          \n\n  9  8  0  0  0  0            999 V2000\n    2.2045   -2.4601    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.1684   -1.5979    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3397   -1.6392    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.1529   -0.8029    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0021   -1.6211    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8230   -1.6211    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8230   -2.4214    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.6388   -1.6211    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.7947   -0.7925    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  2  2  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  6  2  0  0  0  0\nM  CHG  4   1  -1   3  -1   7  -1   8  -1\nM  END",
          "smiles": "O=P([O-])([O-])OP(=O)([O-])[O-]",
          "formula": "O7P2",
          "atropisomerism": "No",
          "charge": -4,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6b72d922-4ac0-490a-a349-050e34338e82"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "173.9434",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4cae1a41-2215-4359-9a95-b5c333597d0e",
      "version": "12",
      "structure": {
        "id": "10be93b8-3f3c-4186-bc08-f00fb5eee378",
        "molfile": "\n  Marvin  01132101062D          \n\n 11  8  0  0  0  0            999 V2000\n    2.1684   -1.5979    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8230   -1.6211    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0021   -1.6211    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2045   -2.4601    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    1.3397   -1.6392    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.8230   -2.4214    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.6388   -1.6211    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.1529   -0.8029    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7947   -0.7925    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9527   -1.4301    0.0000 Ca  0  2  0  0  0  0  0  0  0  0  0  0\n    5.9527   -1.4301    0.0000 Ca  0  2  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  2  1  0  0  0  0\n  7  2  1  0  0  0  0\n  8  1  2  0  0  0  0\n  9  2  2  0  0  0  0\nM  CHG  6   4  -1   5  -1   6  -1   7  -1  10   2  11   2\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  2  10  11\nM  SPA   1  1  10\nM  SDI   1  4    5.5327   -1.8501    5.5327   -1.0101\nM  SDI   1  4    6.3727   -1.0101    6.3727   -1.8501\nM  SMT   1 2\nM  END",
        "smiles": "[Ca+2].[Ca+2].O=P([O-])([O-])OP(=O)([O-])[O-]",
        "formula": "2Ca.O7P2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "254.0994",
        "optical_activity": "NONE",
        "references": [
          "bf044cce-e194-4f10-bc21-fc940c84a33b",
          "539ec4a1-4c27-4995-bd1e-149981e24690"
        ],
        "stereo_centers": 0
      },
      "unii": "X69NU20D19"
    }
  ]
}