{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f56927c8-a265-4357-89c3-cdbf09ca7ce0",
          "code": "15421-15-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=15421-15-5",
          "code_system": "CAS",
          "references": [
            "76c7ac9d-8d9c-402c-999f-a17395dd9a56",
            "995566f8-98fb-4755-80f9-e3327c173a33"
          ]
        },
        {
          "uuid": "ccfffa55-b0e8-40b0-a114-6b12e28f2b48",
          "code": "POTASSIUM ASCORBATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Potassium_ascorbate",
          "code_system": "WIKIPEDIA",
          "references": [
            "76c7ac9d-8d9c-402c-999f-a17395dd9a56"
          ]
        },
        {
          "uuid": "ae3e2250-7c99-44bc-8ec6-a77395ea4423",
          "code": "239-432-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.035.832",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "76c7ac9d-8d9c-402c-999f-a17395dd9a56"
          ]
        },
        {
          "uuid": "e83708f2-b02e-438e-9ac7-0aa0ad139af9",
          "code": "1592259",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1592259/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "76c7ac9d-8d9c-402c-999f-a17395dd9a56"
          ]
        },
        {
          "uuid": "e120d7fb-1875-4094-977b-bb86a1b0f361",
          "code": "SUB03962MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "76c7ac9d-8d9c-402c-999f-a17395dd9a56"
          ]
        },
        {
          "uuid": "3a9bb588-d802-4450-9525-3fd97210bb0c",
          "code": "23687519",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/23687519",
          "code_system": "PUBCHEM",
          "references": [
            "76c7ac9d-8d9c-402c-999f-a17395dd9a56"
          ]
        },
        {
          "uuid": "99bc4599-9178-69a2-2316-78a078d7859b",
          "code": "DTXSID80165560",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80165560",
          "code_system": "EPA CompTox",
          "references": [
            "06191ee9-5e07-9795-505f-7bb357ce997a"
          ]
        },
        {
          "uuid": "bb0d23c8-926f-4ce0-defb-ee8ba704da65",
          "code": "3386 (Number of products:10)",
          "comments": "Dietary Supplement Label Database|chemical|Potassium ascorbate",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=3386&item=Potassium ascorbate",
          "code_system": "DSLD",
          "references": [
            "c7ad9175-9509-62ba-f48e-17ef3f946a2b"
          ]
        },
        {
          "uuid": "882e2160-54a5-4695-9a5c-c156ac554b5b",
          "code": "X5523762RI",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a5b29083-bd80-0308-8ff6-dd59dbf933d5",
          "code": "X5523762RI",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=X5523762RI",
          "code_system": "DAILYMED",
          "references": [
            "26086ba6-115e-dc02-7f7e-ace53d70ffdf"
          ]
        },
        {
          "uuid": "3140ab9d-4f77-e0f3-ab91-8fe0269d4030",
          "code": "100000085497",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "da8f636f-30e3-87cd-36b9-56d1684cca51"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "ad47d215-976e-44b8-a8d6-c620bcb5d208",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "a088f0e6-fa92-459c-ba4a-4bda0bce0106",
            "refuuid": "57ca4d1b-fb8c-4302-8789-70655308ebc1",
            "name": "ASCORBIC ACID",
            "unii": "PQ6CK8PD0R",
            "linking_id": "PQ6CK8PD0R",
            "ref_pname": "ASCORBIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "20b2e55f-ccaa-493d-a8ea-8012828aab95",
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "a8fe9ed7-98b3-44ab-af32-89003a5dad2a"
          ],
          "related_substance": {
            "uuid": "e5fef4e5-4dfc-48d4-b718-be3e437f5afa",
            "refuuid": "70af50f6-7156-4d4c-9a40-d14231a257b0",
            "name": "Potassium ascorbate dihydrate",
            "unii": "LDE9L7LM7R",
            "linking_id": "LDE9L7LM7R",
            "ref_pname": "Potassium ascorbate dihydrate",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4dde93c7-fec6-48bb-afc7-271bbaf04ce8",
          "name": "E-303",
          "stdName": "E-303",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "23c097ed-5871-4210-97b0-cf8ce137dabb"
          ],
          "display_name": false
        },
        {
          "uuid": "beef4f32-ba19-4f74-9f9a-bfdde5411cce",
          "name": "E303",
          "stdName": "E303",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "23c097ed-5871-4210-97b0-cf8ce137dabb"
          ],
          "display_name": false
        },
        {
          "uuid": "e75f8b1a-974d-4364-8ed9-b59520c20661",
          "name": "MONOPOTASSIUM ASCORBATE",
          "stdName": "MONOPOTASSIUM ASCORBATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "23c097ed-5871-4210-97b0-cf8ce137dabb"
          ],
          "display_name": false
        },
        {
          "uuid": "c2c9883d-2316-4f16-ae55-b8690121c0cb",
          "name": "POTASSIUM (2R)-2-((1S)-1,2-DIHYDROXYETHYL)-4-HYDROXY-5-OXO-2H-FURAN-3-OLATE",
          "stdName": "POTASSIUM (2R)-2-((1S)-1,2-DIHYDROXYETHYL)-4-HYDROXY-5-OXO-2H-FURAN-3-OLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "23c097ed-5871-4210-97b0-cf8ce137dabb"
          ],
          "display_name": false
        },
        {
          "uuid": "d9bfe1c8-d2b4-4d5a-bc42-ea7c54d5e4b9",
          "name": "POTASSIUM ASCORBATE",
          "stdName": "POTASSIUM ASCORBATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "34c71cb7-68f9-4d6f-8865-602ab68c285f",
            "a4c0e23f-aa69-42d6-bb7d-efdd98533df5",
            "970dd19b-b1b7-4a72-acd2-d5062c003d1d",
            "c99ef4a9-b235-40f3-adc5-b8e6006a63f6",
            "c146f643-1d6d-41c8-8e62-0558c52447b6"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "89196dd5-ad3c-4c8a-a54d-1921ca2e738a",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "8061d648-de33-4d2f-a340-56539922aa38",
          "name": "POTASSIUM L-ASCORBATE",
          "stdName": "POTASSIUM L-ASCORBATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "23c097ed-5871-4210-97b0-cf8ce137dabb"
          ],
          "display_name": false
        },
        {
          "uuid": "756f9914-d90e-69db-b55d-f3af8ccb2977",
          "name": "Potassium ascorbate [WHO-DD]",
          "stdName": "POTASSIUM ASCORBATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "795a1efb-41ac-365c-06ce-9c1d138475bf"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "34c71cb7-68f9-4d6f-8865-602ab68c285f",
          "citation": "EMEA 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "23c097ed-5871-4210-97b0-cf8ce137dabb",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "970dd19b-b1b7-4a72-acd2-d5062c003d1d",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a4c0e23f-aa69-42d6-bb7d-efdd98533df5",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "76c7ac9d-8d9c-402c-999f-a17395dd9a56",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390985000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ac007ced-d30e-4134-bdfb-811c0fd1685d",
          "citation": "SRS import [X5523762RI]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=X5523762RI",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390985000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad7ce889-7815-4de7-8bfb-bab5a4f7bbe7",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c146f643-1d6d-41c8-8e62-0558c52447b6",
          "citation": "POTASSIUM ASCORBATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c99ef4a9-b235-40f3-adc5-b8e6006a63f6",
          "citation": "POTASSIUM ASCORBATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "06191ee9-5e07-9795-505f-7bb357ce997a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=15421-15-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a8fe9ed7-98b3-44ab-af32-89003a5dad2a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "c7ad9175-9509-62ba-f48e-17ef3f946a2b",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "995566f8-98fb-4755-80f9-e3327c173a33",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "26086ba6-115e-dc02-7f7e-ace53d70ffdf",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "795a1efb-41ac-365c-06ce-9c1d138475bf",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "da8f636f-30e3-87cd-36b9-56d1684cca51",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8ddb824e-6cac-45ed-9914-33cff50ef986",
          "id": "8ddb824e-6cac-45ed-9914-33cff50ef986",
          "molfile": "\n  Marvin  01132107222D          \n\n  1  0  0  0  1  0            999 V2000\n    8.2968   -6.4740    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[K+]",
          "formula": "K",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7deef836-0064-431a-b0bb-fe8db644ba4a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "39.0983",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "01346079-51be-43c9-8f8e-5334a29994b2",
          "id": "01346079-51be-43c9-8f8e-5334a29994b2",
          "molfile": "\n  Marvin  01132100222D          \n\n 12 12  0  0  1  0            999 V2000\n    7.9780   -3.9055    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.9780   -2.9988    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6210   -4.3276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3171   -3.9474    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.1989   -4.1769    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.5011   -3.7134    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8493   -4.2181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0396   -3.9819    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1207   -4.9864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6571   -5.6999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9582   -4.9864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4677   -5.6385    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  6  1  6  0  0  0\n  5 11  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7  9  2  3  0  0  0\n 10  9  1  0  0  0  0\n 11  9  1  0  0  0  0\n 12 11  2  0  0  0  0\nM  CHG  1   4  -1\nM  END",
          "smiles": "C([C@@H]([C@@H]1C(=O)C(=C(O)O1)O)O)[O-]",
          "formula": "C6H7O6",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5c671e7e-7946-40b7-a8c9-a7c87a3a3efb"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "175.1164",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "673a8f0e-9c93-475f-8dcf-3b05596a725b",
      "version": "10",
      "structure": {
        "id": "b6498418-e819-4c82-95ae-5b4fbe2c410b",
        "molfile": "\n  Marvin  01132109262D          \n\n 14 13  0  0  1  0            999 V2000\n    6.1115   -4.9789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9477   -4.9789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1880   -4.1706    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.9659   -3.8996    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.9659   -2.9943    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6080   -4.3211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3030   -3.9414    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4913   -3.7078    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8405   -4.2117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0320   -3.9759    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7728   -4.7571    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4564   -5.6300    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.6486   -5.6913    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2968   -6.4740    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  1  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  3  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9  1  1  0  0  0  0\n 10  9  2  0  0  0  0\n  3 11  1  1  0  0  0\n 12  2  1  0  0  0  0\n 13  1  1  0  0  0  0\nM  CHG  2  12  -1  14   1\nM  END",
        "smiles": "C([C@@H]([C@]1([H])C(=C(C(=O)O1)O)[O-])O)O.[K+]",
        "formula": "C6H7O6.K",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "214.2147",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "ad7ce889-7815-4de7-8bfb-bab5a4f7bbe7",
          "ac007ced-d30e-4134-bdfb-811c0fd1685d"
        ],
        "stereo_centers": 2
      },
      "unii": "X5523762RI"
    }
  ]
}