{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2ec21296-0aa0-45bf-9b89-7da74176bff9",
          "code": "499-69-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=499-69-4",
          "code_system": "CAS",
          "references": [
            "82ee4305-f903-492b-9f17-464e12187819",
            "cddc3594-9543-4df8-9b40-a23c49039b26"
          ]
        },
        {
          "uuid": "6252c623-d51e-4899-83df-a4137ece9be7",
          "code": "P-MENTHAN-2-OL",
          "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=5162",
          "code_system": "JECFA EVALUATION",
          "references": [
            "82ee4305-f903-492b-9f17-464e12187819"
          ]
        },
        {
          "uuid": "745afdae-995b-4807-bf7f-cc2a3009f7cc",
          "code": "207-885-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.170",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "82ee4305-f903-492b-9f17-464e12187819"
          ]
        },
        {
          "uuid": "d3feec8b-114d-4485-9e5f-bd939429c982",
          "code": "62350",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/62350",
          "code_system": "PUBCHEM",
          "references": [
            "82ee4305-f903-492b-9f17-464e12187819"
          ]
        },
        {
          "uuid": "d17f2f1c-1d47-aa51-fc5b-2dcb6b7ea405",
          "code": "DTXSID90198147",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90198147",
          "code_system": "EPA CompTox",
          "references": [
            "1aed3c0b-5736-7e6c-ffea-d1d894acc1ca"
          ]
        },
        {
          "uuid": "edf7ca44-e973-40ac-beba-67f89cfb79a4",
          "code": "X55010FU6N",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "1b22c904-cba9-4cbb-921b-4e96e9e278f3",
          "code": "81",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/81/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "82db500a-2a24-2a33-1b54-f8ff3507d061"
          ]
        },
        {
          "uuid": "3270ff69-76bc-4e3c-7331-50dcf4d07210",
          "code": "300000038769",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "55e35bc9-c5d4-f5d3-77a0-b23d6efb9c0a"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "8da00455-d389-48a0-841d-98929d551f7d",
          "name": "(±)-CARVOMENTHOL",
          "stdName": "(+/-)-CARVOMENTHOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9fadc23-b16a-4088-8e1b-c41d758af875"
          ],
          "display_name": false
        },
        {
          "uuid": "fb613c30-b038-4507-8d93-65f96472cf08",
          "name": "CARVOMENTHOL",
          "stdName": "CARVOMENTHOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "05cb714f-d3f0-4064-a9d0-5822e1fcba7b"
          ],
          "display_name": true
        },
        {
          "uuid": "bffaa8ca-28f9-4f68-87db-8e6b2d8ad9a9",
          "name": "CYCLOHEXANOL, 2-METHYL-5-(1-METHYLETHYL)-, (1R,2R,5R)-REL-",
          "stdName": "CYCLOHEXANOL, 2-METHYL-5-(1-METHYLETHYL)-, (1R,2R,5R)-REL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3b93623-00a8-4303-8738-13542a0cf78e"
          ],
          "display_name": false
        },
        {
          "uuid": "725c2e6c-c497-4038-af6a-ffcdca8e4a87",
          "name": "DL-CARVOMENTHOL",
          "stdName": "DL-CARVOMENTHOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fff50b27-f60a-477d-9274-598877f301df"
          ],
          "display_name": false
        },
        {
          "uuid": "2f09a96c-6a9b-4d87-8cef-e6bbf45985b9",
          "name": "FEMA NO. 3562",
          "stdName": "FEMA NO. 3562",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e9362fe7-35b0-434c-98e5-3fa983a223c5",
            "a5b7338c-9dbe-4518-af23-2df12ae4b8e4"
          ],
          "display_name": false
        },
        {
          "uuid": "35d5a709-9420-4ac0-af86-488fbcc08b4d",
          "name": "P-MENTHAN-2-OL [FHFI]",
          "stdName": "P-MENTHAN-2-OL [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "79ab27fe-7026-489c-8fe8-ed6864ce75ab"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e9362fe7-35b0-434c-98e5-3fa983a223c5",
          "citation": "CHEMID FEMA BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a5b7338c-9dbe-4518-af23-2df12ae4b8e4",
          "citation": "CHEMID BATCH 2010",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "05cb714f-d3f0-4064-a9d0-5822e1fcba7b",
          "citation": "GRAS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f9fadc23-b16a-4088-8e1b-c41d758af875",
          "citation": "fda_srs",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a3b93623-00a8-4303-8738-13542a0cf78e",
          "citation": "http://www.chemicalbook.com/ProductSynonyms.aspx?CBNumber=CB2932356&postData3=EN&SYMBOL_Type=A",
          "url": "http://www.chemicalbook.com/ProductSynonyms.aspx?CBNumber=CB2932356&postData3=EN&SYMBOL_Type=A",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fff50b27-f60a-477d-9274-598877f301df",
          "citation": "http://www.chemicalbook.com/ProductSynonyms.aspx?CBNumber=CB2932356&postData3=",
          "url": "http://www.chemicalbook.com/ProductSynonyms.aspx?CBNumber=CB2932356&postData3=",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "79ab27fe-7026-489c-8fe8-ed6864ce75ab",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "82ee4305-f903-492b-9f17-464e12187819",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390964000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "512df8a5-6450-471d-99de-56c1eced304d",
          "citation": "SRS import [X55010FU6N]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=X55010FU6N",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390964000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a987b7f1-64b0-4c23-bd0d-0f1623a4ec11",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1aed3c0b-5736-7e6c-ffea-d1d894acc1ca",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=499-69-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "cddc3594-9543-4df8-9b40-a23c49039b26",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "55e35bc9-c5d4-f5d3-77a0-b23d6efb9c0a",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "82db500a-2a24-2a33-1b54-f8ff3507d061",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "877043ef-2455-45bf-9cf8-cdd6aaaa795c",
          "id": "877043ef-2455-45bf-9cf8-cdd6aaaa795c",
          "molfile": "\n  Marvin  01132107022D          \n\n 11 11  0  0  0  0            999 V2000\n    5.1429   -6.2412    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.4272   -6.6516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8624   -6.6516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5781   -6.2412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5781   -5.4166    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.8624   -5.0024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1429   -5.4166    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    4.4272   -5.0024    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2853   -5.0024    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.2853   -4.1778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0049   -5.4166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  7  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  9  1  6  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  6  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\nM  END",
          "smiles": "C[C@H](C)[C@@H]1CC[C@@H](C)[C@@H](C1)O",
          "formula": "C10H20O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "432360bc-8214-4ca3-8bea-ff8b4f9262da"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "156.2656",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4fe17348-44be-4add-b7f0-a904b44e5d7f",
      "version": "6",
      "structure": {
        "id": "2b91ba75-c492-4e8f-afdf-1a1c731454de",
        "molfile": "\n  Marvin  01132102212D          \n\n 11 11  0  0  0  0            999 V2000\n    6.5781   -5.4166    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.8624   -5.0024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1429   -5.4166    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.1429   -6.2412    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.4272   -6.6516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8624   -6.6516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5781   -6.2412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4272   -5.0024    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2853   -5.0024    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.2853   -4.1778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0049   -5.4166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  1  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  1  7  1  0  0  0  0\n  3  8  1  6  0  0  0\n  1  9  1  6  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\nM  END",
        "smiles": "C[C@H](C)[C@@H]1CC[C@@H](C)[C@@H](C1)O",
        "formula": "C10H20O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "156.2656",
        "optical_activity": "( + / - )",
        "references": [
          "512df8a5-6450-471d-99de-56c1eced304d",
          "a987b7f1-64b0-4c23-bd0d-0f1623a4ec11"
        ],
        "stereo_centers": 3
      },
      "unii": "X55010FU6N"
    }
  ]
}