{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "016d2de7-d9c8-4cc3-8ccb-c007e9ceb541", "code": "N0000000190", "comments": "Cellular or Molecular Interactions [MoA]|Receptor Interactions [MoA]|G-Protein-linked Receptor Interactions [MoA]|Histamine Receptor Interactions [MoA]|Histamine Receptor Antagonists [MoA]|Histamine H1 Receptor Antagonists [MoA]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000000190", "code_system": "NDF-RT", "references": [ "43acdce9-3607-4e38-bd53-cb6609ce819a" ] }, { "uuid": "80023a71-8d35-4fde-92d7-e73a7cb384d3", "code": "N0000175519", "comments": "Established Pharmacologic Class [EPC]|Histamine-1 Receptor Inhibitor [EPC]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175519", "code_system": "NDF-RT", "references": [ "43acdce9-3607-4e38-bd53-cb6609ce819a" ] }, { "uuid": "537af9e5-8a42-49f3-9f5c-2672d5a21af7", "code": "QR06AX17", "comments": "VATC|ANTIHISTAMINES FOR SYSTEMIC USE|ANTIHISTAMINES FOR SYSTEMIC USE|Other antihistamines for systemic use|ketotifen", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QR06AX17&showdescription=yes", "code_system": "WHO-VATC", "references": [ "43acdce9-3607-4e38-bd53-cb6609ce819a" ] }, { "uuid": "e2831865-0a10-49d9-8e6c-2cb8bccc3c3f", "code": "QS01GX08", "comments": "VATC|OPHTHALMOLOGICALS|DECONGESTANTS AND ANTIALLERGICS|Other antiallergics|ketotifen", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QS01GX08&showdescription=yes", "code_system": "WHO-VATC", "references": [ "43acdce9-3607-4e38-bd53-cb6609ce819a" ] }, { "uuid": "1ae511d4-cddc-4b1e-a81a-aaa9245451ce", "code": "34580-13-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=34580-13-7", "code_system": "CAS", "references": [ "43acdce9-3607-4e38-bd53-cb6609ce819a", "8e60abd7-968d-4934-9d27-5fa0464a2124" ] }, { "uuid": "9984ea52-5b49-4e61-a4d0-e455644d0a47", "code": "C61799", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C61799", "code_system": "NCI_THESAURUS", "references": [ "43acdce9-3607-4e38-bd53-cb6609ce819a" ] }, { "uuid": "5b273bac-ed3e-4c35-818f-af81ae658136", "code": "D007665", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/68007665", "code_system": "MESH", "references": [ "43acdce9-3607-4e38-bd53-cb6609ce819a" ] }, { "uuid": "4fe57c0b-7c18-4870-8118-d0be5c9f9be9", "code": "KETOTIFEN", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Ketotifen", "code_system": "WIKIPEDIA", "references": [ "43acdce9-3607-4e38-bd53-cb6609ce819a" ] }, { "uuid": "73a119ca-fc7d-476c-8509-69b4d80002e0", "code": "3993", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=3993", "code_system": "INN", "references": [ "43acdce9-3607-4e38-bd53-cb6609ce819a" ] }, { "uuid": "a08962a6-9cde-4853-97c9-1a009d9c4cac", "code": "252-099-7", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.047.348", "code_system": "ECHA (EC/EINECS)", "references": [ "43acdce9-3607-4e38-bd53-cb6609ce819a" ] }, { "uuid": "8d530108-4adc-4239-ad07-b63282bf2722", "code": "7206", "type": "PRIMARY", "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=7206", "code_system": "IUPHAR", "references": [ "43acdce9-3607-4e38-bd53-cb6609ce819a" ] }, { "uuid": "fae3081f-f3c5-4cc7-9b5d-2a4186d1e31c", "code": "6146", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/6146/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "43acdce9-3607-4e38-bd53-cb6609ce819a" ] }, { "uuid": "c7576bd5-0866-4cac-90b1-9c6abb89d6a1", "code": "m6624", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m6624?q=authorize", "code_system": "MERCK INDEX", "references": [ "43acdce9-3607-4e38-bd53-cb6609ce819a" ] }, { "uuid": "23485577-f366-45f2-854d-4b08eaed9ddd", "code": "SUB08377MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "43acdce9-3607-4e38-bd53-cb6609ce819a" ] }, { "uuid": "c3fcf295-ea13-4179-afdf-0206cc044ad0", "code": "CHEMBL534", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL534", "code_system": "ChEMBL", "references": [ "43acdce9-3607-4e38-bd53-cb6609ce819a" ] }, { "uuid": "87c9cde8-b45c-4508-900a-9336f05a98cb", "code": "3827", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3827", "code_system": "PUBCHEM", "references": [ "43acdce9-3607-4e38-bd53-cb6609ce819a" ] }, { "uuid": "cb8650aa-2b3d-4d87-8ecd-987125472d6a", "code": "S01GX08", "comments": "ATC|SENSORY ORGANS|OPHTHALMOLOGICALS|DECONGESTANTS AND ANTIALLERGICS|Other antiallergics|ketotifen", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=S01GX08&showdescription=yes", "code_system": "WHO-ATC", "references": [ "43acdce9-3607-4e38-bd53-cb6609ce819a" ] }, { "uuid": "d5d9148a-3a85-4662-b238-f4f577adbe26", "code": "R06AX17", "comments": "ATC|RESPIRATORY SYSTEM|ANTIHISTAMINES FOR SYSTEMIC USE|ANTIHISTAMINES FOR SYSTEMIC USE|Other antihistamines for systemic use|ketotifen", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=R06AX17&showdescription=yes", "code_system": "WHO-ATC", "references": [ "43acdce9-3607-4e38-bd53-cb6609ce819a" ] }, { "uuid": "b21bf517-e4a6-d0c9-cedd-1f51f6c56a86", "code": "7283", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7283", "code_system": "HSDB", "references": [ "6ee33b6f-5d68-d7d3-2ab2-145e50f9d638" ] }, { "uuid": "6ce6366a-0f5f-7ddd-1e12-656c1fc8f24c", "code": "464714", "comments": "ORPHAN DRUG|Designated|Treatment of mastocytosis", "type": "PRIMARY", "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=464714", "code_system": "FDA ORPHAN DRUG" }, { "uuid": "2fa5e395-a0c8-5e7e-4c1c-ba7676122057", "code": "C29578", "comments": "Pharmacologic Substance[C1909]|Immunotherapeutic Agent[C308]|Histamine-1 Receptor Antagonist", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29578", "code_system": "NCI_THESAURUS", "references": [ "ded350c6-f1ad-9d66-6d30-c361be3580f2" ] }, { "uuid": "7812142a-b0b3-4ad0-a8d0-66e269c39611", "code": "X49220T18G", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "4d3ba208-027f-cb98-8f6a-fe2d6f81d4d1", "code": "Ketotifen", "type": "PRIMARY", "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM637/", "code_system": "LACTMED", "references": [ "ded350c6-f1ad-9d66-6d30-c361be3580f2" ] }, { "uuid": "d440b7fb-d148-e70f-bfdf-7990bf70424e", "code": "1530", "type": "PRIMARY", "url": "https://drugcentral.org/drugcard/1530", "code_system": "DRUG CENTRAL", "references": [ "ded350c6-f1ad-9d66-6d30-c361be3580f2" ] }, { "uuid": "5aea715a-3730-5816-df03-91cb400f14a7", "code": "DB00920", "type": "PRIMARY", "url": "https://go.drugbank.com/drugs/DB00920", "code_system": "DRUG BANK", "references": [ "ded350c6-f1ad-9d66-6d30-c361be3580f2" ] }, { "uuid": "003891a3-98b3-291a-a96b-aa0ef25819c1", "code": "92511", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:92511", "code_system": "CHEBI", "references": [ "ded350c6-f1ad-9d66-6d30-c361be3580f2" ] }, { "uuid": "753af290-882e-388d-f03f-de0952eb9092", "code": "X49220T18G", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=X49220T18G", "code_system": "DAILYMED", "references": [ "b74c9447-b420-a597-c611-d964fcc89249" ] }, { "uuid": "dffc938a-af7c-e8b2-943e-1f4c1ec4496a", "code": "100000092111", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "880fb0b7-1daf-82fb-a362-fb8185497f41" ] }, { "uuid": "8a6418e6-7c7a-49a6-334d-dca2c8a9af93", "code": "DTXSID7023190", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7023190", "code_system": "EPA CompTox", "references": [ "d85cd480-d6bc-0f93-0bda-9df74a74a7ce" ] } ], "substance_class": "chemical", "references": [ { "uuid": "c5241a89-4a27-49cf-b328-45212ce2c711", "citation": "USP Dictionary 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "722664f5-a9fa-4675-92b2-ad12463e542e", "citation": "INN Proposed List 35", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL35.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "8b0f5a99-025a-4be8-b2ec-4adff21c6788", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "0afb13bc-b65d-4c01-a60e-0425e6d89688", "citation": "MERCK INDEX", "doc_type": "MERCK INDEX", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "776dd6f8-8c77-49f6-8e51-9a3669a1e7f9", "citation": "HSDB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "361c5b76-5f46-4ea4-b00f-166a889b13cb", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "62ebee86-a960-4b4b-bd45-35fa4d1901be", "citation": "NDF-RT", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "43acdce9-3607-4e38-bd53-cb6609ce819a", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389749000, "tags": [ "NOMEN" ] }, { "uuid": "b7b7cf79-2c7c-4a48-8197-939d13396a6c", "citation": "SRS import [X49220T18G]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=X49220T18G", "doc_type": "SRS", "public_domain": true, "document_date": 1493389749000, "tags": [ "NOMEN" ] }, { "uuid": "c45fb078-1ba9-4048-a082-2dc50f5b460c", "citation": "KETOTIFEN [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "ef09843b-7623-44d1-af63-659701c5dc8f", "citation": "KETOTIFEN [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "11bd32c2-6948-419f-a529-d466268b7ba9", "citation": "KETOTIFEN [HSDB]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "35f0da26-db11-46f7-af5f-45da0de6ff2b", "citation": "KETOTIFEN [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "88135b0c-1da8-48ee-8e10-d7de5e2408e6", "citation": "KETOTIFEN [VANDF]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "6ee33b6f-5d68-d7d3-2ab2-145e50f9d638", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+34580-13-7", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "80963ece-dc68-8147-a720-b09a625eec42", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=34580-13-7", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "e1333ce4-9390-c9e9-64f0-cdb3c9a002ba", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+34580-13-7", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "431d247b-9522-5002-3ccc-de4b23c80ca3", "citation": "https://www.clinicalkey.com/pharmacology/monograph/2459?sec=monphar", "doc_type": "LEPINDEX", "public_domain": true }, { "uuid": "ded350c6-f1ad-9d66-6d30-c361be3580f2", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "8e60abd7-968d-4934-9d27-5fa0464a2124", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "616e1afc-f327-6e70-c81d-9685e73b31a5", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "b74c9447-b420-a597-c611-d964fcc89249", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "9d736596-7b77-4a5c-99b8-fb68327276e4", "citation": "11.2", "doc_type": "EP", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "880fb0b7-1daf-82fb-a362-fb8185497f41", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "d85cd480-d6bc-0f93-0bda-9df74a74a7ce", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "0b2a3e55-2997-4808-b902-f4f36565c6a4", "id": "0b2a3e55-2997-4808-b902-f4f36565c6a4", "molfile": "\n Marvin 01132100502D \n\n 22 25 0 0 0 0 999 V2000\n 1.3095 -11.4577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3095 -10.6901 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0093 -10.2311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0131 -9.4183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2756 -8.9894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5870 -9.4070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5870 -10.2311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2756 -8.1879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0319 -7.8342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7356 -8.2330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3527 -7.7025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0630 -6.8897 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1937 -7.0252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6820 -6.3705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0319 -5.6254 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8730 -6.3705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3537 -7.0252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4365 -6.7843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0460 -7.3488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8541 -8.1502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0639 -8.3911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5456 -7.8342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 1 0 0 0 0\n 2 7 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 6 5 1 0 0 0 0\n 5 8 2 0 0 0 0\n 7 6 1 0 0 0 0\n 8 9 1 0 0 0 0\n 22 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 13 9 2 0 0 0 0\n 11 10 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 2 0 0 0 0\n 16 14 1 0 0 0 0\n 16 17 1 0 0 0 0\n 18 17 1 0 0 0 0\n 17 22 2 0 0 0 0\n 19 18 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\nM END", "smiles": "CN1CCC(=C2c3ccccc3CC(=O)c4c2ccs4)CC1", "formula": "C19H19NOS", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "4e882856-6753-4af6-9e84-5747f39dd861" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "309.427", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "f23dd545-7322-41c5-8eb3-4ccb59e7904c", "version": "27", "structure": { "id": "2a070947-3e55-4f37-a3c6-31582a86310b", "molfile": "\n Marvin 01132102172D \n\n 22 25 0 0 0 0 999 V2000\n 2.0319 -7.8342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2756 -8.1879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1937 -7.0252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6820 -6.3705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5456 -7.8342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2756 -8.9894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3537 -7.0252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0630 -6.8897 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8730 -6.3705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7356 -8.2330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3095 -10.6901 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3527 -7.7025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0319 -5.6254 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0131 -9.4183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5870 -9.4070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0093 -10.2311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5870 -10.2311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0639 -8.3911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4365 -6.7843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3095 -11.4577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8541 -8.1502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0460 -7.3488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 1 2 0 0 0 0\n 4 3 1 0 0 0 0\n 5 2 1 0 0 0 0\n 6 2 2 0 0 0 0\n 7 5 2 0 0 0 0\n 8 3 1 0 0 0 0\n 9 4 1 0 0 0 0\n 10 1 1 0 0 0 0\n 11 17 1 0 0 0 0\n 12 10 2 0 0 0 0\n 13 4 2 0 0 0 0\n 14 6 1 0 0 0 0\n 15 6 1 0 0 0 0\n 16 14 1 0 0 0 0\n 17 15 1 0 0 0 0\n 18 5 1 0 0 0 0\n 19 7 1 0 0 0 0\n 20 11 1 0 0 0 0\n 21 18 2 0 0 0 0\n 22 21 1 0 0 0 0\n 12 8 1 0 0 0 0\n 9 7 1 0 0 0 0\n 16 11 1 0 0 0 0\n 22 19 2 0 0 0 0\nM END", "smiles": "CN1CCC(=C2c3ccccc3CC(=O)c4c2ccs4)CC1", "formula": "C19H19NOS", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "309.427", "optical_activity": "NONE", "references": [ "c5241a89-4a27-49cf-b328-45212ce2c711", "b7b7cf79-2c7c-4a48-8197-939d13396a6c", "722664f5-a9fa-4675-92b2-ad12463e542e" ], "stereo_centers": 0 }, "unii": "X49220T18G", "relationships": [ { "uuid": "37232371-4248-47d1-aade-48b1aedc3733", "amount": { "uuid": "a5b42e8c-f607-41c9-bd80-b1b221c231e4" }, "type": "ACTIVE MOIETY", "related_substance": { "uuid": "9254e194-0211-4a41-85e6-e9763c006f2a", "refuuid": "f23dd545-7322-41c5-8eb3-4ccb59e7904c", "name": "KETOTIFEN", "unii": "X49220T18G", "linking_id": "X49220T18G", "ref_pname": "KETOTIFEN", "substance_class": "reference" } }, { "uuid": "201274d1-1566-464f-86a2-11635ef30fdf", "amount": { "uuid": "9a87e8d8-b1ac-4ed4-9ef0-221c790b25b7" }, "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "d9564dac-b2e7-43e3-ad3f-540aba422edb", "refuuid": "71bff0e3-3290-439d-a51f-06b8d550dd4e", "name": "KETOTIFEN FUMARATE", "unii": "HBD503WORO", "linking_id": "HBD503WORO", "ref_pname": "KETOTIFEN FUMARATE", "substance_class": "reference" } }, { "uuid": "0995e758-941b-469e-bfaa-e6b3a766c29b", "amount": { "uuid": "dfab2969-736d-49e5-9cf1-720c6628462c", "average": 75, "units": "%" }, "type": "BINDER->LIGAND", "interaction_type": "BINDING", "references": [ "431d247b-9522-5002-3ccc-de4b23c80ca3" ], "related_substance": { "uuid": "5c877393-31f8-4549-828d-ecccaf92b009", "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30", "name": "PLASMA PROTEIN FRACTION (HUMAN)", "unii": "6D53G0FD0Z", "linking_id": "6D53G0FD0Z", "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)", "substance_class": "reference" } }, { "uuid": "ed649581-46fc-4f46-bb20-0eb3e5a1e43c", "amount": { "uuid": "cf9dd542-3036-4d5c-97bf-a191aa0a226a" }, "type": "PARENT->IMPURITY", "references": [ "9d736596-7b77-4a5c-99b8-fb68327276e4" ], "related_substance": { "uuid": "63b83949-ac72-4322-aafd-dc049af476e8", "refuuid": "71bff0e3-3290-439d-a51f-06b8d550dd4e", "name": "KETOTIFEN FUMARATE", "unii": "HBD503WORO", "linking_id": "HBD503WORO", "ref_pname": "KETOTIFEN FUMARATE", "substance_class": "reference" } } ], "names": [ { "uuid": "009a6623-4962-43a8-bce6-4a543ed81336", "name": "10-(1-methylpiperidin-4-ylidene)-5,10-dihydro-4H-benzo[5,6]cyclohepta[1,2-b]thiophen-4-one", "stdName": "10-(1-METHYLPIPERIDIN-4-YLIDENE)-5,10-DIHYDRO-4H-BENZO(5,6)CYCLOHEPTA(1,2-B)THIOPHEN-4-ONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9d736596-7b77-4a5c-99b8-fb68327276e4" ], "display_name": false }, { "uuid": "0e187db5-6058-4573-9e95-06fabb25d50c", "name": "10H-Benzo[4,5]cyclohepta[1,2-b]thiophen-10-one, 4,9-dihydro-4-(1-methyl-4-piperidinylidene)-", "stdName": "10H-BENZO(4,5)CYCLOHEPTA(1,2-B)THIOPHEN-10-ONE, 4,9-DIHYDRO-4-(1-METHYL-4-PIPERIDINYLIDENE)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8e60abd7-968d-4934-9d27-5fa0464a2124" ], "display_name": false }, { "uuid": "dc433804-fa0c-464e-89c7-aac1f6eee6df", "name": "4,9-Dihydro-4-(1-methyl-4-piperidinylidene)-10H-benzo[4,5]cyclohepta[1,2-b]thiophen-10-one", "stdName": "4,9-DIHYDRO-4-(1-METHYL-4-PIPERIDINYLIDENE)-10H-BENZO(4,5)CYCLOHEPTA(1,2-B)THIOPHEN-10-ONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8e60abd7-968d-4934-9d27-5fa0464a2124" ], "display_name": false }, { "uuid": "db80d433-75bd-4a42-a8cd-b7d943612b53", "name": "KETOTIFEN", "stdName": "KETOTIFEN", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "88135b0c-1da8-48ee-8e10-d7de5e2408e6", "c45fb078-1ba9-4048-a082-2dc50f5b460c", "ef09843b-7623-44d1-af63-659701c5dc8f", "361c5b76-5f46-4ea4-b00f-166a889b13cb", "722664f5-a9fa-4675-92b2-ad12463e542e", "11bd32c2-6948-419f-a529-d466268b7ba9", "c5241a89-4a27-49cf-b328-45212ce2c711", "62ebee86-a960-4b4b-bd45-35fa4d1901be", "776dd6f8-8c77-49f6-8e51-9a3669a1e7f9", "0afb13bc-b65d-4c01-a60e-0425e6d89688", "8b0f5a99-025a-4be8-b2ec-4adff21c6788", "35f0da26-db11-46f7-af5f-45da0de6ff2b" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "c046a4b4-5ba4-4646-9a12-729d13d5a89f", "name_org": "INN" } ] }, { "uuid": "30650e29-a068-4cf7-ad9e-17ed42d7e450", "name": "KETOTIFEN HYDROGEN FUMARATE IMPURITY E [EP IMPURITY]", "stdName": "KETOTIFEN HYDROGEN FUMARATE IMPURITY E [EP IMPURITY]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9d736596-7b77-4a5c-99b8-fb68327276e4" ], "display_name": false }, { "uuid": "caeaf4a8-1c7e-4cf9-a43a-f2fa29dd4b19", "name": "KETOTIFEN [HSDB]", "stdName": "KETOTIFEN [HSDB]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "776dd6f8-8c77-49f6-8e51-9a3669a1e7f9", "0afb13bc-b65d-4c01-a60e-0425e6d89688" ], "display_name": false }, { "uuid": "041dd096-c6c1-475d-8159-ea30ab90b23d", "name": "KETOTIFEN [MI]", "stdName": "KETOTIFEN [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "0afb13bc-b65d-4c01-a60e-0425e6d89688", "8b0f5a99-025a-4be8-b2ec-4adff21c6788" ], "display_name": false }, { "uuid": "26bbad33-a10a-4146-b15f-eb18c358f02d", "name": "KETOTIFEN [VANDF]", "stdName": "KETOTIFEN [VANDF]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "62ebee86-a960-4b4b-bd45-35fa4d1901be", "0afb13bc-b65d-4c01-a60e-0425e6d89688" ], "display_name": false }, { "uuid": "7966e25d-3013-9b77-14b6-5241a8d32938", "name": "Ketotifen [WHO-DD]", "stdName": "KETOTIFEN [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "616e1afc-f327-6e70-c81d-9685e73b31a5" ], "display_name": false }, { "uuid": "b95fdc4a-b91e-4fcb-a730-23f3335248ab", "name": "ketotifen [INN]", "stdName": "KETOTIFEN [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "722664f5-a9fa-4675-92b2-ad12463e542e" ], "display_name": false } ], "properties": [ { "uuid": "bb6155fb-fe9a-454f-96c4-91fb19546c8c", "name": "Biological Half-life", "value": { "uuid": "b8cb3ac4-2ae4-4bc7-adb8-7b66a4d50112", "high": 22, "low": 2, "units": "hours" }, "defining": false, "property_type": "PHARMACOKINETIC", "references": [ "431d247b-9522-5002-3ccc-de4b23c80ca3" ] } ] } ] }