{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b9b00e39-d70d-47dc-ad16-f7f4579d6f11",
          "code": "106-28-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=106-28-5",
          "code_system": "CAS",
          "references": [
            "4af8a3b5-29a2-40a4-b0ab-c207869b81bd",
            "2a6c0edf-b6e0-4557-9ed4-ed813c596783"
          ]
        },
        {
          "uuid": "4cf06071-76cc-4aaa-92c3-432d53449236",
          "code": "C64169",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C64169",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4af8a3b5-29a2-40a4-b0ab-c207869b81bd"
          ]
        },
        {
          "uuid": "3d556edb-26c7-4442-ac05-eacf1bd019d7",
          "code": "m5245",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5245?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "4af8a3b5-29a2-40a4-b0ab-c207869b81bd"
          ]
        },
        {
          "uuid": "f5d918b5-bb0b-4ef5-865f-8aafe8990b92",
          "code": "445070",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/445070",
          "code_system": "PUBCHEM",
          "references": [
            "4af8a3b5-29a2-40a4-b0ab-c207869b81bd"
          ]
        },
        {
          "uuid": "4c1efe5f-90e9-67c1-6759-a126a051a4b8",
          "code": "DTXSID2040789",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2040789",
          "code_system": "EPA CompTox",
          "references": [
            "11ba6876-7c61-3d86-4137-5749a4cdec4c"
          ]
        },
        {
          "uuid": "eea15b7b-de35-c2b9-5e86-90ca91392d6f",
          "code": "C275",
          "comments": "Pharmacologic Substance[C1909]|Protective Agent[C26170]|Antioxidant",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C275",
          "code_system": "NCI_THESAURUS",
          "references": [
            "57d41fe2-a8ff-8054-7f38-e6198614826b"
          ]
        },
        {
          "uuid": "597bf055-2b1d-fa85-85db-e972da701edb",
          "code": "C860",
          "comments": "Drug or Chemical by Structure[C1913]|Organic Chemical[C718]|Lipid[C616]|Terpene Compound",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C860",
          "code_system": "NCI_THESAURUS",
          "references": [
            "57d41fe2-a8ff-8054-7f38-e6198614826b"
          ]
        },
        {
          "uuid": "f182e630-65f4-486f-a006-cbaebf34bed2",
          "code": "X23PI60R17",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a4c037b0-974a-eaf1-592d-35d25c36928a",
          "code": "16619",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:16619",
          "code_system": "CHEBI",
          "references": [
            "57d41fe2-a8ff-8054-7f38-e6198614826b"
          ]
        },
        {
          "uuid": "9b3bd553-9dce-361e-6064-eed1529faffb",
          "code": "X23PI60R17",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=X23PI60R17",
          "code_system": "DAILYMED",
          "references": [
            "9707c649-3bea-8098-1bc3-3657484d87b4"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a4596c42-5588-4ab1-bb66-04d763836b31",
          "name": "(2E,6E)-FARNESOL",
          "stdName": "(2E,6E)-FARNESOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61d9b8ab-ea1e-4791-85d5-c9c0c8306a29",
            "86615ae2-3f8e-4b1f-a6c1-b9f2db9f59bc"
          ],
          "display_name": false
        },
        {
          "uuid": "bf6b3a1d-982f-422d-bb68-ab9522957396",
          "name": "(E)-.BETA.-FARNESOL",
          "stdName": "(E)-.BETA.-FARNESOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61d9b8ab-ea1e-4791-85d5-c9c0c8306a29",
            "86615ae2-3f8e-4b1f-a6c1-b9f2db9f59bc"
          ],
          "display_name": false
        },
        {
          "uuid": "9c3cdd0b-190e-49b3-a1df-b474b969ee84",
          "name": "(E,E)-3,7,11-TRIMETHYL-2,6,10-DODECATNEN-1-OL",
          "stdName": "(E,E)-3,7,11-TRIMETHYL-2,6,10-DODECATNEN-1-OL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61d9b8ab-ea1e-4791-85d5-c9c0c8306a29",
            "86615ae2-3f8e-4b1f-a6c1-b9f2db9f59bc"
          ],
          "display_name": false
        },
        {
          "uuid": "123c3663-1241-46c0-bd93-9c83a98a83d7",
          "name": "(E,E)-FARNESOL",
          "stdName": "(E,E)-FARNESOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e15beaf9-fce9-4ddb-be66-6a3d71f99720",
            "86615ae2-3f8e-4b1f-a6c1-b9f2db9f59bc"
          ],
          "display_name": false
        },
        {
          "uuid": "010412c7-3f9e-4060-a1cb-0a386c6b837d",
          "name": "2,6,10-DODECATRIEN-1-OL, 3,7,11-TRIMETHYL-, (2E,6E)-",
          "stdName": "2,6,10-DODECATRIEN-1-OL, 3,7,11-TRIMETHYL-, (2E,6E)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "017b47de-c195-4d61-a787-c3cfcaa24712",
            "86615ae2-3f8e-4b1f-a6c1-b9f2db9f59bc"
          ],
          "display_name": false
        },
        {
          "uuid": "6046d637-4d7d-4abf-9053-dd23917e1143",
          "name": "2,6-DI-TRANS-FARNESOL",
          "stdName": "2,6-DI-TRANS-FARNESOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61d9b8ab-ea1e-4791-85d5-c9c0c8306a29",
            "86615ae2-3f8e-4b1f-a6c1-b9f2db9f59bc"
          ],
          "display_name": false
        },
        {
          "uuid": "0f27c95f-58be-47b2-a7c8-84cdf13e4a77",
          "name": "3,7,11-TRIMETHYLDODECA-2-TRANS,6-TRANS,10-TRIEN-1-OL",
          "stdName": "3,7,11-TRIMETHYLDODECA-2-TRANS,6-TRANS,10-TRIEN-1-OL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61d9b8ab-ea1e-4791-85d5-c9c0c8306a29",
            "86615ae2-3f8e-4b1f-a6c1-b9f2db9f59bc"
          ],
          "display_name": false
        },
        {
          "uuid": "5e20b544-7ef1-427c-bf54-50a494aae3b1",
          "name": "ALL-E-FARNESOL",
          "stdName": "ALL-E-FARNESOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61d9b8ab-ea1e-4791-85d5-c9c0c8306a29",
            "86615ae2-3f8e-4b1f-a6c1-b9f2db9f59bc"
          ],
          "display_name": false
        },
        {
          "uuid": "15fad0c4-423c-4857-be0b-220e2495f8d9",
          "name": "FARNESOL TRANS,TRANS-FARNESOL [MI]",
          "stdName": "FARNESOL TRANS,TRANS-FARNESOL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e15beaf9-fce9-4ddb-be66-6a3d71f99720",
            "86615ae2-3f8e-4b1f-a6c1-b9f2db9f59bc"
          ],
          "display_name": false
        },
        {
          "uuid": "36a9fa52-fc15-4bb6-a36f-19823fe8fd51",
          "name": "FARNESOL, (2E,6E)-",
          "stdName": "FARNESOL, (2E,6E)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "48693ef9-0b15-459b-a669-9182f79e826a",
            "86615ae2-3f8e-4b1f-a6c1-b9f2db9f59bc"
          ],
          "display_name": true
        },
        {
          "uuid": "127e5364-342c-432b-b864-5fc05d90dfc8",
          "name": "FEMA NO. 2478, (2E,6E)-",
          "stdName": "FEMA NO. 2478, (2E,6E)-",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "48693ef9-0b15-459b-a669-9182f79e826a",
            "86615ae2-3f8e-4b1f-a6c1-b9f2db9f59bc"
          ],
          "display_name": false
        },
        {
          "uuid": "ce64d515-5fa7-4d5a-a0df-ee073c36d82e",
          "name": "INHIBITOR A2",
          "stdName": "INHIBITOR A2",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61d9b8ab-ea1e-4791-85d5-c9c0c8306a29",
            "86615ae2-3f8e-4b1f-a6c1-b9f2db9f59bc"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e15beaf9-fce9-4ddb-be66-6a3d71f99720",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "86615ae2-3f8e-4b1f-a6c1-b9f2db9f59bc",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "017b47de-c195-4d61-a787-c3cfcaa24712",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "48693ef9-0b15-459b-a669-9182f79e826a",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "61d9b8ab-ea1e-4791-85d5-c9c0c8306a29",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4af8a3b5-29a2-40a4-b0ab-c207869b81bd",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390467000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "832a1899-38a4-4bb4-867a-3e2eb23b154c",
          "citation": "SRS import [X23PI60R17]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=X23PI60R17",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390467000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "11ba6876-7c61-3d86-4137-5749a4cdec4c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=106-28-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "57d41fe2-a8ff-8054-7f38-e6198614826b",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "2a6c0edf-b6e0-4557-9ed4-ed813c596783",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "9707c649-3bea-8098-1bc3-3657484d87b4",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4d291b9c-0b6d-4eae-88cd-63340eda91c0",
          "id": "4d291b9c-0b6d-4eae-88cd-63340eda91c0",
          "molfile": "\n  Marvin  01132104022D          \n\n 16 15  0  0  0  0            999 V2000\n    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7137   -0.4138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7137   -1.2335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4301    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1438   -0.4138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8575    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5764   -0.4138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5764   -1.2335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2928    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0065   -0.4138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7125    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4262   -0.4138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4262   -1.2335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1451    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8614   -0.4138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5751    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 12  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\nM  END",
          "smiles": "CC(=CCC/C(=C/CC/C(=C/CO)/C)/C)C",
          "formula": "C15H26O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3dee4f3c-6f5f-43ec-90d7-13a71837ce41"
          },
          "defined_stereo": 0,
          "ez_centers": 2,
          "molecular_weight": "222.3669",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a4f376c6-c3f3-4a6e-836e-cff6e045796e",
      "version": "7",
      "structure": {
        "id": "b47afa2d-cc9e-441a-a83b-c94fe81026e5",
        "molfile": "\n  Marvin  01132109212D          \n\n 16 15  0  0  0  0            999 V2000\n    3.5764   -0.4138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7137   -0.4138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4262   -0.4138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4301    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2928    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1451    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1438   -0.4138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0065   -0.4138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5751    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7125    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8575    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8614   -0.4138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7137   -1.2335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5764   -1.2335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4262   -1.2335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  4  2  0  0  0  0\n  3 10  1  0  0  0  0\n  4  7  1  0  0  0  0\n  5  1  2  0  0  0  0\n  6  3  2  0  0  0  0\n  7 11  1  0  0  0  0\n  8  5  1  0  0  0  0\n  9 12  1  0  0  0  0\n 10  8  1  0  0  0  0\n 11  1  1  0  0  0  0\n 12  6  1  0  0  0  0\n 13  2  1  0  0  0  0\n 14  2  1  0  0  0  0\n 15  1  1  0  0  0  0\n 16  3  1  0  0  0  0\nM  END",
        "smiles": "CC(=CCC/C(=C/CC/C(=C/CO)/C)/C)C",
        "formula": "C15H26O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 2,
        "molecular_weight": "222.3669",
        "optical_activity": "NONE",
        "references": [
          "832a1899-38a4-4bb4-867a-3e2eb23b154c",
          "e15beaf9-fce9-4ddb-be66-6a3d71f99720"
        ],
        "stereo_centers": 0
      },
      "unii": "X23PI60R17"
    }
  ]
}