{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f28e652a-858f-4efb-a1a6-b822b8604a21",
          "code": "108801",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2898",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "a26103d8-8457-459c-831c-96a6ce1d647e"
          ]
        },
        {
          "uuid": "eff9a3d5-4b1a-40de-b785-3555ab1cd99d",
          "code": "257-060-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.051.856",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a26103d8-8457-459c-831c-96a6ce1d647e"
          ]
        },
        {
          "uuid": "1625aee3-3659-4f8d-9b58-0542cc38699b",
          "code": "m7493",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7493?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "a26103d8-8457-459c-831c-96a6ce1d647e"
          ]
        },
        {
          "uuid": "73bbc11e-4620-413d-b1f9-0104053e436d",
          "code": "4169",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4169",
          "code_system": "PUBCHEM",
          "references": [
            "a26103d8-8457-459c-831c-96a6ce1d647e"
          ]
        },
        {
          "uuid": "4dac5253-7260-4572-883c-d5798bcb059b",
          "code": "51218-45-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=51218-45-2",
          "code_system": "CAS",
          "references": [
            "a26103d8-8457-459c-831c-96a6ce1d647e",
            "b6007405-3c80-49b3-9b5c-abcc094a548a"
          ]
        },
        {
          "uuid": "efa2c71d-125a-4abf-82f8-99f6e9a83d51",
          "code": "C051786",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67051786",
          "code_system": "MESH",
          "references": [
            "a26103d8-8457-459c-831c-96a6ce1d647e"
          ]
        },
        {
          "uuid": "f3c3ea7d-d3d3-4e57-a365-0e70d727b294",
          "code": "METOLACHLOR",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Metolachlor",
          "code_system": "WIKIPEDIA",
          "references": [
            "a26103d8-8457-459c-831c-96a6ce1d647e"
          ]
        },
        {
          "uuid": "e5d925aa-fb2d-a738-00c9-ec5b9001befd",
          "code": "6706",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6706",
          "code_system": "HSDB",
          "references": [
            "b6238651-86f6-6c16-9284-fce8353da885"
          ]
        },
        {
          "uuid": "aa1534b9-62ea-2926-3635-5a312a342dc9",
          "code": "DTXSID4022448",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4022448",
          "code_system": "EPA CompTox",
          "references": [
            "fe3d0c38-6258-105c-99fe-d0fd0ed30b80"
          ]
        },
        {
          "uuid": "38a2d723-5efa-4467-b774-4f554a7bfb73",
          "code": "X0I01K05X2",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "acdec599-89f6-9fbc-7919-dcb28a46b571",
          "code": "100000183633",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "f4c62c97-8e7e-860c-9d59-4154840994eb"
          ]
        },
        {
          "uuid": "c8e44915-1a7f-c5ff-3812-f0d3d8dea46f",
          "code": "metolachlor",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/metolachlor.html",
          "code_system": "ALANWOOD",
          "references": [
            "5c81b741-88e1-1a5a-0278-fdfe0ebdd7c6"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "63a68184-73f6-499c-b3aa-04e9fc4b9ff6",
          "name": ".ALPHA.-CHLORO-2-ETHYL-6-METHYL-N-(1-METHYL-2-METHOXYETHYL)ACETANILIDE",
          "stdName": ".ALPHA.-CHLORO-2-ETHYL-6-METHYL-N-(1-METHYL-2-METHOXYETHYL)ACETANILIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef415bdf-8fdb-4bfb-86d6-e6127832ee5d",
            "9d204c3a-91e9-4fd9-b6e9-ad71e714aff4"
          ],
          "display_name": false
        },
        {
          "uuid": "0d4d7635-507d-4daf-b37b-fdc4e944cb01",
          "name": "2-CHLORO-6-ETHYL-N-(2-METHOXY-1-METHYLETHYL)ACET-O-TOLUIDIDE",
          "stdName": "2-CHLORO-6-ETHYL-N-(2-METHOXY-1-METHYLETHYL)ACET-O-TOLUIDIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef415bdf-8fdb-4bfb-86d6-e6127832ee5d",
            "9d204c3a-91e9-4fd9-b6e9-ad71e714aff4"
          ],
          "display_name": false
        },
        {
          "uuid": "f20fb572-f9e7-4346-a583-2f9bda9f8b84",
          "name": "2-CHLORO-N-(2-ETHYL-6-METHYLPHENYL)-N-(2-METHOXY-1-METHYLETHYL)ACETAMIDE",
          "stdName": "2-CHLORO-N-(2-ETHYL-6-METHYLPHENYL)-N-(2-METHOXY-1-METHYLETHYL)ACETAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef415bdf-8fdb-4bfb-86d6-e6127832ee5d",
            "9d204c3a-91e9-4fd9-b6e9-ad71e714aff4"
          ],
          "display_name": false
        },
        {
          "uuid": "25608332-5743-4f7e-8a21-ab1e23e54e64",
          "name": "ACETAMIDE, 2-CHLORO-N-(2-ETHYL-6-METHYLPHENYL)-N-(2-METHOXY-1-METHYLETHYL)-",
          "stdName": "ACETAMIDE, 2-CHLORO-N-(2-ETHYL-6-METHYLPHENYL)-N-(2-METHOXY-1-METHYLETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef415bdf-8fdb-4bfb-86d6-e6127832ee5d",
            "52b4c907-e7e9-4070-92eb-028c8bcb18af"
          ],
          "display_name": false
        },
        {
          "uuid": "b33bf45f-e66c-40ab-9fde-fac0ed92f9d5",
          "name": "CGA-24705",
          "stdName": "CGA-24705",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef415bdf-8fdb-4bfb-86d6-e6127832ee5d",
            "9d204c3a-91e9-4fd9-b6e9-ad71e714aff4"
          ],
          "display_name": false
        },
        {
          "uuid": "a76c468e-06dc-4d3b-b449-3c8a1ce77a2c",
          "name": "CODAL",
          "stdName": "CODAL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef415bdf-8fdb-4bfb-86d6-e6127832ee5d",
            "52b4c907-e7e9-4070-92eb-028c8bcb18af"
          ],
          "display_name": false
        },
        {
          "uuid": "e49e51bd-fe0c-4062-8eef-c693dc349d9d",
          "name": "JINDUAL",
          "stdName": "JINDUAL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef415bdf-8fdb-4bfb-86d6-e6127832ee5d",
            "52b4c907-e7e9-4070-92eb-028c8bcb18af"
          ],
          "display_name": false
        },
        {
          "uuid": "6f976b18-7c83-45f6-9e2b-faf3825905b5",
          "name": "METELILACHLOR",
          "stdName": "METELILACHLOR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef415bdf-8fdb-4bfb-86d6-e6127832ee5d",
            "9d204c3a-91e9-4fd9-b6e9-ad71e714aff4"
          ],
          "display_name": false
        },
        {
          "uuid": "89ebf989-1735-4fc7-a1b9-4c416db99345",
          "name": "METOKEN",
          "stdName": "METOKEN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef415bdf-8fdb-4bfb-86d6-e6127832ee5d",
            "52b4c907-e7e9-4070-92eb-028c8bcb18af"
          ],
          "display_name": false
        },
        {
          "uuid": "be8da280-ff3d-4ba3-8a8b-3d0494327251",
          "name": "METOLACHLOR",
          "stdName": "METOLACHLOR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "72e0fee5-98a2-4cb9-9188-323954eee23b",
            "ef415bdf-8fdb-4bfb-86d6-e6127832ee5d",
            "775df9df-6513-4b57-8231-d5238149990f",
            "c68f0b95-3c67-4990-9668-dd7c8b59a1fd",
            "a0e770de-270c-472b-80f7-2f1b92fa052f",
            "ccfca877-ca8e-42c9-b47f-cf7938e27531",
            "9d204c3a-91e9-4fd9-b6e9-ad71e714aff4"
          ],
          "display_name": true
        },
        {
          "uuid": "1f992f5a-edf3-41b5-a420-032b366d1e3a",
          "name": "METOLACHLOR [HSDB]",
          "stdName": "METOLACHLOR [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "72e0fee5-98a2-4cb9-9188-323954eee23b",
            "ef415bdf-8fdb-4bfb-86d6-e6127832ee5d"
          ],
          "display_name": false
        },
        {
          "uuid": "e0b4d77b-cbcf-403f-9d9c-1b2fac700883",
          "name": "METOLACHLOR [ISO]",
          "stdName": "METOLACHLOR [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef415bdf-8fdb-4bfb-86d6-e6127832ee5d",
            "a0e770de-270c-472b-80f7-2f1b92fa052f"
          ],
          "display_name": false
        },
        {
          "uuid": "5e4949a4-89cf-46f1-b9ad-082c0954fbe9",
          "name": "METOLACHLOR [MI]",
          "stdName": "METOLACHLOR [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef415bdf-8fdb-4bfb-86d6-e6127832ee5d",
            "9d204c3a-91e9-4fd9-b6e9-ad71e714aff4"
          ],
          "display_name": false
        },
        {
          "uuid": "f78112e4-7268-4228-b35e-476eb5510d82",
          "name": "N-(1-METHYL-2-METHOXYETHYL)-N-CHLOROACETYL-2-ETHYL-6-METHYLANILINE",
          "stdName": "N-(1-METHYL-2-METHOXYETHYL)-N-CHLOROACETYL-2-ETHYL-6-METHYLANILINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef415bdf-8fdb-4bfb-86d6-e6127832ee5d",
            "52b4c907-e7e9-4070-92eb-028c8bcb18af"
          ],
          "display_name": false
        },
        {
          "uuid": "8c8eb2d0-0083-4431-80ea-58d95d99d156",
          "name": "PENNANT",
          "stdName": "PENNANT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef415bdf-8fdb-4bfb-86d6-e6127832ee5d",
            "52b4c907-e7e9-4070-92eb-028c8bcb18af"
          ],
          "display_name": false
        },
        {
          "uuid": "d500b748-d009-4470-abd8-25cd0fbbf63e",
          "name": "YIBINGJIACAOAN",
          "stdName": "YIBINGJIACAOAN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef415bdf-8fdb-4bfb-86d6-e6127832ee5d",
            "52b4c907-e7e9-4070-92eb-028c8bcb18af"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "9d204c3a-91e9-4fd9-b6e9-ad71e714aff4",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ef415bdf-8fdb-4bfb-86d6-e6127832ee5d",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "72e0fee5-98a2-4cb9-9188-323954eee23b",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "52b4c907-e7e9-4070-92eb-028c8bcb18af",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a0e770de-270c-472b-80f7-2f1b92fa052f",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a26103d8-8457-459c-831c-96a6ce1d647e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391424000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a2eda860-7e5c-481f-a09d-1284fd3428e5",
          "citation": "SRS import [X0I01K05X2]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=X0I01K05X2",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391424000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "775df9df-6513-4b57-8231-d5238149990f",
          "citation": "METOLACHLOR [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c68f0b95-3c67-4990-9668-dd7c8b59a1fd",
          "citation": "METOLACHLOR [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ccfca877-ca8e-42c9-b47f-cf7938e27531",
          "citation": "METOLACHLOR [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b6238651-86f6-6c16-9284-fce8353da885",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+51218-45-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fe3d0c38-6258-105c-99fe-d0fd0ed30b80",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=51218-45-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5c81b741-88e1-1a5a-0278-fdfe0ebdd7c6",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "b6007405-3c80-49b3-9b5c-abcc094a548a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f4c62c97-8e7e-860c-9d59-4154840994eb",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a235eba3-f53a-4d94-a646-8a043bd25554",
          "id": "a235eba3-f53a-4d94-a646-8a043bd25554",
          "molfile": "\n  Marvin  01132108262D          \n\n 19 19  0  0  0  0            999 V2000\n    4.1092   -5.9078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8228   -5.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5402   -5.9078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5402   -6.7356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2538   -7.1495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9711   -6.7356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9711   -5.9078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6848   -5.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2538   -5.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2538   -4.6699    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9711   -4.2560    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    7.6848   -4.6699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9711   -3.4319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6848   -3.0180    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6848   -2.1903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5402   -4.2560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8228   -4.6699    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5402   -3.4319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8228   -3.0180    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  9  3  2  0  0  0  0\n  4  5  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 16  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 16 18  1  0  0  0  0\n 19 18  1  0  0  0  0\nM  END",
          "smiles": "CCc1cccc(C)c1N(C(C)COC)C(=O)CCl",
          "formula": "C15H22ClNO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e0b81d92-5126-4d03-bdf5-b57e687e1bef"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "283.7942",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ab28b208-e424-449c-a865-c29e7e32e4b9",
      "version": "6",
      "structure": {
        "id": "bf6a4228-9d28-48af-80cd-11e0b4006373",
        "molfile": "\n  Marvin  01132109542D          \n\n 19 19  0  0  0  0            999 V2000\n    4.8228   -3.0180    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.5402   -3.4319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5402   -4.2560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8228   -4.6699    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2538   -4.6699    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9711   -4.2560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9711   -3.4319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6848   -3.0180    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6848   -2.1903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6848   -4.6699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2538   -5.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5402   -5.9078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8228   -5.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1092   -5.9078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5402   -6.7356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2538   -7.1495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9711   -6.7356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9711   -5.9078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6848   -5.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  3  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  6 10  1  0  0  0  0\n  5 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 12 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 11 18  2  0  0  0  0\n 18 19  1  0  0  0  0\nM  END",
        "smiles": "CCc1cccc(C)c1N(C(C)COC)C(=O)CCl",
        "formula": "C15H22ClNO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "283.7942",
        "optical_activity": "( + / - )",
        "references": [
          "a2eda860-7e5c-481f-a09d-1284fd3428e5",
          "9d204c3a-91e9-4fd9-b6e9-ad71e714aff4"
        ],
        "stereo_centers": 1
      },
      "unii": "X0I01K05X2"
    }
  ]
}