{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "1e2fbc61-18ef-485c-ab4e-dcb3d8ca4d52", "code": "6014-42-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=6014-42-2", "code_system": "CAS", "references": [ "33811d26-d401-4c75-b141-98f30ff96cf5", "c4876bdb-1cbf-47cb-8785-286d4568b301" ] }, { "uuid": "32218afe-8a8d-4ba6-82ad-7a150e6b2dd2", "code": "439710", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439710", "code_system": "PUBCHEM", "references": [ "33811d26-d401-4c75-b141-98f30ff96cf5" ] }, { "uuid": "ace73856-572b-427c-8d6c-c38a3a353614", "code": "X0E04Y9M7F", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "8796daa8-7301-5410-1d05-9e588e0a4e3e", "code": "DTXSID30331435", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30331435", "code_system": "EPA CompTox", "references": [ "e59e819b-87c8-36cc-4c93-7707dadca2e6" ] } ], "substance_class": "chemical", "names": [ { "uuid": "ab1a7c1b-b5a8-469b-9b2a-5310540fee12", "name": ".ALPHA.-L-MANNOPYRANOSE, 6-DEOXY-", "stdName": ".ALPHA.-L-MANNOPYRANOSE, 6-DEOXY-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "12787ad9-dc4c-4a7e-ab97-9d074849c21e", "7d259f70-9401-44e0-be1f-0565800902fd" ], "display_name": false }, { "uuid": "9f7b2385-8920-4bc9-92a0-1bc6d52c6798", "name": ".ALPHA.-L-RHAMNOPYRANOSE", "stdName": ".ALPHA.-L-RHAMNOPYRANOSE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "12787ad9-dc4c-4a7e-ab97-9d074849c21e", "7d259f70-9401-44e0-be1f-0565800902fd" ], "display_name": false }, { "uuid": "98be0330-2429-41c4-adea-166c09764b5a", "name": ".ALPHA.-L-RHAMNOSE", "stdName": ".ALPHA.-L-RHAMNOSE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "12787ad9-dc4c-4a7e-ab97-9d074849c21e", "7d259f70-9401-44e0-be1f-0565800902fd" ], "display_name": true } ], "references": [ { "uuid": "12787ad9-dc4c-4a7e-ab97-9d074849c21e", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "7d259f70-9401-44e0-be1f-0565800902fd", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "33811d26-d401-4c75-b141-98f30ff96cf5", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392748000, "tags": [ "NOMEN" ] }, { "uuid": "b3188aad-d778-42be-a4ac-37fcf9e186cc", "citation": "SRS import [X0E04Y9M7F]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=X0E04Y9M7F", "doc_type": "SRS", "public_domain": true, "document_date": 1493392748000, "tags": [ "NOMEN" ] }, { "uuid": "c71ebf7b-c308-b210-5907-f9e29d7e5d4e", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=6014-42-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "c4876bdb-1cbf-47cb-8785-286d4568b301", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "e59e819b-87c8-36cc-4c93-7707dadca2e6", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "b8d678a9-f7c4-4eeb-96e1-6f891fb3c9ca", "id": "b8d678a9-f7c4-4eeb-96e1-6f891fb3c9ca", "molfile": "\n Marvin 01132109342D \n\n 11 11 0 0 1 0 999 V2000\n 9.5629 -6.7589 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 10.2774 -7.1714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5629 -5.9339 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8485 -5.5214 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 8.8485 -4.6964 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1340 -5.9339 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 7.4195 -5.5214 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1340 -6.7589 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 7.4195 -7.1714 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8485 -7.1714 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 8.8485 -7.9964 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 1 3 1 0 0 0 0\n 10 1 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 6 0 0 0\n 6 4 1 0 0 0 0\n 6 7 1 1 0 0 0\n 8 6 1 0 0 0 0\n 8 9 1 1 0 0 0\n 10 8 1 0 0 0 0\n 10 11 1 6 0 0 0\nM END", "smiles": "C[C@H]1[C@@H]([C@H]([C@H]([C@H](O)O1)O)O)O", "formula": "C6H12O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "b9ec16bb-3d48-43b2-a3a2-2abd5e436a83" }, "defined_stereo": 5, "ez_centers": 0, "molecular_weight": "164.1567", "optical_activity": "UNSPECIFIED", "stereo_centers": 5 } ], "definition_level": "COMPLETE", "uuid": "a1481449-58fb-4d94-b45b-4ae6729dc465", "version": "5", "structure": { "id": "08eb97d1-fcca-4628-8b92-195ac2e25ab7", "molfile": "\n Marvin 01132100442D \n\n 11 11 0 0 1 0 999 V2000\n 8.8485 -7.9964 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8485 -7.1714 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.5629 -6.7589 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 10.2774 -7.1714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5629 -5.9339 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8485 -5.5214 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.8485 -4.6964 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1340 -5.9339 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.4195 -5.5214 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1340 -6.7589 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.4195 -7.1714 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 6 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 1 0 0 0\n 3 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 6 0 0 0\n 8 6 1 0 0 0 0\n 8 9 1 1 0 0 0\n 10 8 1 0 0 0 0\n 2 10 1 0 0 0 0\n 10 11 1 1 0 0 0\nM END", "smiles": "C[C@H]1[C@@H]([C@H]([C@H]([C@H](O)O1)O)O)O", "formula": "C6H12O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 5, "ez_centers": 0, "molecular_weight": "164.1567", "optical_activity": "UNSPECIFIED", "references": [ "12787ad9-dc4c-4a7e-ab97-9d074849c21e", "b3188aad-d778-42be-a4ac-37fcf9e186cc" ], "stereo_centers": 5 }, "unii": "X0E04Y9M7F" } ] }