{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "fd67d78a-f7c9-4b7e-9f7b-8c41eea00740",
          "code": "84454-97-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=84454-97-7",
          "code_system": "CAS",
          "references": [
            "094a3cf5-3c1e-468d-8e38-952b7dfab480",
            "90b39cea-0d5e-4dc4-a758-26dbbbc10723"
          ]
        },
        {
          "uuid": "0bbdf4f6-4c62-4352-8e5f-314950d08c5b",
          "code": "13473418",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13473418",
          "code_system": "PUBCHEM",
          "references": [
            "094a3cf5-3c1e-468d-8e38-952b7dfab480"
          ]
        },
        {
          "uuid": "1b88897c-060f-02d4-51cb-ec921a4ca6c5",
          "code": "DTXSID50233427",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50233427",
          "code_system": "EPA CompTox",
          "references": [
            "7d718170-0750-0178-f29c-75c2b85d5757"
          ]
        },
        {
          "uuid": "e79766e7-c6ed-4412-a26a-bf47b02ed8a1",
          "code": "X01340435H",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "34c54a4d-abb0-4413-90d9-5a92e959fd95",
          "name": "3-PYRIDINECARBOXAMIDE, N-(2-(3,4-DIHYDROXYPHENYL)ETHYL)-",
          "stdName": "3-PYRIDINECARBOXAMIDE, N-(2-(3,4-DIHYDROXYPHENYL)ETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "65ef883c-4c89-4f6f-8900-884e94999ac2",
            "bb766fee-5308-4ae0-8a00-dab2a76fc03c"
          ],
          "display_name": false
        },
        {
          "uuid": "a0f6288b-bacd-46e8-a93e-30dd3e1baaa6",
          "name": "EP-NDD",
          "stdName": "EP-NDD",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bb766fee-5308-4ae0-8a00-dab2a76fc03c",
            "ab2b55c0-3cd2-4150-983f-cf9fd0f38ecb"
          ],
          "display_name": false
        },
        {
          "uuid": "3b860dc8-13d3-4480-b4d0-349e66ee9cbf",
          "name": "N-NICOTINOYL DOPAMINE",
          "stdName": "N-NICOTINOYL DOPAMINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f611730-2b65-431b-8bdf-8e7ceed5833d",
            "bb766fee-5308-4ae0-8a00-dab2a76fc03c",
            "ab2b55c0-3cd2-4150-983f-cf9fd0f38ecb"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "b3b23dab-1178-4c65-8b9b-0f3b92ead040",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "e9a5ce37-77b8-40b1-bc39-87df859b2543",
          "name": "N-NICOTINOYLDOPAMINE",
          "stdName": "N-NICOTINOYLDOPAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "65ef883c-4c89-4f6f-8900-884e94999ac2",
            "bb766fee-5308-4ae0-8a00-dab2a76fc03c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ab2b55c0-3cd2-4150-983f-cf9fd0f38ecb",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "bb766fee-5308-4ae0-8a00-dab2a76fc03c",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "65ef883c-4c89-4f6f-8900-884e94999ac2",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "094a3cf5-3c1e-468d-8e38-952b7dfab480",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391546000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "08c66466-1ce6-485b-a29e-968feb4a01ad",
          "citation": "SRS import [X01340435H]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=X01340435H",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391546000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8f611730-2b65-431b-8bdf-8e7ceed5833d",
          "citation": "N-NICOTINOYL DOPAMINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7d718170-0750-0178-f29c-75c2b85d5757",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=84454-97-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "90b39cea-0d5e-4dc4-a758-26dbbbc10723",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ca7b0821-40ae-45d3-afa1-6b629c22375e",
          "id": "ca7b0821-40ae-45d3-afa1-6b629c22375e",
          "molfile": "\n  Marvin  01132110272D          \n\n 19 20  0  0  0  0            999 V2000\n   11.0660   -0.9442    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0696   -1.7691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3569   -2.1848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3606   -3.0097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0769   -3.4191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0805   -4.2441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3678   -4.6597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3715   -5.4847    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6589   -5.9003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6625   -6.7253    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9425   -5.4910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2299   -5.9067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5136   -5.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5100   -4.6723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2227   -4.2567    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9389   -4.6660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7895   -3.0035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7858   -2.1785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4985   -1.7629    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 18  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 17  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11  9  1  0  0  0  0\n 11 12  1  0  0  0  0\n 16 11  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  2  0  0  0  0\n 15 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\nM  END",
          "smiles": "c1cc(cnc1)C(=O)NCCc2ccc(c(c2)O)O",
          "formula": "C14H14N2O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6b629817-28ba-466a-9308-d2c70c130e0d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "258.2731",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1d9225b0-5629-446a-92c6-b244c056f5c9",
      "version": "4",
      "structure": {
        "id": "7c7ac9ef-ac43-4939-b722-bc54e4a92c8b",
        "molfile": "\n  Marvin  01132106282D          \n\n 19 20  0  0  0  0            999 V2000\n    8.2227   -4.2567    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9389   -4.6660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9425   -5.4910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2299   -5.9067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5136   -5.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5100   -4.6723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6589   -5.9003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6625   -6.7253    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3715   -5.4847    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3678   -4.6597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0805   -4.2441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0769   -3.4191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3606   -3.0097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3569   -2.1848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0696   -1.7691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7858   -2.1785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7895   -3.0035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0660   -0.9442    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4985   -1.7629    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  1  6  1  0  0  0  0\n  3  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 13 12  2  0  0  0  0\n 12 17  1  0  0  0  0\n 15 18  1  0  0  0  0\n 16 19  1  0  0  0  0\nM  END",
        "smiles": "c1cc(cnc1)C(=O)NCCc2ccc(c(c2)O)O",
        "formula": "C14H14N2O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "258.2731",
        "optical_activity": "NONE",
        "references": [
          "08c66466-1ce6-485b-a29e-968feb4a01ad",
          "65ef883c-4c89-4f6f-8900-884e94999ac2"
        ],
        "stereo_centers": 0
      },
      "unii": "X01340435H"
    }
  ]
}