{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "79cfadae-b4f9-47e8-8c0f-9d2b8c4d7178",
          "code": "84852-53-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=84852-53-9",
          "code_system": "CAS",
          "references": [
            "7a4214d7-6a9a-4652-b47a-f81535f5a845",
            "6bdd07a6-d8cf-48f8-bd81-c2b2f61022b5"
          ]
        },
        {
          "uuid": "e0e7f5d1-f45d-4504-a20b-40e51e07baf4",
          "code": "284-366-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.076.669",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7a4214d7-6a9a-4652-b47a-f81535f5a845"
          ]
        },
        {
          "uuid": "f0739371-867c-4979-9431-c630aa8138f2",
          "code": "10985889",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10985889",
          "code_system": "PUBCHEM",
          "references": [
            "7a4214d7-6a9a-4652-b47a-f81535f5a845"
          ]
        },
        {
          "uuid": "add48f80-bb1e-f784-ba92-a8bd481267d7",
          "code": "DTXSID2052732",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2052732",
          "code_system": "EPA CompTox",
          "references": [
            "6c0940e0-2f6a-2fbc-95ea-63f19b727687"
          ]
        },
        {
          "uuid": "f4924cba-3770-4762-831c-e86f8d9aa1a1",
          "code": "WZ2532TA0A",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5918a130-5ea4-64cc-50fb-dd816a07177a",
          "name": "1,1'-(1,2-ETHANEDIYL)BIS(2,3,4,5,6-PENTABROMOBENZENE)",
          "stdName": "1,1'-(1,2-ETHANEDIYL)BIS(2,3,4,5,6-PENTABROMOBENZENE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f9f1f6c-91af-6e18-45e2-8a7046580ba2"
          ],
          "display_name": false
        },
        {
          "uuid": "13c4158d-3c1c-e74e-ebc0-7b846cbd70ed",
          "name": "1,2-BIS(PENTABROMOPHENYL)ETHANE",
          "stdName": "1,2-BIS(PENTABROMOPHENYL)ETHANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f9f1f6c-91af-6e18-45e2-8a7046580ba2"
          ],
          "display_name": false
        },
        {
          "uuid": "57881fa4-58a0-b1f3-6579-5df7287765a1",
          "name": "BENZENE, 1,1'-(1,2-ETHANEDIYL)BIS(2,3,4,5,6-PENTABROMO-",
          "stdName": "BENZENE, 1,1'-(1,2-ETHANEDIYL)BIS(2,3,4,5,6-PENTABROMO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f9f1f6c-91af-6e18-45e2-8a7046580ba2"
          ],
          "display_name": false
        },
        {
          "uuid": "dc07312a-a64b-28da-132f-73cfe6331d04",
          "name": "BIS(PENTABROMOPHENYL)ETHANE",
          "stdName": "BIS(PENTABROMOPHENYL)ETHANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f9f1f6c-91af-6e18-45e2-8a7046580ba2"
          ],
          "display_name": false
        },
        {
          "uuid": "4cb997f9-7a17-4569-9084-eb9a9a7bd1ca",
          "name": "DECABROMODIPHENYL ETHANE",
          "stdName": "DECABROMODIPHENYL ETHANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "21d527ff-aa53-4be7-80f7-f6b0635868e7",
            "0b0a0f22-1895-43af-826e-e321e8939cbc"
          ],
          "display_name": false
        },
        {
          "uuid": "954c9fd1-88d7-6845-df4f-f6ac9ad31d94",
          "name": "DECABROMODIPHENYLETHANE",
          "stdName": "DECABROMODIPHENYLETHANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f9f1f6c-91af-6e18-45e2-8a7046580ba2"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "21d527ff-aa53-4be7-80f7-f6b0635868e7",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0b0a0f22-1895-43af-826e-e321e8939cbc",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7a4214d7-6a9a-4652-b47a-f81535f5a845",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392888000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5e22304b-2a65-4a69-bef9-8bc886d029fe",
          "citation": "CHEMID RECORD 84852-53-9",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6c0940e0-2f6a-2fbc-95ea-63f19b727687",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=84852-53-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0f9f1f6c-91af-6e18-45e2-8a7046580ba2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6bdd07a6-d8cf-48f8-bd81-c2b2f61022b5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e519af9d-3a3e-4ec4-9a31-1a1e666f0d05",
          "id": "e519af9d-3a3e-4ec4-9a31-1a1e666f0d05",
          "molfile": "\n  Marvin  01132111522D          \n\n 24 25  0  0  0  0            999 V2000\n   11.7458   -2.1542    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n   10.9208   -2.1500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5042   -2.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9125   -3.5792    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    9.6792   -2.8583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2625   -3.5708    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    9.2708   -2.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4458   -2.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0333   -1.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2083   -1.4333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8042   -2.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2292   -2.8625    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    5.9833   -2.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5792   -2.8833    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    5.5583   -1.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7333   -1.4667    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    5.9625   -0.7333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5375   -0.0250    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    6.7875   -0.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1875   -0.0042    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    9.6875   -1.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2792   -0.7125    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n   10.5125   -1.4333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9292   -0.7167    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n 23  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  3  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  7  1  0  0  0  0\n 21  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 19 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 11  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  1  0  0  0  0\n 16 15  1  0  0  0  0\n 15 17  2  0  0  0  0\n 18 17  1  0  0  0  0\n 17 19  1  0  0  0  0\n 20 19  1  0  0  0  0\n 22 21  1  0  0  0  0\n 21 23  1  0  0  0  0\n 24 23  1  0  0  0  0\nM  END",
          "smiles": "C(Cc1c(c(c(c(c1Br)Br)Br)Br)Br)c2c(c(c(c(c2Br)Br)Br)Br)Br",
          "formula": "C14H4Br10",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "93cb6dd7-e105-4226-b818-8448a3b61f87"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "971.2173",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "8df1fe78-08d3-4119-95a0-53b5232e5c00",
      "version": "6",
      "structure": {
        "id": "6db1e78b-d931-459f-bff8-54c51b2a316e",
        "molfile": "\n  Marvin  01132105422D          \n\n 24 25  0  0  0  0            999 V2000\n   10.9208   -2.1500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5583   -1.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2083   -1.4333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2708   -2.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5125   -1.4333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9833   -2.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5042   -2.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9625   -0.7333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6792   -2.8583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6875   -1.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8042   -2.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7875   -0.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4458   -2.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0333   -1.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7458   -2.1542    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    4.7333   -1.4667    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n   10.9125   -3.5792    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    5.5792   -2.8833    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n   10.9292   -0.7167    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    5.5375   -0.0250    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    7.2292   -2.8625    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    9.2792   -0.7125    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    7.1875   -0.0042    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    9.2625   -3.5708    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n  2  8  2  0  0  0  0\n  3 14  1  0  0  0  0\n  4  9  2  0  0  0  0\n  5  1  1  0  0  0  0\n  6 11  2  0  0  0  0\n  7  1  2  0  0  0  0\n  8 12  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  5  2  0  0  0  0\n 11  3  1  0  0  0  0\n 12  3  2  0  0  0  0\n 13  4  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15  1  1  0  0  0  0\n 16  2  1  0  0  0  0\n 17  7  1  0  0  0  0\n 18  6  1  0  0  0  0\n 19  5  1  0  0  0  0\n 20  8  1  0  0  0  0\n 21 11  1  0  0  0  0\n 22 10  1  0  0  0  0\n 23 12  1  0  0  0  0\n 24  9  1  0  0  0  0\n 10  4  1  0  0  0  0\n  2  6  1  0  0  0  0\nM  END",
        "smiles": "C(Cc1c(c(c(c(c1Br)Br)Br)Br)Br)c2c(c(c(c(c2Br)Br)Br)Br)Br",
        "formula": "C14H4Br10",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "971.2173",
        "optical_activity": "NONE",
        "references": [
          "5e22304b-2a65-4a69-bef9-8bc886d029fe",
          "0f9f1f6c-91af-6e18-45e2-8a7046580ba2"
        ],
        "stereo_centers": 0
      },
      "unii": "WZ2532TA0A"
    }
  ]
}