{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "25628e98-3bf2-4765-ab50-8c3cb0c7a40e", "code": "33581-77-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=33581-77-0", "code_system": "CAS", "references": [ "de6c1ccd-a160-4f4e-a2cc-ba629d66c108", "bca6534b-e1c2-4132-941e-918b0d0994b6" ] }, { "uuid": "27d2108c-7586-4a04-a689-7db8540de724", "code": "251-580-9", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.046.877", "code_system": "ECHA (EC/EINECS)", "references": [ "de6c1ccd-a160-4f4e-a2cc-ba629d66c108" ] }, { "uuid": "adfaadf1-06f0-41bc-bc5a-96ffd1a7eb88", "code": "118503", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/118503", "code_system": "PUBCHEM", "references": [ "de6c1ccd-a160-4f4e-a2cc-ba629d66c108" ] }, { "uuid": "74be1151-6b93-1747-7ded-fae44504b2cc", "code": "DTXSID50187279", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50187279", "code_system": "EPA CompTox", "references": [ "45d631cc-f505-2b28-6fb2-1c866784512f" ] }, { "uuid": "449a4656-2ca2-499b-a9a6-824e4ae5b8e3", "code": "WY41M9TKT0", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "15a17126-41d5-4860-ab2d-8b005c5046ad", "name": "TRIMETHYLSILYL ((TRIMETHYLSILYL)OXY)ACETATE", "stdName": "TRIMETHYLSILYL ((TRIMETHYLSILYL)OXY)ACETATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "20c20ee3-5c52-4437-8b44-8d7a3afbcf4d" ], "display_name": true } ], "references": [ { "uuid": "20c20ee3-5c52-4437-8b44-8d7a3afbcf4d", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "de6c1ccd-a160-4f4e-a2cc-ba629d66c108", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392180000, "tags": [ "NOMEN" ] }, { "uuid": "f279a218-f49f-4848-b9d7-80896b16a836", "citation": "SRS import [WY41M9TKT0]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=WY41M9TKT0", "doc_type": "SRS", "public_domain": true, "document_date": 1493392180000, "tags": [ "NOMEN" ] }, { "uuid": "45d631cc-f505-2b28-6fb2-1c866784512f", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=33581-77-0", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "bca6534b-e1c2-4132-941e-918b0d0994b6", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "caf3493a-1eaa-40d8-b712-141263db344c", "id": "caf3493a-1eaa-40d8-b712-141263db344c", "molfile": "\n Marvin 01132110292D \n\n 13 12 0 0 0 0 999 V2000\n 4.6347 -0.8945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8282 -1.3580 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8282 -2.1829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6347 -1.8261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0265 -0.8945 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5027 -1.1957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1319 -0.9872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1319 -0.1622 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6083 -1.2884 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8064 -0.8250 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.2884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8064 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -0.3615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 5 2 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 2 0 0 0 0\n 7 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 12 1 0 0 0 0\n 10 13 1 0 0 0 0\nM END", "smiles": "C[Si](C)(C)OCC(=O)O[Si](C)(C)C", "formula": "C8H20O3Si2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "9791577d-327b-4440-8eb2-4e33bedaddef" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "220.4137", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "8a20e7fc-143d-464b-a88b-a036892aeb66", "version": "3", "structure": { "id": "4becb0d0-8f90-4cbf-bbba-a170d06347bc", "molfile": "\n Marvin 01132103582D \n\n 13 12 0 0 0 0 999 V2000\n 2.1319 -0.9872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5027 -1.1957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6083 -1.2884 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1319 -0.1622 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0265 -0.8945 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8064 -0.8250 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8282 -1.3580 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.2884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8064 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -0.3615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6347 -0.8945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8282 -2.1829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6347 -1.8261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 1 0 0 0 0\n 1 4 2 0 0 0 0\n 2 5 1 0 0 0 0\n 3 6 1 0 0 0 0\n 5 7 1 0 0 0 0\n 6 8 1 0 0 0 0\n 6 9 1 0 0 0 0\n 6 10 1 0 0 0 0\n 7 11 1 0 0 0 0\n 7 12 1 0 0 0 0\n 7 13 1 0 0 0 0\nM END", "smiles": "C[Si](C)(C)OCC(=O)O[Si](C)(C)C", "formula": "C8H20O3Si2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "220.4137", "optical_activity": "NONE", "references": [ "f279a218-f49f-4848-b9d7-80896b16a836", "20c20ee3-5c52-4437-8b44-8d7a3afbcf4d" ], "stereo_centers": 0 }, "unii": "WY41M9TKT0" } ] }