{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "87b58f19-b02b-4c62-9808-6beaa96972b3",
          "code": "652-67-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=652-67-5",
          "code_system": "CAS",
          "references": [
            "bf410d1d-f8db-420b-b064-e0f9bd8a88ae",
            "f5c8142d-589e-4fe8-947d-6d83bff4882b"
          ]
        },
        {
          "uuid": "ed15edea-38e2-4bf8-a40f-7364c4d96fd1",
          "code": "C60773",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C60773",
          "code_system": "NCI_THESAURUS",
          "references": [
            "bf410d1d-f8db-420b-b064-e0f9bd8a88ae"
          ]
        },
        {
          "uuid": "9a5a7c21-77b6-4866-adf0-c9d025f25a9a",
          "code": "D007547",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68007547",
          "code_system": "MESH",
          "references": [
            "bf410d1d-f8db-420b-b064-e0f9bd8a88ae"
          ]
        },
        {
          "uuid": "4f581fe9-da26-4f0b-9704-818b95fed0f5",
          "code": "ISOSORBIDE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Isosorbide",
          "code_system": "WIKIPEDIA",
          "references": [
            "bf410d1d-f8db-420b-b064-e0f9bd8a88ae"
          ]
        },
        {
          "uuid": "dd0344b7-3a44-445d-8de5-369496e989be",
          "code": "6433",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=6433",
          "code_system": "INN",
          "references": [
            "bf410d1d-f8db-420b-b064-e0f9bd8a88ae"
          ]
        },
        {
          "uuid": "23036cb3-63a9-464d-9c88-64bf0094550d",
          "code": "6057",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/6057/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "bf410d1d-f8db-420b-b064-e0f9bd8a88ae"
          ]
        },
        {
          "uuid": "3f1888f6-5acf-481b-b6cb-c499fee6abaa",
          "code": "m6540",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6540?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "bf410d1d-f8db-420b-b064-e0f9bd8a88ae"
          ]
        },
        {
          "uuid": "d5ca6b3e-8834-4d46-96cb-18700a163e50",
          "code": "SUB08334MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "bf410d1d-f8db-420b-b064-e0f9bd8a88ae"
          ]
        },
        {
          "uuid": "2b996514-ddc0-4b2f-93e4-5a9c995ebf37",
          "code": "CHEMBL1200660",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1200660",
          "code_system": "ChEMBL",
          "references": [
            "bf410d1d-f8db-420b-b064-e0f9bd8a88ae"
          ]
        },
        {
          "uuid": "18701320-8709-40b6-b8b8-f0ecba6c2958",
          "code": "211-492-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.010.449",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "bf410d1d-f8db-420b-b064-e0f9bd8a88ae"
          ]
        },
        {
          "uuid": "ba2b9d28-d625-4a3f-a99e-148743812cac",
          "code": "12597",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/12597",
          "code_system": "PUBCHEM",
          "references": [
            "bf410d1d-f8db-420b-b064-e0f9bd8a88ae"
          ]
        },
        {
          "uuid": "896fbc5d-2c64-26d3-6257-c6a8f257b020",
          "code": "3105",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3105",
          "code_system": "HSDB",
          "references": [
            "8d249723-7ae3-9b84-053c-cb3f2942178d"
          ]
        },
        {
          "uuid": "4fa374d6-c45a-c236-12ca-700eff5bcf44",
          "code": "DTXSID5046196",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5046196",
          "code_system": "EPA CompTox",
          "references": [
            "a347ee3c-0f50-d309-6d95-0a93c45736a2"
          ]
        },
        {
          "uuid": "d1c5ce0a-e8df-4a9f-24b0-197dfd3a7cd5",
          "code": "C29707",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Cardiovascular System[C78274]|Vasodilating Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29707",
          "code_system": "NCI_THESAURUS",
          "references": [
            "3b4c2664-ddd8-0933-f244-f46c17c5e117"
          ]
        },
        {
          "uuid": "ff63b3f4-fb19-4e6f-bde4-b36ca7dfb6ac",
          "code": "WXR179L51S",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c8fe52ac-918b-b2c3-cf5a-a0ffcc8b8dc9",
          "code": "1501",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1501",
          "code_system": "DRUG CENTRAL",
          "references": [
            "3b4c2664-ddd8-0933-f244-f46c17c5e117"
          ]
        },
        {
          "uuid": "f253aa64-0cdb-594e-e4cf-690a2adfe680",
          "code": "DB09401",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB09401",
          "code_system": "DRUG BANK",
          "references": [
            "3b4c2664-ddd8-0933-f244-f46c17c5e117"
          ]
        },
        {
          "uuid": "24cdaa28-615c-b108-80dd-24fbbb28024e",
          "code": "1352008",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1352008",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "3b4c2664-ddd8-0933-f244-f46c17c5e117"
          ]
        },
        {
          "uuid": "859b75fa-c4be-d337-97ae-b9f1c20de619",
          "code": "40725",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=40725",
          "code_system": "NSC",
          "references": [
            "32334ab4-69eb-cba7-9447-4ed0502ed2a7"
          ]
        },
        {
          "uuid": "a31ae0fd-e0a9-677e-a3e7-2232cc926406",
          "code": "WXR179L51S",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=WXR179L51S",
          "code_system": "DAILYMED",
          "references": [
            "c52620f9-ab3c-8c41-485b-6708ae799f8d"
          ]
        },
        {
          "uuid": "ace41750-9041-edf7-fd02-9a9fc77de8cc",
          "code": "100000082855",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "2ffb5f1a-2767-30aa-ea78-fb2f4537e813"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "c53a7120-ddc1-47aa-9c69-409546b864a5",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "91f8214c-547a-4857-b227-d40d0f182a65",
            "refuuid": "27905126-d3b1-482f-bd14-1a7d460adef8",
            "name": "ISOSORBIDE",
            "unii": "WXR179L51S",
            "linking_id": "WXR179L51S",
            "ref_pname": "ISOSORBIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d90569c7-3074-4467-8c6b-ea3632d22b41",
          "name": "1,4:3,6-DIANHYDRO-D-GLUCITOL",
          "stdName": "1,4:3,6-DIANHYDRO-D-GLUCITOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3058f8d6-0f83-43dd-9b08-7ea3661b8d56"
          ],
          "display_name": false
        },
        {
          "uuid": "b4303b45-c532-4c56-8d1b-1715c647f078",
          "name": "AT-101",
          "stdName": "AT-101",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "51d5013c-b87e-457a-b9e6-cd2c25c08a11"
          ],
          "display_name": false
        },
        {
          "uuid": "e4725b63-773d-4f39-b7a4-c9b010e0524f",
          "name": "D-GLUCITOL, 1,4:3,6-DIANHYDRO-",
          "stdName": "D-GLUCITOL, 1,4:3,6-DIANHYDRO-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3058f8d6-0f83-43dd-9b08-7ea3661b8d56"
          ],
          "display_name": false
        },
        {
          "uuid": "4348144e-c5bd-4b12-95c9-9d88ec2ce804",
          "name": "ISMOTIC",
          "stdName": "ISMOTIC",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "51d5013c-b87e-457a-b9e6-cd2c25c08a11"
          ],
          "display_name": false
        },
        {
          "uuid": "3514186c-79d4-4c36-b436-a33c2f119946",
          "name": "ISOBIDE",
          "stdName": "ISOBIDE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cf8a5c15-e3af-46e8-8c9c-6d473b8b6992",
            "725973bd-92f9-40a3-8f4d-fb25032bcf05"
          ],
          "display_name": false
        },
        {
          "uuid": "3b54ccf2-7c02-432c-84f0-7413a5f906a7",
          "name": "ISOSORBIDE",
          "stdName": "ISOSORBIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fc257c6e-16a9-4856-8fdd-c2a62e893094",
            "67b4e12a-58e7-4232-b139-684d98fb76e1",
            "f1728ddc-4179-4a72-aecd-475a298537dd",
            "7655805d-de32-4887-a221-f1d0f43ae129",
            "699451e0-60a7-4353-81c6-0ec9d592e9c2",
            "d43bd0d8-47da-40a3-8b4d-d6f45a2df090",
            "2d5d5dcf-03d0-465e-bb71-cf0f242718dd",
            "e978c1d8-190a-4696-9027-fc0bb0ea06e2",
            "9c0a4bdf-e638-49a4-9286-f5196bf5ce7a",
            "3d3f2364-d1cd-450a-925b-d2ad2daa31d0",
            "e2380917-6662-4d86-ad6c-250587fb05d7",
            "0d470a45-ab0b-4c75-92cc-0d65780db64c",
            "fd8eed27-ec5d-48ba-bae2-207a0df5d794",
            "074c48ab-ce55-4905-90b4-ec6f9601b48b",
            "e386a78d-0ba9-4497-8b87-68e27cdf4c12",
            "ff16ea5f-f1cf-4e72-a04b-1322ccc19a4b",
            "1768df89-83be-4678-81fc-da884b305c1f",
            "e0d36d45-218c-48b9-a36d-8ba731924659",
            "87e1f06d-da9f-4026-9a0d-10878a5b0e29",
            "109fd993-beff-4680-a69b-6cba8383b3c4",
            "3058f8d6-0f83-43dd-9b08-7ea3661b8d56"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "1d386bbd-e8a7-4f13-aa5e-d433937c37a2",
              "name_org": "INN"
            },
            {
              "uuid": "5b1bd980-f8ff-40e5-ae3e-8c7f88726816",
              "name_org": "USAN"
            },
            {
              "uuid": "065869f9-64d1-478b-8a79-cedfc3b7faf9",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "532675e9-04c3-433c-9187-2eab72c38169",
          "name": "ISOSORBIDE [HSDB]",
          "stdName": "ISOSORBIDE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e386a78d-0ba9-4497-8b87-68e27cdf4c12"
          ],
          "display_name": false
        },
        {
          "uuid": "5fd5f147-cb4a-4a88-be6e-8bd7fdd9b3d2",
          "name": "ISOSORBIDE [JAN]",
          "stdName": "ISOSORBIDE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4e005036-5f9c-793a-a17e-dc05259cbf6d"
          ],
          "display_name": false
        },
        {
          "uuid": "dd04d674-b6d5-4dde-ae62-e5a73bf2c6f3",
          "name": "ISOSORBIDE [MART.]",
          "stdName": "ISOSORBIDE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "074c48ab-ce55-4905-90b4-ec6f9601b48b"
          ],
          "display_name": false
        },
        {
          "uuid": "75a8b4db-f774-432d-bc58-00774fc45a00",
          "name": "ISOSORBIDE [MI]",
          "stdName": "ISOSORBIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "87e1f06d-da9f-4026-9a0d-10878a5b0e29"
          ],
          "display_name": false
        },
        {
          "uuid": "6b78cddc-d252-4070-96a1-4b0f9d4efad4",
          "name": "ISOSORBIDE [ORANGE BOOK]",
          "stdName": "ISOSORBIDE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d43bd0d8-47da-40a3-8b4d-d6f45a2df090"
          ],
          "display_name": false
        },
        {
          "uuid": "de1e70dd-2746-4ae1-84cf-c12372eaaa6e",
          "name": "ISOSORBIDE [USAN]",
          "stdName": "ISOSORBIDE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0d470a45-ab0b-4c75-92cc-0d65780db64c"
          ],
          "display_name": false
        },
        {
          "uuid": "db2bb923-8659-882e-d8e4-918f05056879",
          "name": "ISOSORBIDE [USP IMPURITY]",
          "stdName": "ISOSORBIDE [USP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1728ddc-4179-4a72-aecd-475a298537dd"
          ],
          "display_name": false
        },
        {
          "uuid": "540e087c-dbfa-486e-93b1-f72f417db3b6",
          "name": "ISOSORBIDE [USP-RS]",
          "stdName": "ISOSORBIDE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "109fd993-beff-4680-a69b-6cba8383b3c4"
          ],
          "display_name": false
        },
        {
          "uuid": "0f38db77-3ffb-4e11-869c-ad51e7888600",
          "name": "ISOSORBIDE [VANDF]",
          "stdName": "ISOSORBIDE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fd8eed27-ec5d-48ba-bae2-207a0df5d794"
          ],
          "display_name": false
        },
        {
          "uuid": "ff6f95ad-cc35-f5e9-8a33-e44e45c9d1b3",
          "name": "Isosorbide [WHO-DD]",
          "stdName": "ISOSORBIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "88e57008-85c2-dca5-b5b6-47153aa94fb2"
          ],
          "display_name": false
        },
        {
          "uuid": "7d670f2c-27ab-42df-a56e-646f964a5668",
          "name": "NSC-40725",
          "stdName": "NSC-40725",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "51d5013c-b87e-457a-b9e6-cd2c25c08a11"
          ],
          "display_name": false
        },
        {
          "uuid": "d4d48e46-a502-4157-b67e-e4340fe30876",
          "name": "isosorbide [INN]",
          "stdName": "ISOSORBIDE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67b4e12a-58e7-4232-b139-684d98fb76e1"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f1728ddc-4179-4a72-aecd-475a298537dd",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d43bd0d8-47da-40a3-8b4d-d6f45a2df090",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "074c48ab-ce55-4905-90b4-ec6f9601b48b",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "87e1f06d-da9f-4026-9a0d-10878a5b0e29",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "725973bd-92f9-40a3-8f4d-fb25032bcf05",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf8a5c15-e3af-46e8-8c9c-6d473b8b6992",
          "citation": "D00347",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e386a78d-0ba9-4497-8b87-68e27cdf4c12",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "109fd993-beff-4680-a69b-6cba8383b3c4",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e978c1d8-190a-4696-9027-fc0bb0ea06e2",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fd8eed27-ec5d-48ba-bae2-207a0df5d794",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf410d1d-f8db-420b-b064-e0f9bd8a88ae",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389711000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c165c72b-cdc4-4a9a-a938-67a75afb0c8e",
          "citation": "SRS import [WXR179L51S]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=WXR179L51S",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389711000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7655805d-de32-4887-a221-f1d0f43ae129",
          "citation": "ISOSORBIDE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ff16ea5f-f1cf-4e72-a04b-1322ccc19a4b",
          "citation": "ISOSORBIDE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e0d36d45-218c-48b9-a36d-8ba731924659",
          "citation": "ISOSORBIDE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fc257c6e-16a9-4856-8fdd-c2a62e893094",
          "citation": "ISOSORBIDE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "699451e0-60a7-4353-81c6-0ec9d592e9c2",
          "citation": "ISOSORBIDE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e2380917-6662-4d86-ad6c-250587fb05d7",
          "citation": "ISOSORBIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2d5d5dcf-03d0-465e-bb71-cf0f242718dd",
          "citation": "ISOSORBIDE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1768df89-83be-4678-81fc-da884b305c1f",
          "citation": "ISOSORBIDE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9c0a4bdf-e638-49a4-9286-f5196bf5ce7a",
          "citation": "ISOSORBIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3d3f2364-d1cd-450a-925b-d2ad2daa31d0",
          "citation": "ISOSORBIDE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3058f8d6-0f83-43dd-9b08-7ea3661b8d56",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "51d5013c-b87e-457a-b9e6-cd2c25c08a11",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "67b4e12a-58e7-4232-b139-684d98fb76e1",
          "citation": "INN Proposed List 61",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL61.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0d470a45-ab0b-4c75-92cc-0d65780db64c",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4e005036-5f9c-793a-a17e-dc05259cbf6d",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8d249723-7ae3-9b84-053c-cb3f2942178d",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+652-67-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a347ee3c-0f50-d309-6d95-0a93c45736a2",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=652-67-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3b4c2664-ddd8-0933-f244-f46c17c5e117",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "f5c8142d-589e-4fe8-947d-6d83bff4882b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f135add6-97d9-3d9d-1455-9a4ebe2831bf",
          "citation": "PCPC",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true
        },
        {
          "uuid": "32334ab4-69eb-cba7-9447-4ed0502ed2a7",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "c52620f9-ab3c-8c41-485b-6708ae799f8d",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "88e57008-85c2-dca5-b5b6-47153aa94fb2",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "2ffb5f1a-2767-30aa-ea78-fb2f4537e813",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7e35eaa8-f970-43b2-9a2d-ece841961b3f",
          "id": "7e35eaa8-f970-43b2-9a2d-ece841961b3f",
          "molfile": "\n  Marvin  01132106332D          \n\n 10 11  0  0  1  0            999 V2000\n   -0.6156   -0.3168    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    0.0644    0.1546    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6542   -1.1385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4423   -1.3703    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9059   -0.6954    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   -2.6787   -0.3941    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   -3.3355   -0.8500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6401    0.4327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8519    0.6388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3883   -0.0386    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n 10  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  6  0  0  0\n  6  5  1  0  0  0  0\n  5 10  1  0  0  0  0\n  6  7  1  6  0  0  0\n  6  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  6  0  0  0\nM  END",
          "smiles": "C1[C@H]([C@@H]2[C@@H]([C@H](CO2)O)O1)O",
          "formula": "C6H10O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "838c3db4-17c3-44f7-b6f6-ca22d0b0e1a7"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "146.1414",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "27905126-d3b1-482f-bd14-1a7d460adef8",
      "version": "22",
      "structure": {
        "id": "0782dcf4-f811-4eb3-a7b6-fbb3e3df96e9",
        "molfile": "\n  Marvin  01132100402D          \n\n 12 13  0  0  1  0            999 V2000\n   -1.9001   -0.6933    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -1.3840   -0.0385    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -1.4379   -1.3661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8462    0.6368    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6137   -0.3158    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -2.6705   -0.3929    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -2.6320    0.4314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6522   -1.1350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0642    0.1541    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3253   -0.8474    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7934    0.5521    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4882   -1.2814    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  3  1  0  0  0  0\n  5  9  1  1  0  0  0\n  6 10  1  6  0  0  0\n  2 11  1  1  0  0  0\n  1 12  1  1  0  0  0\n  4  7  1  0  0  0  0\n  5  8  1  0  0  0  0\nM  END",
        "smiles": "C1[C@H]([C@]2([H])[C@@]([H])([C@H](CO2)O)O1)O",
        "formula": "C6H10O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "146.1414",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "3058f8d6-0f83-43dd-9b08-7ea3661b8d56",
          "c165c72b-cdc4-4a9a-a938-67a75afb0c8e",
          "67b4e12a-58e7-4232-b139-684d98fb76e1"
        ],
        "stereo_centers": 4
      },
      "unii": "WXR179L51S"
    }
  ]
}