{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "810a7189-67db-48a6-b70e-fb68803e0146",
          "code": "A08AA10",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|ANTIOBESITY PREPARATIONS, EXCL. DIET PRODUCTS|ANTIOBESITY PREPARATIONS, EXCL. DIET PRODUCTS|Centrally acting antiobesity products|sibutramine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A08AA10&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "e90eaa3f-dcba-484e-9cd8-e9bc2df1ac61"
          ]
        },
        {
          "uuid": "9cfb68cc-b39c-4ed3-afea-00110783d9e9",
          "code": "N0000175424",
          "comments": "Established Pharmacologic Class [EPC]|Norepinephrine, Serotonin, and Dopamine Reuptake Inhibitor Anorectic [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175424",
          "code_system": "NDF-RT",
          "references": [
            "e90eaa3f-dcba-484e-9cd8-e9bc2df1ac61"
          ]
        },
        {
          "uuid": "ce3a955a-bbf5-49d3-acc7-508482e08ae2",
          "code": "N0000000102",
          "comments": "Cellular or Molecular Interactions [MoA]|Receptor Interactions [MoA]|Active Transporter Interactions [MoA]|Neurotransmitter Transporter Interactions [MoA]|Norepinephrine Transporter Interactions [MoA]|Norepinephrine Uptake Inhibitors [MoA]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000000102",
          "code_system": "NDF-RT",
          "references": [
            "e90eaa3f-dcba-484e-9cd8-e9bc2df1ac61"
          ]
        },
        {
          "uuid": "d4ba9528-378e-4b3a-b752-1fa99088682c",
          "code": "N0000000114",
          "comments": "Cellular or Molecular Interactions [MoA]|Receptor Interactions [MoA]|Active Transporter Interactions [MoA]|Neurotransmitter Transporter Interactions [MoA]|Dopamine Transporter Interactions [MoA]|Dopamine Uptake Inhibitors [MoA]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000000114",
          "code_system": "NDF-RT",
          "references": [
            "e90eaa3f-dcba-484e-9cd8-e9bc2df1ac61"
          ]
        },
        {
          "uuid": "db83c2d5-58b9-460c-a343-70800e71516a",
          "code": "N0000000109",
          "comments": "Cellular or Molecular Interactions [MoA]|Receptor Interactions [MoA]|Active Transporter Interactions [MoA]|Neurotransmitter Transporter Interactions [MoA]|Serotonin Transporter Interactions [MoA]|Serotonin Uptake Inhibitors [MoA]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000000109",
          "code_system": "NDF-RT",
          "references": [
            "e90eaa3f-dcba-484e-9cd8-e9bc2df1ac61"
          ]
        },
        {
          "uuid": "2e914d9f-2477-4f6d-927a-98e681ee0b68",
          "code": "N0000175372",
          "comments": "Physiological Effects [PE]|Generalized Systemic Effects [PE]|Appetite Alteration [PE]|Appetite Suppression [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175372",
          "code_system": "NDF-RT",
          "references": [
            "e90eaa3f-dcba-484e-9cd8-e9bc2df1ac61"
          ]
        },
        {
          "uuid": "1c4769d8-3c7b-4f36-b100-4678d5700dde",
          "code": "N0000175372",
          "comments": "Physiological Effects [PE]|Organ System Specific Effects [PE]|Nervous System Activity Alteration [PE]|Central Nervous System Activity Alteration [PE]|Central Nervous System Depression [PE]|Appetite Suppression [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175372",
          "code_system": "NDF-RT",
          "references": [
            "e90eaa3f-dcba-484e-9cd8-e9bc2df1ac61"
          ]
        },
        {
          "uuid": "ce1909cc-0af5-4acb-bcbd-99d858c3778e",
          "code": "QA08AA10",
          "comments": "VATC|ANTIOBESITY PREPARATIONS, EXCL. DIET PRODUCTS|ANTIOBESITY PREPARATIONS, EXCL. DIET PRODUCTS|Centrally acting antiobesity products|sibutramine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA08AA10&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "e90eaa3f-dcba-484e-9cd8-e9bc2df1ac61"
          ]
        },
        {
          "uuid": "d5174626-6c07-461b-b09f-3c021d6e7062",
          "code": "106650-56-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=106650-56-0",
          "code_system": "CAS",
          "references": [
            "e90eaa3f-dcba-484e-9cd8-e9bc2df1ac61",
            "531c7ab1-71e6-498f-9a65-5e32ca1becdf"
          ]
        },
        {
          "uuid": "b08582ae-be60-4eea-ad3d-9b8ef8b0c3da",
          "code": "C75965",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C75965",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e90eaa3f-dcba-484e-9cd8-e9bc2df1ac61"
          ]
        },
        {
          "uuid": "c4225c1f-becd-4c65-85e9-99bc9da70706",
          "code": "C058254",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67058254",
          "code_system": "MESH",
          "references": [
            "e90eaa3f-dcba-484e-9cd8-e9bc2df1ac61"
          ]
        },
        {
          "uuid": "ffb5d48f-f922-4c62-b317-97d95352ee90",
          "code": "NBK548248",
          "comments": "LiverTox|Weight loss agent|Obesity|SNRI",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK548248/",
          "code_system": "LIVERTOX",
          "references": [
            "13fc099a-dcd1-ec95-1a60-99c6ab1aedd4"
          ]
        },
        {
          "uuid": "26a0cfd4-a7c7-452e-867a-86d1c56513d8",
          "code": "SIBUTRAMINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Sibutramine",
          "code_system": "WIKIPEDIA",
          "references": [
            "e90eaa3f-dcba-484e-9cd8-e9bc2df1ac61"
          ]
        },
        {
          "uuid": "a32fdae0-efb9-4889-ba51-115efd2f9ee3",
          "code": "6124",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=6124",
          "code_system": "INN",
          "references": [
            "e90eaa3f-dcba-484e-9cd8-e9bc2df1ac61"
          ]
        },
        {
          "uuid": "c4498941-25eb-490d-8234-70f40a4b1811",
          "code": "1675",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule IV.|Stimulants",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "e90eaa3f-dcba-484e-9cd8-e9bc2df1ac61"
          ]
        },
        {
          "uuid": "5d93bc02-7162-457c-95a6-5a49c86c0294",
          "code": "2586",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=2586",
          "code_system": "IUPHAR",
          "references": [
            "e90eaa3f-dcba-484e-9cd8-e9bc2df1ac61"
          ]
        },
        {
          "uuid": "1db9abe3-91a4-4dd1-8411-95df83f91881",
          "code": "36514",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/36514/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "e90eaa3f-dcba-484e-9cd8-e9bc2df1ac61"
          ]
        },
        {
          "uuid": "fde20630-cbac-4144-8bd4-5dd8a69ffb2e",
          "code": "m9894",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9894?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "e90eaa3f-dcba-484e-9cd8-e9bc2df1ac61"
          ]
        },
        {
          "uuid": "810daad6-67c7-4cc8-b926-71f77a23d158",
          "code": "DB01105",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01105",
          "code_system": "DRUG BANK",
          "references": [
            "e90eaa3f-dcba-484e-9cd8-e9bc2df1ac61"
          ]
        },
        {
          "uuid": "79de108b-1444-455b-98a1-c9421557b9a3",
          "code": "SUB10512MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "e90eaa3f-dcba-484e-9cd8-e9bc2df1ac61"
          ]
        },
        {
          "uuid": "24fb70bd-d94a-41b7-a777-f54a357f44ca",
          "code": "CHEMBL1419",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1419",
          "code_system": "ChEMBL",
          "references": [
            "e90eaa3f-dcba-484e-9cd8-e9bc2df1ac61"
          ]
        },
        {
          "uuid": "63670b6e-00a6-4995-b85e-5c01e26e463c",
          "code": "5210",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5210",
          "code_system": "PUBCHEM",
          "references": [
            "e90eaa3f-dcba-484e-9cd8-e9bc2df1ac61"
          ]
        },
        {
          "uuid": "f546627b-8aae-c066-7b02-b5985705ce91",
          "code": "7209",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7209",
          "code_system": "HSDB",
          "references": [
            "5d15773e-27fc-fbab-b542-fc14dc123630"
          ]
        },
        {
          "uuid": "ed75e23e-d6a6-15f0-b92a-f05cdb14cc2d",
          "code": "DTXSID1023578",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1023578",
          "code_system": "EPA CompTox",
          "references": [
            "df81f56e-89d1-479c-b6c6-5a0dcfa3291a"
          ]
        },
        {
          "uuid": "eb12e325-17c9-332c-24de-abf615331f5c",
          "code": "Sibutramine",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM1000/",
          "code_system": "LACTMED",
          "references": [
            "13fc099a-dcd1-ec95-1a60-99c6ab1aedd4"
          ]
        },
        {
          "uuid": "f335d770-595d-1fed-fff8-38eeb3717db6",
          "code": "C29728",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Anorexiant",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29728",
          "code_system": "NCI_THESAURUS",
          "references": [
            "13fc099a-dcd1-ec95-1a60-99c6ab1aedd4"
          ]
        },
        {
          "uuid": "5e53c5ad-ffeb-4deb-af15-9fbcf8de915a",
          "code": "WV5EC51866",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "cf82fb59-b360-e4dd-d876-4f71861ab565",
          "code": "2440",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2440",
          "code_system": "DRUG CENTRAL",
          "references": [
            "13fc099a-dcd1-ec95-1a60-99c6ab1aedd4"
          ]
        },
        {
          "uuid": "6c9ea6d0-9df0-3128-ebd2-1ed94b2fb8a7",
          "code": "100000084327",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "5cce63cc-2206-dbc5-83d3-8e7a2952b145"
          ]
        },
        {
          "uuid": "f4cbc516-7770-d753-455c-f10c97d3589a",
          "code": "21 CFR 216.24",
          "comments": "PART 216 -- HUMAN DRUG COMPOUNDING|Subpart B--Compounded Drug Products|Sec. 216.24 Drug products withdrawn or removed from the market for reasons of safety or effectiveness.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=216.24",
          "code_system": "CFR",
          "references": [
            "ec2bd85f-e249-d4a1-abe4-8c3dabfea958"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "a5a46a93-c859-45ee-84cc-0e76699f2aa4",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "94e92116-97e3-4ed3-b262-757fc94de644",
            "refuuid": "b361f2c5-d6ec-473d-a483-e92d7bc322b6",
            "name": "SIBUTRAMINE",
            "unii": "WV5EC51866",
            "linking_id": "WV5EC51866",
            "ref_pname": "SIBUTRAMINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "48ffeaf1-1b0f-4b8f-ba5d-8f0021ce54a5",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "314310fa-90e0-42b6-97ba-1c433a455d10",
            "refuuid": "c940354a-a4c6-4f89-9031-7cd092368c1c",
            "name": "SIBUTRAMINE HYDROCHLORIDE",
            "unii": "OGM0YHD1WF",
            "linking_id": "OGM0YHD1WF",
            "ref_pname": "SIBUTRAMINE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ead2e0b9-853f-4787-9dbe-488909ab3534",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "dcbfc69f-fb30-41b6-a655-5087f1a2c72c",
            "refuuid": "553f9d94-77db-4bff-8aab-59db090173b4",
            "name": "SIBUTRAMINE HYDROCHLORIDE ANHYDROUS",
            "unii": "9GG866ZP1E",
            "linking_id": "9GG866ZP1E",
            "ref_pname": "SIBUTRAMINE HYDROCHLORIDE ANHYDROUS",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8073d4c1-a100-4a9b-a0ce-e189d74c32b5",
          "type": "METABOLITE ACTIVE->PARENT",
          "references": [
            "47e0bcd8-63bf-4913-8748-cf5684005735"
          ],
          "related_substance": {
            "uuid": "1cfee4fe-a7e5-45b9-ae58-38ca25e402c2",
            "refuuid": "ea1b257a-a969-42da-827a-d597ab182432",
            "name": "DIDESMETHYLSIBUTRAMINE",
            "unii": "987R943R3P",
            "linking_id": "987R943R3P",
            "ref_pname": "DIDESMETHYLSIBUTRAMINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7bdfeff6-fdb9-424b-959b-71c479be4656",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "7fd5e204-86df-4e27-9964-923074a6ccde",
            "refuuid": "d3dba474-cb5f-43df-b859-b0c37bafcadc",
            "name": "SIBUTRAMINE, (S)-",
            "unii": "WFW97V6HV0",
            "linking_id": "WFW97V6HV0",
            "ref_pname": "SIBUTRAMINE, (S)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "338eeca9-539d-426d-ba8e-122b00e00476",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "c085eb0c-3ef0-462e-a072-cca3e42b3fea",
            "refuuid": "03aff533-1dc8-46cd-9375-5469e51747dd",
            "name": "SIBUTRAMINE, (R)-",
            "unii": "2K5E83H3LL",
            "linking_id": "2K5E83H3LL",
            "ref_pname": "SIBUTRAMINE, (R)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b4426ee4-ab3b-4faf-8ed8-afb335f28e28",
          "type": "METABOLITE->PARENT",
          "related_substance": {
            "uuid": "b16ae3ed-8ae3-4df4-b7db-e758bfaf6012",
            "refuuid": "6403cdc6-f015-4e0d-a246-178ab7d07073",
            "name": "DESMETHYLSIBUTRAMINE",
            "unii": "889I657R9P",
            "linking_id": "889I657R9P",
            "ref_pname": "DESMETHYLSIBUTRAMINE"
          }
        },
        {
          "uuid": "a04f06e3-a4ff-40ff-b030-7c6f76250cb9",
          "amount": {
            "uuid": "672a5620-9095-485c-b251-1cac41838ddd",
            "average": 97,
            "units": "%"
          },
          "type": "BINDER->LIGAND",
          "references": [
            "5a5ad429-ab54-3ee8-7352-efb6b57aed80"
          ],
          "related_substance": {
            "uuid": "697189d7-133b-4d8a-a9b4-7e30b7cb9e02",
            "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30",
            "name": "PLASMA PROTEIN FRACTION (HUMAN)",
            "unii": "6D53G0FD0Z",
            "linking_id": "6D53G0FD0Z",
            "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "136362f6-06ad-4a2a-89f8-89eaca0a0002",
          "amount": {
            "uuid": "aae1c80a-4571-4b5f-a4d6-e322117813fd"
          },
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "303b589c-aa14-4a53-910a-eb5c3984d54c"
          ],
          "related_substance": {
            "uuid": "0b61b824-e01d-4ecf-b7f4-72709227dc62",
            "refuuid": "548e8cc6-ab17-4cc7-baae-59c67d20d36a",
            "name": "SIBUTRAMINE MESYLATE",
            "unii": "NTF6Z4MEY2",
            "linking_id": "NTF6Z4MEY2",
            "ref_pname": "SIBUTRAMINE MESYLATE"
          }
        },
        {
          "uuid": "0db17e62-6b6b-4091-93b3-c66058e1514b",
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "925da517-109a-4efd-a4bb-13c36b915545"
          ],
          "related_substance": {
            "uuid": "f68610c2-dd47-4dbd-8086-8030755ae83c",
            "refuuid": "c594356a-426c-644d-7e13-fa366f17a521",
            "name": "SIBUTRAMINE MALEATE",
            "unii": "FL7VAZ52GY",
            "linking_id": "FL7VAZ52GY",
            "ref_pname": "SIBUTRAMINE MALEATE"
          }
        },
        {
          "uuid": "2ab1af6f-d89e-46f5-a9b5-210c25a30c8f",
          "amount": {
            "uuid": "7171e92f-eb00-4c3d-b96b-2efd1d977d1c"
          },
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "0eddc423-4b27-42e4-ab2f-afe0be7aaec3"
          ],
          "related_substance": {
            "uuid": "1df5fd27-e818-43c7-a54e-dd0955949710",
            "refuuid": "8715bedb-0fce-4b61-bcb7-3c469912a2c7",
            "name": "SIBUTRAMINE MESYLATE HEMIHYDRATE",
            "unii": "F3BM7G49ET",
            "linking_id": "F3BM7G49ET",
            "ref_pname": "SIBUTRAMINE MESYLATE HEMIHYDRATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "30384f3c-5a28-40bf-be9f-aa8a8d4fc342",
          "name": "(±)-1-(P-CHLOROPHENYL)-.ALPHA.-ISOBUTYL-N,N-DIMETHYLCYCLOBUTANEMETHYLAMINE",
          "stdName": "(+/-)-1-(P-CHLOROPHENYL)-.ALPHA.-ISOBUTYL-N,N-DIMETHYLCYCLOBUTANEMETHYLAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8c2ae698-2f00-4174-9e2c-af04b7dfa57f"
          ],
          "display_name": false
        },
        {
          "uuid": "28d51b17-706d-4340-891f-18c221b9decc",
          "name": "(±)-SIBUTRAMINE",
          "stdName": "(+/-)-SIBUTRAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6c892c8-8c9d-4253-aeae-6e97efabb139",
            "9074818d-772e-41d4-8ce3-daecef02f99b"
          ],
          "display_name": false
        },
        {
          "uuid": "898133f1-b656-444e-8d81-0013f8589c19",
          "name": "1-(4-CHLOROPHENYL)-N,N-DIMETHYL-.ALPHA.-(2-METHYLPROPYL)CYCLOBUTANEMETHANAMINE",
          "stdName": "1-(4-CHLOROPHENYL)-N,N-DIMETHYL-.ALPHA.-(2-METHYLPROPYL)CYCLOBUTANEMETHANAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6c892c8-8c9d-4253-aeae-6e97efabb139",
            "9074818d-772e-41d4-8ce3-daecef02f99b"
          ],
          "display_name": false
        },
        {
          "uuid": "72e738ae-d9ad-4eb2-8b15-a8d58854f5a8",
          "name": "BUTRAMIN",
          "stdName": "BUTRAMIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee34472c-53f6-41c3-a1b1-d5aded4b50d6",
            "e8d3f86e-d11d-44a9-a4da-efeed874a1b3"
          ],
          "display_name": false
        },
        {
          "uuid": "ad168b6a-e98d-4246-8124-c4a94658e265",
          "name": "CF-ALLI",
          "stdName": "CF-ALLI",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6c892c8-8c9d-4253-aeae-6e97efabb139",
            "9074818d-772e-41d4-8ce3-daecef02f99b"
          ],
          "display_name": false
        },
        {
          "uuid": "874d2bce-e371-460e-b6cb-4478921df41c",
          "name": "CYCLOBUTANEMETHANAMINE, 1-(4-CHLOROPHENYL)-N,N-DIMETHYL-.ALPHA.-(2-METHYLPROPYL)-",
          "stdName": "CYCLOBUTANEMETHANAMINE, 1-(4-CHLOROPHENYL)-N,N-DIMETHYL-.ALPHA.-(2-METHYLPROPYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6c892c8-8c9d-4253-aeae-6e97efabb139",
            "9074818d-772e-41d4-8ce3-daecef02f99b"
          ],
          "display_name": false
        },
        {
          "uuid": "a75b5daf-65d0-4411-ab60-5ba4d556d58c",
          "name": "MEDARIA",
          "stdName": "MEDARIA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6c892c8-8c9d-4253-aeae-6e97efabb139",
            "9074818d-772e-41d4-8ce3-daecef02f99b"
          ],
          "display_name": false
        },
        {
          "uuid": "64f2d625-1808-4376-ac3b-871166137b03",
          "name": "RACEMIC SIBUTRAMINE",
          "stdName": "RACEMIC SIBUTRAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6c892c8-8c9d-4253-aeae-6e97efabb139",
            "9074818d-772e-41d4-8ce3-daecef02f99b"
          ],
          "display_name": false
        },
        {
          "uuid": "74839b63-c4c8-404b-b65c-af7f8eb80bd3",
          "name": "SIBUTRAMINE",
          "stdName": "SIBUTRAMINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9074818d-772e-41d4-8ce3-daecef02f99b",
            "8739b7df-a12c-4217-b4b5-86d6e0d6cc7c",
            "0788385b-d6ca-4c79-9d84-26ac31055ca4",
            "62036250-066d-494c-bce9-a24bf07255c4",
            "127e8be1-b4be-4ce6-8254-57443cdf5612",
            "c587afff-f61e-49e0-967e-67cc97131694",
            "2b08d82f-a38e-4273-954d-c9e9cc48bdf9",
            "37551ad6-ad43-417b-bc80-f5514141dfb2",
            "0a3425bc-453f-4f17-b1e7-23364f1a9341",
            "48646dc2-005e-497c-8623-3c9658b44821"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "26a68feb-dee1-46c2-b663-88b893712e4e",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "282ac6b5-2da6-48b1-a218-457e98a20173",
          "name": "SIBUTRAMINE [MI]",
          "stdName": "SIBUTRAMINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9074818d-772e-41d4-8ce3-daecef02f99b",
            "48646dc2-005e-497c-8623-3c9658b44821"
          ],
          "display_name": false
        },
        {
          "uuid": "bc01bfe9-8714-44d3-96ed-982b3eb3aa89",
          "name": "SIBUTRAMINE [VANDF]",
          "stdName": "SIBUTRAMINE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9074818d-772e-41d4-8ce3-daecef02f99b",
            "37551ad6-ad43-417b-bc80-f5514141dfb2"
          ],
          "display_name": false
        },
        {
          "uuid": "82cae0fc-4c44-9a92-3aaa-92b7d0e5d7d9",
          "name": "Sibutramine [WHO-DD]",
          "stdName": "SIBUTRAMINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ff8910e-78ca-587b-346f-ad5a2402ac3f"
          ],
          "display_name": false
        },
        {
          "uuid": "70ee1892-5edf-4fa6-a213-62e54e7c02df",
          "name": "sibutramine [INN]",
          "stdName": "SIBUTRAMINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c587afff-f61e-49e0-967e-67cc97131694"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "127e8be1-b4be-4ce6-8254-57443cdf5612",
          "citation": "USP Dictionary 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8c2ae698-2f00-4174-9e2c-af04b7dfa57f",
          "citation": "USP DICTIONARY 2014",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c587afff-f61e-49e0-967e-67cc97131694",
          "citation": "INN Proposed List 57",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL57.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "48646dc2-005e-497c-8623-3c9658b44821",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9074818d-772e-41d4-8ce3-daecef02f99b",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ee34472c-53f6-41c3-a1b1-d5aded4b50d6",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e8d3f86e-d11d-44a9-a4da-efeed874a1b3",
          "citation": "D08513",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "62036250-066d-494c-bce9-a24bf07255c4",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "37551ad6-ad43-417b-bc80-f5514141dfb2",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f6c892c8-8c9d-4253-aeae-6e97efabb139",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e90eaa3f-dcba-484e-9cd8-e9bc2df1ac61",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390007000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0268f6e3-21bc-42cf-82d6-40a49b306b02",
          "citation": "SRS import [WV5EC51866]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=WV5EC51866",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390007000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d1113f6a-4a5c-44eb-a302-cf6d8c0d4699",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0a3425bc-453f-4f17-b1e7-23364f1a9341",
          "citation": "SIBUTRAMINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0788385b-d6ca-4c79-9d84-26ac31055ca4",
          "citation": "SIBUTRAMINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8739b7df-a12c-4217-b4b5-86d6e0d6cc7c",
          "citation": "SIBUTRAMINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2b08d82f-a38e-4273-954d-c9e9cc48bdf9",
          "citation": "SIBUTRAMINE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5a5ad429-ab54-3ee8-7352-efb6b57aed80",
          "citation": "Pharmacol Rev 65:578–640, April 2013",
          "url": "http://dx.doi.org/10.1124/pr.111.005439",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "5d15773e-27fc-fbab-b542-fc14dc123630",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+106650-56-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "df81f56e-89d1-479c-b6c6-5a0dcfa3291a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=106650-56-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1a87c4f9-d55e-5528-facb-28dd5242a614",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+106650-56-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "13fc099a-dcd1-ec95-1a60-99c6ab1aedd4",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "531c7ab1-71e6-498f-9a65-5e32ca1becdf",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "de098488-fd33-4663-aa48-008611e209b7",
          "citation": "WHO-SDG",
          "doc_type": "WHO-SDG",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "925da517-109a-4efd-a4bb-13c36b915545",
          "citation": "WHO-SDG",
          "doc_type": "WHO-SDG",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "47e0bcd8-63bf-4913-8748-cf5684005735",
          "citation": "Br J Pharmacol 1994 Jan;111(1):97-102",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "303b589c-aa14-4a53-910a-eb5c3984d54c",
          "citation": "WHO-SDG",
          "doc_type": "WHO-SDG",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "aeed257f-cc2c-04b1-222a-ceb38f0dd7a1",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "7ff8910e-78ca-587b-346f-ad5a2402ac3f",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "5cce63cc-2206-dbc5-83d3-8e7a2952b145",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "0eddc423-4b27-42e4-ab2f-afe0be7aaec3",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true
        },
        {
          "uuid": "ec2bd85f-e249-d4a1-abe4-8c3dabfea958",
          "citation": "21 CFR 216.24",
          "doc_type": "CFR",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3f58b564-4e0e-43d9-a9da-b9c973223845",
          "id": "3f58b564-4e0e-43d9-a9da-b9c973223845",
          "molfile": "\n  Marvin  01132103212D          \n\n 19 20  0  0  0  0            999 V2000\n   -0.7790    0.1294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2743   -0.5150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5408   -0.4011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5926   -1.2939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0725   -1.9150    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    0.7479   -1.8115    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0532   -1.0585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2473   -2.4585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3856   -2.6836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7169   -3.4652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0673   -3.7705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3700   -2.9994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1439   -2.3705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8115   -2.8907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5724   -2.5594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6836   -1.7572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4522   -1.4492    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0367   -1.2551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2603   -1.5734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5  9  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  6  1  0  0  0  0\n 10  9  1  0  0  0  0\n 12  9  1  0  0  0  0\n 13  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 19 13  2  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 16  2  0  0  0  0\n 18 19  1  0  0  0  0\nM  END",
          "smiles": "CC(C)CC(C1(CCC1)c2ccc(cc2)Cl)N(C)C",
          "formula": "C17H26ClN",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "72cc3e79-4f6a-494b-a78a-306a90da0a9a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "279.8486",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b361f2c5-d6ec-473d-a483-e92d7bc322b6",
      "version": "25",
      "structure": {
        "id": "34a63343-183f-4fc3-b7ab-55c68c7563f9",
        "molfile": "\n  Marvin  01132102482D          \n\n 19 20  0  0  0  0            999 V2000\n   -0.3856   -2.6836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0725   -1.9150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1439   -2.3705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7479   -1.8115    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5926   -1.2939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2603   -1.5734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8115   -2.8907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6836   -1.7572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7169   -3.4652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3700   -2.9994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5724   -2.5594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0367   -1.2551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4522   -1.4492    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.0673   -3.7705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2743   -0.5150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0532   -1.0585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2473   -2.4585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7790    0.1294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5408   -0.4011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  3  2  0  0  0  0\n  7  3  1  0  0  0  0\n  8 11  1  0  0  0  0\n  9  1  1  0  0  0  0\n 10  1  1  0  0  0  0\n 11  7  2  0  0  0  0\n 12  6  1  0  0  0  0\n 13  8  1  0  0  0  0\n 14 10  1  0  0  0  0\n 15  5  1  0  0  0  0\n 16  4  1  0  0  0  0\n 17  4  1  0  0  0  0\n 18 15  1  0  0  0  0\n 19 15  1  0  0  0  0\n  9 14  1  0  0  0  0\n 12  8  2  0  0  0  0\nM  END",
        "smiles": "CC(C)CC(C1(CCC1)c2ccc(cc2)Cl)N(C)C",
        "formula": "C17H26ClN",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "279.8486",
        "optical_activity": "( + / - )",
        "references": [
          "0268f6e3-21bc-42cf-82d6-40a49b306b02",
          "d1113f6a-4a5c-44eb-a302-cf6d8c0d4699",
          "c587afff-f61e-49e0-967e-67cc97131694"
        ],
        "stereo_centers": 1
      },
      "unii": "WV5EC51866"
    }
  ]
}