{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "68dec5ed-00b1-4431-b243-db7e345c0240",
          "code": "A10BB02",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|DRUGS USED IN DIABETES|BLOOD GLUCOSE LOWERING DRUGS, EXCL. INSULINS|Sulfonamides, urea derivatives|chlorpropamide",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A10BB02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "e1ef5f1e-a4a8-4984-bea5-f854fc32fbf7"
          ]
        },
        {
          "uuid": "ee52023b-4044-4eae-9497-b2eda02e9bd6",
          "code": "N0000175608",
          "comments": "Established Pharmacologic Class [EPC]|Sulfonylurea [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175608",
          "code_system": "NDF-RT",
          "references": [
            "e1ef5f1e-a4a8-4984-bea5-f854fc32fbf7"
          ]
        },
        {
          "uuid": "6ead70eb-aee4-40d7-9f08-246870712cb0",
          "code": "N0000008054",
          "comments": "Chemical Ingredients [Chemical/Ingredient]|Organic Chemicals [Chemical/Ingredient]|Urea [Chemical/Ingredient]|Sulfonylurea Compounds [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000008054",
          "code_system": "NDF-RT",
          "references": [
            "e1ef5f1e-a4a8-4984-bea5-f854fc32fbf7"
          ]
        },
        {
          "uuid": "496a323c-b890-40c4-84c1-104c5598daa6",
          "code": "N0000008054",
          "comments": "Chemical Ingredients [Chemical/Ingredient]|Organic Chemicals [Chemical/Ingredient]|Sulfur Compounds [Chemical/Ingredient]|Sulfones [Chemical/Ingredient]|Sulfonylurea Compounds [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000008054",
          "code_system": "NDF-RT",
          "references": [
            "e1ef5f1e-a4a8-4984-bea5-f854fc32fbf7"
          ]
        },
        {
          "uuid": "ffe586dc-24f2-4762-ba68-1d2e21e0e0bd",
          "code": "N0000008054",
          "comments": "Chemical Ingredients [Chemical/Ingredient]|Inorganic Chemicals [Chemical/Ingredient]|Sulfur Compounds [Chemical/Ingredient]|Sulfones [Chemical/Ingredient]|Sulfonylurea Compounds [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000008054",
          "code_system": "NDF-RT",
          "references": [
            "e1ef5f1e-a4a8-4984-bea5-f854fc32fbf7"
          ]
        },
        {
          "uuid": "3871b8e8-25dc-41ce-9435-6d5cb7a7c19d",
          "code": "QA10BB02",
          "comments": "VATC|DRUGS USED IN DIABETES|BLOOD GLUCOSE LOWERING DRUGS, EXCL. INSULINS|Sulfonamides, urea derivatives|chlorpropamide",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA10BB02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "e1ef5f1e-a4a8-4984-bea5-f854fc32fbf7"
          ]
        },
        {
          "uuid": "2956202f-2ef1-436f-9ea1-5b85ea9c67ec",
          "code": "94-20-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=94-20-2",
          "code_system": "CAS",
          "references": [
            "e1ef5f1e-a4a8-4984-bea5-f854fc32fbf7",
            "8fc044ff-1990-4a82-b6e1-b276558ad570"
          ]
        },
        {
          "uuid": "0d607398-d91e-48e8-903d-37047b5543d4",
          "code": "C47447",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47447",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e1ef5f1e-a4a8-4984-bea5-f854fc32fbf7"
          ]
        },
        {
          "uuid": "aaaf0c96-d633-4a3a-99be-40fe39f0904f",
          "code": "197",
          "comments": "LiverTox|Endocrine|Diabetes|Sulfonylurea, 1st gen",
          "type": "PRIMARY",
          "url": "https://livertox.nlm.nih.gov/Chlorpropamide.htm",
          "code_system": "LIVERTOX",
          "references": [
            "e1ef5f1e-a4a8-4984-bea5-f854fc32fbf7"
          ]
        },
        {
          "uuid": "fdc8dae9-5445-42ca-99d8-e6919890f5cc",
          "code": "D002747",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68002747",
          "code_system": "MESH",
          "references": [
            "e1ef5f1e-a4a8-4984-bea5-f854fc32fbf7"
          ]
        },
        {
          "uuid": "337a50f7-412f-4444-86b2-786be36d79cb",
          "code": "CHLORPROPAMIDE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Chlorpropamide",
          "code_system": "WIKIPEDIA",
          "references": [
            "e1ef5f1e-a4a8-4984-bea5-f854fc32fbf7"
          ]
        },
        {
          "uuid": "5709c7ab-e9ca-4839-9079-dee36f81c810",
          "code": "790",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=790",
          "code_system": "INN",
          "references": [
            "e1ef5f1e-a4a8-4984-bea5-f854fc32fbf7"
          ]
        },
        {
          "uuid": "240df462-279b-4627-86d1-5e404606324a",
          "code": "6801",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=6801",
          "code_system": "IUPHAR",
          "references": [
            "e1ef5f1e-a4a8-4984-bea5-f854fc32fbf7"
          ]
        },
        {
          "uuid": "c6c4b698-bfdc-49e7-8b55-91551fd810c0",
          "code": "m3462",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3462?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "e1ef5f1e-a4a8-4984-bea5-f854fc32fbf7"
          ]
        },
        {
          "uuid": "3c7558e8-9a1b-4643-9ce8-e37d7373e1c8",
          "code": "2404",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2404/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "e1ef5f1e-a4a8-4984-bea5-f854fc32fbf7"
          ]
        },
        {
          "uuid": "418df22f-adf2-44be-a077-9b69b2daa79b",
          "code": "DB00672",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00672",
          "code_system": "DRUG BANK",
          "references": [
            "e1ef5f1e-a4a8-4984-bea5-f854fc32fbf7"
          ]
        },
        {
          "uuid": "c7680fa5-0f92-4fbb-978d-0cae68440952",
          "code": "SUB06209MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "e1ef5f1e-a4a8-4984-bea5-f854fc32fbf7"
          ]
        },
        {
          "uuid": "7bfb1213-ae7b-40f6-8f9a-6498f8d82337",
          "code": "CHEMBL498",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL498",
          "code_system": "ChEMBL",
          "references": [
            "e1ef5f1e-a4a8-4984-bea5-f854fc32fbf7"
          ]
        },
        {
          "uuid": "b1ccd4f4-477b-4e99-9e72-57ebbc47b3e1",
          "code": "202-314-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.002.104",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e1ef5f1e-a4a8-4984-bea5-f854fc32fbf7"
          ]
        },
        {
          "uuid": "52525cf3-9bbe-473d-a8e8-ead32c477851",
          "code": "2727",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2727",
          "code_system": "PUBCHEM",
          "references": [
            "e1ef5f1e-a4a8-4984-bea5-f854fc32fbf7"
          ]
        },
        {
          "uuid": "e803a70e-6d7a-240a-95bb-5af18d35e21c",
          "code": "2051",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/2051",
          "code_system": "HSDB",
          "references": [
            "0ed519fc-2b2f-1880-3116-61c082e76c13"
          ]
        },
        {
          "uuid": "068effbe-9bb3-551b-90cc-891fb821dba4",
          "code": "DTXSID9020322",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9020322",
          "code_system": "EPA CompTox",
          "references": [
            "88cbab5f-a217-c517-a3a7-31e7fd919c77"
          ]
        },
        {
          "uuid": "2605cf0c-d2cd-ef7e-17cd-5212e2170b19",
          "code": "Chlorpropamide",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM66/",
          "code_system": "LACTMED",
          "references": [
            "8699db6b-d430-83d8-41d6-22ca8157f9a3"
          ]
        },
        {
          "uuid": "b43d9c8e-e308-b6f1-a151-2213ff3c7cac",
          "code": "C97936",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Digestive System or Metabolism[C78276]|Anti-diabetic Agent[C29711]|Sulfonylurea Antidiabetic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C97936",
          "code_system": "NCI_THESAURUS",
          "references": [
            "8699db6b-d430-83d8-41d6-22ca8157f9a3"
          ]
        },
        {
          "uuid": "92bf802e-a233-4ca9-8c76-843e0c4a6b64",
          "code": "WTM2C3IL2X",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d655ca16-4945-0fbe-05ef-d9a6d189ebc6",
          "code": "622",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/622",
          "code_system": "DRUG CENTRAL",
          "references": [
            "8699db6b-d430-83d8-41d6-22ca8157f9a3"
          ]
        },
        {
          "uuid": "40e5b386-7be9-e0ea-8274-faf23247af55",
          "code": "3650",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:3650",
          "code_system": "CHEBI",
          "references": [
            "8699db6b-d430-83d8-41d6-22ca8157f9a3"
          ]
        },
        {
          "uuid": "76e21735-1883-2d4f-14f2-42bf06be1e46",
          "code": "1126009",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1126009",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "8699db6b-d430-83d8-41d6-22ca8157f9a3"
          ]
        },
        {
          "uuid": "809208c9-5cb4-9106-6d9a-556807b5c935",
          "code": "100000081875",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "57f29ac1-8b42-4301-a6bc-7b3b46fb50f6"
          ]
        },
        {
          "uuid": "8d1da852-376b-ed16-2f05-206740fd86fa",
          "code": "44634",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=44634",
          "code_system": "NSC",
          "references": [
            "fb9fd952-b0c1-7e3b-41a9-edecf645e526"
          ]
        },
        {
          "uuid": "74483832-1c13-68ab-29ba-cfefa81985d2",
          "code": "626720",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=626720",
          "code_system": "NSC",
          "references": [
            "fb9fd952-b0c1-7e3b-41a9-edecf645e526"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "44d6d749-0775-4801-bd22-27a34f1ec958",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2c5706d1-f6b3-495c-ab61-9c826ab642c0",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "38d0e1ee-3ca4-42df-94df-8a09c567efcd",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f6127ade-1bec-45f1-852d-2fe73b63ad34",
          "citation": "INN Proposed List 8",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL08.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f924222a-0056-4e9c-90a2-8c353dc2f85d",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "317110f6-6142-45bb-8311-a2eb965b3ead",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "af682d55-851d-4265-9c03-279a3fdb23a1",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dbd61e88-5c91-4123-abba-1494f5247c04",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c048dd5b-eef7-4879-9f9d-c19af1e78ba0",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cd5738e2-06d0-44a5-9012-293d4eddc1de",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e85547be-8b2b-43ad-b8ad-827ae97b9c85",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf6ceb7d-eea6-4b26-8746-2d02da85fa18",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5e629fe7-c35b-4b50-ae2a-696bdf3b2360",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1c80a648-b936-41cd-8d0f-db44c22eeab0",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e1ef5f1e-a4a8-4984-bea5-f854fc32fbf7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389726000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f2978b18-eb5b-438e-b91e-a755a9254aa3",
          "citation": "SRS import [WTM2C3IL2X]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=WTM2C3IL2X",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389726000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff36f110-80d1-4c63-bd73-7eea6ff370e4",
          "citation": "CHLORPROPAMIDE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3416657f-42c2-48b3-a13c-fb8b6d1342a5",
          "citation": "CHLORPROPAMIDE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "26d1f2bb-4355-44b6-8580-628f77be637d",
          "citation": "CHLORPROPAMIDE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ec2ebd91-7f00-46c7-b1b3-2baa605e4dde",
          "citation": "CHLORPROPAMIDE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ead2a294-5419-49dd-9db7-c5c39c092c46",
          "citation": "CHLORPROPAMIDE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d0bbe0c6-670b-459d-931a-031cd37b997b",
          "citation": "CHLORPROPAMIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "531567af-33a6-4390-bf9a-a24ad665bcd3",
          "citation": "CHLORPROPAMIDE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "715880e8-8e18-41e6-9e0e-19d9a442480b",
          "citation": "CHLORPROPAMIDE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b476ae46-c004-4d59-8b0a-fecf1c68c34a",
          "citation": "CHLORPROPAMIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7eabdacc-83af-42b7-bf81-8d3f182c1114",
          "citation": "CHLORPROPAMIDE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fbc40cf1-64f2-4b3c-215b-a05861337b2b",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0ed519fc-2b2f-1880-3116-61c082e76c13",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+94-20-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "88cbab5f-a217-c517-a3a7-31e7fd919c77",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=94-20-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "03cd4d1b-c99e-3539-ce75-9225c12730b6",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+94-20-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "303fd826-d847-dfda-16a6-20d6f1344c9c",
          "citation": "https://www.drugbank.ca/biodb/polypeptides/Q09428",
          "doc_type": "WEB PAGE",
          "public_domain": true
        },
        {
          "uuid": "66205e48-ca16-eda9-a08a-60da94d5451a",
          "citation": "http://fco.factsandcomparisons.com/lco/action/doc/retrieve/docid/fc_dfc/5548576#f_pharmacokinetics",
          "doc_type": "LEPINDEX",
          "public_domain": true
        },
        {
          "uuid": "8699db6b-d430-83d8-41d6-22ca8157f9a3",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "8fc044ff-1990-4a82-b6e1-b276558ad570",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "e83504af-2ba9-c638-3fb6-830533529f1b",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "259a58c7-16d3-aa92-ca3c-121a97622132",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "fb9fd952-b0c1-7e3b-41a9-edecf645e526",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "3f26c8e8-82f0-1fce-df08-b8e3a48e209c",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "57f29ac1-8b42-4301-a6bc-7b3b46fb50f6",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "15eb8a22-6aec-44ca-9069-12421e5f49ca",
          "id": "15eb8a22-6aec-44ca-9069-12421e5f49ca",
          "molfile": "\n  Marvin  01132101202D          \n\n 17 17  0  0  0  0            999 V2000\n    7.6032   -2.4843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8892   -2.8977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1753   -2.4927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4613   -2.9060    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7473   -2.4927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7473   -1.6659    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0333   -2.9060    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3194   -2.4969    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9060   -1.7787    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7327   -1.7787    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6096   -2.9102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8914   -2.4969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1774   -2.9102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1774   -3.7452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4551   -4.1503    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.8914   -4.1586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6096   -3.7452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  8  2  0  0  0  0\n 11  8  1  0  0  0  0\n 12 11  1  0  0  0  0\n 17 11  2  0  0  0  0\n 13 12  2  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  1  0  0  0  0\n 14 16  2  0  0  0  0\n 16 17  1  0  0  0  0\nM  END",
          "smiles": "CCCNC(=O)NS(=O)(=O)c1ccc(cc1)Cl",
          "formula": "C10H13ClN2O3S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1498f6ad-c49f-4178-b910-00352f8dd0a9"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "276.7412",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2923ad35-2a28-4298-b0d9-d107e51ed8a3",
      "version": "28",
      "structure": {
        "id": "2e771fe8-c4d4-4cc7-b73a-e19267be89fb",
        "molfile": "\n  Marvin  01132102302D          \n\n 17 17  0  0  0  0            999 V2000\n    3.3194   -2.4969    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0333   -2.9060    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7473   -2.4927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6096   -2.9102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9060   -1.7787    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7327   -1.7787    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7473   -1.6659    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4613   -2.9060    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8914   -2.4969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6096   -3.7452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1774   -3.7452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1774   -2.9102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8914   -4.1586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4551   -4.1503    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.1753   -2.4927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8892   -2.8977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6032   -2.4843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  1  2  0  0  0  0\n  6  1  2  0  0  0  0\n  7  3  2  0  0  0  0\n  8  3  1  0  0  0  0\n  9  4  2  0  0  0  0\n 10  4  1  0  0  0  0\n 11 13  1  0  0  0  0\n 12  9  1  0  0  0  0\n 13 10  2  0  0  0  0\n 14 11  1  0  0  0  0\n 15  8  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 12 11  2  0  0  0  0\nM  END",
        "smiles": "CCCNC(=O)NS(=O)(=O)c1ccc(cc1)Cl",
        "formula": "C10H13ClN2O3S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "276.7412",
        "optical_activity": "NONE",
        "references": [
          "44d6d749-0775-4801-bd22-27a34f1ec958",
          "f2978b18-eb5b-438e-b91e-a755a9254aa3",
          "f6127ade-1bec-45f1-852d-2fe73b63ad34"
        ],
        "stereo_centers": 0
      },
      "unii": "WTM2C3IL2X",
      "relationships": [
        {
          "uuid": "e401fa06-5675-45f0-ad93-0e1cd023927c",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "2e4f3723-6632-4edc-961b-889acc236c12",
            "refuuid": "2923ad35-2a28-4298-b0d9-d107e51ed8a3",
            "name": "CHLORPROPAMIDE",
            "unii": "WTM2C3IL2X",
            "linking_id": "WTM2C3IL2X",
            "ref_pname": "CHLORPROPAMIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d3849470-7b8c-4a2b-824b-a3d52e6e4ec6",
          "type": "TARGET->INHIBITOR",
          "references": [
            "303fd826-d847-dfda-16a6-20d6f1344c9c"
          ],
          "related_substance": {
            "uuid": "47b669e5-0d63-4d8b-8d77-cd972c92679c",
            "refuuid": "011edec4-cdaf-4dec-a307-c234223b211c",
            "name": "ATP-BINDING CASSETTE SUB-FAMILY C MEMBER 8",
            "unii": "8RT5G5EY5Z",
            "linking_id": "8RT5G5EY5Z",
            "ref_pname": "ATP-BINDING CASSETTE SUB-FAMILY C MEMBER 8",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "706e31a9-929f-4a71-828d-1317bf64943c",
          "amount": {
            "uuid": "0f59c0d9-8af2-4c77-8e5f-840b85f33afc",
            "average": 90,
            "units": "%"
          },
          "type": "BINDER->LIGAND",
          "interaction_type": "BINDING",
          "references": [
            "66205e48-ca16-eda9-a08a-60da94d5451a"
          ],
          "related_substance": {
            "uuid": "44b0a9e4-508d-4cf2-b4ad-3dfc92458d3d",
            "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30",
            "name": "PLASMA PROTEIN FRACTION (HUMAN)",
            "unii": "6D53G0FD0Z",
            "linking_id": "6D53G0FD0Z",
            "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "b4bea89c-ac0c-4224-8e22-0fc390420ce5",
          "name": "1-((P-CHLOROPHENYL)SULFONYL)-3-PROPYLUREA",
          "stdName": "1-((P-CHLOROPHENYL)SULFONYL)-3-PROPYLUREA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c5706d1-f6b3-495c-ab61-9c826ab642c0"
          ],
          "display_name": false
        },
        {
          "uuid": "5c3d99a5-4777-413b-a073-a57a2ef5dfbf",
          "name": "BENZENESULFONAMIDE, 4-CHLORO-N-((PROPYLAMINO)CARBONYL)-",
          "stdName": "BENZENESULFONAMIDE, 4-CHLORO-N-((PROPYLAMINO)CARBONYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c5706d1-f6b3-495c-ab61-9c826ab642c0"
          ],
          "display_name": false
        },
        {
          "uuid": "f64799fe-2245-4b48-b79b-b62c28ae1d9b",
          "name": "CHLORPROPAMIDE",
          "stdName": "CHLORPROPAMIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b476ae46-c004-4d59-8b0a-fecf1c68c34a",
            "ff36f110-80d1-4c63-bd73-7eea6ff370e4",
            "26d1f2bb-4355-44b6-8580-628f77be637d",
            "c048dd5b-eef7-4879-9f9d-c19af1e78ba0",
            "531567af-33a6-4390-bf9a-a24ad665bcd3",
            "3416657f-42c2-48b3-a13c-fb8b6d1342a5",
            "ead2a294-5419-49dd-9db7-c5c39c092c46",
            "e85547be-8b2b-43ad-b8ad-827ae97b9c85",
            "715880e8-8e18-41e6-9e0e-19d9a442480b",
            "7eabdacc-83af-42b7-bf81-8d3f182c1114",
            "af682d55-851d-4265-9c03-279a3fdb23a1",
            "cf6ceb7d-eea6-4b26-8746-2d02da85fa18",
            "cd5738e2-06d0-44a5-9012-293d4eddc1de",
            "5e629fe7-c35b-4b50-ae2a-696bdf3b2360",
            "ec2ebd91-7f00-46c7-b1b3-2baa605e4dde",
            "44d6d749-0775-4801-bd22-27a34f1ec958",
            "317110f6-6142-45bb-8311-a2eb965b3ead",
            "f6127ade-1bec-45f1-852d-2fe73b63ad34",
            "dbd61e88-5c91-4123-abba-1494f5247c04",
            "d0bbe0c6-670b-459d-931a-031cd37b997b",
            "f924222a-0056-4e9c-90a2-8c353dc2f85d"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "8cef682f-21fa-4dc9-a449-d78d7a613f9c",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "0682f7a1-3609-ea02-5a7f-cb0dad1b9567",
          "name": "CHLORPROPAMIDE [EP IMPURITY]",
          "stdName": "CHLORPROPAMIDE [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "317110f6-6142-45bb-8311-a2eb965b3ead"
          ],
          "display_name": false
        },
        {
          "uuid": "3f041ab0-9d93-42ee-b235-1e7dc10e2746",
          "name": "CHLORPROPAMIDE [HSDB]",
          "stdName": "CHLORPROPAMIDE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd5738e2-06d0-44a5-9012-293d4eddc1de"
          ],
          "display_name": false
        },
        {
          "uuid": "7096832d-3a31-4565-ad58-42e1722d494c",
          "name": "CHLORPROPAMIDE [JAN]",
          "stdName": "CHLORPROPAMIDE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fbc40cf1-64f2-4b3c-215b-a05861337b2b"
          ],
          "display_name": false
        },
        {
          "uuid": "51a53f5b-cd34-483d-a9a7-c9420983b63a",
          "name": "CHLORPROPAMIDE [MART.]",
          "stdName": "CHLORPROPAMIDE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dbd61e88-5c91-4123-abba-1494f5247c04"
          ],
          "display_name": false
        },
        {
          "uuid": "235ba4eb-f29c-4a4f-bcf6-80fe4628f1e4",
          "name": "CHLORPROPAMIDE [MI]",
          "stdName": "CHLORPROPAMIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c048dd5b-eef7-4879-9f9d-c19af1e78ba0"
          ],
          "display_name": false
        },
        {
          "uuid": "45f09b88-088a-488b-afc4-f2ad64222fe5",
          "name": "CHLORPROPAMIDE [ORANGE BOOK]",
          "stdName": "CHLORPROPAMIDE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "af682d55-851d-4265-9c03-279a3fdb23a1"
          ],
          "display_name": false
        },
        {
          "uuid": "f0b56539-620c-9f61-cb74-c84cb5943a71",
          "name": "CHLORPROPAMIDE [USP MONOGRAPH]",
          "stdName": "CHLORPROPAMIDE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e83504af-2ba9-c638-3fb6-830533529f1b"
          ],
          "display_name": false
        },
        {
          "uuid": "167bdf51-ef83-415e-a5b6-8216d39693f3",
          "name": "CHLORPROPAMIDE [USP-RS]",
          "stdName": "CHLORPROPAMIDE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e85547be-8b2b-43ad-b8ad-827ae97b9c85"
          ],
          "display_name": false
        },
        {
          "uuid": "ba61b351-9b6f-4b4e-b446-908dc71d9ada",
          "name": "CHLORPROPAMIDE [VANDF]",
          "stdName": "CHLORPROPAMIDE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e629fe7-c35b-4b50-ae2a-696bdf3b2360"
          ],
          "display_name": false
        },
        {
          "uuid": "6e198233-1c9c-abae-c742-3332d3ce136c",
          "name": "Chlorpropamide [WHO-DD]",
          "stdName": "CHLORPROPAMIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3f26c8e8-82f0-1fce-df08-b8e3a48e209c"
          ],
          "display_name": false
        },
        {
          "uuid": "b5aec049-dbb8-46c7-9a81-5796c9a613ee",
          "name": "DIABINESE",
          "stdName": "DIABINESE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "38d0e1ee-3ca4-42df-94df-8a09c567efcd"
          ],
          "display_name": false
        },
        {
          "uuid": "2acf48b4-973a-4941-80c4-5ee72ca8f323",
          "name": "GLUCAMIDE",
          "stdName": "GLUCAMIDE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "38d0e1ee-3ca4-42df-94df-8a09c567efcd"
          ],
          "display_name": false
        },
        {
          "uuid": "46256450-6152-41a2-9a8e-6fbdb3b76e0f",
          "name": "NSC-44634",
          "stdName": "NSC-44634",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c80a648-b936-41cd-8d0f-db44c22eeab0"
          ],
          "display_name": false
        },
        {
          "uuid": "c8bfb2df-efdd-4606-82c7-450dfb125562",
          "name": "NSC-626720",
          "stdName": "NSC-626720",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c80a648-b936-41cd-8d0f-db44c22eeab0"
          ],
          "display_name": false
        },
        {
          "uuid": "3f41ec4d-7a36-4321-87f1-87e7dfa138ad",
          "name": "chlorpropamide [INN]",
          "stdName": "CHLORPROPAMIDE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6127ade-1bec-45f1-852d-2fe73b63ad34"
          ],
          "display_name": false
        }
      ],
      "properties": [
        {
          "uuid": "0fa9cc01-5c3c-471c-ad29-b8430b56423c",
          "name": "Biological Half-life",
          "value": {
            "uuid": "dc17b097-c1aa-4d49-9324-17ee2a614abc",
            "average": 36,
            "units": "hours"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "66205e48-ca16-eda9-a08a-60da94d5451a"
          ]
        },
        {
          "uuid": "25b607c8-e72b-4507-a1d4-3dd4f2e220f7",
          "name": "Volume of Distribution",
          "value": {
            "uuid": "b48b52a8-af05-43b6-9dd6-8268552d1575",
            "high": 0.23,
            "low": 0.13,
            "units": "Liters/Kilogram"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "66205e48-ca16-eda9-a08a-60da94d5451a"
          ]
        }
      ]
    }
  ]
}