{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "80a1a478-d261-4931-b4b8-a578ceb3bbcd",
          "code": "136982-89-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=136982-89-3",
          "code_system": "CAS",
          "references": [
            "d098c19a-49c2-46f7-9803-c4e7d22cd688",
            "c78b0427-dab7-4924-9960-af7a9a97a629"
          ]
        },
        {
          "uuid": "0424d401-915a-4f68-b301-f946987df00a",
          "code": "451593",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/451593",
          "code_system": "PUBCHEM",
          "references": [
            "d098c19a-49c2-46f7-9803-c4e7d22cd688"
          ]
        },
        {
          "uuid": "d6ab673d-ac14-44cb-a566-9a9d2aa37309",
          "code": "WT6GZM4YA8",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "79197497-ef96-47dc-8ebd-10ce27cafb15",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "8295e4de-af8a-47d4-8ab7-dd432e93f0bb",
            "refuuid": "ded7b8b6-70a3-49e1-914e-27514b9383f4",
            "name": "DIOXOLANE T",
            "unii": "WT6GZM4YA8",
            "linking_id": "WT6GZM4YA8",
            "ref_pname": "DIOXOLANE T",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "bd2605aa-9364-4168-85fa-f110d3d65506",
          "name": "2,4(1H,3H)-PYRIMIDINEDIONE, 1-(2-(HYDROXYMETHYL)-1,3-DIOXOLAN-4-YL)-5-METHYL-, (2R-CIS)-",
          "stdName": "2,4(1H,3H)-PYRIMIDINEDIONE, 1-(2-(HYDROXYMETHYL)-1,3-DIOXOLAN-4-YL)-5-METHYL-, (2R-CIS)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5a181805-8fff-4cad-b31d-cdb46fb87a5a",
            "2d791e05-cc3a-4fea-a3fe-62a77bef2f80"
          ],
          "display_name": false
        },
        {
          "uuid": "3c05b217-f77e-4f4a-84ae-9f75528ca18c",
          "name": "DIOXOLANE T",
          "stdName": "DIOXOLANE T",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6217d66a-3380-4100-b90e-70a4b3ecdb43",
            "1ff99aaa-cdbb-4656-9a10-7c6db1ca01ca"
          ],
          "display_name": true
        },
        {
          "uuid": "0cb667c8-c1d8-4823-913d-b910d42ef074",
          "name": "DIOXOLANE THYMINE NUCLEOSIDE",
          "stdName": "DIOXOLANE THYMINE NUCLEOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d791e05-cc3a-4fea-a3fe-62a77bef2f80",
            "2407125b-c3d8-43ed-a55f-77f2e40899b1"
          ],
          "display_name": false
        },
        {
          "uuid": "f1e3acc6-69a3-4832-9979-312fa74f09f2",
          "name": "DOT",
          "stdName": "DOT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d791e05-cc3a-4fea-a3fe-62a77bef2f80",
            "2407125b-c3d8-43ed-a55f-77f2e40899b1"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3d36b186-b77f-4ab2-8c04-4493efb01728",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6217d66a-3380-4100-b90e-70a4b3ecdb43",
          "citation": "CHEMID 2011 Drugportal",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ff99aaa-cdbb-4656-9a10-7c6db1ca01ca",
          "citation": "DRUGPORTAL 2011",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2407125b-c3d8-43ed-a55f-77f2e40899b1",
          "citation": "NCATSLIST",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2d791e05-cc3a-4fea-a3fe-62a77bef2f80",
          "citation": "NCATS List",
          "doc_type": "NCATS List",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5a181805-8fff-4cad-b31d-cdb46fb87a5a",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d098c19a-49c2-46f7-9803-c4e7d22cd688",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391075000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c78b0427-dab7-4924-9960-af7a9a97a629",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "17ca029f-1cd9-4cd3-903c-39e7596d0c57",
          "id": "17ca029f-1cd9-4cd3-903c-39e7596d0c57",
          "molfile": "\n  Marvin  01132101252D          \n\n 16 17  0  0  0  0            999 V2000\n    3.5292   -4.1750    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    2.9292   -3.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2125   -3.7417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8042   -4.9542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6375   -4.9375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8750   -4.1333    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    4.1917   -3.6667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5917   -3.5542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8750   -3.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8667   -2.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1542   -1.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5917   -1.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5917   -1.0667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3042   -2.3167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3042   -3.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0167   -3.5542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  4  1  0  0  0  0\n  1  7  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  1  0  0  0\n  6  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 15  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 12  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  2  0  0  0  0\nM  END",
          "smiles": "Cc1cn([C@H]2CO[C@@H](CO)O2)c(=O)[nH]c1=O",
          "formula": "C9H12N2O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ffa3666d-f825-4870-a757-2b9e0f067c4d"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "228.2023",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ded7b8b6-70a3-49e1-914e-27514b9383f4",
      "version": "4",
      "structure": {
        "id": "56ee8e63-485a-4cd6-a772-0b85da5bdfa3",
        "molfile": "\n  Marvin  01132104312D          \n\n 16 17  0  0  1  0            999 V2000\n    5.5917   -3.5542    0.0000 N   0  0  1  0  0  0  0  0  0  0  0  0\n    6.3042   -3.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3042   -2.3167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8750   -3.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8667   -2.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5917   -1.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8750   -4.1333    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.1917   -3.6667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8042   -4.9542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5292   -4.1750    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.0167   -3.5542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6375   -4.9375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5917   -1.0667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1542   -1.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2125   -3.7417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9292   -3.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  1  1  1  0  0  0\n  8  7  1  0  0  0  0\n  9 12  1  0  0  0  0\n 10  8  1  0  0  0  0\n 11  2  2  0  0  0  0\n 12  7  1  0  0  0  0\n 13  6  2  0  0  0  0\n 14  5  1  0  0  0  0\n 15 16  1  0  0  0  0\n 10 16  1  1  0  0  0\n 10  9  1  0  0  0  0\n  3  6  1  0  0  0  0\nM  END",
        "smiles": "Cc1cn([C@H]2CO[C@@H](CO)O2)c(=O)[nH]c1=O",
        "formula": "C9H12N2O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "228.2023",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "3d36b186-b77f-4ab2-8c04-4493efb01728",
          "2d791e05-cc3a-4fea-a3fe-62a77bef2f80"
        ],
        "stereo_centers": 2
      },
      "unii": "WT6GZM4YA8"
    }
  ]
}