{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "18766c94-8db8-4486-bdb5-ca6bcdb94746",
          "code": "556-02-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=556-02-5",
          "code_system": "CAS",
          "references": [
            "0c22b3a6-d4af-831a-41b4-e2f8e26c9058"
          ]
        },
        {
          "uuid": "cbf195e1-0314-464b-9d59-3f4d669799d0",
          "code": "71098",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71098",
          "code_system": "PUBCHEM",
          "references": [
            "f286fe37-9424-bd43-70c8-24c1e861b303"
          ]
        },
        {
          "uuid": "d94a2f69-5c61-d31c-4139-d6a0858b5bb0",
          "code": "209-112-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.008.285",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e70b9c85-bfe0-d053-8da7-ef35fc2faf05"
          ]
        },
        {
          "uuid": "dbecce48-87ca-4d56-8698-504c87e40825",
          "code": "WQ5G9JQ7GC",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "033905f3-11ff-cdee-e01c-58ea00ca3436",
          "code": "DB03839",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB03839",
          "code_system": "DRUG BANK",
          "references": [
            "2420d9e6-d709-5f6f-63ad-a351c263b97b"
          ]
        },
        {
          "uuid": "8beb504a-ae87-3562-1327-4e8f849dd61e",
          "code": "58570",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:58570",
          "code_system": "CHEBI",
          "references": [
            "2420d9e6-d709-5f6f-63ad-a351c263b97b"
          ]
        },
        {
          "uuid": "1f034948-47f7-d614-6a02-e3a27e22f66f",
          "code": "28479",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:28479",
          "code_system": "CHEBI",
          "references": [
            "2420d9e6-d709-5f6f-63ad-a351c263b97b"
          ]
        },
        {
          "uuid": "d1786812-fbdf-4ccc-0418-22268eb4d98a",
          "code": "DTXSID50883441",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50883441",
          "code_system": "EPA CompTox",
          "references": [
            "2420d9e6-d709-5f6f-63ad-a351c263b97b"
          ]
        },
        {
          "uuid": "8a3c4b55-7108-82c0-3cab-3ff78c51cf97",
          "code": "300000026574",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "b5e6c8ef-7fa0-3866-f68e-0d28caf86f66"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "8a13ab8c-87e7-ba5c-7da5-7992debf28a9",
          "name": "(2R)-2-AMINO-3-(4-HYDROXYPHENYL)PROPANOIC ACID",
          "stdName": "(2R)-2-AMINO-3-(4-HYDROXYPHENYL)PROPANOIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0c22b3a6-d4af-831a-41b4-e2f8e26c9058"
          ],
          "display_name": false
        },
        {
          "uuid": "0cafb359-022b-138d-4a42-8d00274a88ee",
          "name": "(R)-TYROSINE",
          "stdName": "(R)-TYROSINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0c22b3a6-d4af-831a-41b4-e2f8e26c9058"
          ],
          "display_name": false
        },
        {
          "uuid": "7deae3b2-7a77-0ecc-229c-701774c18a9d",
          "name": "D-4-HYDROXYPHENYLALANINE",
          "stdName": "D-4-HYDROXYPHENYLALANINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0c22b3a6-d4af-831a-41b4-e2f8e26c9058"
          ],
          "display_name": false
        },
        {
          "uuid": "4d427b2e-7708-e884-557e-0889e8262670",
          "name": "D-TYROSINE",
          "stdName": "D-TYROSINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0c22b3a6-d4af-831a-41b4-e2f8e26c9058"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "f286fe37-9424-bd43-70c8-24c1e861b303",
          "citation": "PUBCHEM",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71098",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0c22b3a6-d4af-831a-41b4-e2f8e26c9058",
          "citation": "SCIFINDER",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e70b9c85-bfe0-d053-8da7-ef35fc2faf05",
          "citation": "EC",
          "doc_type": "ECHA (EC/EINECS)",
          "public_domain": true
        },
        {
          "uuid": "2420d9e6-d709-5f6f-63ad-a351c263b97b",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "b5e6c8ef-7fa0-3866-f68e-0d28caf86f66",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "65b0adff-91ce-6515-f476-8c9b1b101a54",
          "id": "65b0adff-91ce-6515-f476-8c9b1b101a54",
          "molfile": "\n  Marvin  01132105172D          \n\n 13 13  0  0  1  0            999 V2000\n   13.5852   -4.0703    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   13.5852   -4.8953    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8707   -3.6578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1562   -4.0703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4417   -3.6578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7272   -4.0703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7272   -4.8953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0127   -5.3079    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4417   -5.3079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1562   -4.8953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2997   -3.6578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0141   -4.0703    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2997   -2.8327    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 11  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4 10  2  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  7  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\nM  END",
          "smiles": "c1cc(ccc1C[C@H](C(=O)O)N)O",
          "formula": "C9H11NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5eca1bc8-215b-4a50-8711-80bc218d5e19"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "181.1889",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b5884c56-f4c7-4ba6-a008-a1434dbc011f",
      "version": "11",
      "structure": {
        "id": "15e32664-c9c4-c6f3-a0ef-c7ada7673ad3",
        "molfile": "D-Tyrosine\n  Marvin  01132101202D          \n\n 13 13  0  0  1  0            999 V2000\n   12.8707   -3.6578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5852   -4.0703    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   14.2997   -3.6578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0141   -4.0703    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2997   -2.8327    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5852   -4.8953    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1562   -4.0703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4417   -3.6578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7272   -4.0703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7272   -4.8953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4417   -5.3079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1562   -4.8953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0127   -5.3079    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  2  6  1  6  0  0  0\n  1  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n  7 12  1  0  0  0  0\n 10 13  1  0  0  0  0\nM  END",
        "smiles": "c1cc(ccc1C[C@H](C(=O)O)N)O",
        "formula": "C9H11NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "181.1889",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "0c22b3a6-d4af-831a-41b4-e2f8e26c9058"
        ],
        "stereo_centers": 1
      },
      "unii": "WQ5G9JQ7GC"
    }
  ]
}