{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "49256b5f-c443-4442-8d4e-cfe7e44ee3ff", "code": "N0000175534", "comments": "Cellular or Molecular Interactions [MoA]|Physiochemical Activity [MoA]|Irrigation [MoA]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175534", "code_system": "NDF-RT", "references": [ "de3641e5-37d8-4407-a416-68e1cf6c42aa" ] }, { "uuid": "ac7c3f1f-3065-4ef7-b63a-5bad0b0ac570", "code": "N0000175835", "comments": "Established Pharmacologic Class [EPC]|Calculi Dissolution Agent [EPC]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175835", "code_system": "NDF-RT", "references": [ "de3641e5-37d8-4407-a416-68e1cf6c42aa" ] }, { "uuid": "f6cacefb-77aa-4959-a1fd-ca2af14f4da0", "code": "90-80-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=90-80-2", "code_system": "CAS", "references": [ "de3641e5-37d8-4407-a416-68e1cf6c42aa", "b201a214-ff5a-4c6c-9f96-d58d82926e03" ] }, { "uuid": "857cb1fe-99ce-42f2-8650-1b7aa3abc754", "code": "C47549", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47549", "code_system": "NCI_THESAURUS", "references": [ "de3641e5-37d8-4407-a416-68e1cf6c42aa" ] }, { "uuid": "30fdf883-644a-4347-bee0-bdc5ca1ed6b5", "code": "C010730", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67010730", "code_system": "MESH", "references": [ "de3641e5-37d8-4407-a416-68e1cf6c42aa" ] }, { "uuid": "18921052-31ca-4a15-8dd1-164b7d63bc22", "code": "GLUCONO DELTA-LACTONE", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Glucono_delta-lactone", "code_system": "WIKIPEDIA", "references": [ "de3641e5-37d8-4407-a416-68e1cf6c42aa" ] }, { "uuid": "7ffae015-1b77-4168-ab98-9703f6c05fb1", "code": "21 CFR 184.1318", "comments": "PART 184 -- DIRECT FOOD SUBSTANCES AFFIRMED AS GENERALLY RECOGNIZED AS SAFE|Subpart B--Listing of Specific Substances Affirmed as GRAS|Sec. 184.1318 Glucono delta-lactone", "type": "PRIMARY", "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=184.1318", "code_system": "CFR", "references": [ "de3641e5-37d8-4407-a416-68e1cf6c42aa" ] }, { "uuid": "354738bd-b037-4dbb-adf4-9340f1b973c5", "code": "INS-575", "comments": "JECFA|Functional Classification|ACID|ACIDITY REGULATOR|RAISING AGENT|SEQUESTRANT", "type": "PRIMARY", "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemINS=575", "code_system": "JECFA EVALUATION", "references": [ "de3641e5-37d8-4407-a416-68e1cf6c42aa" ] }, { "uuid": "42540da0-1fb2-47db-bbb4-7305ab8fbc60", "code": "INS-575", "comments": "Codex Alimentarius|Functional Classification|Acidity regulator|Raising agent|Sequestrant", "type": "PRIMARY", "url": "http://www.fao.org/gsfaonline/additives/details.html?id=172", "code_system": "CODEX ALIMENTARIUS (GSFA)", "references": [ "de3641e5-37d8-4407-a416-68e1cf6c42aa" ] }, { "uuid": "a806f6b2-0630-4473-bd83-bd1a1f206d14", "code": "25842", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/25842/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "de3641e5-37d8-4407-a416-68e1cf6c42aa" ] }, { "uuid": "18d5ecde-79d5-4e59-b6a1-55dcf6c06066", "code": "m5763", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m5763?q=authorize", "code_system": "MERCK INDEX", "references": [ "de3641e5-37d8-4407-a416-68e1cf6c42aa" ] }, { "uuid": "cb9c7f4c-1f90-4ddb-8e51-453cff9d3ca2", "code": "SUB120981", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "de3641e5-37d8-4407-a416-68e1cf6c42aa" ] }, { "uuid": "4de7f19f-11c8-4620-9fd3-50bc6e2783bb", "code": "CHEMBL1200829", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1200829", "code_system": "ChEMBL", "references": [ "de3641e5-37d8-4407-a416-68e1cf6c42aa" ] }, { "uuid": "4fb56e4f-2420-4063-bbaa-462d2b72a421", "code": "202-016-5", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.833", "code_system": "ECHA (EC/EINECS)", "references": [ "de3641e5-37d8-4407-a416-68e1cf6c42aa" ] }, { "uuid": "5a3d941c-cf96-4ab8-90ca-c9a7f036e311", "code": "7027", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7027", "code_system": "PUBCHEM", "references": [ "de3641e5-37d8-4407-a416-68e1cf6c42aa" ] }, { "uuid": "0cdd5a7c-bb25-3e79-6065-4b860413e4c4", "code": "488", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/488", "code_system": "HSDB", "references": [ "75ca68cc-0553-8378-f2d5-ac2022194abc" ] }, { "uuid": "1d6b7d17-0f3f-7e36-e523-32cb3fdacf71", "code": "DTXSID0026549", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0026549", "code_system": "EPA CompTox", "references": [ "88dc416b-f077-75a0-7a41-b76b804a1c39" ] }, { "uuid": "f954bb8a-fcf6-0d4d-c6be-d0902731408d", "code": "40189", "comments": "ORPHAN DRUG|Designated/Approved|Treatment of renal and bladder calculi of the apatite or struvite variety.", "type": "PRIMARY", "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=40189", "code_system": "FDA ORPHAN DRUG" }, { "uuid": "8549a9e3-af30-fda1-4214-f71bf29ca978", "code": "C275", "comments": "Pharmacologic Substance[C1909]|Protective Agent[C26170]|Antioxidant", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C306", "code_system": "NCI_THESAURUS", "references": [ "068d461c-9777-3623-43e0-68a253f67baf" ] }, { "uuid": "eebf1e4d-fc45-f4f8-774e-8716d1e16512", "code": "4056 (Number of products:1)", "comments": "Dietary Supplement Label Database|TBD|Glucono-delta-lactone", "type": "PRIMARY", "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=4056&item=Glucono-delta-lactone", "code_system": "DSLD", "references": [ "068d461c-9777-3623-43e0-68a253f67baf" ] }, { "uuid": "1f5918ed-a999-e26e-2c8f-aeb91e031248", "code": "5144", "type": "PRIMARY", "url": "https://drugcentral.org/drugcard/5144", "code_system": "DRUG CENTRAL", "references": [ "068d461c-9777-3623-43e0-68a253f67baf" ] }, { "uuid": "378a2acd-9fb9-315c-0a15-b3bbf52f49ee", "code": "DB04564", "type": "PRIMARY", "url": "https://go.drugbank.com/drugs/DB04564", "code_system": "DRUG BANK", "references": [ "068d461c-9777-3623-43e0-68a253f67baf" ] }, { "uuid": "a4250ae0-21b2-4e0f-b643-ddc4140a4e47", "code": "WQ29KQ9POT", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "e2038a2e-2c04-4087-40f4-a46b8e1e58d7", "code": "1294150", "type": "PRIMARY", "url": "https://store.usp.org/product/1294150", "code_system": "RS_ITEM_NUM", "references": [ "068d461c-9777-3623-43e0-68a253f67baf" ] }, { "uuid": "00565d83-2a13-0e8f-6040-9b80320c7ba8", "code": "16217", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:16217", "code_system": "CHEBI", "references": [ "068d461c-9777-3623-43e0-68a253f67baf" ] }, { "uuid": "6b75b449-1542-9cdb-4f3b-4818697879fa", "code": "100000144440", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "7d6ba0c0-d100-7105-0ffe-9da8fc5f320d" ] }, { "uuid": "94d3e67a-932e-5673-9894-01cdab46589d", "code": "34393", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=34393", "code_system": "NSC", "references": [ "1495645e-d641-e6b3-1a3d-52f462764b95" ] }, { "uuid": "0e875901-5948-e817-f353-1ee7b7719c29", "code": "WQ29KQ9POT", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=WQ29KQ9POT", "code_system": "DAILYMED", "references": [ "67dfcc3a-972d-dea3-1ccf-142a3496daea" ] }, { "uuid": "c87ada1d-daa4-b773-6a32-4ce4d4fd5c7a", "code": "758238", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=758238", "code_system": "NSC", "references": [ "1495645e-d641-e6b3-1a3d-52f462764b95" ] } ], "relationships": [ { "uuid": "7a774fd6-9391-457a-8648-03ed0b202e87", "amount": { "uuid": "07456ae5-95b5-4de3-aa8b-af16aca33f86" }, "type": "ACTIVE MOIETY", "related_substance": { "uuid": "3e7dd08f-4d37-47e2-b4b8-d5eb9068f65e", "refuuid": "5900c799-106a-46e0-8bc5-e228f17c6dfc", "name": "Gluconolactone", "unii": "WQ29KQ9POT", "linking_id": "WQ29KQ9POT", "ref_pname": "Gluconolactone", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "52be1391-3947-4428-b9ee-64bcefbcb2eb", "name": "(3R,4S,5S,6R)-3,4,5-Trihydroxy-6-(hydroxymethyl)oxan-2-one", "stdName": "(3R,4S,5S,6R)-3,4,5-TRIHYDROXY-6-(HYDROXYMETHYL)OXAN-2-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c3554b81-6d5a-468a-af55-d0a3310ce456" ], "display_name": false }, { "uuid": "7bc95a20-f4cc-4281-a000-630e8189afa9", "name": "(3R,4S,5S,6R)-3,4,5-Trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-one", "stdName": "(3R,4S,5S,6R)-3,4,5-TRIHYDROXY-6-(HYDROXYMETHYL)TETRAHYDRO-2H-PYRAN-2-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "b201a214-ff5a-4c6c-9f96-d58d82926e03" ], "display_name": false }, { "uuid": "de9a2bb4-b977-42ca-9175-868bb95688be", "name": ".DELTA.-D-GLUCONOLACTONE", "stdName": ".DELTA.-D-GLUCONOLACTONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "abe3c4db-ae5f-4eea-8d52-270b2b445ff5" ], "display_name": false }, { "uuid": "28a213c6-3f1e-41b8-a956-4bd4aa4cec13", "name": "D-(+)-Glucono-δ-lactone", "stdName": "D-(+)-GLUCONO-.DELTA.-LACTONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b201a214-ff5a-4c6c-9f96-d58d82926e03" ], "display_name": false }, { "uuid": "8cc455ef-96fd-45e3-96bb-ec20de6200a2", "name": "D-GLUCONIC ACID .DELTA.-LACTONE", "stdName": "D-GLUCONIC ACID .DELTA.-LACTONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "5b44859c-5ade-4a50-b041-65c5f3024b0e" ], "display_name": false }, { "uuid": "5eaae19d-140e-498b-8c6f-155e7dcb9cd9", "name": "D-GLUCONIC ACID DELTA-LACTONE", "stdName": "D-GLUCONIC ACID DELTA-LACTONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2c222847-a050-4607-8dd0-ec4519922866" ], "display_name": false }, { "uuid": "d69ddbd8-9cdc-4a06-a799-76eb3d095919", "name": "D-GLUCONO-1,5-LACTONE", "stdName": "D-GLUCONO-1,5-LACTONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "3d8ceec3-2813-4bd4-971e-38296795406f" ], "display_name": false }, { "uuid": "53cbea80-31a0-4238-a986-ba154ee64d9f", "name": "DELTA-GLUCONOLACTONE", "stdName": "DELTA-GLUCONOLACTONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2c222847-a050-4607-8dd0-ec4519922866" ], "display_name": false }, { "uuid": "bfc07165-fa80-411b-86ed-da6c1d447219", "name": "E-575", "stdName": "E-575", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "2c222847-a050-4607-8dd0-ec4519922866" ], "display_name": false }, { "uuid": "7655aa54-7774-43a2-9a77-ca4c2a027f9e", "name": "FUJIGLUCON", "stdName": "FUJIGLUCON", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "0f26cc00-3786-4a5e-9909-1271754e12f5" ], "display_name": false }, { "uuid": "5291b1d1-9102-4111-8b15-da794ec37a6c", "name": "GDL", "stdName": "GDL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2c222847-a050-4607-8dd0-ec4519922866" ], "display_name": false }, { "uuid": "0bd11437-90fd-4663-b553-86702addd50b", "name": "GLUCONO .DELTA. LACTONE", "stdName": "GLUCONO .DELTA. LACTONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ff53be9f-6d19-42d0-9a71-a41e0bf23c6a" ], "display_name": false }, { "uuid": "bd2fab4b-e514-420a-b098-11056ba466c9", "name": "GLUCONO .DELTA.-LACTONE", "stdName": "GLUCONO .DELTA.-LACTONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ff53be9f-6d19-42d0-9a71-a41e0bf23c6a" ], "display_name": false }, { "uuid": "ce0808ab-add9-4328-b12a-2f2bfc944c71", "name": "GLUCONO DELTA-LACTONE [FCC]", "stdName": "GLUCONO DELTA-LACTONE [FCC]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f97236a4-0379-4980-90d7-2e8746c2d162" ], "display_name": false }, { "uuid": "3ae2cc78-6dc0-4f80-98df-7bf0cd4281aa", "name": "GLUCONO-DELTA-LACTONE [VANDF]", "stdName": "GLUCONO-DELTA-LACTONE [VANDF]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "89fc10e7-89b8-4e4d-91f5-a9aca37bdc50" ], "display_name": false }, { "uuid": "edf48984-c9f0-4b9c-8724-3686891b5bdc", "name": "GLUCONOLACTONE [HSDB]", "stdName": "GLUCONOLACTONE [HSDB]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "36f81e35-c3db-48b6-ab13-8f6826feb2bb" ], "display_name": false }, { "uuid": "e136729c-3c97-4a70-a78c-f03029d892c3", "name": "GLUCONOLACTONE [II]", "stdName": "GLUCONOLACTONE [II]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ff53be9f-6d19-42d0-9a71-a41e0bf23c6a" ], "display_name": false }, { "uuid": "125681aa-41fb-42ef-8a02-ec77d8b64783", "name": "GLUCONOLACTONE [MART.]", "stdName": "GLUCONOLACTONE [MART.]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ca399f42-00de-4a96-b461-b505decada18" ], "display_name": false }, { "uuid": "a29640f0-a40d-451e-bc0f-78f1add3d244", "name": "GLUCONOLACTONE [MI]", "stdName": "GLUCONOLACTONE [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "cba31c7d-a592-44f9-9e2f-7a5a283699a8" ], "display_name": false }, { "uuid": "b63bf7be-7c68-4b47-9f3a-b64231c7498b", "name": "GLUCONOLACTONE [ORANGE BOOK]", "stdName": "GLUCONOLACTONE [ORANGE BOOK]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "75004db7-4e86-4eac-8335-535e946a567d" ], "display_name": false }, { "uuid": "d998d904-3a87-d329-7c24-74acdb65e80c", "name": "GLUCONOLACTONE [USP MONOGRAPH]", "stdName": "GLUCONOLACTONE [USP MONOGRAPH]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f41f29a9-6274-d8be-3de4-debe2d8b58e0" ], "display_name": false }, { "uuid": "b3be16d2-29c5-5cd6-0eba-3a426dac5c5e", "name": "GLUCONOLACTONE [USP-RS]", "stdName": "GLUCONOLACTONE [USP-RS]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "22db9f23-bd02-2b30-c462-25a79cc97896" ], "display_name": false }, { "uuid": "ec8fa811-9a84-42c5-a2af-a69445eb5db5", "name": "Glucono delta-lactone", "stdName": "GLUCONO DELTA-LACTONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "807df30c-c0ba-41f3-8bd3-d93c57dace61", "f97236a4-0379-4980-90d7-2e8746c2d162" ], "display_name": false }, { "uuid": "6a7b6bf7-6e5d-4bb2-9fbd-a91d043b9074", "name": "Gluconolactone", "stdName": "GLUCONOLACTONE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "370c213d-2524-4c2a-b21d-2e9b0b7a3b1f", "cba31c7d-a592-44f9-9e2f-7a5a283699a8", "ff53be9f-6d19-42d0-9a71-a41e0bf23c6a", "08a5d927-ab6e-4339-8351-f66f802c42cb", "01b3102e-8ee4-43c7-8ea9-dee47aeb4558", "3df28bb2-3304-415f-a100-70ea0a63fa44", "09eaeb1f-1743-4eef-aa89-b9993787d343", "c5ce5674-0351-473b-b338-a2234772badb", "36f81e35-c3db-48b6-ab13-8f6826feb2bb", "ca399f42-00de-4a96-b461-b505decada18", "5a0c6f15-4bc0-4ea8-a12a-bf7414730e9e", "db743daa-431a-49c3-9ecd-4d36386e1c67", "421ae86c-7106-4179-b65b-0c5b801cfc33", "be9ea7ed-c410-4926-ade7-7a3c2b366e3a", "08251c65-13ec-4975-ba9d-bd03627e8824", "75004db7-4e86-4eac-8335-535e946a567d" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "d6cdb717-d6ba-4655-9f20-be2d9d57066a", "name_org": "INCI" } ] }, { "uuid": "a5cab48e-57ff-b1ae-4f4f-dcb6694f3180", "name": "Gluconolactone [WHO-DD]", "stdName": "GLUCONOLACTONE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "33a7315a-45b5-8e0c-62dc-693dad48d27b" ], "display_name": false }, { "uuid": "b2b85b27-fa1a-4c86-b421-8fe3859f5549", "name": "INS NO.575", "stdName": "INS NO.575", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "2c222847-a050-4607-8dd0-ec4519922866" ], "display_name": false }, { "uuid": "4f6e0260-cba1-4811-b7d9-2e8df6383542", "name": "INS-575", "stdName": "INS-575", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "2c222847-a050-4607-8dd0-ec4519922866" ], "display_name": false }, { "uuid": "1fe72aa5-9d4b-4799-80d9-9b0f85cc18b5", "name": "LYSACTONE", "stdName": "LYSACTONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "0f26cc00-3786-4a5e-9909-1271754e12f5" ], "display_name": false }, { "uuid": "498aa0fd-49c6-4ea3-b5c6-43f807a8399f", "name": "NSC-34393", "stdName": "NSC-34393", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "80565e54-0b1e-481a-968c-1b83b8eafced" ], "display_name": false }, { "uuid": "3d81d9cc-96ff-0ab2-77f2-a0ce32028723", "name": "NSC-758238", "stdName": "NSC-758238", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "1495645e-d641-e6b3-1a3d-52f462764b95" ], "display_name": false }, { "uuid": "57c4ab92-eee3-4d51-bd9c-36a955c00165", "name": "RENACIDIN COMPONENT GLUCONOLACTONE", "stdName": "RENACIDIN COMPONENT GLUCONOLACTONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "279b62dd-0fd1-4cd1-bc5d-cccf2beca5f8", "c4675d13-3ffd-4d45-bf3d-e0898b87f935" ], "display_name": false }, { "uuid": "2ad5892d-4ddc-4d96-b986-62a26ea7c67d", "name": "RIKEN LACTONE", "stdName": "RIKEN LACTONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "0f26cc00-3786-4a5e-9909-1271754e12f5" ], "display_name": false } ], "references": [ { "uuid": "ff53be9f-6d19-42d0-9a71-a41e0bf23c6a", "citation": "USP Dictionary", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "5b44859c-5ade-4a50-b041-65c5f3024b0e", "citation": "USP DICTIONARY 2009", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "db743daa-431a-49c3-9ecd-4d36386e1c67", "citation": "USP 33", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "279b62dd-0fd1-4cd1-bc5d-cccf2beca5f8", "citation": "Drugs@FDA 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c4675d13-3ffd-4d45-bf3d-e0898b87f935", "citation": "Drugs@FDA 2012", "doc_type": "DRUGS@FDA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "75004db7-4e86-4eac-8335-535e946a567d", "citation": "ORANGE BOOK 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ca399f42-00de-4a96-b461-b505decada18", "citation": "MARTINDALE 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "cba31c7d-a592-44f9-9e2f-7a5a283699a8", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f97236a4-0379-4980-90d7-2e8746c2d162", "citation": "FCC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "421ae86c-7106-4179-b65b-0c5b801cfc33", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "36f81e35-c3db-48b6-ab13-8f6826feb2bb", "citation": "HSDB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "abe3c4db-ae5f-4eea-8d52-270b2b445ff5", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "08251c65-13ec-4975-ba9d-bd03627e8824", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "89fc10e7-89b8-4e4d-91f5-a9aca37bdc50", "citation": "NDF-RT", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "2c222847-a050-4607-8dd0-ec4519922866", "citation": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=172", "url": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=172", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "0f26cc00-3786-4a5e-9909-1271754e12f5", "citation": "SCIFINDER", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3d8ceec3-2813-4bd4-971e-38296795406f", "citation": "http://www.fao.org/ag/agn/jecfa-additives/specs/Monograph1/Additive-202.pdf", "url": "http://www.fao.org/ag/agn/jecfa-additives/specs/Monograph1/Additive-202.pdf", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "80565e54-0b1e-481a-968c-1b83b8eafced", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "de3641e5-37d8-4407-a416-68e1cf6c42aa", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390732000, "tags": [ "NOMEN" ] }, { "uuid": "99f1c9c0-1d38-4b3d-9603-0782eec69198", "citation": "SRS import [WQ29KQ9POT]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=WQ29KQ9POT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390732000, "tags": [ "NOMEN" ] }, { "uuid": "370c213d-2524-4c2a-b21d-2e9b0b7a3b1f", "citation": "GLUCONOLACTONE [USP]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "08a5d927-ab6e-4339-8351-f66f802c42cb", "citation": "GLUCONOLACTONE [ORANGE BOOK]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "09eaeb1f-1743-4eef-aa89-b9993787d343", "citation": "GLUCONOLACTONE [MART.]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "5a0c6f15-4bc0-4ea8-a12a-bf7414730e9e", "citation": "GLUCONOLACTONE [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "01b3102e-8ee4-43c7-8ea9-dee47aeb4558", "citation": "GLUCONOLACTONE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "807df30c-c0ba-41f3-8bd3-d93c57dace61", "citation": "GLUCONO DELTA-LACTONE [FCC]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "c5ce5674-0351-473b-b338-a2234772badb", "citation": "GLUCONOLACTONE [II]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "be9ea7ed-c410-4926-ade7-7a3c2b366e3a", "citation": "GLUCONOLACTONE [HSDB]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "3df28bb2-3304-415f-a100-70ea0a63fa44", "citation": "GLUCONOLACTONE [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "3b433bb6-6a2a-41fc-981e-8b97f19adbf9", "citation": "GLUCONO-DELTA-LACTONE [VANDF]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "75ca68cc-0553-8378-f2d5-ac2022194abc", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+90-80-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "88dc416b-f077-75a0-7a41-b76b804a1c39", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=90-80-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "068d461c-9777-3623-43e0-68a253f67baf", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "b201a214-ff5a-4c6c-9f96-d58d82926e03", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "22db9f23-bd02-2b30-c462-25a79cc97896", "citation": "USP-RS", "doc_type": "USPNF", "public_domain": true }, { "uuid": "1495645e-d641-e6b3-1a3d-52f462764b95", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "f41f29a9-6274-d8be-3de4-debe2d8b58e0", "citation": "USP/NF", "doc_type": "USPNF", "public_domain": true }, { "uuid": "67dfcc3a-972d-dea3-1ccf-142a3496daea", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "33a7315a-45b5-8e0c-62dc-693dad48d27b", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "7d6ba0c0-d100-7105-0ffe-9da8fc5f320d", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "c3554b81-6d5a-468a-af55-d0a3310ce456", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "39bb7bf8-008b-4c57-93f3-baf98ff6bdb6", "id": "39bb7bf8-008b-4c57-93f3-baf98ff6bdb6", "molfile": "\n CDK 05092410562D\n\n 12 12 0 0 1 0 0 0 0 0999 V2000\n 25.3760 -6.1237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.0250 -6.9035 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 22.6830 -6.1287 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 21.3225 -6.9045 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 21.3206 -8.4885 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 22.6626 -9.2633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.6679 -10.8233 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 24.0245 -8.4645 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.9691 -9.2676 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.9741 -6.1200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.6872 -4.5687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.7269 -6.9039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 1 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 6 8 1 0 0 0 0\n 2 8 1 0 0 0 0\n 5 9 1 6 0 0 0\n 4 10 1 1 0 0 0\n 3 11 1 6 0 0 0\n 1 12 1 0 0 0 0\nM END", "smiles": "C([C@@H]1[C@H]([C@@H]([C@H](C(=O)O1)O)O)O)O", "formula": "C6H10O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "66b956db-123a-4e7c-ac39-cc75467c491f" }, "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "178.1403", "optical_activity": "UNSPECIFIED", "stereo_centers": 4 } ], "definition_level": "COMPLETE", "uuid": "5900c799-106a-46e0-8bc5-e228f17c6dfc", "version": "39", "structure": { "id": "16bb65e4-a3cf-4d60-8b9f-2e936a47196c", "molfile": "\n JSDraw205092410562D\n\n 12 12 0 0 1 0 0 V2000\n 20.2936 -5.9556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.6491 -6.7276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.6584 -8.2772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.0152 -9.0595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.3832 -8.2608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.3739 -6.7113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.7175 -5.9186 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.9965 -5.9395 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.7383 -9.0336 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 23.0193 -10.6194 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.3100 -9.0616 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.2845 -4.3956 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 1 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 6 8 1 0 0 0 0\n 2 8 1 0 0 0 0\n 5 9 1 6 0 0 0\n 4 10 1 1 0 0 0\n 3 11 1 6 0 0 0\n 1 12 1 0 0 0 0\nM END", "smiles": "C([C@@H]1[C@H]([C@@H]([C@H](C(=O)O1)O)O)O)O", "formula": "C6H10O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "178.1403", "optical_activity": "UNSPECIFIED", "references": [ "ff53be9f-6d19-42d0-9a71-a41e0bf23c6a", "99f1c9c0-1d38-4b3d-9603-0782eec69198" ], "stereo_centers": 4 }, "unii": "WQ29KQ9POT" } ] }