{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9abced08-06ef-49fe-bdad-9608811c0260",
          "code": "R01AB06",
          "comments": "ATC|RESPIRATORY SYSTEM|NASAL PREPARATIONS|DECONGESTANTS AND OTHER NASAL PREPARATIONS FOR TOPICAL USE|Sympathomimetics, combinations excl. corticosteroids|xylometazoline",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=R01AB06&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "36079a68-1a99-44ba-bf00-2cfd74cc8d36"
          ]
        },
        {
          "uuid": "b502fdaa-d550-436c-b02d-44d8834e943b",
          "code": "R01AA07",
          "comments": "ATC|RESPIRATORY SYSTEM|NASAL PREPARATIONS|DECONGESTANTS AND OTHER NASAL PREPARATIONS FOR TOPICAL USE|Sympathomimetics, plain|xylometazoline",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=R01AA07&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "36079a68-1a99-44ba-bf00-2cfd74cc8d36"
          ]
        },
        {
          "uuid": "e1bad358-cff4-4405-a983-1ccebcf96b50",
          "code": "S01GA03",
          "comments": "ATC|SENSORY ORGANS|OPHTHALMOLOGICALS|DECONGESTANTS AND ANTIALLERGICS|Sympathomimetics used as decongestants|xylometazoline",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=S01GA03&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "36079a68-1a99-44ba-bf00-2cfd74cc8d36"
          ]
        },
        {
          "uuid": "d7e03971-5e3b-4373-a637-fc597af990f0",
          "code": "QR01AA07",
          "comments": "VATC|NASAL PREPARATIONS|DECONGESTANTS AND OTHER NASAL PREPARATIONS FOR TOPICAL USE|Sympathomimetics, plain|xylometazoline",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QR01AA07&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "36079a68-1a99-44ba-bf00-2cfd74cc8d36"
          ]
        },
        {
          "uuid": "13064475-c063-4a4a-a249-f7529bd4fda6",
          "code": "QS01GA03",
          "comments": "VATC|OPHTHALMOLOGICALS|DECONGESTANTS AND ANTIALLERGICS|Sympathomimetics used as decongestants|xylometazoline",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QS01GA03&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "36079a68-1a99-44ba-bf00-2cfd74cc8d36"
          ]
        },
        {
          "uuid": "dd3e5deb-6c84-4be0-8399-0cf0088c65cc",
          "code": "QS01GA53",
          "comments": "VATC|OPHTHALMOLOGICALS|DECONGESTANTS AND ANTIALLERGICS|Sympathomimetics used as decongestants|xylometazoline, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QS01GA53&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "36079a68-1a99-44ba-bf00-2cfd74cc8d36"
          ]
        },
        {
          "uuid": "6884637b-44cb-46a0-807e-95cdbac0708f",
          "code": "526-36-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=526-36-3",
          "code_system": "CAS",
          "references": [
            "36079a68-1a99-44ba-bf00-2cfd74cc8d36",
            "20256456-6267-4da6-8598-d54d4d59d46d"
          ]
        },
        {
          "uuid": "1b6145bc-9cc0-43de-8faa-57d0433e56bb",
          "code": "C87749",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C87749",
          "code_system": "NCI_THESAURUS",
          "references": [
            "36079a68-1a99-44ba-bf00-2cfd74cc8d36"
          ]
        },
        {
          "uuid": "055a4a5b-4800-4c34-9ca2-59102fa7b75b",
          "code": "C009695",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67009695",
          "code_system": "MESH",
          "references": [
            "36079a68-1a99-44ba-bf00-2cfd74cc8d36"
          ]
        },
        {
          "uuid": "4f528d22-efca-4494-8b2c-3d46115abda7",
          "code": "28",
          "comments": "WHO ESSENTIAL MEDICINES LIST|Ear, nose and throat conditions in children",
          "type": "PRIMARY",
          "url": "http://prais.paho.org/medicine/359/?section=163#type777",
          "code_system": "WHO-ESSENTIAL MEDICINES LIST",
          "references": [
            "36079a68-1a99-44ba-bf00-2cfd74cc8d36"
          ]
        },
        {
          "uuid": "60dd4f72-0e7b-4a5d-9133-3b472a3ab8ce",
          "code": "XYLOMETAZOLINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Xylometazoline",
          "code_system": "WIKIPEDIA",
          "references": [
            "36079a68-1a99-44ba-bf00-2cfd74cc8d36"
          ]
        },
        {
          "uuid": "d1e2cf9e-878f-4778-9bc9-54193ae957c5",
          "code": "S01GA53",
          "comments": "ATC|SENSORY ORGANS|OPHTHALMOLOGICALS|DECONGESTANTS AND ANTIALLERGICS|Sympathomimetics used as decongestants|xylometazoline, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=S01GA53&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "36079a68-1a99-44ba-bf00-2cfd74cc8d36"
          ]
        },
        {
          "uuid": "cd0f601a-6288-42cf-962f-631775c28d82",
          "code": "QR01AB06",
          "comments": "VATC|NASAL PREPARATIONS|DECONGESTANTS AND OTHER NASAL PREPARATIONS FOR TOPICAL USE|Sympathomimetics, combinations excl. corticosteroids|xylometazoline",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QR01AB06&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "36079a68-1a99-44ba-bf00-2cfd74cc8d36"
          ]
        },
        {
          "uuid": "b2b64933-bb6c-46e5-90df-eac16924cb0c",
          "code": "809",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=809",
          "code_system": "INN",
          "references": [
            "36079a68-1a99-44ba-bf00-2cfd74cc8d36"
          ]
        },
        {
          "uuid": "00cb4466-40f8-4993-bdfb-8f5a8b62c69e",
          "code": "517",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=517",
          "code_system": "IUPHAR",
          "references": [
            "36079a68-1a99-44ba-bf00-2cfd74cc8d36"
          ]
        },
        {
          "uuid": "2270842e-54bd-410d-b4c6-31c2574c9a6d",
          "code": "39841",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/39841/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "36079a68-1a99-44ba-bf00-2cfd74cc8d36"
          ]
        },
        {
          "uuid": "641109a2-1223-4537-b88d-1513c45d4e44",
          "code": "m11554",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11554?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "36079a68-1a99-44ba-bf00-2cfd74cc8d36"
          ]
        },
        {
          "uuid": "080466f4-4a3e-4ea5-98c4-be5f7184a025",
          "code": "DB06694",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB06694",
          "code_system": "DRUG BANK",
          "references": [
            "36079a68-1a99-44ba-bf00-2cfd74cc8d36"
          ]
        },
        {
          "uuid": "8db460fa-836e-45c6-ab7b-d66d57d18eb2",
          "code": "SUB00122MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "36079a68-1a99-44ba-bf00-2cfd74cc8d36"
          ]
        },
        {
          "uuid": "a54bbe75-d8e0-48fc-9c1c-e9ed9d6cfadb",
          "code": "CHEMBL312448",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL312448",
          "code_system": "ChEMBL",
          "references": [
            "36079a68-1a99-44ba-bf00-2cfd74cc8d36"
          ]
        },
        {
          "uuid": "8766c533-e8b0-49fe-a4c4-5bded56732d0",
          "code": "5709",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5709",
          "code_system": "PUBCHEM",
          "references": [
            "36079a68-1a99-44ba-bf00-2cfd74cc8d36"
          ]
        },
        {
          "uuid": "43fcfe75-29bc-4f6c-b92b-dab321572069",
          "code": "208-390-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.629",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "36079a68-1a99-44ba-bf00-2cfd74cc8d36"
          ]
        },
        {
          "uuid": "a4c3c0df-df97-4155-c354-0afc518ff27d",
          "code": "DTXSID8046957",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8046957",
          "code_system": "EPA CompTox",
          "references": [
            "a67b1263-5ff3-44fc-a7ec-a791b2009730"
          ]
        },
        {
          "uuid": "f15ffccb-bc8f-6aae-fdb4-85e1c0abb0d2",
          "code": "C29709",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Adrenergic Agent[C29747]|Adrenergic Agonist[C87053]|Alpha-Adrenergic Agonist",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29709",
          "code_system": "NCI_THESAURUS",
          "references": [
            "b7f4348d-0448-4a51-5919-37f4bee35b6e"
          ]
        },
        {
          "uuid": "4cec0e52-7bc5-7d5a-f2af-a10cc89d0d41",
          "code": "C29578",
          "comments": "Pharmacologic Substance[C1909]|Immunotherapeutic Agent[C308]|Histamine-1 Receptor Antagonist",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29578",
          "code_system": "NCI_THESAURUS",
          "references": [
            "b7f4348d-0448-4a51-5919-37f4bee35b6e"
          ]
        },
        {
          "uuid": "aa2c9de3-f122-4669-9ab4-3f34dc0ec96e",
          "code": "WPY40FTH8K",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ea5f7159-89ad-5079-744e-6e14030779ef",
          "code": "3658",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3658",
          "code_system": "DRUG CENTRAL",
          "references": [
            "b7f4348d-0448-4a51-5919-37f4bee35b6e"
          ]
        },
        {
          "uuid": "a10888e0-fdd3-2919-7130-0bad2958587b",
          "code": "WPY40FTH8K",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=WPY40FTH8K",
          "code_system": "DAILYMED",
          "references": [
            "3c85c5cf-d166-2ffe-72fd-6c6c7921a1ae"
          ]
        },
        {
          "uuid": "1e66a752-4b72-192f-006e-cc116960cd5d",
          "code": "100000079363",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "c5b93197-cb95-5fee-2e73-f0d2fd648d68"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "6d777869-c8e6-493c-9bca-7ec38e39fedd",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "8f3d8565-6abe-4fb6-a92e-9521cb9cdb65",
            "refuuid": "aee187ea-6a4b-4ce8-b59b-e85a8045f62e",
            "name": "XYLOMETAZOLINE",
            "unii": "WPY40FTH8K",
            "linking_id": "WPY40FTH8K",
            "ref_pname": "XYLOMETAZOLINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "5667a92b-6add-468a-9760-c64b34829e46",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "c413d27e-320d-46d4-a88f-e544185f8393",
            "refuuid": "632f506c-a3b1-4997-8fe3-6f5efe69ab9f",
            "name": "XYLOMETAZOLINE HYDROCHLORIDE",
            "unii": "X5S84033NZ",
            "linking_id": "X5S84033NZ",
            "ref_pname": "XYLOMETAZOLINE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "653736e0-c5da-4cf5-9f2c-845b2ed06ac8",
          "type": "IMPURITY->PARENT",
          "related_substance": {
            "uuid": "eba14710-f783-4ce7-a4a7-3072234610cf",
            "refuuid": "3df4e5da-7667-4033-8de7-56987e6e50a3",
            "name": "N-(2-AMINOETHYL)-2-(4-(TERT-BUTYL)-2,6-DIMETHYLPHENYL)ACETAMIDE",
            "unii": "C35A4W5KUD",
            "linking_id": "C35A4W5KUD",
            "ref_pname": "N-(2-AMINOETHYL)-2-(4-(TERT-BUTYL)-2,6-DIMETHYLPHENYL)ACETAMIDE"
          }
        },
        {
          "uuid": "8333220f-201b-4dc1-8200-257c96e241e6",
          "amount": {
            "uuid": "d9ef9c2c-374e-447a-9165-62735fbc8598"
          },
          "type": "TARGET->AGONIST",
          "related_substance": {
            "uuid": "e792035a-a9de-49e7-8fa8-f1fff6347671",
            "refuuid": "6405b2ce-8c41-48ff-873d-e8ddad175f61",
            "name": "ALPHA-2B ADRENERGIC RECEPTOR",
            "unii": "93V99BB37L",
            "linking_id": "93V99BB37L",
            "ref_pname": "ALPHA-2B ADRENERGIC RECEPTOR",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "12b5cd44-b101-424c-97bd-883e290c622a",
          "name": "1H-IMIDAZOLE, 2-((4-(1,1-DIMETHYLETHYL)-2,6-DIMETHYLPHENYL)METHYL)-4,5-DIHYDRO-",
          "stdName": "1H-IMIDAZOLE, 2-((4-(1,1-DIMETHYLETHYL)-2,6-DIMETHYLPHENYL)METHYL)-4,5-DIHYDRO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2ff028e-d39a-4315-8c0d-a9d25dc41de3"
          ],
          "display_name": false
        },
        {
          "uuid": "913ba7eb-5c54-4cdb-8b26-f8f379dd34bc",
          "name": "2-(4-TERT-BUTYL-2,6-DIMETHYLBENZYL)-2-IMIDAZOLINE",
          "stdName": "2-(4-TERT-BUTYL-2,6-DIMETHYLBENZYL)-2-IMIDAZOLINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2ff028e-d39a-4315-8c0d-a9d25dc41de3"
          ],
          "display_name": false
        },
        {
          "uuid": "bdb8a15e-ba42-4632-814c-ee0fc7ffade6",
          "name": "BALMINIL",
          "stdName": "BALMINIL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d0763052-78d5-4cb5-961b-04deef522c06",
            "1df11d9e-4bf2-4607-874d-e1ac3120c4e6"
          ],
          "display_name": false
        },
        {
          "uuid": "60ad52d4-bea2-48f2-a9a8-8f6aa5a366cb",
          "name": "XYLOMETAZOLINE",
          "stdName": "XYLOMETAZOLINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5425439e-33cf-40df-9555-517c87c6e41f",
            "b2ff028e-d39a-4315-8c0d-a9d25dc41de3",
            "b079d30f-4df2-4290-b7a6-7c4ead60941d",
            "709eff0e-c806-4035-a6d4-8cba6586c3e8",
            "12022ba1-aa6d-48ee-a060-4f0df140b8ac",
            "d9b78d3d-2ae6-448e-bc31-4841d2a2ecde",
            "42022c16-e701-49b2-bb5e-6f624ae20994",
            "df4ae216-9e9f-478d-9340-3fa6c618649a",
            "aed98a02-34ae-4fb1-bae1-cb0f294d4428"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "ed887ebb-bd9c-4913-8350-f896f3271bb3",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "99af8889-73e4-4d23-ae89-ffc9165cfa13",
          "name": "XYLOMETAZOLINE [MI]",
          "stdName": "XYLOMETAZOLINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aed98a02-34ae-4fb1-bae1-cb0f294d4428"
          ],
          "display_name": false
        },
        {
          "uuid": "a8106276-55fc-4cf3-bb8d-66edbbb0f3e2",
          "name": "XYLOMETAZOLINE [VANDF]",
          "stdName": "XYLOMETAZOLINE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d9b78d3d-2ae6-448e-bc31-4841d2a2ecde"
          ],
          "display_name": false
        },
        {
          "uuid": "67346bec-b254-a65b-e18e-24e3335d8102",
          "name": "Xylometazoline [WHO-DD]",
          "stdName": "XYLOMETAZOLINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6705f857-4723-ac0b-a029-360089e28d46"
          ],
          "display_name": false
        },
        {
          "uuid": "2c0863a0-9ffe-41ff-9017-cf3649c99ae1",
          "name": "xylometazoline [INN]",
          "stdName": "XYLOMETAZOLINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b079d30f-4df2-4290-b7a6-7c4ead60941d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b2ff028e-d39a-4315-8c0d-a9d25dc41de3",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b079d30f-4df2-4290-b7a6-7c4ead60941d",
          "citation": "INN Proposed List 8",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL08.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "aed98a02-34ae-4fb1-bae1-cb0f294d4428",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1df11d9e-4bf2-4607-874d-e1ac3120c4e6",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d0763052-78d5-4cb5-961b-04deef522c06",
          "citation": "D08684",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "709eff0e-c806-4035-a6d4-8cba6586c3e8",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d9b78d3d-2ae6-448e-bc31-4841d2a2ecde",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "36079a68-1a99-44ba-bf00-2cfd74cc8d36",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390523000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d7a40d84-0ce4-4995-b461-77b378bafc5d",
          "citation": "SRS import [WPY40FTH8K]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=WPY40FTH8K",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390523000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "42022c16-e701-49b2-bb5e-6f624ae20994",
          "citation": "XYLOMETAZOLINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5425439e-33cf-40df-9555-517c87c6e41f",
          "citation": "XYLOMETAZOLINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "12022ba1-aa6d-48ee-a060-4f0df140b8ac",
          "citation": "XYLOMETAZOLINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "df4ae216-9e9f-478d-9340-3fa6c618649a",
          "citation": "XYLOMETAZOLINE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a67b1263-5ff3-44fc-a7ec-a791b2009730",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=526-36-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f68e6173-84bd-8bd3-bb5f-0f8dd9480205",
          "citation": "https://www.drugbank.ca/drugs/DB06694",
          "doc_type": "WEBSITE",
          "public_domain": true
        },
        {
          "uuid": "b7f4348d-0448-4a51-5919-37f4bee35b6e",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "20256456-6267-4da6-8598-d54d4d59d46d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6705f857-4723-ac0b-a029-360089e28d46",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "3c85c5cf-d166-2ffe-72fd-6c6c7921a1ae",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "c5b93197-cb95-5fee-2e73-f0d2fd648d68",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1012b8d6-7748-4cd5-bb54-c08df4f25ee9",
          "id": "1012b8d6-7748-4cd5-bb54-c08df4f25ee9",
          "molfile": "\n  Marvin  01132101042D          \n\n 18 19  0  0  0  0            999 V2000\n    9.7542  -18.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0417  -18.4708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3250  -18.8833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6125  -18.4708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6125  -17.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3250  -17.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3167  -16.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0417  -17.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7542  -17.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4667  -17.6375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2542  -17.3833    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7375  -18.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2458  -18.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4625  -18.4625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8917  -18.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1792  -18.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8917  -19.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1792  -19.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  8  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n 15  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  7  6  1  0  0  0  0\n  6  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 14 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 15  1  0  0  0  0\n 18 15  1  0  0  0  0\nM  END",
          "smiles": "Cc1cc(cc(C)c1CC2=NCCN2)C(C)(C)C",
          "formula": "C16H24N2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4bf9d05e-2a0b-4d11-bfad-fd27986fe6b6"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "244.3758",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "aee187ea-6a4b-4ce8-b59b-e85a8045f62e",
      "version": "16",
      "structure": {
        "id": "62dca745-20d4-4dc5-8604-fb98a9df4e64",
        "molfile": "\n  Marvin  01132105082D          \n\n 18 19  0  0  0  0            999 V2000\n    9.0417  -17.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6125  -18.4708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4667  -17.6375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0417  -18.4708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3250  -17.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4625  -18.4625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3250  -18.8833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6125  -17.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7542  -17.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2542  -17.3833    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8917  -18.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2458  -18.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7542  -18.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3167  -16.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7375  -18.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1792  -18.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8917  -19.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1792  -19.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  8  2  0  0  0  0\n  3  9  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  1  2  0  0  0  0\n  6  3  2  0  0  0  0\n  7  4  2  0  0  0  0\n  8  5  1  0  0  0  0\n  9  1  1  0  0  0  0\n 10  3  1  0  0  0  0\n 11  2  1  0  0  0  0\n 12  6  1  0  0  0  0\n 13  4  1  0  0  0  0\n 14  5  1  0  0  0  0\n 15 10  1  0  0  0  0\n 16 11  1  0  0  0  0\n 17 11  1  0  0  0  0\n 18 11  1  0  0  0  0\n  7  2  1  0  0  0  0\n 15 12  1  0  0  0  0\nM  END",
        "smiles": "Cc1cc(cc(C)c1CC2=NCCN2)C(C)(C)C",
        "formula": "C16H24N2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "244.3758",
        "optical_activity": "NONE",
        "references": [
          "d7a40d84-0ce4-4995-b461-77b378bafc5d",
          "b2ff028e-d39a-4315-8c0d-a9d25dc41de3",
          "b079d30f-4df2-4290-b7a6-7c4ead60941d"
        ],
        "stereo_centers": 0
      },
      "unii": "WPY40FTH8K"
    }
  ]
}