{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "e4df1eb5-e3a4-4a33-90b1-ab24fedb059c", "code": "67527-71-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=67527-71-3", "code_system": "CAS", "references": [ "b00f6300-7079-4b3d-8a5f-61fe9467b127", "bd65f408-366c-4eb2-a6a4-05696a8cf708" ] }, { "uuid": "d1cd30f9-b99e-4801-a9c0-b9d8b53c51a0", "code": "m7542", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m7542?q=authorize", "code_system": "MERCK INDEX", "references": [ "b00f6300-7079-4b3d-8a5f-61fe9467b127" ] }, { "uuid": "227b4c79-d2d4-4e3c-8b86-84c3857ecc01", "code": "12850205", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/12850205", "code_system": "PUBCHEM", "references": [ "b00f6300-7079-4b3d-8a5f-61fe9467b127" ] }, { "uuid": "72e74bcb-05d5-444a-a31a-803f411607d5", "code": "WPS3TSW377", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "b2fc755d-192d-3d21-5987-4c19e9ba4ab4", "code": "DTXSID30986909", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30986909", "code_system": "EPA CompTox" } ], "relationships": [ { "uuid": "a0f49d4e-24fc-449e-9f23-2f0d22bb906c", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "19626abd-054b-4dc8-a869-c3a702ad9d42", "refuuid": "ceddffcf-fa95-4323-8041-721824ea0198", "name": "MILDIOMYCIN", "unii": "WPS3TSW377", "linking_id": "WPS3TSW377", "ref_pname": "MILDIOMYCIN", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "dad31cf7-5298-419c-84e8-441d31415ae8", "name": "2(1H)-PYRIMIDINONE, 4-AMINO-1-(4-(((2S)-2-AMINO-3-HYDROXY-1-OXOPROPYL)AMINO)-9-((AMINOIMINOMETHYL)AMINO)-6-C-CARBOXY-2,3,4,7,9-PENTADEOXY-.ALPHA.-L-TALO-NON-2-ENOPYRANOSYL)-5-(HYDROXYMETHYL)-", "stdName": "2(1H)-PYRIMIDINONE, 4-AMINO-1-(4-(((2S)-2-AMINO-3-HYDROXY-1-OXOPROPYL)AMINO)-9-((AMINOIMINOMETHYL)AMINO)-6-C-CARBOXY-2,3,4,7,9-PENTADEOXY-.ALPHA.-L-TALO-NON-2-ENOPYRANOSYL)-5-(HYDROXYMETHYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "56c3f06e-0a20-453d-82c5-0639ecd0272e", "3da136a9-42ed-4eda-846e-93e8f17e18ff" ], "display_name": false }, { "uuid": "da03d7c2-1cf3-4bf4-a5c8-585ce76ea2fd", "name": "ANTIBIOTIC B 98891", "stdName": "ANTIBIOTIC B 98891", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "56c3f06e-0a20-453d-82c5-0639ecd0272e", "3da136a9-42ed-4eda-846e-93e8f17e18ff" ], "display_name": false }, { "uuid": "ad6b568d-ee04-4586-b343-e6abc253d4c5", "name": "MILDIOMYCIN", "stdName": "MILDIOMYCIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9d4e6694-40a1-444f-abe1-66db5651be06", "4ecfa6a8-de6a-4d83-8db5-0fc717f45d94", "45fdcbc7-5e79-4975-908a-537234301a16", "3da136a9-42ed-4eda-846e-93e8f17e18ff" ], "display_name": true }, { "uuid": "9e14adeb-19b8-450b-9f83-58e3e2999c3c", "name": "MILDIOMYCIN [MI]", "stdName": "MILDIOMYCIN [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9d4e6694-40a1-444f-abe1-66db5651be06", "3da136a9-42ed-4eda-846e-93e8f17e18ff" ], "display_name": false }, { "uuid": "75bf6735-8b1a-47c4-b301-ef34601f274c", "name": "MIRANESHIN", "stdName": "MIRANESHIN", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "56c3f06e-0a20-453d-82c5-0639ecd0272e", "3da136a9-42ed-4eda-846e-93e8f17e18ff" ], "display_name": false }, { "uuid": "cf70ea0c-fc0c-45d9-bb37-983cd1f0f564", "name": "TF-138", "stdName": "TF-138", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "56c3f06e-0a20-453d-82c5-0639ecd0272e", "3da136a9-42ed-4eda-846e-93e8f17e18ff" ], "display_name": false } ], "references": [ { "uuid": "9d4e6694-40a1-444f-abe1-66db5651be06", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "3da136a9-42ed-4eda-846e-93e8f17e18ff", "citation": "MERCK INDEX", "doc_type": "MERCK INDEX", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "56c3f06e-0a20-453d-82c5-0639ecd0272e", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "45fdcbc7-5e79-4975-908a-537234301a16", "citation": "Merk Index", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b00f6300-7079-4b3d-8a5f-61fe9467b127", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392600000, "tags": [ "NOMEN" ] }, { "uuid": "2efbdb54-14d0-43fb-899f-5585bbfb832a", "citation": "SRS import [WPS3TSW377]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=WPS3TSW377", "doc_type": "SRS", "public_domain": true, "document_date": 1493392600000, "tags": [ "NOMEN" ] }, { "uuid": "26c971fc-639b-40b8-a02c-20b2d13a671d", "citation": "MERK INDEX MONOGRAPH: MONO1500006272", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4ecfa6a8-de6a-4d83-8db5-0fc717f45d94", "citation": "MILDIOMYCIN [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "bd65f408-366c-4eb2-a6a4-05696a8cf708", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "1ea42382-1a31-4902-b4e3-c911324191ed", "id": "1ea42382-1a31-4902-b4e3-c911324191ed", "molfile": "\n Marvin 01132101452D \n\n 36 37 0 0 1 0 999 V2000\n 3.7395 -6.2046 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 3.3969 -5.4571 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2605 -6.8760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4389 -6.7954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5610 -6.2850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8991 -7.0372 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0354 -5.6181 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8570 -5.6942 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 6.1996 -6.4463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0211 -6.5268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4955 -5.8553 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 7.1576 -5.1032 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3361 -5.0273 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 5.9935 -4.2752 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 5.2460 -4.6131 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6556 -3.5277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8340 -3.4471 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 4.3550 -4.1140 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4961 -2.6950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6746 -2.6145 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3319 -1.8669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8155 -1.1955 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5151 -1.7864 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7457 -3.9325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4172 -4.4115 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8263 -3.1157 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3171 -5.9359 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6551 -6.6834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4767 -6.7640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8192 -7.5161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3402 -8.1829 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9557 -6.0971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7772 -6.1731 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6177 -5.3449 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7962 -5.2645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4536 -4.5123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 3 1 0 0 0 0\n 1 5 1 0 0 0 0\n 3 4 1 0 0 0 0\n 5 6 2 0 0 0 0\n 5 7 1 0 0 0 0\n 8 7 1 6 0 0 0\n 8 9 1 0 0 0 0\n 13 8 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 1 0 0 0\n 11 27 1 0 0 0 0\n 13 12 1 1 0 0 0\n 14 13 1 0 0 0 0\n 14 15 1 1 0 0 0\n 14 16 1 0 0 0 0\n 14 24 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 21 23 2 0 0 0 0\n 24 25 1 0 0 0 0\n 24 26 2 0 0 0 0\n 27 28 1 0 0 0 0\n 27 35 1 0 0 0 0\n 28 29 2 0 0 0 0\n 29 30 1 0 0 0 0\n 29 32 1 0 0 0 0\n 30 31 1 0 0 0 0\n 32 33 1 0 0 0 0\n 32 34 2 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 2 0 0 0 0\nM END", "smiles": "C1=C[C@H](n2cc(CO)c(N)nc2=O)O[C@@H]([C@H]1NC(=O)[C@H](CO)N)[C@](CC(CNC(=N)N)O)(C(=O)O)O", "formula": "C19H30N8O9", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "EPIMERIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "9a961b9a-e867-4fae-b16c-7410f1be7253" }, "defined_stereo": 5, "ez_centers": 0, "molecular_weight": "514.4905", "optical_activity": "UNSPECIFIED", "stereo_centers": 6 } ], "definition_level": "COMPLETE", "uuid": "ceddffcf-fa95-4323-8041-721824ea0198", "version": "3", "structure": { "id": "3572dfc8-570d-4921-99f7-c4d63d6cdaa1", "molfile": "\n Marvin 01132102512D \n\n 36 37 0 0 0 0 999 V2000\n 3.3969 -5.4571 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7395 -6.2046 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 3.2605 -6.8760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4389 -6.7954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5610 -6.2850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8991 -7.0372 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0354 -5.6181 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8570 -5.6942 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.1996 -6.4463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0211 -6.5268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4955 -5.8553 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 8.3171 -5.9359 0.0000 N 0 0 1 0 0 0 0 0 0 0 0 0\n 8.6551 -6.6834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4767 -6.7640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8192 -7.5161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3402 -8.1829 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9557 -6.0971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7772 -6.1731 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6177 -5.3449 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7962 -5.2645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4536 -4.5123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1576 -5.1032 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3361 -5.0273 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 5.9935 -4.2752 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 5.2460 -4.6131 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6556 -3.5277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8340 -3.4471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3550 -4.1140 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4961 -2.6950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6746 -2.6145 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3319 -1.8669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8155 -1.1955 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5151 -1.7864 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7457 -3.9325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4172 -4.4115 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8263 -3.1157 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 6 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 2 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 5 7 1 0 0 0 0\n 8 7 1 6 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 1 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 14 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 12 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 11 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 8 23 1 0 0 0 0\n 23 24 1 1 0 0 0\n 24 25 1 0 0 0 0\n 24 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 27 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 2 0 0 0 0\n 31 32 1 0 0 0 0\n 31 33 1 0 0 0 0\n 24 34 1 0 0 0 0\n 34 35 1 0 0 0 0\n 34 36 2 0 0 0 0\nM END", "smiles": "C1=C[C@H](n2cc(CO)c(N)nc2=O)O[C@@H]([C@H]1NC(=O)[C@H](CO)N)C(CC(CN=C(N)N)O)(C(=O)O)O", "formula": "C19H30N8O9", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "UNKNOWN", "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "514.4905", "optical_activity": "UNSPECIFIED", "references": [ "26c971fc-639b-40b8-a02c-20b2d13a671d", "2efbdb54-14d0-43fb-899f-5585bbfb832a" ], "stereo_centers": 6 }, "unii": "WPS3TSW377" } ] }