{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a8766f89-6d95-4335-987c-1c93ffae0137",
          "code": "1100-88-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1100-88-5",
          "code_system": "CAS",
          "references": [
            "076c7171-c093-446e-9506-1c49d0061316",
            "39c62e9a-e141-490a-9a52-17d1d3972af1"
          ]
        },
        {
          "uuid": "af5e4506-82a3-4087-bfe1-f5486f5a43c3",
          "code": "214-154-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.012.868",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "076c7171-c093-446e-9506-1c49d0061316"
          ]
        },
        {
          "uuid": "9f671e8f-75eb-4172-802f-b3d412c06723",
          "code": "70671",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/70671",
          "code_system": "PUBCHEM",
          "references": [
            "076c7171-c093-446e-9506-1c49d0061316"
          ]
        },
        {
          "uuid": "4a69a3bb-699a-cf7d-9c29-77e95234ee25",
          "code": "DTXSID6051566",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6051566",
          "code_system": "EPA CompTox",
          "references": [
            "ee9b4307-6195-9fbe-244c-c019947412a7"
          ]
        },
        {
          "uuid": "f114d40a-2f2f-28d6-3f70-62062e94c10e",
          "code": "116712",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=116712",
          "code_system": "NSC",
          "references": [
            "8574e6df-5d9e-40ab-b124-540634334848"
          ]
        },
        {
          "uuid": "d3472a1c-fab5-48d9-992b-5cb8c4976d5b",
          "code": "WM5533HY8L",
          "type": "PRIMARY",
          "code_system": "FDA UNII",
          "references": [
            "39c62e9a-e141-490a-9a52-17d1d3972af1"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2b319011-0842-4a6f-94b9-787459fe1f28",
          "name": "BENZYLTRIPHENYLPHOSPHONIUM CHLORIDE",
          "stdName": "BENZYLTRIPHENYLPHOSPHONIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "55d97146-691b-43ae-a690-d4d624e329e0",
            "dc04cb12-7390-4e80-b325-27595addfdc1"
          ],
          "display_name": true
        },
        {
          "uuid": "d7c789a3-86d1-4025-95fd-bf406dfd22db",
          "name": "BPP",
          "stdName": "BPP",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "39c62e9a-e141-490a-9a52-17d1d3972af1"
          ],
          "display_name": false
        },
        {
          "uuid": "8f6a847c-4ae6-4c1d-bf8d-57a4eb43f847",
          "name": "GM-200",
          "stdName": "GM-200",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "39c62e9a-e141-490a-9a52-17d1d3972af1"
          ],
          "display_name": false
        },
        {
          "uuid": "d65b357c-ed64-4a40-a18e-f009f1d56629",
          "name": "NSC-116712",
          "stdName": "NSC-116712",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "55d97146-691b-43ae-a690-d4d624e329e0",
            "dc04cb12-7390-4e80-b325-27595addfdc1"
          ],
          "display_name": false
        },
        {
          "uuid": "57826fc6-426f-48c8-97d0-319a3045481d",
          "name": "Phosphonium, benzyltriphenyl-, chloride",
          "stdName": "PHOSPHONIUM, BENZYLTRIPHENYL-, CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "39c62e9a-e141-490a-9a52-17d1d3972af1"
          ],
          "display_name": false
        },
        {
          "uuid": "227506f1-8808-4fe7-98bb-bd5a36242d5b",
          "name": "Phosphonium, triphenyl(phenylmethyl)-, chloride",
          "stdName": "PHOSPHONIUM, TRIPHENYL(PHENYLMETHYL)-, CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "39c62e9a-e141-490a-9a52-17d1d3972af1"
          ],
          "display_name": false
        },
        {
          "uuid": "fb77ff8d-64d4-40a6-9d75-77aba13db15a",
          "name": "Phosphonium, triphenyl(phenylmethyl)-, chloride (1:1)",
          "stdName": "PHOSPHONIUM, TRIPHENYL(PHENYLMETHYL)-, CHLORIDE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "39c62e9a-e141-490a-9a52-17d1d3972af1"
          ],
          "display_name": false
        },
        {
          "uuid": "64654cf6-5890-48e4-87ad-dd19d0508e8b",
          "name": "TPP-ZC",
          "stdName": "TPP-ZC",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "39c62e9a-e141-490a-9a52-17d1d3972af1"
          ],
          "display_name": false
        },
        {
          "uuid": "b06372b8-a1d7-440d-8ffe-ef5db925397a",
          "name": "Triphenylbenzylphosphonium chloride",
          "stdName": "TRIPHENYLBENZYLPHOSPHONIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "39c62e9a-e141-490a-9a52-17d1d3972af1"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "55d97146-691b-43ae-a690-d4d624e329e0",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dc04cb12-7390-4e80-b325-27595addfdc1",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "076c7171-c093-446e-9506-1c49d0061316",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393998000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ee9b4307-6195-9fbe-244c-c019947412a7",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1100-88-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "39c62e9a-e141-490a-9a52-17d1d3972af1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8574e6df-5d9e-40ab-b124-540634334848",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b052bce4-785f-4de7-b7d5-55eb81bcf33a",
          "id": "b052bce4-785f-4de7-b7d5-55eb81bcf33a",
          "molfile": "\n  Marvin  02202310562D          \n\n 26 29  0  0  0  0            999 V2000\n   12.6231   -4.1937    0.0000 P   0  3  0  0  0  0  0  0  0  0  0  0\n   13.3375   -4.6063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9086   -3.7813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1941   -4.1937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9086   -2.9562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4796   -3.7813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1941   -2.5438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4796   -2.9562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8366   -3.3968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2532   -2.8135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6334   -3.1833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4667   -2.0165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8470   -2.3864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2636   -1.8031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2105   -4.9082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3856   -4.9082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6231   -5.6227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9731   -5.6227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2105   -6.3371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3856   -6.3371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0520   -4.1937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0520   -3.3688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7665   -4.6063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7665   -2.9562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4810   -4.1937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4810   -3.3688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  9  1  0  0  0  0\n  1 15  1  0  0  0  0\n  2 21  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  5  7  2  0  0  0  0\n  6  8  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 11 13  2  0  0  0  0\n 12 14  2  0  0  0  0\n 13 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 17 19  2  0  0  0  0\n 18 20  2  0  0  0  0\n 19 20  1  0  0  0  0\n 21 22  2  0  0  0  0\n 21 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 23 25  2  0  0  0  0\n 24 26  2  0  0  0  0\n 25 26  1  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "c1ccc(cc1)C[P+](c2ccccc2)(c3ccccc3)c4ccccc4",
          "formula": "C25H22P",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "975b1399-2317-4d28-9ce1-7c4b465b3a00"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "353.4169",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "ec2df33d-67ec-4d81-90a6-86fde6827932",
          "id": "ec2df33d-67ec-4d81-90a6-86fde6827932",
          "molfile": "\n  Marvin  02202310562D          \n\n  1  0  0  0  0  0            999 V2000\n   18.0404   -4.0701    0.0000 Cl  0  5  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1  -1\nM  END",
          "smiles": "[Cl-]",
          "formula": "Cl",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e09bc4ca-2df9-4da1-bece-aac0e7085522"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "35.4529",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "30f5e4f6-83cd-407d-9b9a-de2d82b8a3e0",
      "version": "7",
      "structure": {
        "id": "71b35e18-cf66-48bd-b6b5-a0dc6aa57bee",
        "molfile": "Triphenyl(phenylmethyl)phosphonium\n   JSDraw202202310562D\n\n 27 29  0  0  0  0              0 V2000\n   23.8686   -7.9298    0.0000 P   0  3  0  0  0  0  0  0  0  0  0  0\n   25.2194   -8.7098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.5176   -7.1499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1665   -7.9298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.5176   -5.5898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.8156   -7.1499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1665   -4.8099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.8156   -5.5898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.2722   -6.4229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.1692   -5.3199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.7790   -6.0192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.5729   -3.8130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.1829   -4.5124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.0796   -3.4094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.0885   -9.2808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.5286   -9.2808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8686  -10.6317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.7486  -10.6317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.0885  -11.9826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.5286  -11.9826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5704   -7.9298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5704   -6.3699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.9215   -8.7098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.9215   -5.5898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.2724   -7.9298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.2724   -6.3699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   34.1120   -7.6960    0.0000 Cl  0  5  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  9  1  0  0  0  0\n  1 15  1  0  0  0  0\n  2 21  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  5  7  2  0  0  0  0\n  6  8  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 11 13  2  0  0  0  0\n 12 14  2  0  0  0  0\n 13 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 17 19  2  0  0  0  0\n 18 20  2  0  0  0  0\n 19 20  1  0  0  0  0\n 21 22  2  0  0  0  0\n 21 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 23 25  2  0  0  0  0\n 24 26  2  0  0  0  0\n 25 26  1  0  0  0  0\nM  CHG  2   1   1  27  -1\nM  END",
        "smiles": "c1ccc(cc1)C[P+](c2ccccc2)(c3ccccc3)c4ccccc4.[Cl-]",
        "formula": "C25H22P.Cl",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "388.8698",
        "optical_activity": "NONE",
        "references": [
          "55d97146-691b-43ae-a690-d4d624e329e0",
          "39c62e9a-e141-490a-9a52-17d1d3972af1"
        ],
        "stereo_centers": 0
      },
      "unii": "WM5533HY8L"
    }
  ]
}