{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "86f917e5-5f42-47ab-9d7e-084690afcb59",
          "code": "1190307-88-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1190307-88-0",
          "code_system": "CAS",
          "references": [
            "4f67c6ed-00eb-44da-85a7-46d6fa0824de",
            "f3011bb6-5b3c-40cb-93b6-a4c5f71f56b2"
          ]
        },
        {
          "uuid": "6ee785d9-7d7b-48eb-bd9e-51fc30a728cd",
          "code": "C101263",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C101263",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4f67c6ed-00eb-44da-85a7-46d6fa0824de"
          ]
        },
        {
          "uuid": "6e29a721-e7fa-4814-80b6-2f95ab0b40d7",
          "code": "SOFOSBUVIR",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Sofosbuvir",
          "code_system": "WIKIPEDIA",
          "references": [
            "4f67c6ed-00eb-44da-85a7-46d6fa0824de"
          ]
        },
        {
          "uuid": "705d8bd1-6f29-4518-af8e-cfeab3e46e35",
          "code": "9665",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=9665",
          "code_system": "INN",
          "references": [
            "4f67c6ed-00eb-44da-85a7-46d6fa0824de"
          ]
        },
        {
          "uuid": "cae51270-7924-4720-b2d6-4ba37132c3ac",
          "code": "HARVONI (AUTHORIZED: HEPATITIS C, CHRONIC)",
          "comments": "EMA EPAR|DISEASES|DIGESTIVE SYSTEM DISEASES|LIVER DISEASES|HEPATITIS|HEPATITIS, CHRONIC|HEPATITIS C, CHRONIC",
          "type": "PRIMARY",
          "url": "http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/human/medicines/003850/human_med_001813.jsp&mid=WC0b01ac058001d124",
          "code_system": "EMA ASSESSMENT REPORTS",
          "references": [
            "4f67c6ed-00eb-44da-85a7-46d6fa0824de"
          ]
        },
        {
          "uuid": "7ed24149-89a3-48ad-956c-41fc878a7278",
          "code": "SOVALDI (AUTHORIZED: HEPATITIS C, CHRONIC)",
          "comments": "EMA EPAR|DISEASES|DIGESTIVE SYSTEM DISEASES|LIVER DISEASES|HEPATITIS|HEPATITIS, CHRONIC|HEPATITIS C, CHRONIC",
          "type": "PRIMARY",
          "url": "http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/human/medicines/002798/human_med_001723.jsp&mid=WC0b01ac058001d124",
          "code_system": "EMA ASSESSMENT REPORTS",
          "references": [
            "4f67c6ed-00eb-44da-85a7-46d6fa0824de"
          ]
        },
        {
          "uuid": "0769c2b5-65b2-4869-bc1a-b32960ceb171",
          "code": "7368",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=7368",
          "code_system": "IUPHAR",
          "references": [
            "4f67c6ed-00eb-44da-85a7-46d6fa0824de"
          ]
        },
        {
          "uuid": "96d8f691-915e-4071-96d4-369432a7693d",
          "code": "1484911",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1484911/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "4f67c6ed-00eb-44da-85a7-46d6fa0824de"
          ]
        },
        {
          "uuid": "735ec05a-434c-49d6-9b90-9c245cb94dcb",
          "code": "DB08934",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB08934",
          "code_system": "DRUG BANK",
          "references": [
            "4f67c6ed-00eb-44da-85a7-46d6fa0824de"
          ]
        },
        {
          "uuid": "d369eb0d-8336-48d6-8a42-dd9504fb2048",
          "code": "SUB121170",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "4f67c6ed-00eb-44da-85a7-46d6fa0824de"
          ]
        },
        {
          "uuid": "b39dde3f-3ec8-4957-9595-4816c1e67475",
          "code": "CHEMBL1259059",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1259059",
          "code_system": "ChEMBL",
          "references": [
            "4f67c6ed-00eb-44da-85a7-46d6fa0824de"
          ]
        },
        {
          "uuid": "52928c92-8249-430a-b752-30b199c64fd6",
          "code": "J05AX15",
          "comments": "ATC|ANTIINFECTIVES FOR SYSTEMIC USE|ANTIVIRALS FOR SYSTEMIC USE|DIRECT ACTING ANTIVIRALS|Other antivirals|sofosbuvir",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=J05AX15&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "4f67c6ed-00eb-44da-85a7-46d6fa0824de"
          ]
        },
        {
          "uuid": "5197ffd4-894c-4d75-93fa-3f13817801ba",
          "code": "J05AX65",
          "comments": "ATC|ANTIINFECTIVES FOR SYSTEMIC USE|ANTIVIRALS FOR SYSTEMIC USE|DIRECT ACTING ANTIVIRALS|Other antivirals|sofosbuvir and ledipasvir",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=J05AX65&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "4f67c6ed-00eb-44da-85a7-46d6fa0824de"
          ]
        },
        {
          "uuid": "8aee1588-e2d4-4817-9f34-76c0efbb4445",
          "code": "N0000191493",
          "comments": "Established Pharmacologic Class [EPC]|Hepatitis C Virus Nucleotide Analog NS5B Polymerase Inhibitor [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000191493",
          "code_system": "NDF-RT",
          "references": [
            "4f67c6ed-00eb-44da-85a7-46d6fa0824de"
          ]
        },
        {
          "uuid": "93a1e529-e96e-42e1-8d63-ecd8349e61eb",
          "code": "N0000191258",
          "comments": "RNA Replicase Inhibitors [MoA]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000191258",
          "code_system": "NDF-RT",
          "references": [
            "4f67c6ed-00eb-44da-85a7-46d6fa0824de"
          ]
        },
        {
          "uuid": "c57371af-dc07-41ba-9dfc-b42260b121c5",
          "code": "45375808",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/45375808",
          "code_system": "PUBCHEM",
          "references": [
            "4f67c6ed-00eb-44da-85a7-46d6fa0824de"
          ]
        },
        {
          "uuid": "24ccf714-2f6c-15a5-8303-2319cbe6a406",
          "code": "8226",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/8226",
          "code_system": "HSDB",
          "references": [
            "9278a93f-23a6-368d-f4f7-d8dea21cff74"
          ]
        },
        {
          "uuid": "551a5fda-8c88-0661-38f6-9e5f9c46f7e4",
          "code": "535916",
          "comments": "ORPHAN DRUG|Designated/Approved|Treatment of chronic hepatitis C virus (HCV) infection in pediatric patients",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=535916",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "338f9b3a-366f-4c32-a29d-b8e645dae66e",
          "code": "m11680",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11680",
          "code_system": "MERCK INDEX",
          "references": [
            "ed569bdf-d6a3-fb3f-8841-6ce89b708f15"
          ]
        },
        {
          "uuid": "aea13eca-1d82-13ca-dd9b-7803bc28567f",
          "code": "541716",
          "comments": "ORPHAN DRUG|Designated/Approved|Treatment of pediatric chronic hepatitis C virus infection",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=541716",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "6cbe2a84-1ed8-8fb0-f1d6-d48fd5a379f2",
          "code": "J05AP08",
          "comments": "ATC|ANTIINFECTIVES FOR SYSTEMIC USE|ANTIVIRALS FOR SYSTEMIC USE|DIRECT ACTING ANTIVIRALS|Antivirals for treatment of HCV infections|sofosbuvir",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=J05AP08&showdescription=yes",
          "code_system": "WHO-ATC"
        },
        {
          "uuid": "cc101c3a-f54b-843b-0b1a-f97cde4eb124",
          "code": "J05AP56",
          "comments": "ATC|ANTIINFECTIVES FOR SYSTEMIC USE|ANTIVIRALS FOR SYSTEMIC USE|DIRECT ACTING ANTIVIRALS|Antivirals for treatment of HCV infections|sofosbuvir, velpatasvir and voxilaprevir",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=J05AP56&showdescription=yes",
          "code_system": "WHO-ATC"
        },
        {
          "uuid": "04a612b4-6a70-ddef-68ce-9d046b951192",
          "code": "J05AP55",
          "comments": "ATC|ANTIINFECTIVES FOR SYSTEMIC USE|ANTIVIRALS FOR SYSTEMIC USE|DIRECT ACTING ANTIVIRALS|Antivirals for treatment of HCV infections|sofosbuvir and velpatasvir",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=J05AP55&showdescription=yes",
          "code_system": "WHO-ATC"
        },
        {
          "uuid": "b081334f-62f7-0af3-b128-236502e5ad5f",
          "code": "J05AP51",
          "comments": "ATC|ANTIINFECTIVES FOR SYSTEMIC USE|ANTIVIRALS FOR SYSTEMIC USE|DIRECT ACTING ANTIVIRALS|Antivirals for treatment of HCV infections|sofosbuvir and ledipasvir",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=J05AP51&showdescription=yes",
          "code_system": "WHO-ATC"
        },
        {
          "uuid": "4a5bc580-6fb7-7b7e-2b98-c82c53c5062c",
          "code": "C281",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Antiviral Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C281",
          "code_system": "NCI_THESAURUS",
          "references": [
            "f8803a05-7bae-84e9-e78b-db0b9ea0ecc9"
          ]
        },
        {
          "uuid": "aa2f7733-b93b-fe70-3b29-0ac5d3da6ef4",
          "code": "C25995",
          "comments": "Pharmacologic Substance[C1909]|Enzyme Inhibitor[C471]|RNA Polymerase Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C25995",
          "code_system": "NCI_THESAURUS",
          "references": [
            "f8803a05-7bae-84e9-e78b-db0b9ea0ecc9"
          ]
        },
        {
          "uuid": "9877379e-806c-4caf-a388-3b9b541f9f4e",
          "code": "WJ6CA3ZU8B",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ce168b88-74e9-0996-b8e0-f88d09d57da2",
          "code": "Sofosbuvir",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM1242/",
          "code_system": "LACTMED",
          "references": [
            "f8803a05-7bae-84e9-e78b-db0b9ea0ecc9"
          ]
        },
        {
          "uuid": "bf449f6f-ef0e-77c1-9c5c-94a3a78ab156",
          "code": "4811",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/4811",
          "code_system": "DRUG CENTRAL",
          "references": [
            "f8803a05-7bae-84e9-e78b-db0b9ea0ecc9"
          ]
        },
        {
          "uuid": "7e4fb2ed-9ab3-1961-1e56-d199354b329d",
          "code": "85083",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:85083",
          "code_system": "CHEBI",
          "references": [
            "f8803a05-7bae-84e9-e78b-db0b9ea0ecc9"
          ]
        },
        {
          "uuid": "00291126-2127-3409-153b-0ac9a06c72c6",
          "code": "DTXSID701027632",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID701027632",
          "code_system": "EPA CompTox",
          "references": [
            "f8803a05-7bae-84e9-e78b-db0b9ea0ecc9"
          ]
        },
        {
          "uuid": "df3c3030-d1c8-1ab7-46cc-16a95fc3101f",
          "code": "XX-67",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/XX-67/relevant/1/",
          "code_system": "USAN",
          "references": [
            "8ef4a6a8-a56e-5210-4419-1cf79db96ca7"
          ]
        },
        {
          "uuid": "643eedc8-8535-fbf1-86d8-ec81c928b3fb",
          "code": "WJ6CA3ZU8B",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=WJ6CA3ZU8B",
          "code_system": "DAILYMED",
          "references": [
            "6f0d71e1-3f6c-036f-7e42-1ffac59b7da8"
          ]
        },
        {
          "uuid": "6b612127-ba5f-9b3b-ad3d-14535eeaf356",
          "code": "100000144530",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "2871c61e-85eb-1352-3516-623a48df5309"
          ]
        },
        {
          "uuid": "b4bac1b2-e87f-8f4f-8262-e3a2fd902ff8",
          "code": "554816",
          "comments": "ORPHAN DRUG|Designated/Approved|Treatment of pediatric chronic hepatitis C virus (HCV) infection",
          "codeText": "ORPHAN DRUG|Designated/Approved|Treatment of pediatric chronic hepatitis C virus (HCV) infection",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=554816",
          "code_system": "FDA ORPHAN DRUG"
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "5c6eaafd-e065-96e1-80cb-c717778c92df",
          "citation": "orange book",
          "doc_type": "ORANGE BOOK",
          "public_domain": true
        },
        {
          "uuid": "9568dd3c-92d1-4537-a889-9b3447eb532e",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a173cebd-75f2-44d8-9c4c-f071158da9d8",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "35ef290d-cef3-4e75-b08c-8f1bd70dd801",
          "citation": "usan council",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "371dbb02-bfbf-439d-9746-71bb93e4af83",
          "citation": "CLINICAL TRIALS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad097fae-7c9a-43b4-9e0f-b90e586c5efd",
          "citation": "USP DICTIONARY 2012",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "26a46b49-8330-4480-a49d-44098fc36855",
          "citation": "INN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0eae5485-3021-42e3-ac99-410d6eb5ec93",
          "citation": "https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=7f30631a-ee3b-4cfe-866b-964df3f0a44f",
          "url": "https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=7f30631a-ee3b-4cfe-866b-964df3f0a44f",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f7485fab-981e-4967-b653-18782fa01f7d",
          "citation": "http://www.sovaldi.com/",
          "url": "http://www.sovaldi.com/",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e0242e0e-a7cb-4aee-a9b2-83203d3844cf",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3b8b897a-1317-4897-963f-fb6f1c20792e",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6598362a-eb8d-4320-86a3-05403faca495",
          "citation": "DM",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "817e6549-637e-461d-b2ff-884dc1007329",
          "citation": "http://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=f4ec77e4-bae8-4db0-b3d5-bde09c5fa075",
          "url": "http://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=f4ec77e4-bae8-4db0-b3d5-bde09c5fa075",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3fa1c4fa-15a0-4ce6-a442-a098eafc5dc6",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4f67c6ed-00eb-44da-85a7-46d6fa0824de",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391235000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b558c3cd-46da-46ca-8efb-a4af181c5fad",
          "citation": "HTTP://WWW.JBC.ORG/CONTENT/285/45/34337.FULL.PDF",
          "url": "THE JOURNAL OF BIOLOGICAL CHEMISTRY VOL. 285, NO. 45, pp. 34337?34347, November 5, 2010",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8f63fbb5-3ef2-431f-9f55-ec99c7429866",
          "citation": "THE JOURNAL OF BIOLOGICAL CHEMISTRY VOL. 285, NO. 45, PP. 34337?34347, NOVEMBER 5, 2010",
          "url": "http://www.jbc.org/content/285/45/34337.full.pdf",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c1062a97-12c7-4c81-9574-3122e5f37c02",
          "citation": "SRS import [WJ6CA3ZU8B]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=WJ6CA3ZU8B",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391235000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ba572f9-e4b3-4107-9b60-456ff9e06b9e",
          "citation": "USAN COUNCIL",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "04776fcd-5252-4947-9683-1b36ab84ddd0",
          "citation": "SOFOSBUVIR [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b5e755b7-19c1-4aab-89b6-5ecc011f4c27",
          "citation": "SOFOSBUVIR [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "be542451-373e-4c42-870f-00cd59d16bd4",
          "citation": "SOFOSBUVIR [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "213d13bf-5325-4913-b31b-da503c3d85dc",
          "citation": "SOFOSBUVIR [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bf04be14-6faf-4097-a39e-5f8d0fe603f1",
          "citation": "SOFOSBUVIR [DASH]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "db658935-0ff0-7f92-de08-ca0de35ef78c",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9278a93f-23a6-368d-f4f7-d8dea21cff74",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+1190307-88-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b2b11131-c707-5390-cbb4-cbd1cdd1d933",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+1190307-88-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ed569bdf-d6a3-fb3f-8841-6ce89b708f15",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "5f4d4251-4bba-c4a1-012f-509965f9d6e4",
          "citation": "P T. 2014 May; 39(5): 345–352",
          "url": "https://www.ncbi.nlm.nih.gov/pmc/articles/PMC4029125/",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "9de29822-e97f-1375-b41e-b297262a937d",
          "citation": "THE JOURNAL OF BIOLOGICAL CHEMISTRY VOL. 285, NO. 45, pp. 34337–34347, November 5, 2010",
          "url": "http://www.jbc.org/content/285/45/34337.full.pdf",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "f8803a05-7bae-84e9-e78b-db0b9ea0ecc9",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "a79ed09f-2464-f4fc-f08f-e1cbe128888f",
          "citation": "https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=17ffc094-8ca7-45d2-80d8-fd043bc9a221",
          "doc_type": "DAILYMED",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "f3011bb6-5b3c-40cb-93b6-a4c5f71f56b2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2f159721-984c-cf57-baa3-f5191db37b21",
          "citation": "https://clinicaltrials.gov/ct2/show/NCT03794258",
          "url": "https://clinicaltrials.gov/ct2/show/NCT03794258",
          "doc_type": "CLINICAL_TRIALS.GOV",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "eec48ba3-e9f0-78a6-8bbc-a793bd266874",
          "citation": "USAN COUN 2012",
          "doc_type": "USANCOUN",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8ef4a6a8-a56e-5210-4419-1cf79db96ca7",
          "citation": "USAD COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "86afb53f-a015-f16d-309e-8aa7629c7de7",
          "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/nda/2013/204671Orig1s000ClinPharmR.pdf",
          "doc_type": "NDA PUBLIC REVIEW",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "13736aaa-1e1b-a163-cebb-047f61cc5e65",
          "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/label/2013/204671s000lbl.pdf",
          "doc_type": "NDA PUBLIC REVIEW",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "bcc1ab8e-9976-4d54-a7c8-62b8fd51d3b2",
          "citation": "sofosbuvir",
          "doc_type": "WEB PAGE",
          "public_domain": true
        },
        {
          "uuid": "c783699e-6b3c-3f81-079f-404e297e6202",
          "citation": "OB",
          "doc_type": "ORANGE BOOK",
          "public_domain": true
        },
        {
          "uuid": "aaf2f665-7b15-442f-8736-646bbcfaaba4",
          "citation": "INN Proposed List 108",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL108.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "af0f736b-8baa-1a1d-dc72-a66daba7c3b2",
          "citation": "USAN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "e2f2f86a-7dc9-308b-ea63-7331dc8f7dd3",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "6f0d71e1-3f6c-036f-7e42-1ffac59b7da8",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "2871c61e-85eb-1352-3516-623a48df5309",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "00c482a1-f3c8-46fb-bacc-95ff45f7f9ab",
          "citation": "204671Orig1s000 CLINICAL PHARMACOLOGY AND BIOPHARMACEUTICS REVIEW(S)",
          "url": "https://www.accessdata.fda.gov/drugsatfda_docs/nda/2013/204671Orig1s000ClinPharmR.pdf",
          "doc_type": "NDA PUBLIC REVIEW",
          "public_domain": true,
          "tags": [
            "CLIN"
          ]
        },
        {
          "uuid": "8fce3bbd-4dda-4671-893e-697d75ca3b2b",
          "citation": "sofosbuvir",
          "doc_type": "WEB PAGE",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "74f9d924-2106-4a09-a444-e0fe98e19c6e",
          "id": "74f9d924-2106-4a09-a444-e0fe98e19c6e",
          "molfile": "\n  Marvin  01132106042D          \n\n 36 38  0  0  1  0            999 V2000\n    3.8623   -3.6383    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.5645   -4.0716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1361   -4.0297    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1119   -4.8544    0.0000 P   0  0  2  0  0  0  0  0  0  2  0  0\n    3.0877   -5.6791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9366   -4.8786    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3280   -5.6048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1526   -5.6290    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.6569   -4.9761    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4337   -5.2539    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.1151   -4.7887    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8586   -5.1462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5400   -4.6811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4779   -3.8583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1592   -3.3932    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7343   -3.5009    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0530   -3.9660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3094   -3.6085    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4095   -6.0785    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.5574   -6.8902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2322   -6.0164    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6178   -6.3103    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.3399   -7.0872    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2873   -4.8302    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8540   -5.5323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2454   -6.2586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8122   -6.9607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9875   -6.9365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5961   -6.2103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0294   -5.5081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8865   -2.8137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1845   -2.3804    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6128   -2.4223    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6369   -1.5976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9349   -1.1644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3632   -1.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 31  1  0  0  0  0\n  4  3  1  1  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  4 24  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  1  0  0  0\n  8  9  1  0  0  0  0\n 22  8  1  0  0  0  0\n 10  9  1  1  0  0  0\n 10 11  1  0  0  0  0\n 19 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 17 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  2  0  0  0  0\n 16 14  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  2  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  1  6  0  0  0\n 19 22  1  0  0  0  0\n 22 23  1  6  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 25 30  2  0  0  0  0\n 26 27  2  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  2  0  0  0  0\n 29 30  1  0  0  0  0\n 31 32  2  0  0  0  0\n 31 33  1  0  0  0  0\n 33 34  1  0  0  0  0\n 34 35  1  0  0  0  0\n 34 36  1  0  0  0  0\nM  END",
          "smiles": "CC(C)OC(=O)[C@H](C)N[P@](=O)(OC[C@@H]1[C@H]([C@](C)([C@H](n2ccc(=O)[nH]c2=O)O1)F)O)Oc3ccccc3",
          "formula": "C22H29FN3O9P",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "03f520f4-9873-4989-830c-7e4731554a3d"
          },
          "defined_stereo": 6,
          "ez_centers": 0,
          "molecular_weight": "529.4534",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 6
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e9c3b740-5bbc-4873-8520-afeb5a34e536",
      "version": "79",
      "structure": {
        "id": "6db5eaab-5a59-4401-8951-f39262b36428",
        "molfile": "\n  Marvin  01132105422D          \n\n 36 38  0  0  1  0            999 V2000\n    3.8865   -2.8137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8623   -3.6383    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.5645   -4.0716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1361   -4.0297    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1119   -4.8544    0.0000 P   0  0  1  0  0  0  0  0  0  0  0  0\n    3.0877   -5.6791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2873   -4.8302    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8540   -5.5323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2454   -6.2586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8122   -6.9607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9875   -6.9365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5961   -6.2103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0294   -5.5081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9366   -4.8786    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3280   -5.6048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1526   -5.6290    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.6569   -4.9761    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4337   -5.2539    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.4095   -6.0785    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.6178   -6.3103    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.3399   -7.0872    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5574   -6.8902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2322   -6.0164    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1151   -4.7887    0.0000 N   0  0  1  0  0  0  0  0  0  0  0  0\n    7.8586   -5.1462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5400   -4.6811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4779   -3.8583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7343   -3.5009    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0530   -3.9660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3094   -3.6085    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1592   -3.3932    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1845   -2.3804    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6128   -2.4223    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6369   -1.5976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9349   -1.1644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3632   -1.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  6  0  0  0\n  2  4  1  0  0  0  0\n  5  4  1  1  0  0  0\n  5  6  2  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n  8 13  2  0  0  0  0\n  5 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  1  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 16 20  1  0  0  0  0\n 20 21  1  6  0  0  0\n 19 22  1  0  0  0  0\n 19 23  1  6  0  0  0\n 18 24  1  1  0  0  0\n 25 24  1  0  0  0  0\n 26 25  2  0  0  0  0\n 27 26  1  0  0  0  0\n 28 27  1  0  0  0  0\n 29 28  1  0  0  0  0\n 29 24  1  0  0  0  0\n 29 30  2  0  0  0  0\n 27 31  2  0  0  0  0\n  1 32  2  0  0  0  0\n  1 33  1  0  0  0  0\n 33 34  1  0  0  0  0\n 34 35  1  0  0  0  0\n 34 36  1  0  0  0  0\nM  END",
        "smiles": "CC(C)OC(=O)[C@H](C)N[P@](=O)(OC[C@@H]1[C@H]([C@](C)([C@H](n2ccc(=O)[nH]c2=O)O1)F)O)Oc3ccccc3",
        "formula": "C22H29FN3O9P",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 6,
        "ez_centers": 0,
        "molecular_weight": "529.4534",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "c1062a97-12c7-4c81-9574-3122e5f37c02",
          "1ba572f9-e4b3-4107-9b60-456ff9e06b9e",
          "aaf2f665-7b15-442f-8736-646bbcfaaba4"
        ],
        "stereo_centers": 6
      },
      "unii": "WJ6CA3ZU8B",
      "relationships": [
        {
          "uuid": "645eff39-e737-4e6e-afa0-200a91b587fc",
          "type": "METABOLITE ACTIVE->PRODRUG",
          "interaction_type": "MINOR",
          "related_substance": {
            "uuid": "4334b9fe-3993-4488-89f0-902c5592d78a",
            "refuuid": "73f56f72-be2a-4911-be9d-0c697bf13e99",
            "name": "PSI-7409",
            "unii": "T90A75S60M",
            "linking_id": "T90A75S60M",
            "ref_pname": "PSI-7409",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "780d3585-e6ba-4be6-8cc4-339e90aa3f76",
          "type": "EPIMER->DIASTEREOISOMER",
          "references": [
            "8f63fbb5-3ef2-431f-9f55-ec99c7429866"
          ],
          "related_substance": {
            "uuid": "9b94853d-081b-431b-a03c-5968b573847a",
            "refuuid": "6723d22a-b495-4eda-87bc-b19ceafa181c",
            "name": "PSI-7851",
            "unii": "3S5S1851OV",
            "linking_id": "3S5S1851OV",
            "ref_pname": "PSI-7851",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0befe1bb-2e80-44ae-a3b0-0ca8a907b53f",
          "amount": {
            "uuid": "8ea0db39-f836-46fb-a33e-790919d8f01b"
          },
          "type": "METABOLITE INACTIVE->PARENT",
          "related_substance": {
            "uuid": "7df8c741-b206-4fb4-b921-adf6fa2c87ae",
            "refuuid": "77564005-f9db-494d-bc1b-65500c0c30e2",
            "name": "(2′R)-2′-Deoxy-2′-fluoro-2′-methyluridine",
            "unii": "44V7045CXS",
            "linking_id": "44V7045CXS",
            "ref_pname": "(2′R)-2′-Deoxy-2′-fluoro-2′-methyluridine",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "123c91ec-7c69-4c6a-bcd3-7c21fa689fc9",
          "type": "METABOLIC ENZYME->SUBSTRATE",
          "related_substance": {
            "uuid": "43eb50d5-c029-4514-97e6-5de757fd2c8d",
            "refuuid": "57f7f4d0-c1da-417a-aa04-f047d0da8e09",
            "name": "LIVER CARBOXYLESTERASE 1",
            "unii": "HPN66MJEK8",
            "linking_id": "HPN66MJEK8",
            "ref_pname": "LIVER CARBOXYLESTERASE 1"
          }
        },
        {
          "uuid": "077fc6c4-a959-4371-87a1-ac884cd92070",
          "amount": {
            "uuid": "34c23ff9-90b6-412b-9310-19d862720633",
            "average": 1.121,
            "units": "microM/min"
          },
          "qualification": "kcat",
          "type": "METABOLIC ENZYME->SUBSTRATE",
          "interaction_type": "IN-VITRO",
          "references": [
            "00c482a1-f3c8-46fb-bacc-95ff45f7f9ab"
          ],
          "related_substance": {
            "uuid": "15cd62c4-1eb2-40f5-8794-b18f154043a5",
            "refuuid": "a0b1e8ce-4cfb-4ea4-aa56-55b2a76b3a67",
            "name": "LYSOSOMAL PROTECTIVE PROTEIN",
            "unii": "SU59CZ8IUV",
            "linking_id": "SU59CZ8IUV",
            "ref_pname": "LYSOSOMAL PROTECTIVE PROTEIN"
          }
        },
        {
          "uuid": "2a7c8040-992f-42fe-a3a6-92431530ff93",
          "type": "METABOLITE->PARENT",
          "related_substance": {
            "uuid": "86e2d075-0b50-4d6c-84bc-df802ea1b617",
            "refuuid": "b80799b9-ebc8-499f-97d8-7e8f1e140d48",
            "name": "PSI-7410",
            "unii": "YQ33JQ8MWT",
            "linking_id": "YQ33JQ8MWT",
            "ref_pname": "PSI-7410"
          }
        },
        {
          "uuid": "9691dfb5-ae73-4ea8-af0e-095a0fc3e566",
          "type": "METABOLITE->PARENT",
          "related_substance": {
            "uuid": "b74252af-734e-4a2b-a04b-ce6943fcc319",
            "refuuid": "cd5d3938-c608-4626-a031-383010838742",
            "name": "GS-566500",
            "unii": "8C9Y1F217H",
            "linking_id": "8C9Y1F217H",
            "ref_pname": "GS-566500"
          }
        },
        {
          "uuid": "42069c5b-720c-4580-bd69-709136cefcce",
          "type": "METABOLITE->PARENT",
          "references": [
            "5f4d4251-4bba-c4a1-012f-509965f9d6e4"
          ],
          "related_substance": {
            "uuid": "1d8c5036-0658-49fd-92c4-772c2a598ecf",
            "refuuid": "5f1eb31a-3046-4490-bbc2-aecba0fe812d",
            "name": "PSI-7411",
            "unii": "OOL8KAC85O",
            "linking_id": "OOL8KAC85O",
            "ref_pname": "PSI-7411",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "74118c78-fcd1-4605-9c9a-7bd556799f50",
          "type": "TARGET->INHIBITOR",
          "related_substance": {
            "uuid": "2df6fa29-e18e-4b87-a39a-9547bbf34974",
            "refuuid": "b35be58d-6ed5-4bdd-a833-1b44571c1781",
            "name": "HCV NS5B POLYMERASE",
            "unii": "VTC1801X29",
            "linking_id": "VTC1801X29",
            "ref_pname": "HCV NS5B POLYMERASE"
          }
        },
        {
          "uuid": "44dda8e0-27f3-479b-a981-e80497162b43",
          "type": "METABOLITE INACTIVE->PARENT",
          "related_substance": {
            "uuid": "19fe03d0-dbee-4a51-b0c4-e5d66ad87237",
            "refuuid": "cd5d3938-c608-4626-a031-383010838742",
            "name": "GS-566500",
            "unii": "8C9Y1F217H",
            "linking_id": "8C9Y1F217H",
            "ref_pname": "GS-566500"
          }
        },
        {
          "uuid": "e43e495e-c18c-46f1-ab34-86821d501673",
          "amount": {
            "uuid": "530a884a-f63e-4087-870a-0966624d393f",
            "high": 65,
            "low": 61,
            "units": "%"
          },
          "type": "BINDER->LIGAND",
          "interaction_type": "BINDING",
          "references": [
            "13736aaa-1e1b-a163-cebb-047f61cc5e65"
          ],
          "related_substance": {
            "uuid": "91aa0a17-575f-428c-bfe4-921306d77eed",
            "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30",
            "name": "PLASMA PROTEIN FRACTION (HUMAN)",
            "unii": "6D53G0FD0Z",
            "linking_id": "6D53G0FD0Z",
            "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d7b1666a-4b38-4f1c-81d4-3187f334a8d4",
          "amount": {
            "uuid": "0f7d907b-c489-49fe-a32b-29a070f85d2e",
            "average": 78,
            "units": "%"
          },
          "qualification": "URINE",
          "type": "EXCRETED UNCHANGED",
          "references": [
            "13736aaa-1e1b-a163-cebb-047f61cc5e65"
          ],
          "related_substance": {
            "uuid": "67a4d609-9852-4526-b43f-f4836ece1ce1",
            "refuuid": "77564005-f9db-494d-bc1b-65500c0c30e2",
            "name": "(2′R)-2′-Deoxy-2′-fluoro-2′-methyluridine",
            "unii": "44V7045CXS",
            "linking_id": "44V7045CXS",
            "ref_pname": "(2′R)-2′-Deoxy-2′-fluoro-2′-methyluridine",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "78f7d1c3-2258-4e0f-939f-00cb60e7fb41",
          "amount": {
            "uuid": "13528da8-5fe2-4ce5-b738-b30a58ab4374",
            "average": 3.5,
            "units": "%"
          },
          "qualification": "URINE",
          "type": "EXCRETED UNCHANGED",
          "references": [
            "13736aaa-1e1b-a163-cebb-047f61cc5e65"
          ],
          "related_substance": {
            "uuid": "22cdaafc-cdd6-4eb9-9b99-1f88b4728a0c",
            "refuuid": "e9c3b740-5bbc-4873-8520-afeb5a34e536",
            "name": "SOFOSBUVIR",
            "unii": "WJ6CA3ZU8B",
            "linking_id": "WJ6CA3ZU8B",
            "ref_pname": "SOFOSBUVIR",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d2988703-74d5-47a7-8ce7-64f0953a93b6",
          "amount": {
            "uuid": "65912596-e156-4162-a808-87ee1d7ccfa2"
          },
          "type": "TARGET ORGANISM->INHIBITOR",
          "references": [
            "8fce3bbd-4dda-4671-893e-697d75ca3b2b"
          ],
          "related_substance": {
            "uuid": "f206d361-4c29-449c-b2cc-7c58038a1964",
            "refuuid": "186951f3-922c-42c6-8ac1-f9c0baa3597a",
            "name": "HEPATITIS C VIRUS",
            "unii": "QI56415283",
            "linking_id": "QI56415283",
            "ref_pname": "HEPATITIS C VIRUS"
          }
        }
      ],
      "names": [
        {
          "uuid": "8a6cbf3e-e173-4fc1-9751-fd9fea6bedaa",
          "name": "(S)-ISOPROPYL 2-((S)-(((2R,3R,4R,5R)-5-(2,4-DIOXO-3,4-DIHYDROPYRIMIDIN-1(2H)-YL)-4-FLUORO-3-HYDROXY-4-METHYLTETRAHYDROFURAN-2-YL)METHOXY)-(PHENOXY)PHOSPHORYLAMINO)PROPANOATE",
          "stdName": "(S)-ISOPROPYL 2-((S)-(((2R,3R,4R,5R)-5-(2,4-DIOXO-3,4-DIHYDROPYRIMIDIN-1(2H)-YL)-4-FLUORO-3-HYDROXY-4-METHYLTETRAHYDROFURAN-2-YL)METHOXY)-(PHENOXY)PHOSPHORYLAMINO)PROPANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6598362a-eb8d-4320-86a3-05403faca495"
          ],
          "display_name": false
        },
        {
          "uuid": "2e4331ef-96fa-44b9-8c89-f20d06bc6eaf",
          "name": "EPCLUSA COMPONENT SOFOSBUVIR",
          "stdName": "EPCLUSA COMPONENT SOFOSBUVIR",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0eae5485-3021-42e3-ac99-410d6eb5ec93"
          ],
          "display_name": false
        },
        {
          "uuid": "3d7520ed-02c9-40cb-8095-2aaba3d0185c",
          "name": "GS-7977",
          "stdName": "GS-7977",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9568dd3c-92d1-4537-a889-9b3447eb532e"
          ],
          "display_name": false
        },
        {
          "uuid": "e76c2c3d-cb95-499b-8fb5-4ea3c9e5498a",
          "name": "GS7977",
          "stdName": "GS7977",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "371dbb02-bfbf-439d-9746-71bb93e4af83"
          ],
          "display_name": false
        },
        {
          "uuid": "2bcb41d2-289e-47d2-b18c-8993e8e401c6",
          "name": "HARVONI COMPONENT SOFOSBUVIR",
          "stdName": "HARVONI COMPONENT SOFOSBUVIR",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "817e6549-637e-461d-b2ff-884dc1007329"
          ],
          "display_name": false
        },
        {
          "uuid": "5ea5504d-3696-4f04-8a01-4257021fdb11",
          "name": "L-ALANINE, N-((P(S),2'R)-2'-DEOXY-2'-FLUORO-2'-METHYL-P-PHENYL-5'-URIDYLYL)-, 1-METHYLETHYL ESTER",
          "stdName": "L-ALANINE, N-((P(S),2'R)-2'-DEOXY-2'-FLUORO-2'-METHYL-P-PHENYL-5'-URIDYLYL)-, 1-METHYLETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a173cebd-75f2-44d8-9c4c-f071158da9d8"
          ],
          "display_name": false
        },
        {
          "uuid": "da4b69b3-9e2d-4b21-beed-740d02b00430",
          "name": "PSI-7977",
          "stdName": "PSI-7977",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3fa1c4fa-15a0-4ce6-a442-a098eafc5dc6"
          ],
          "display_name": false
        },
        {
          "uuid": "7fdc2a37-ca0a-f7ca-c834-6345e730e0ec",
          "name": "SOF",
          "stdName": "SOF",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f159721-984c-cf57-baa3-f5191db37b21"
          ],
          "display_name": false
        },
        {
          "uuid": "b2ada1dd-e125-41d4-b6fe-f396b993def6",
          "name": "SOFOSBUVIR",
          "stdName": "SOFOSBUVIR",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "04776fcd-5252-4947-9683-1b36ab84ddd0",
            "be542451-373e-4c42-870f-00cd59d16bd4",
            "3b8b897a-1317-4897-963f-fb6f1c20792e",
            "bf04be14-6faf-4097-a39e-5f8d0fe603f1",
            "35ef290d-cef3-4e75-b08c-8f1bd70dd801",
            "26a46b49-8330-4480-a49d-44098fc36855",
            "b5e755b7-19c1-4aab-89b6-5ecc011f4c27",
            "e0242e0e-a7cb-4aee-a9b2-83203d3844cf",
            "ad097fae-7c9a-43b4-9e0f-b90e586c5efd",
            "213d13bf-5325-4913-b31b-da503c3d85dc"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "73ae960e-b039-4edd-8691-a369f73e046d",
              "name_org": "USAN"
            },
            {
              "uuid": "303a7d78-4f37-44e2-a139-5b72555b11ab",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "f0f7123d-9931-4295-9ed7-2c2b91520733",
          "name": "SOFOSBUVIR [JAN]",
          "stdName": "SOFOSBUVIR [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "db658935-0ff0-7f92-de08-ca0de35ef78c"
          ],
          "display_name": false
        },
        {
          "uuid": "c0025825-1df6-5097-c022-35c1be195cdc",
          "name": "SOFOSBUVIR [MI]",
          "stdName": "SOFOSBUVIR [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ed569bdf-d6a3-fb3f-8841-6ce89b708f15"
          ],
          "display_name": false
        },
        {
          "uuid": "e38aff7b-bd46-5364-1799-2b1dac9a22b4",
          "name": "SOFOSBUVIR [ORANGE BOOK]",
          "stdName": "SOFOSBUVIR [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c783699e-6b3c-3f81-079f-404e297e6202"
          ],
          "display_name": false
        },
        {
          "uuid": "6e000c45-9095-4adc-895d-fc8b5fcebbef",
          "name": "SOFOSBUVIR [USAN]",
          "stdName": "SOFOSBUVIR [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ad097fae-7c9a-43b4-9e0f-b90e586c5efd"
          ],
          "display_name": false
        },
        {
          "uuid": "22590078-eb22-4e8a-b2a6-a8f4c48c69f5",
          "name": "SOFOSBUVIR [VANDF]",
          "stdName": "SOFOSBUVIR [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b8b897a-1317-4897-963f-fb6f1c20792e"
          ],
          "display_name": false
        },
        {
          "uuid": "81f3a689-f378-4c02-bf81-cd5591dbdcad",
          "name": "SOVALDI",
          "stdName": "SOVALDI",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f7485fab-981e-4967-b653-18782fa01f7d"
          ],
          "display_name": false
        },
        {
          "uuid": "8f3231b5-3aa5-4be2-feaf-9643d40e7ac9",
          "name": "Sofosbuvir [WHO-DD]",
          "stdName": "SOFOSBUVIR [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2f2f86a-7dc9-308b-ea63-7331dc8f7dd3"
          ],
          "display_name": false
        },
        {
          "uuid": "ef0436d9-095a-da87-1003-2ea2eb9893ec",
          "name": "VOSEVI COMPONENT SOFOSBUVIR",
          "stdName": "VOSEVI COMPONENT SOFOSBUVIR",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a79ed09f-2464-f4fc-f08f-e1cbe128888f"
          ],
          "display_name": false
        },
        {
          "uuid": "12ca775f-e60d-46a4-9a81-f62e3c9ba183",
          "name": "sofosbuvir [INN]",
          "stdName": "SOFOSBUVIR [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "26a46b49-8330-4480-a49d-44098fc36855",
            "aaf2f665-7b15-442f-8736-646bbcfaaba4"
          ],
          "display_name": false
        }
      ],
      "properties": [
        {
          "uuid": "91cc39d5-7221-423f-95e1-9e0f64283169",
          "name": "Tmax",
          "value": {
            "uuid": "ac3c4258-7844-4032-afb3-16d9d104ec15",
            "high": 2,
            "low": 0.5,
            "units": "hours"
          },
          "defining": false,
          "parameters": [
            {
              "uuid": "a2703c3e-3cc5-4831-b138-bb5b83cf207f",
              "name": "ORAL ADMINISTRATION",
              "references": []
            }
          ],
          "property_type": "PHARMACOKINETIC",
          "references": [
            "13736aaa-1e1b-a163-cebb-047f61cc5e65"
          ]
        },
        {
          "uuid": "5cc36e7a-8165-43ce-a587-d93ecb383609",
          "name": "Biological Half-life",
          "value": {
            "uuid": "2eda6add-6840-4da8-9314-0fe8c2b6cbe8",
            "average": 0.4,
            "units": "hours"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "13736aaa-1e1b-a163-cebb-047f61cc5e65"
          ]
        }
      ]
    }
  ]
}