{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7f702bea-d4ba-42fa-bb32-dc97611e9264",
          "code": "43119-47-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=43119-47-7",
          "code_system": "CAS",
          "references": [
            "54f42011-efdf-46d6-b2ed-d32903475981",
            "37aeb977-c5f2-42ce-ad91-afacdf8b0684"
          ]
        },
        {
          "uuid": "1476cf4e-1cf5-4e8b-a094-f06f6764abd2",
          "code": "C012581",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67012581",
          "code_system": "MESH",
          "references": [
            "54f42011-efdf-46d6-b2ed-d32903475981"
          ]
        },
        {
          "uuid": "80a87148-19ae-484c-9aa8-b503af350e5d",
          "code": "1359091",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1359091/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "54f42011-efdf-46d6-b2ed-d32903475981"
          ]
        },
        {
          "uuid": "bdd96b0b-281a-46f8-b7fb-777c363e83fe",
          "code": "SUB15586MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "54f42011-efdf-46d6-b2ed-d32903475981"
          ]
        },
        {
          "uuid": "bda3954f-4d9c-41d8-a366-675a083bdeb7",
          "code": "27990",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/27990",
          "code_system": "PUBCHEM",
          "references": [
            "54f42011-efdf-46d6-b2ed-d32903475981"
          ]
        },
        {
          "uuid": "2f3c1e36-25c3-46ff-91eb-7277f24e5e55",
          "code": "256-101-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.050.984",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "54f42011-efdf-46d6-b2ed-d32903475981"
          ]
        },
        {
          "uuid": "556b2b29-7086-7b0c-729f-0044277448a6",
          "code": "DTXSID1046396",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1046396",
          "code_system": "EPA CompTox",
          "references": [
            "deabe835-3dbc-a5f4-8e9f-0cf41af404cb"
          ]
        },
        {
          "uuid": "f021ff78-fc0a-23aa-f62a-c0e100ac3568",
          "code": "2689",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2689",
          "code_system": "DRUG CENTRAL",
          "references": [
            "36865fce-fdaa-79f6-43f5-0864823a87db"
          ]
        },
        {
          "uuid": "e306655b-7222-474f-b0a4-3303e35f92e9",
          "code": "WI1J5UCY5C",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "64f9a9b8-f0af-c07b-4827-dc211b680db5",
          "code": "WI1J5UCY5C",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=WI1J5UCY5C",
          "code_system": "DAILYMED",
          "references": [
            "6f352dda-8780-1939-59db-b775263aaf3d"
          ]
        },
        {
          "uuid": "709875c0-157e-71da-264f-a5628d528fc0",
          "code": "100000088059",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "c7fa40ab-8366-1fa6-bd1c-7e35666c5d91"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "9d323022-9fc8-460e-a107-f93083b9b934",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "65f196e0-b9cf-4c0b-83ab-c52043a5899c",
            "refuuid": "81efdc8f-9b68-41ce-866c-e7af062805d1",
            "name": "TOCOPHEROL",
            "unii": "R0ZB2556P8",
            "linking_id": "R0ZB2556P8",
            "ref_pname": "TOCOPHEROL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f7328c51-848d-4bf4-ac57-674c166c5eec",
          "amount": {
            "uuid": "cafba652-884a-4074-b128-5c20070c105e"
          },
          "type": "RACEMATE->ENANTIOMER",
          "related_substance": {
            "uuid": "13d6ad52-a146-4504-8947-530bdfa1c761",
            "refuuid": "cf3609b5-3e97-4c5e-99b4-d55957eae69a",
            "name": ".ALPHA.-TOCOPHEROL NICOTINATE, DL-",
            "unii": "QCP2FMP7I8",
            "linking_id": "QCP2FMP7I8",
            "ref_pname": ".ALPHA.-TOCOPHEROL NICOTINATE, DL-"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b091e5fc-36b7-4c74-818f-023aafdc6931",
          "name": ".ALPHA.-TOCOPHEROL NICOTINATE, D-",
          "stdName": ".ALPHA.-TOCOPHEROL NICOTINATE, D-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "40a93396-5749-48aa-aca6-f4b0c51e89a8",
            "1be6e073-b607-4539-9271-d586f1f66f78"
          ],
          "display_name": false
        },
        {
          "uuid": "1966e59c-0a35-46a5-b85f-2b31b79ead46",
          "name": "3-PYRIDINECARBOXYLIC ACID, (2R)-3,4-DIHYDRO-2,5,7,8-TETRAMETHYL-2-((4R,8R)-4,8,12-TRIMETHYLTRIDECYL)-2H-1-BENZOPYRAN-6-YL ESTER",
          "stdName": "3-PYRIDINECARBOXYLIC ACID, (2R)-3,4-DIHYDRO-2,5,7,8-TETRAMETHYL-2-((4R,8R)-4,8,12-TRIMETHYLTRIDECYL)-2H-1-BENZOPYRAN-6-YL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "030f20ae-2d9e-4265-9938-807ca236bd38",
            "1be6e073-b607-4539-9271-d586f1f66f78"
          ],
          "display_name": false
        },
        {
          "uuid": "9011ee21-6278-4658-8cce-91f5514ec499",
          "name": "RENASCIN",
          "stdName": "RENASCIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7c27dfc2-17a4-40d3-abf3-14a0fac1a43e",
            "1be6e073-b607-4539-9271-d586f1f66f78"
          ],
          "display_name": false
        },
        {
          "uuid": "a9dff309-82f2-43c3-a24e-7801079359e0",
          "name": "TOCOFERIL NICOTINATE [MART.]",
          "stdName": "TOCOFERIL NICOTINATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b7848be3-e84e-4246-93a7-6e8bec0319c7",
            "1be6e073-b607-4539-9271-d586f1f66f78"
          ],
          "display_name": false
        },
        {
          "uuid": "3a143f07-16e7-48d6-8d24-bcdb82c5c0d5",
          "name": "TOCOPHERYL NICOTINATE",
          "stdName": "TOCOPHERYL NICOTINATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "993334de-7910-49b7-8118-27d62dbd0229",
            "f8dc34c8-6a6f-4bfc-b8f2-647f1fb3cf6b",
            "1be6e073-b607-4539-9271-d586f1f66f78",
            "e12640f1-549f-46fa-8c25-eb3a2cde4a16",
            "4d7b2dd3-467b-4975-bdd2-575a3d622781",
            "77d2b6d9-7eef-466b-bd31-7ca07c7dd1a6",
            "955be6e5-8e80-49de-b53b-ef34df612411"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "c17bc5b5-650e-44c8-8d2c-cc90b693539e",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "7208e67a-035d-44ec-9400-63eb7ea9bd44",
          "name": "TOCOPHERYL NICOTINATE, D-.ALPHA.",
          "stdName": "TOCOPHERYL NICOTINATE, D-.ALPHA.",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "1be6e073-b607-4539-9271-d586f1f66f78",
            "2ec0d8db-4187-46d1-86ec-ea68422edaa5"
          ],
          "display_name": false
        },
        {
          "uuid": "0e92dd8a-f341-7efe-fb23-402465b04b1a",
          "name": "Tocopheryl nicotinate [WHO-DD]",
          "stdName": "TOCOPHERYL NICOTINATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ab714f55-39b5-4f12-2778-49aa4e415f4f"
          ],
          "display_name": false
        },
        {
          "uuid": "d88360c6-e6b3-469c-b509-34e82ed7d51c",
          "name": "VITAMIN E NICOTINATE",
          "stdName": "VITAMIN E NICOTINATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7c27dfc2-17a4-40d3-abf3-14a0fac1a43e",
            "1be6e073-b607-4539-9271-d586f1f66f78"
          ],
          "display_name": false
        },
        {
          "uuid": "68892036-878a-4730-98ba-c9f35cd92991",
          "name": "VITAMIN E NICOTINIC ACID ESTER",
          "stdName": "VITAMIN E NICOTINIC ACID ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7c27dfc2-17a4-40d3-abf3-14a0fac1a43e",
            "1be6e073-b607-4539-9271-d586f1f66f78"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "4d7b2dd3-467b-4975-bdd2-575a3d622781",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "993334de-7910-49b7-8118-27d62dbd0229",
          "citation": "DL CTFA",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2ec0d8db-4187-46d1-86ec-ea68422edaa5",
          "citation": "PCPC_DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1be6e073-b607-4539-9271-d586f1f66f78",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "030f20ae-2d9e-4265-9938-807ca236bd38",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7c27dfc2-17a4-40d3-abf3-14a0fac1a43e",
          "citation": "http://chem.sis.nlm.nih.gov/chemidplus/jsp/common/ChemInfo.jsp?type=names",
          "url": "http://chem.sis.nlm.nih.gov/chemidplus/jsp/common/ChemInfo.jsp?type=names",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e12640f1-549f-46fa-8c25-eb3a2cde4a16",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b7848be3-e84e-4246-93a7-6e8bec0319c7",
          "citation": "MARTINDALE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "955be6e5-8e80-49de-b53b-ef34df612411",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "40a93396-5749-48aa-aca6-f4b0c51e89a8",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "54f42011-efdf-46d6-b2ed-d32903475981",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390478000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f1c762e1-dfa2-43d8-ab9e-bdc277888d12",
          "citation": "SRS import [WI1J5UCY5C]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=WI1J5UCY5C",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390478000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2aa5a0d9-f832-40db-80d3-a555f48f088f",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "77d2b6d9-7eef-466b-bd31-7ca07c7dd1a6",
          "citation": "TOCOPHERYL NICOTINATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f8dc34c8-6a6f-4bfc-b8f2-647f1fb3cf6b",
          "citation": "TOCOPHERYL NICOTINATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "deabe835-3dbc-a5f4-8e9f-0cf41af404cb",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=43119-47-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "37aeb977-c5f2-42ce-ad91-afacdf8b0684",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "36865fce-fdaa-79f6-43f5-0864823a87db",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "ab714f55-39b5-4f12-2778-49aa4e415f4f",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "6f352dda-8780-1939-59db-b775263aaf3d",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "c7fa40ab-8366-1fa6-bd1c-7e35666c5d91",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3a43955e-4754-488b-ba40-56c9f4ac816e",
          "id": "3a43955e-4754-488b-ba40-56c9f4ac816e",
          "molfile": "\n  Marvin  01132103052D          \n\n 39 41  0  0  1  0            999 V2000\n   11.7480   -4.5577    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   11.7480   -5.3825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4576   -4.1337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1812   -4.5347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8909   -4.1199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6099   -4.5162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3195   -4.1013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6099   -5.3412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0291   -4.1567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3101   -4.5669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5864   -4.1706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8813   -4.5992    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.8813   -5.4194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1717   -4.1889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4574   -4.6037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7293   -4.2120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0104   -4.6176    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.7431   -4.9909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0104   -5.4610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3099   -5.8619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5863   -5.4610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8858   -5.8619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8858   -6.6822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1530   -5.4610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4295   -5.8573    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7198   -5.4471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7198   -4.6222    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0102   -5.8573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2958   -5.4424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4186   -5.8480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4186   -6.6776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2959   -7.0924    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0102   -6.6823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1530   -4.6176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4295   -4.2212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8858   -4.2212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8858   -3.3963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5863   -4.6176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3099   -4.2212    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  3  1  1  0  0  0  0\n  1  9  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  1  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  1  0  0  0\n 19 17  1  0  0  0  0\n 17 39  1  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 21  1  0  0  0  0\n 21 38  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 22  2  0  0  0  0\n 25 24  1  0  0  0  0\n 24 34  1  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  2  0  0  0  0\n 28 26  1  0  0  0  0\n 29 28  1  0  0  0  0\n 33 28  2  0  0  0  0\n 30 29  2  0  0  0  0\n 31 30  1  0  0  0  0\n 32 31  2  0  0  0  0\n 32 33  1  0  0  0  0\n 35 34  1  0  0  0  0\n 34 36  2  0  0  0  0\n 37 36  1  0  0  0  0\n 36 38  1  0  0  0  0\n 39 38  1  0  0  0  0\nM  END",
          "smiles": "CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@]1(C)CCc2c(C)c(c(C)c(C)c2O1)OC(=O)c3cccnc3",
          "formula": "C35H53NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "791f51f3-b350-458f-b265-72e9ff63ac4f"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "535.8015",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6263ab61-9c4d-4f65-a5ce-adfb03edd334",
      "version": "11",
      "structure": {
        "id": "bf48ee91-d43e-45c5-8342-cbd5be9122b4",
        "molfile": "\n  Marvin  01132109532D          \n\n 39 41  0  0  1  0            999 V2000\n    4.5863   -4.6176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5863   -5.4610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8858   -5.8619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8858   -6.6822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1530   -5.4610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1530   -4.6176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8858   -4.2212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8858   -3.3963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4295   -4.2212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4295   -5.8573    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7198   -5.4471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0102   -5.8573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0102   -6.6823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2959   -7.0924    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4186   -6.6776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4186   -5.8480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2958   -5.4424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7198   -4.6222    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3099   -5.8619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0104   -5.4610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0104   -4.6176    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.3099   -4.2212    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7293   -4.2120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4574   -4.6037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1717   -4.1889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8813   -4.5992    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.5864   -4.1706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3101   -4.5669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0291   -4.1567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7480   -4.5577    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   12.4576   -4.1337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1812   -4.5347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8909   -4.1199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6099   -4.5162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3195   -4.1013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6099   -5.3412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7480   -5.3825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8813   -5.4194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7431   -4.9909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  3  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  1  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  6  1  0  0  0  0\n 10  5  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 12  1  0  0  0  0\n 18 11  2  0  0  0  0\n 19  2  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22  1  1  0  0  0  0\n 21 23  1  6  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 27  1  0  0  0  0\n 29 28  1  0  0  0  0\n 30 29  1  0  0  0  0\n 31 30  1  0  0  0  0\n 32 31  1  0  0  0  0\n 33 32  1  0  0  0  0\n 34 33  1  0  0  0  0\n 35 34  1  0  0  0  0\n 36 34  1  0  0  0  0\n 30 37  1  1  0  0  0\n 26 38  1  1  0  0  0\n 21 39  1  1  0  0  0\nM  END",
        "smiles": "CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@]1(C)CCc2c(C)c(c(C)c(C)c2O1)OC(=O)c3cccnc3",
        "formula": "C35H53NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "535.8015",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "f1c762e1-dfa2-43d8-ab9e-bdc277888d12",
          "2aa5a0d9-f832-40db-80d3-a555f48f088f"
        ],
        "stereo_centers": 3
      },
      "unii": "WI1J5UCY5C"
    }
  ]
}