{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "801162d4-e129-47cb-943a-245ee5795763",
          "code": "58-96-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=58-96-8",
          "code_system": "CAS",
          "references": [
            "78fad285-102c-4721-8098-a7dd6627510a",
            "8341e225-f6a1-47ac-b280-c4a2549854e4"
          ]
        },
        {
          "uuid": "fa3e27d9-b330-4000-8b85-689fbb6f0a61",
          "code": "C922",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C922",
          "code_system": "NCI_THESAURUS",
          "references": [
            "78fad285-102c-4721-8098-a7dd6627510a"
          ]
        },
        {
          "uuid": "53828d6a-63cb-438e-8b48-65e852821b9d",
          "code": "D014529",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68014529",
          "code_system": "MESH",
          "references": [
            "78fad285-102c-4721-8098-a7dd6627510a"
          ]
        },
        {
          "uuid": "b0c6fd11-e7e4-4b76-8b30-b06bb4a43f4d",
          "code": "URIDINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Uridine",
          "code_system": "WIKIPEDIA",
          "references": [
            "78fad285-102c-4721-8098-a7dd6627510a"
          ]
        },
        {
          "uuid": "89f10ddc-b649-41d6-a5af-5fcd45271a84",
          "code": "m11332",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11332?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "78fad285-102c-4721-8098-a7dd6627510a"
          ]
        },
        {
          "uuid": "2cc181e1-9ad1-4c69-b9d3-40c9dec1afee",
          "code": "11017",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/11017/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "78fad285-102c-4721-8098-a7dd6627510a"
          ]
        },
        {
          "uuid": "6b109e46-60cf-4430-b716-1c25bbd7b22c",
          "code": "SUB05047MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "78fad285-102c-4721-8098-a7dd6627510a"
          ]
        },
        {
          "uuid": "56e294e8-9d27-4b09-9adf-a9a07254b5a0",
          "code": "N0000191809",
          "comments": "Established Pharmacologic Class [EPC]|Pyrimidine Analog [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000191809",
          "code_system": "NDF-RT",
          "references": [
            "78fad285-102c-4721-8098-a7dd6627510a"
          ]
        },
        {
          "uuid": "1ce367f6-4b65-469f-bcec-7b068df86b01",
          "code": "N0000175452",
          "comments": "Analogs/Derivatives [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175452",
          "code_system": "NDF-RT",
          "references": [
            "78fad285-102c-4721-8098-a7dd6627510a"
          ]
        },
        {
          "uuid": "bb8953f3-5ef1-4745-ad3f-db54578da714",
          "code": "N0000007587",
          "comments": "Pyrimidines [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000007587",
          "code_system": "NDF-RT",
          "references": [
            "78fad285-102c-4721-8098-a7dd6627510a"
          ]
        },
        {
          "uuid": "9d103c6d-88ae-4229-9cc5-47d4eef9a0e9",
          "code": "200-407-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.370",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "78fad285-102c-4721-8098-a7dd6627510a"
          ]
        },
        {
          "uuid": "cc132565-fd33-4fe3-b89c-7569f63a9cdd",
          "code": "6029",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6029",
          "code_system": "PUBCHEM",
          "references": [
            "78fad285-102c-4721-8098-a7dd6627510a"
          ]
        },
        {
          "uuid": "86282782-bd64-97c5-1303-baa79d6b838a",
          "code": "DTXSID40891555",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40891555",
          "code_system": "EPA CompTox",
          "references": [
            "2f1fd42f-5ef1-12a9-39d0-8c28aaec92aa"
          ]
        },
        {
          "uuid": "2e4027c1-9af7-eb65-f0fd-52dcd2164f63",
          "code": "C2080",
          "comments": "Pharmacologic Substance[C1909]|Protective Agent[C26170]|Chemoprotective Agent[C2459]|Cytoprotective Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2080",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d32873cb-065a-c760-64ef-6936525f90c5"
          ]
        },
        {
          "uuid": "19342486-f5ce-177e-268f-e08bb881a825",
          "code": "59216-2",
          "comments": "LOINC|ACTIVE|CHEM|Urine|Uridine/Creatinine [Molar ratio] in Urine",
          "type": "PRIMARY",
          "url": "https://loinc.org/59216-2/",
          "code_system": "LOINC",
          "references": [
            "d32873cb-065a-c760-64ef-6936525f90c5"
          ]
        },
        {
          "uuid": "f1395819-3c46-57aa-2829-a067660470ca",
          "code": "75130-5",
          "comments": "LOINC|ACTIVE|CHEM|CSF|Uridine [Moles/volume] in Cerebral spinal fluid",
          "type": "PRIMARY",
          "url": "https://loinc.org/75130-5/",
          "code_system": "LOINC",
          "references": [
            "d32873cb-065a-c760-64ef-6936525f90c5"
          ]
        },
        {
          "uuid": "dba36d47-e085-0415-9942-754ff4af5102",
          "code": "75159-4",
          "comments": "LOINC|ACTIVE|CHEM|Ser/Plas|Uridine [Moles/volume] in Serum or Plasma",
          "type": "PRIMARY",
          "url": "https://loinc.org/75159-4/",
          "code_system": "LOINC",
          "references": [
            "d32873cb-065a-c760-64ef-6936525f90c5"
          ]
        },
        {
          "uuid": "aed523bf-828a-9503-d775-61bbb2d3c3b9",
          "code": "3300 (Number of products:5)",
          "comments": "Dietary Supplement Label Database|chemical|Uridine",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=3300&item=Uridine",
          "code_system": "DSLD",
          "references": [
            "d32873cb-065a-c760-64ef-6936525f90c5"
          ]
        },
        {
          "uuid": "25a55a19-96d2-1b19-7c5a-8d64774fc190",
          "code": "DB02745",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB02745",
          "code_system": "DRUG BANK",
          "references": [
            "d32873cb-065a-c760-64ef-6936525f90c5"
          ]
        },
        {
          "uuid": "9bf99368-c770-4189-92e7-ced039402006",
          "code": "WHI7HQ7H85",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0e67073e-e91d-373e-9195-ff9a9cbe33c9",
          "code": "1707114",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1707114",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "d32873cb-065a-c760-64ef-6936525f90c5"
          ]
        },
        {
          "uuid": "2d2883e7-e1e0-b1fd-c91e-801e832ae9eb",
          "code": "16704",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:16704",
          "code_system": "CHEBI",
          "references": [
            "d32873cb-065a-c760-64ef-6936525f90c5"
          ]
        },
        {
          "uuid": "24d7f1f4-d7f2-1499-2f12-6a5ccc64ef8f",
          "code": "WHI7HQ7H85",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=WHI7HQ7H85",
          "code_system": "DAILYMED",
          "references": [
            "0510ae2a-1393-2653-008c-3c534372dd4e"
          ]
        },
        {
          "uuid": "54a7a94b-a4fb-f2c7-0ff2-6dcb88f8a24d",
          "code": "20256",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=20256",
          "code_system": "NSC",
          "references": [
            "f819e66c-6772-a7a9-fc1f-83c37bfe64cd"
          ]
        },
        {
          "uuid": "8c0c3ce7-7ee6-d58f-cb5c-86c68369632e",
          "code": "100000084782",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "4c2c76ef-bcf8-45bc-6364-1ccfac06ddd5"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "b2add7d4-ae39-4bda-8616-198442826153",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f603e81d-74b3-42d3-ac82-70246ae2ed01",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "35b86053-79f0-4364-afd5-1a8ceaa2d0c4",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "16969136-ede6-441f-b8fa-cefb07c119eb",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a5d0c3c5-cfff-45c7-b7f7-b4e49c559892",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b3b9d380-2b82-4bfc-adfd-b4eef3fadb83",
          "citation": "EP",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "10423f19-2d50-444b-ac09-f7b4dc52b444",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "adfe6ad3-3393-46a5-8dd9-466cb79dedc8",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c8346a68-530b-472b-aef0-8904abef52d8",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "78fad285-102c-4721-8098-a7dd6627510a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389721000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2d24e97e-ad71-4274-a964-8707f09f009a",
          "citation": "SRS import [WHI7HQ7H85]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=WHI7HQ7H85",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389721000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5272a80f-39ce-4faf-b8cb-19d17ed95fa2",
          "citation": "URIDINE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ad58ddb4-d9fa-4897-a5e1-2e8cf7d99be7",
          "citation": "URIDINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f9910329-7597-4254-9942-0d0f314a346e",
          "citation": "URIDINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e9ffcc84-f46f-497d-be08-82555ab28db0",
          "citation": "URIDINE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c7bd4ec8-c9e6-483e-b947-22ec8f46412e",
          "citation": "URIDINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f90876e1-8c08-5fda-52e9-7d77c397c99a",
          "citation": "Expert Opinion on Drug Metabolism & Toxicology, Volume 9, 2013 - Issue 2, pp-487-503",
          "url": "http://www.tandfonline.com/doi/pdf/10.1517/17425255.2012.663352?needAccess=true",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "d32873cb-065a-c760-64ef-6936525f90c5",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "7bbd5602-7606-8e79-da41-7581c6a63efd",
          "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/nda/2015/208169Orig1s000ClinPharm.pdf",
          "doc_type": "NDA PUBLIC REVIEW",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8341e225-f6a1-47ac-b280-c4a2549854e4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "73482e30-2a93-4323-b1e2-510282211253",
          "citation": "USP43-NF38 - 1223, Cytarabine Monograph ",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e425d33a-8710-438f-9493-8cd69afcf7b1",
          "citation": "EP",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "7928012e-9bfb-458e-9fa3-e9481040acb1",
          "citation": "EP 10.6",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f819e66c-6772-a7a9-fc1f-83c37bfe64cd",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "0510ae2a-1393-2653-008c-3c534372dd4e",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "741d4b20-cbb9-7852-1f7c-1f471d8191b5",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "2f1fd42f-5ef1-12a9-39d0-8c28aaec92aa",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "4c2c76ef-bcf8-45bc-6364-1ccfac06ddd5",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6cf9c9cd-d7c0-41fc-bd95-d0fb80c28f92",
          "id": "6cf9c9cd-d7c0-41fc-bd95-d0fb80c28f92",
          "molfile": "\n  Marvin  01132105402D          \n\n 17 18  0  0  1  0            999 V2000\n    5.9557   -4.2420    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.4041   -3.6529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5485   -3.6529    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6196   -3.7559    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2835   -4.2420    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.2835   -3.0499    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0128   -2.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0128   -1.7924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2928   -1.3762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2928   -0.5442    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5729   -1.7924    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5729   -2.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8436   -3.0499    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0309   -5.0274    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.6248   -5.4154    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2083   -5.0274    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.6987   -5.5042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  4  1  0  0  0  0\n 16  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  5  4  1  6  0  0  0\n  5  6  1  0  0  0  0\n 14  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n 12  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11  9  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 15  1  6  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  6  0  0  0\nM  END",
          "smiles": "c1cn([C@H]2[C@@H]([C@@H]([C@@H](CO)O2)O)O)c(=O)[nH]c1=O",
          "formula": "C9H12N2O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "21714aab-b5cd-4585-ba61-330522f0c0e6"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "244.2017",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "bfddc2a1-cfd7-4295-90f9-1e84425417a4",
      "version": "35",
      "structure": {
        "id": "d7646a8d-7d1c-4391-a25f-9a370cdf60a8",
        "molfile": "\n  Marvin  01132111102D          \n\n 17 18  0  0  1  0            999 V2000\n   16.6912   -4.1834    0.0000 N   0  0  2  0  0  0  0  0  0  0  0  0\n   16.3863   -5.3200    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   16.1337   -6.1054    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   15.3111   -6.1054    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   14.8015   -6.5822    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0585   -5.3200    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   15.7224   -4.8339    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5069   -4.7309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6513   -4.7309    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7275   -6.4934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9806   -3.7627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9806   -2.9259    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7005   -2.5097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4204   -2.9259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4204   -3.7627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7005   -1.7332    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2513   -4.1834    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  1  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  6  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  2  1  0  0  0  0\n  6  8  1  1  0  0  0\n  9  8  1  0  0  0  0\n  3 10  1  6  0  0  0\n 11  1  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15  1  1  0  0  0  0\n 16 13  2  0  0  0  0\n 17 11  2  0  0  0  0\nM  END",
        "smiles": "c1cn([C@H]2[C@@H]([C@@H]([C@@H](CO)O2)O)O)c(=O)[nH]c1=O",
        "formula": "C9H12N2O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "244.2017",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "b2add7d4-ae39-4bda-8616-198442826153",
          "2d24e97e-ad71-4274-a964-8707f09f009a"
        ],
        "stereo_centers": 4
      },
      "unii": "WHI7HQ7H85",
      "relationships": [
        {
          "uuid": "5a7b8baa-2e6a-413e-bc82-5d2a37d99792",
          "amount": {
            "uuid": "a25a4f9a-55bb-4a5f-9806-c6e6b86e4438"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "8fceaa9b-0e34-43ce-afc7-4ec8159d70b7",
            "refuuid": "bfddc2a1-cfd7-4295-90f9-1e84425417a4",
            "name": "URIDINE",
            "unii": "WHI7HQ7H85",
            "linking_id": "WHI7HQ7H85",
            "ref_pname": "URIDINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0eabd266-c2e6-46db-a279-76e0585efb6c",
          "amount": {
            "uuid": "d5fc7c44-9ebc-447a-be9e-274923df1f2b",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "PARENT->IMPURITY",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "7928012e-9bfb-458e-9fa3-e9481040acb1"
          ],
          "related_substance": {
            "uuid": "cf6f7cb3-00ad-4417-b96f-5f22308ccc30",
            "refuuid": "dc70f2f3-5a14-4f5f-bf00-2fb0ad0100e2",
            "name": "ADENOSINE",
            "unii": "K72T3FS567",
            "linking_id": "K72T3FS567",
            "ref_pname": "ADENOSINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "dc418294-f5c8-4457-8707-00e87282ea51",
          "amount": {
            "uuid": "38bf0c0e-ec32-4d98-8f62-a36f0c467c15"
          },
          "type": "PRODRUG->METABOLITE ACTIVE",
          "related_substance": {
            "uuid": "17d49ab5-3baa-49aa-bdbd-87a5d02a2b90",
            "refuuid": "ad1efa7c-de56-4176-b394-60ae6415ccc3",
            "name": "URIDINE TRIACETATE",
            "unii": "2WP61F175M",
            "linking_id": "2WP61F175M",
            "ref_pname": "URIDINE TRIACETATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0e08d17a-aa7a-424f-bde9-d6ec6b460a83",
          "amount": {
            "uuid": "e6385543-a70f-4f92-8a01-c4888c360b4c"
          },
          "comments": "Mediator Substance is AOX1",
          "type": "PARENT->METABOLITE",
          "references": [
            "f90876e1-8c08-5fda-52e9-7d77c397c99a"
          ],
          "related_substance": {
            "uuid": "8a16894c-9dc5-4b84-9709-4f38b8144e02",
            "refuuid": "a4159581-7607-429c-aa27-3d06cadc68de",
            "name": "ZEBULARINE",
            "unii": "7A9Y5SX0GY",
            "linking_id": "7A9Y5SX0GY",
            "ref_pname": "ZEBULARINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f902c538-fb9d-4779-8673-401fd8252419",
          "amount": {
            "uuid": "450a1738-775e-498c-8da3-ccbf5bbe1ab1"
          },
          "qualification": "USP",
          "type": "PARENT->IMPURITY",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "e425d33a-8710-438f-9493-8cd69afcf7b1"
          ],
          "related_substance": {
            "uuid": "8658c45c-cb83-41b2-a79f-63a48de56d8e",
            "refuuid": "2b258dc9-0ac3-44df-bc57-7712751e5cbe",
            "name": "CYTARABINE",
            "unii": "04079A1RDZ",
            "linking_id": "04079A1RDZ",
            "ref_pname": "CYTARABINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6cd7fcf2-d1e1-4f6b-a493-8d99b5405167",
          "amount": {
            "uuid": "69c5a7f0-6cce-4883-8153-931e17342088",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "PARENT->IMPURITY",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "10423f19-2d50-444b-ac09-f7b4dc52b444"
          ],
          "related_substance": {
            "uuid": "8b9a55ec-f69e-4666-8ce0-36aaea371703",
            "refuuid": "dc70f2f3-5a14-4f5f-bf00-2fb0ad0100e2",
            "name": "ADENOSINE",
            "unii": "K72T3FS567",
            "linking_id": "K72T3FS567",
            "ref_pname": "ADENOSINE",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "da69b167-5ceb-4634-a234-7aacae8278db",
          "name": "1-.BETA.-D-RIBOFURANOSYLPYRIMIDINE-2,4(1H,3H)-DIONE",
          "stdName": "1-.BETA.-D-RIBOFURANOSYLPYRIMIDINE-2,4(1H,3H)-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7928012e-9bfb-458e-9fa3-e9481040acb1"
          ],
          "display_name": false
        },
        {
          "uuid": "b885fb98-461d-4d07-a547-d9c9435166d2",
          "name": "1-.BETA.-D-RIBOFURANOSYLURACIL",
          "stdName": "1-.BETA.-D-RIBOFURANOSYLURACIL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f603e81d-74b3-42d3-ac82-70246ae2ed01",
            "b2add7d4-ae39-4bda-8616-198442826153"
          ],
          "display_name": false
        },
        {
          "uuid": "bb1a4cb6-5cef-6be4-e63f-dad9e938d9d9",
          "name": "ADENOSINE IMPURITY F [EP IMPURITY]",
          "stdName": "ADENOSINE IMPURITY F [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f603e81d-74b3-42d3-ac82-70246ae2ed01",
            "b3b9d380-2b82-4bfc-adfd-b4eef3fadb83"
          ],
          "display_name": false
        },
        {
          "uuid": "d58d9b9b-d936-468d-8e5b-87e5ec25edf3",
          "name": "NSC-20256",
          "stdName": "NSC-20256",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f603e81d-74b3-42d3-ac82-70246ae2ed01",
            "c8346a68-530b-472b-aef0-8904abef52d8"
          ],
          "display_name": false
        },
        {
          "uuid": "11113070-6f44-412a-87d6-4b7ec641694e",
          "name": "URACIL RIBOSIDE",
          "stdName": "URACIL RIBOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f603e81d-74b3-42d3-ac82-70246ae2ed01",
            "b2add7d4-ae39-4bda-8616-198442826153"
          ],
          "display_name": false
        },
        {
          "uuid": "0ff87b82-67da-4bfc-8995-eca0c6b9d33f",
          "name": "URIDINE",
          "stdName": "URIDINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10423f19-2d50-444b-ac09-f7b4dc52b444",
            "f603e81d-74b3-42d3-ac82-70246ae2ed01",
            "adfe6ad3-3393-46a5-8dd9-466cb79dedc8",
            "5272a80f-39ce-4faf-b8cb-19d17ed95fa2",
            "16969136-ede6-441f-b8fa-cefb07c119eb",
            "e9ffcc84-f46f-497d-be08-82555ab28db0",
            "ad58ddb4-d9fa-4897-a5e1-2e8cf7d99be7",
            "b2add7d4-ae39-4bda-8616-198442826153",
            "c7bd4ec8-c9e6-483e-b947-22ec8f46412e",
            "35b86053-79f0-4364-afd5-1a8ceaa2d0c4",
            "a5d0c3c5-cfff-45c7-b7f7-b4e49c559892",
            "f9910329-7597-4254-9942-0d0f314a346e"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "089b46ed-5f8b-4e9f-8b88-113a13863e1d",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "e4397d5a-681f-4410-9aa0-7575f318d745",
          "name": "URIDINE [MART.]",
          "stdName": "URIDINE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35b86053-79f0-4364-afd5-1a8ceaa2d0c4"
          ],
          "display_name": false
        },
        {
          "uuid": "8ff722df-1369-486c-8c18-279f09e5377a",
          "name": "URIDINE [MI]",
          "stdName": "URIDINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f603e81d-74b3-42d3-ac82-70246ae2ed01",
            "16969136-ede6-441f-b8fa-cefb07c119eb"
          ],
          "display_name": false
        },
        {
          "uuid": "948fd240-6e3b-dcf8-0279-4570bc7c1943",
          "name": "URIDINE [USP IMPURITY]",
          "stdName": "URIDINE [USP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10423f19-2d50-444b-ac09-f7b4dc52b444"
          ],
          "display_name": false
        },
        {
          "uuid": "da358b3f-faf1-4344-a6a7-d4199d9ddde7",
          "name": "URIDINE [USP-RS]",
          "stdName": "URIDINE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10423f19-2d50-444b-ac09-f7b4dc52b444",
            "f603e81d-74b3-42d3-ac82-70246ae2ed01"
          ],
          "display_name": false
        },
        {
          "uuid": "8bad6dc3-65c4-73cc-f8c5-8fbe91aec1da",
          "name": "Uridine [WHO-DD]",
          "stdName": "URIDINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "741d4b20-cbb9-7852-1f7c-1f471d8191b5"
          ],
          "display_name": false
        }
      ],
      "properties": [
        {
          "uuid": "62bec9c7-666e-4511-9df1-20dde7ae6b1a",
          "name": "Tmax",
          "value": {
            "uuid": "b4516ba4-f71d-400f-8b11-9f782cba992d",
            "high": 3,
            "low": 2,
            "units": "hours"
          },
          "defining": false,
          "parameters": [
            {
              "uuid": "14a9dd94-fc7b-40ac-92d1-a2ff881964bc",
              "name": "ORAL ADMINISTRATION",
              "references": []
            }
          ],
          "property_type": "PHARMACOKINETIC",
          "references": [
            "7bbd5602-7606-8e79-da41-7581c6a63efd"
          ]
        },
        {
          "uuid": "a9cecfc6-ea96-4626-a12b-092b6b5f8f41",
          "name": "Biological Half-life",
          "value": {
            "uuid": "d285e4ac-5633-4b86-a29f-5568afefcfa0",
            "high": 2.5,
            "low": 2,
            "units": "hours"
          },
          "defining": false,
          "parameters": [
            {
              "uuid": "8c2ba931-5028-4422-b02b-183e16245fda",
              "name": "ORAL ADMINISTRATION",
              "references": []
            }
          ],
          "property_type": "PHARMACOKINETIC",
          "references": [
            "7bbd5602-7606-8e79-da41-7581c6a63efd"
          ]
        }
      ]
    }
  ]
}