{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ea07485a-27f2-4bf2-b12a-832e2f55f236",
          "code": "1228284-64-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1228284-64-7",
          "code_system": "CAS",
          "references": [
            "3ff56ae5-1de3-45ea-b3cb-ee27aeb211a4",
            "812d8827-36e9-41a6-b1f6-b57d015048c5"
          ]
        },
        {
          "uuid": "49f4bf66-8013-4357-89c2-9e012986acb5",
          "code": "56933411",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/56933411",
          "code_system": "PUBCHEM",
          "references": [
            "3ff56ae5-1de3-45ea-b3cb-ee27aeb211a4"
          ]
        },
        {
          "uuid": "2d7fbb75-b944-4b19-913d-42908003bb79",
          "code": "WHG7I49FAK",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "15562028-0eec-ecab-93fe-eab5787feb77",
          "code": "DTXSID60894826",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60894826",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "2ad34ca9-1489-c898-64fc-ad7f8cced36a",
          "code": "pydiflumetofen",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/pydiflumetofen.html",
          "code_system": "ALANWOOD",
          "references": [
            "88693650-049a-8303-689a-21b924931fc6"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "dfec62fc-d2c6-4c01-b50e-cb22d091c808",
          "name": "1H-PYRAZOLE-4-CARBOXAMIDE, 3-(DIFLUOROMETHYL)-N-METHOXY-1-METHYL-N-(1-METHYL-2-(2,4,6-TRICHLOROPHENYL)ETHYL)-",
          "stdName": "1H-PYRAZOLE-4-CARBOXAMIDE, 3-(DIFLUOROMETHYL)-N-METHOXY-1-METHYL-N-(1-METHYL-2-(2,4,6-TRICHLOROPHENYL)ETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c99ad4bf-a409-400a-bbec-bf6de8c265bf",
            "3f0301e1-1fb4-415b-96bf-5ccaf30d8601"
          ],
          "display_name": false
        },
        {
          "uuid": "07893cac-85ca-4b33-9755-a356367d7f5b",
          "name": "3-(DIFLUOROMETHYL)-N-METHOXY-1-METHYL-N-((2.XI.)-1-(2,4,6-TRICHLOROPHENYL)PROPAN-2-YL)-1H-PYRAZOLE-4-CARBOXAMIDE",
          "stdName": "3-(DIFLUOROMETHYL)-N-METHOXY-1-METHYL-N-((2.XI.)-1-(2,4,6-TRICHLOROPHENYL)PROPAN-2-YL)-1H-PYRAZOLE-4-CARBOXAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "39ac16dd-b6b4-4035-9e3e-a7290a268fab",
            "812d8827-36e9-41a6-b1f6-b57d015048c5"
          ],
          "display_name": false
        },
        {
          "uuid": "6fce1e09-3062-44df-8e34-8501a917051c",
          "name": "3-(DIFLUOROMETHYL)-N-METHOXY-1-METHYL-N-((RS)-1-METHYL-2-(2,4,6-TRICHLOROPHENYL)ETHYL)-1H-PYRAZOLE-4-CARBOXAMIDE",
          "stdName": "3-(DIFLUOROMETHYL)-N-METHOXY-1-METHYL-N-((RS)-1-METHYL-2-(2,4,6-TRICHLOROPHENYL)ETHYL)-1H-PYRAZOLE-4-CARBOXAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "39ac16dd-b6b4-4035-9e3e-a7290a268fab",
            "812d8827-36e9-41a6-b1f6-b57d015048c5"
          ],
          "display_name": false
        },
        {
          "uuid": "200226d4-ff47-4b3e-8796-ce8e55744cf5",
          "name": "3-(DIFLUOROMETHYL)-N-METHOXY-1-METHYL-N-(1-METHYL-2-(2,4,6-TRICHLOROPHENYL)ETHYL)-1H-PYRAZOLE-4-CARBOXAMIDE",
          "stdName": "3-(DIFLUOROMETHYL)-N-METHOXY-1-METHYL-N-(1-METHYL-2-(2,4,6-TRICHLOROPHENYL)ETHYL)-1H-PYRAZOLE-4-CARBOXAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "02c41596-e53c-46b7-846a-2fa075f5a451",
            "3f0301e1-1fb4-415b-96bf-5ccaf30d8601"
          ],
          "display_name": false
        },
        {
          "uuid": "d494ff17-116d-49e1-b8dd-c437384d3063",
          "name": "PYDIFLUMETOFEN",
          "stdName": "PYDIFLUMETOFEN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "39ac16dd-b6b4-4035-9e3e-a7290a268fab",
            "812d8827-36e9-41a6-b1f6-b57d015048c5"
          ],
          "display_name": true,
          "domains": [
            "Pesticide"
          ],
          "name_orgs": [
            {
              "uuid": "0bffbba8-d819-4299-bbb3-005ceba85ad8",
              "name_org": "ISO"
            }
          ]
        },
        {
          "uuid": "a9abe7eb-8128-4806-b0c9-011982821322",
          "name": "PYDIFLUMETOFEN [ISO]",
          "stdName": "PYDIFLUMETOFEN [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "39ac16dd-b6b4-4035-9e3e-a7290a268fab",
            "812d8827-36e9-41a6-b1f6-b57d015048c5"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c99ad4bf-a409-400a-bbec-bf6de8c265bf",
          "citation": "EPA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3f0301e1-1fb4-415b-96bf-5ccaf30d8601",
          "citation": "EPA",
          "doc_type": "EPA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "02c41596-e53c-46b7-846a-2fa075f5a451",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3ff56ae5-1de3-45ea-b3cb-ee27aeb211a4",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392799000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3386f538-2a96-40a9-8f7e-71e01ef572bd",
          "citation": "SRS import [WHG7I49FAK]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=WHG7I49FAK",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392799000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "88693650-049a-8303-689a-21b924931fc6",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "39ac16dd-b6b4-4035-9e3e-a7290a268fab",
          "citation": "https://pesticidecompendium.bcpc.org/",
          "url": "https://pesticidecompendium.bcpc.org/pydiflumetofen.html",
          "doc_type": "ALANWOOD",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "812d8827-36e9-41a6-b1f6-b57d015048c5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "40fd694c-fee8-4b0a-8c1d-dd277aba2350",
          "id": "40fd694c-fee8-4b0a-8c1d-dd277aba2350",
          "molfile": "\n  Marvin  01132103262D          \n\n 26 27  0  0  0  0            999 V2000\n   -1.2885    1.2119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5740    0.7994    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5740   -0.0256    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1404   -0.4381    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    0.1404   -1.2631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8549   -0.0256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5694   -0.4381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2839   -0.0256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2839    0.7994    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    2.9983   -0.4381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9983   -1.2631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7128   -1.6756    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    2.2839   -1.6756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5694   -1.2631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8549   -1.6756    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2885   -0.4381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2885   -1.2631    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0030   -0.0256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0892    0.7949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8962    0.9664    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2317    1.7201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3087    0.2520    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7566   -0.3611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9282   -1.1681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.7128   -1.4230    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3151   -1.7201    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n 16  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 14  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  8  2  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 11  2  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 17  2  0  0  0  0\n 18 16  1  0  0  0  0\n 18 19  2  0  0  0  0\n 23 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  1  0  0  0  0\nM  END",
          "smiles": "CC(Cc1c(cc(cc1Cl)Cl)Cl)N(C(=O)c2cn(C)nc2C(F)F)OC",
          "formula": "C16H16Cl3F2N3O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5327c944-5460-4ae1-a08e-6d4251955a23"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "426.6734",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ae84cf54-99f0-4342-a669-85bd8a0d945f",
      "version": "9",
      "structure": {
        "id": "d16b9bbc-e1e7-4d76-ba14-f2ef63f19b2f",
        "molfile": "\n  Marvin  01132110492D          \n\n 26 27  0  0  0  0            999 V2000\n   -2.8962    0.9664    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3087    0.2520    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7566   -0.3611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0030   -0.0256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0892    0.7949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2885   -0.4381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2885   -1.2631    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5740   -0.0256    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1404   -0.4381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8549   -0.0256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5694   -0.4381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5694   -1.2631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2839   -1.6756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9983   -1.2631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9983   -0.4381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2839   -0.0256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2839    0.7994    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.7128   -1.6756    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.8549   -1.6756    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.1404   -1.2631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2317    1.7201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5740    0.7994    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2885    1.2119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9282   -1.1681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.7128   -1.4230    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3151   -1.7201    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  1  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  4  6  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 11 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 14 18  1  0  0  0  0\n 12 19  1  0  0  0  0\n 10 11  1  0  0  0  0\n  9 20  1  0  0  0  0\n  8  9  1  0  0  0  0\n  1 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n  8 22  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  1  0  0  0  0\n  3 24  1  0  0  0  0\nM  END",
        "smiles": "CC(Cc1c(cc(cc1Cl)Cl)Cl)N(C(=O)c2cn(C)nc2C(F)F)OC",
        "formula": "C16H16Cl3F2N3O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "426.6734",
        "optical_activity": "( + / - )",
        "references": [
          "3386f538-2a96-40a9-8f7e-71e01ef572bd",
          "c99ad4bf-a409-400a-bbec-bf6de8c265bf",
          "39ac16dd-b6b4-4035-9e3e-a7290a268fab"
        ],
        "stereo_centers": 1
      },
      "unii": "WHG7I49FAK"
    }
  ]
}