{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "139dacc1-ab98-4239-bf2c-c6acf6d224bb",
          "code": "34760-60-6",
          "type": "NON-SPECIFIC STOICHIOMETRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=34760-60-6",
          "code_system": "CAS",
          "references": [
            "a053ebfb-e2d4-7e3c-0b7b-d039301b852d"
          ]
        },
        {
          "uuid": "9de336e3-c55c-40bd-8368-56057a1f9386",
          "code": "21121987",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/21121987",
          "code_system": "PUBCHEM",
          "references": [
            "55396745-94c5-b48d-2ed6-2ead3ab327cc"
          ]
        },
        {
          "uuid": "c3d23f43-df2b-48ec-912a-8f4a25a21ae8",
          "code": "30925-07-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=30925-07-6",
          "code_system": "CAS",
          "references": [
            "a053ebfb-e2d4-7e3c-0b7b-d039301b852d"
          ]
        },
        {
          "uuid": "51f02911-5cf1-ed1a-0875-65ce9c9b61a7",
          "code": "252-196-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.047.437",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "1f646a66-84b0-0e59-7a75-fba38a2245f5"
          ]
        },
        {
          "uuid": "e2ce2cb3-6a0a-412a-9953-61b395575dfb",
          "code": "WFN1A47EIG",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "94cb6f49-117b-b44c-4591-74bf9750f7b0",
          "code": "DTXSID101335748",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID101335748",
          "code_system": "EPA CompTox",
          "references": [
            "a8c2dfa6-e102-4b22-e889-9ea670e503d9"
          ]
        },
        {
          "uuid": "d4960272-8978-ce94-136d-e41237f2b93d",
          "code": "100000166126",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "c194b39b-0c8b-2d00-877e-3b3f0a438b3c"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "d63a8cbd-5805-4930-a333-daf7a2168034",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "b4c67ee3-43fe-48e7-aac6-e0b7810f4d30",
            "refuuid": "fc42e07f-ae6d-439d-95d9-61c23f19413f",
            "name": "CYSTINE",
            "unii": "48TCX9A1VT",
            "linking_id": "48TCX9A1VT",
            "ref_pname": "CYSTINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d35435ea-e1ad-438f-b76d-5dd1511fa8de",
          "name": "CYSTINE DIHYDROCHLORIDE",
          "stdName": "CYSTINE DIHYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a053ebfb-e2d4-7e3c-0b7b-d039301b852d"
          ],
          "display_name": true
        },
        {
          "uuid": "954e81bf-6917-cded-f046-8e8f02a71125",
          "name": "L-CYSTINE, HYDROCHLORIDE",
          "stdName": "L-CYSTINE, HYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a053ebfb-e2d4-7e3c-0b7b-d039301b852d"
          ],
          "display_name": false
        },
        {
          "uuid": "864f698c-cc19-73d6-2c92-e75240ad3954",
          "name": "L-CYSTINE, HYDROCHLORIDE (1:2)",
          "stdName": "L-CYSTINE, HYDROCHLORIDE (1:2)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a053ebfb-e2d4-7e3c-0b7b-d039301b852d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6a2eb2fc-508d-4e92-86ed-c69793cc4157",
          "citation": "SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a053ebfb-e2d4-7e3c-0b7b-d039301b852d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "55396745-94c5-b48d-2ed6-2ead3ab327cc",
          "citation": "PUBCHEM",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "1f646a66-84b0-0e59-7a75-fba38a2245f5",
          "citation": "EC",
          "doc_type": "ECHA (EC/EINECS)",
          "public_domain": true
        },
        {
          "uuid": "c194b39b-0c8b-2d00-877e-3b3f0a438b3c",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "a8c2dfa6-e102-4b22-e889-9ea670e503d9",
          "citation": "EPA",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "36d48202-4509-442e-1b25-1ab41cec2322",
          "id": "36d48202-4509-442e-1b25-1ab41cec2322",
          "molfile": "\n  Marvin  01132102552D          \n\n 14 13  0  0  1  0            999 V2000\n   13.4728   -3.8990    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   13.4566   -3.0742    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1953   -4.2974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9015   -3.8709    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6239   -4.2692    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3301   -3.8428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0526   -4.2411    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   17.0688   -5.0660    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7588   -3.8147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7426   -2.9898    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4812   -4.2130    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7665   -4.3254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7828   -5.1503    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0441   -3.9271    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  3  1  1  0  0  0  0\n  1 12  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  1  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  2  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  2  0  0  0  0\nM  END",
          "smiles": "C([C@@H](C(=O)O)N)SSC[C@@H](C(=O)O)N",
          "formula": "C6H12N2O4S2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "daea0ad2-dcc7-4618-8894-405f58430557"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "240.3029",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        },
        {
          "uuid": "83476e61-bd97-8703-2bcc-af72d6d55c0e",
          "id": "83476e61-bd97-8703-2bcc-af72d6d55c0e",
          "molfile": "\n  Marvin  01132106492D          \n\n  1  0  0  0  1  0            999 V2000\n   14.6577   -5.8631    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "7ca833e0-504b-4f63-88d2-5e5d07e09513"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f4c0777b-cd00-4f15-886e-9c11129213af",
      "version": "13",
      "structure": {
        "id": "30d58729-9699-4b3f-9119-f20910680a4a",
        "molfile": "\n  Marvin  01132102372D          \n\n 16 13  0  0  1  0            999 V2000\n   17.7426   -2.9898    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4812   -4.2130    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7588   -3.8147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7828   -5.1503    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0441   -3.9271    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7665   -4.3254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4566   -3.0742    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4728   -3.8990    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   14.1953   -4.2974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9015   -3.8709    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6239   -4.2692    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3301   -3.8428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0526   -4.2411    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   17.0688   -5.0660    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6577   -5.8631    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   14.6577   -5.8631    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  3  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n 13  3  1  0  0  0  0\n  6  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  8  6  1  0  0  0  0\n  8  7  1  1  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  1  0  0  0\nM  STY  1   1 MUL\nM  SAL   1  2  15  16\nM  SPA   1  1  15\nM  SDI   1  4   14.2377   -6.2831   14.2377   -5.4431\nM  SDI   1  4   15.0777   -5.4431   15.0777   -6.2831\nM  SMT   1 2\nM  END",
        "smiles": "C([C@@H](C(=O)O)N)SSC[C@@H](C(=O)O)N.Cl.Cl",
        "formula": "C6H12N2O4S2.2ClH",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "313.2247",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "a053ebfb-e2d4-7e3c-0b7b-d039301b852d"
        ],
        "stereo_centers": 2
      },
      "unii": "WFN1A47EIG"
    }
  ]
}