{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2d728bfe-439d-4657-b1ef-a81e152ad5ad",
          "code": "26761-40-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=26761-40-0",
          "code_system": "CAS",
          "references": [
            "47ff9a6d-b37a-4e4a-9b16-d910e544e9e8",
            "2b99a913-5994-4391-a1f6-16c96bb4e7f1"
          ]
        },
        {
          "uuid": "f8f33fa9-d69f-4e82-96cb-9c9d690e744b",
          "code": "C042080",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67042080",
          "code_system": "MESH",
          "references": [
            "47ff9a6d-b37a-4e4a-9b16-d910e544e9e8"
          ]
        },
        {
          "uuid": "65839c3f-82f1-4abf-8d2d-3163136a08df",
          "code": "DIISODECYL PHTHALATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Diisodecyl_phthalate",
          "code_system": "WIKIPEDIA",
          "references": [
            "47ff9a6d-b37a-4e4a-9b16-d910e544e9e8"
          ]
        },
        {
          "uuid": "de54a92c-ceb2-4c9e-9713-fa80f79b123d",
          "code": "247-977-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.043.601",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "47ff9a6d-b37a-4e4a-9b16-d910e544e9e8"
          ]
        },
        {
          "uuid": "f853b9b4-5d45-4c2f-bf32-f4f24e27dae3",
          "code": "33599",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/33599",
          "code_system": "PUBCHEM",
          "references": [
            "47ff9a6d-b37a-4e4a-9b16-d910e544e9e8"
          ]
        },
        {
          "uuid": "97eaebb0-76ab-8925-3e50-d84cfaa05737",
          "code": "930",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/930",
          "code_system": "HSDB",
          "references": [
            "37555f88-0262-fe18-1a68-335f1955e0c7"
          ]
        },
        {
          "uuid": "3eb56d73-4e6e-634a-e4e1-04eb91b3899e",
          "code": "DTXSID4025082",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4025082",
          "code_system": "EPA CompTox",
          "references": [
            "f4e2bacc-adb7-375e-3b4a-d9d8d5e389d1"
          ]
        },
        {
          "uuid": "f1199b4d-ade1-4660-a257-28ca81b96130",
          "code": "WF93T741QI",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3a85a382-7140-4c3b-b813-3d170e45fe15",
          "name": "1,2-BENZENEDICARBOXYLIC ACID DIISODECYL ESTER",
          "stdName": "1,2-BENZENEDICARBOXYLIC ACID DIISODECYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d2d3c59-f927-4f3e-8fa8-7d460da5ebc6",
            "c3bee74b-ee29-4e39-aadd-8e2008ffa1fb"
          ],
          "display_name": false
        },
        {
          "uuid": "cb272564-a50c-4686-8705-84084b9b76f6",
          "name": "1,2-BENZENEDICARBOXYLIC ACID, BIS(8-METHYLNONYL) ESTER",
          "stdName": "1,2-BENZENEDICARBOXYLIC ACID, BIS(8-METHYLNONYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d2d3c59-f927-4f3e-8fa8-7d460da5ebc6",
            "c3bee74b-ee29-4e39-aadd-8e2008ffa1fb"
          ],
          "display_name": false
        },
        {
          "uuid": "67282c25-7f09-4eab-b6b0-e6ed7c24c825",
          "name": "BIS(8-METHYLNONYL) BENZENE-1,2-DICARBOXYLATE",
          "stdName": "BIS(8-METHYLNONYL) BENZENE-1,2-DICARBOXYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d2d3c59-f927-4f3e-8fa8-7d460da5ebc6",
            "c3bee74b-ee29-4e39-aadd-8e2008ffa1fb"
          ],
          "display_name": false
        },
        {
          "uuid": "b52a591f-4e33-41a1-a9e4-1530c85f7a11",
          "name": "BIS(8-METHYLNONYL) PHTHALATE",
          "stdName": "BIS(8-METHYLNONYL) PHTHALATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d2d3c59-f927-4f3e-8fa8-7d460da5ebc6",
            "c3bee74b-ee29-4e39-aadd-8e2008ffa1fb"
          ],
          "display_name": false
        },
        {
          "uuid": "a02b5567-fb1f-4b0c-b88c-535a9c5a1e95",
          "name": "DI-ISODECYL PHTHALATE",
          "stdName": "DI-ISODECYL PHTHALATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d2d3c59-f927-4f3e-8fa8-7d460da5ebc6",
            "c3bee74b-ee29-4e39-aadd-8e2008ffa1fb"
          ],
          "display_name": false
        },
        {
          "uuid": "9c454414-2b89-434c-a3da-7b98a911bfbd",
          "name": "DIISODECYL PHTHALATE",
          "stdName": "DIISODECYL PHTHALATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e4757bc7-a0a2-4ea1-be54-f5c21684f018",
            "d249c8f5-e562-49e8-9f0f-3be78d962cc6",
            "79aa3a49-62b8-4384-8d11-961fc92a1c6f",
            "c3bee74b-ee29-4e39-aadd-8e2008ffa1fb"
          ],
          "display_name": true
        },
        {
          "uuid": "ffb0f233-655d-4524-a337-e268ebd13937",
          "name": "DIISODECYL PHTHALATE [HSDB]",
          "stdName": "DIISODECYL PHTHALATE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d249c8f5-e562-49e8-9f0f-3be78d962cc6",
            "c3bee74b-ee29-4e39-aadd-8e2008ffa1fb"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e4757bc7-a0a2-4ea1-be54-f5c21684f018",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2d2d3c59-f927-4f3e-8fa8-7d460da5ebc6",
          "citation": "CHEMSPIDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c3bee74b-ee29-4e39-aadd-8e2008ffa1fb",
          "citation": "CHEMSPIDER",
          "doc_type": "CHEMSPIDER",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d249c8f5-e562-49e8-9f0f-3be78d962cc6",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "47ff9a6d-b37a-4e4a-9b16-d910e544e9e8",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390953000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b6fc5156-2b40-4e17-b51b-71aa56fc0264",
          "citation": "SRS import [WF93T741QI]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=WF93T741QI",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390953000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f1deea94-8ea5-401a-825e-f07f33a3b7a2",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "79aa3a49-62b8-4384-8d11-961fc92a1c6f",
          "citation": "DIISODECYL PHTHALATE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "37555f88-0262-fe18-1a68-335f1955e0c7",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+26761-40-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f4e2bacc-adb7-375e-3b4a-d9d8d5e389d1",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=26761-40-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2b99a913-5994-4391-a1f6-16c96bb4e7f1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "02c403a8-8d69-47ad-a510-c4ea4be0c344",
          "id": "02c403a8-8d69-47ad-a510-c4ea4be0c344",
          "molfile": "\n  Marvin  01132100272D          \n\n 32 32  0  0  0  0            999 V2000\n    2.7087   -2.5009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0970   -3.2461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9062   -3.2461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6555   -3.9385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0440   -4.6731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6124   -5.3656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9743   -6.1002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7677   -6.1002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1830   -5.3761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0133   -5.3761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4081   -6.0838    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2385   -6.0838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6537   -5.3761    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6537   -6.8032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2385   -7.5161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6537   -8.2295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4577   -8.2295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8728   -7.5161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4577   -6.8032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8728   -6.0838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4577   -5.3761    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7037   -6.0838    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0978   -5.3761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9287   -5.3761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3439   -6.1002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1630   -6.1002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5786   -5.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1742   -4.6993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5899   -3.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1742   -3.2461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6274   -2.5540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3813   -3.2461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 14 12  1  0  0  0  0\n 14 15  1  0  0  0  0\n 19 14  2  0  0  0  0\n 15 16  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 20 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 29 30  1  0  0  0  0\n 30 31  1  0  0  0  0\n 30 32  1  0  0  0  0\nM  END",
          "smiles": "CC(C)CCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCCC(C)C",
          "formula": "C28H46O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "08585865-69c8-4f1a-925b-ad9bd92d1c11"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "446.6635",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3fcbea81-92d6-4ded-bd59-3e72ce0e2c06",
      "version": "4",
      "structure": {
        "id": "97854d93-6c44-4997-ba33-49c84f601372",
        "molfile": "\n  Marvin  01132107522D          \n\n 32 32  0  0  0  0            999 V2000\n    7.4572   -6.8027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6533   -6.8027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2381   -7.5156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6533   -8.2290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4572   -8.2290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8723   -7.5156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2381   -6.0834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4077   -6.0834    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0130   -5.3757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1827   -5.3757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7674   -6.0998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9741   -6.0998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6122   -5.3652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0438   -4.6728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6553   -3.9382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0968   -3.2459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7085   -2.5007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9059   -3.2459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6533   -5.3757    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8723   -6.0834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7031   -6.0834    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0972   -5.3757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9280   -5.3757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3432   -6.0998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1623   -6.0998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5778   -5.3913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1735   -4.6990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5891   -3.9914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1735   -3.2459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6266   -2.5538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3806   -3.2459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4572   -5.3757    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  1  6  1  0  0  0  0\n  2  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n  7 19  2  0  0  0  0\n  1 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 29 30  1  0  0  0  0\n 29 31  1  0  0  0  0\n 20 32  2  0  0  0  0\nM  END",
        "smiles": "CC(C)CCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCCC(C)C",
        "formula": "C28H46O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "446.6635",
        "optical_activity": "NONE",
        "references": [
          "b6fc5156-2b40-4e17-b51b-71aa56fc0264",
          "f1deea94-8ea5-401a-825e-f07f33a3b7a2"
        ],
        "stereo_centers": 0
      },
      "unii": "WF93T741QI"
    }
  ]
}