{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "c54180a9-2743-4709-9ddd-b7871c673759", "code": "19799-49-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=19799-49-6", "code_system": "CAS", "references": [ "0f1ff991-17f5-46ab-b93c-2710af4ba7bb", "262dfa18-fd51-49fa-a806-65b5f9e244f0" ] }, { "uuid": "7acb568e-bb71-4c6e-bb04-e6e52c332239", "code": "220535", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/220535", "code_system": "PUBCHEM", "references": [ "0f1ff991-17f5-46ab-b93c-2710af4ba7bb" ] }, { "uuid": "ca02951b-2ee9-4457-a73d-f198eef1c0eb", "code": "WF06BEU369", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "9557435a-3b59-4e6b-ee77-ba35eebb5a44", "code": "DB08702", "type": "PRIMARY", "url": "http://www.drugbank.ca/drugs/DB08702", "code_system": "DRUG BANK", "references": [ "512dd72a-2dce-0de6-8d67-2446690d7f03" ] }, { "uuid": "2dc9ebd7-3a50-40cf-9b87-81fe8000f9c2", "code": "DTXSID10277660", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10277660", "code_system": "EPA CompTox", "references": [ "512dd72a-2dce-0de6-8d67-2446690d7f03" ] }, { "uuid": "7b667c35-fbad-45be-6ab5-f1e108b6e430", "code": "3437", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=3437", "code_system": "NSC", "references": [ "a6abf4f9-3af0-cbf3-7d45-bfe352c6f2ef" ] } ], "substance_class": "chemical", "names": [ { "uuid": "d2f32d3c-f100-4c99-b31c-d84d882f9b3d", "name": "2,5-DIPHENYLFURAN-3,4-DICARBOXYLIC ACID", "stdName": "2,5-DIPHENYLFURAN-3,4-DICARBOXYLIC ACID", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "a6f3dfa1-7f3f-44bf-970b-a67cd2cacf6d" ], "display_name": true }, { "uuid": "0e4dfd15-49b8-de9e-8f91-976b43a9eb36", "name": "3,4-FURANDICARBOXYLIC ACID, 2,5-DIPHENYL-", "stdName": "3,4-FURANDICARBOXYLIC ACID, 2,5-DIPHENYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "262dfa18-fd51-49fa-a806-65b5f9e244f0" ], "display_name": false }, { "uuid": "49ef9de5-36ef-2577-6cc4-eed00cd7bde9", "name": "NSC-3437", "stdName": "NSC-3437", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "262dfa18-fd51-49fa-a806-65b5f9e244f0" ], "display_name": false } ], "references": [ { "uuid": "a6f3dfa1-7f3f-44bf-970b-a67cd2cacf6d", "citation": "Drug Bank", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "0f1ff991-17f5-46ab-b93c-2710af4ba7bb", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393545000, "tags": [ "NOMEN" ] }, { "uuid": "69998393-1037-489a-935a-9387ebe34412", "citation": "Drug Bank DB08702", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "512dd72a-2dce-0de6-8d67-2446690d7f03", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "262dfa18-fd51-49fa-a806-65b5f9e244f0", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "a6abf4f9-3af0-cbf3-7d45-bfe352c6f2ef", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "9789b5e0-7838-4aba-af66-91205ef30998", "id": "9789b5e0-7838-4aba-af66-91205ef30998", "molfile": "\n Marvin 01132107522D \n\n 23 25 0 0 0 0 999 V2000\n -2.1948 -0.3491 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5817 0.2029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7532 1.0099 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7971 -0.0520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1297 0.4329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5378 -0.0520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2828 -0.8366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5422 -0.8366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0271 -1.5041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6915 -2.2577 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8476 -1.4178 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7678 -1.5041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5882 -1.4178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0732 -2.0853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7376 -2.8389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9171 -2.9252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4322 -2.2577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1297 1.2579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8441 1.6704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8441 2.4954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1297 2.9079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5848 2.4954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5848 1.6704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 2 0 0 0 0\n 4 2 1 0 0 0 0\n 5 4 2 0 0 0 0\n 4 8 1 0 0 0 0\n 5 6 1 0 0 0 0\n 18 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 8 7 2 0 0 0 0\n 7 12 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 9 11 2 0 0 0 0\n 12 13 1 0 0 0 0\n 12 17 2 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 23 18 2 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 2 0 0 0 0\n 22 23 1 0 0 0 0\nM END", "smiles": "c1ccc(cc1)-c2c(c(c(-c3ccccc3)o2)C(=O)O)C(=O)O", "formula": "C18H12O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "b78b2d8e-afa5-406a-9263-aa8b8796ca6f" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "308.2856", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "910558e7-8554-496a-b7bd-00e4e53436aa", "version": "7", "structure": { "id": "ca37d3ee-6003-4919-bae2-36325a392717", "molfile": "\n Marvin 01132110262D \n\n 23 25 0 0 0 0 999 V2000\n -0.8441 1.6704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8441 2.4954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1297 2.9079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5848 2.4954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5848 1.6704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1297 1.2579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1297 0.4329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5378 -0.0520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7971 -0.0520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5817 0.2029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1948 -0.3491 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7532 1.0099 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5422 -0.8366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0271 -1.5041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6915 -2.2577 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8476 -1.4178 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2828 -0.8366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7678 -1.5041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5882 -1.4178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0732 -2.0853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7376 -2.8389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9171 -2.9252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4322 -2.2577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 1 6 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 2 0 0 0 0\n 8 17 1 0 0 0 0\n 9 10 1 0 0 0 0\n 9 13 1 0 0 0 0\n 10 11 2 0 0 0 0\n 10 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 17 2 0 0 0 0\n 14 15 2 0 0 0 0\n 14 16 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 18 23 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 2 0 0 0 0\nM END", "smiles": "c1ccc(cc1)-c2c(c(c(-c3ccccc3)o2)C(=O)O)C(=O)O", "formula": "C18H12O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "308.2856", "optical_activity": "NONE", "references": [ "69998393-1037-489a-935a-9387ebe34412" ], "stereo_centers": 0 }, "unii": "WF06BEU369" } ] }