{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "82a4badd-fee6-43cf-aef6-ffb0c20af21e",
          "code": "42131-27-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=42131-27-1",
          "code_system": "CAS",
          "references": [
            "2808032c-6765-42d3-b0f9-2de52b3c98ec",
            "a08f1e2d-dcb2-4787-86b9-d25a27f72b26"
          ]
        },
        {
          "uuid": "d43b8d8d-d5f9-4001-bf32-beaf12fca4e9",
          "code": "1307088",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1307088/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "2808032c-6765-42d3-b0f9-2de52b3c98ec"
          ]
        },
        {
          "uuid": "9e21a566-f9e4-4140-b5c7-915ea6f2ae88",
          "code": "255-673-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.050.594",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "2808032c-6765-42d3-b0f9-2de52b3c98ec"
          ]
        },
        {
          "uuid": "ca569188-1af4-e92b-7de2-0adf70d3f8c6",
          "code": "100993",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/100993",
          "code_system": "PUBCHEM",
          "references": [
            "1402d606-db4b-abb6-26c3-014e10f2a01f"
          ]
        },
        {
          "uuid": "d9ffa1a2-a02c-43c7-80a3-56a13d849998",
          "code": "WEF51750MT",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "bed60ade-09b5-7824-7d24-09a27a568736",
          "code": "WEF51750MT",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=WEF51750MT",
          "code_system": "DAILYMED",
          "references": [
            "ddc2f252-53c8-e0e8-3375-050b92b1d22e"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "15ddbadb-aca5-4d21-8383-f829f2fc5d48",
          "name": "ISONONANOIC ACID, ISOTRIDECYL ESTER",
          "stdName": "ISONONANOIC ACID, ISOTRIDECYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bb777d61-741a-4536-897f-aa5bbf1f6db3",
            "498e8bec-e14e-41a4-8555-f59017a57085"
          ],
          "display_name": false
        },
        {
          "uuid": "09582329-39d4-4f9e-8e83-4d076901cd87",
          "name": "ISOTRIDECYL ISONONANOATE",
          "stdName": "ISOTRIDECYL ISONONANOATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6cdb5eca-268b-4753-83ba-ce5a00a2d926",
            "9793b36d-049e-4c3e-ab5e-238c2905f019",
            "ab089758-e6f3-49f8-9548-9121cec5a703",
            "bb777d61-741a-4536-897f-aa5bbf1f6db3",
            "498e8bec-e14e-41a4-8555-f59017a57085"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "4adefe22-d595-45cf-b3fe-64558b75b695",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "2148689b-1621-4313-8de3-699c28a28d89",
          "name": "KAK 139",
          "stdName": "KAK 139",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bb777d61-741a-4536-897f-aa5bbf1f6db3",
            "498e8bec-e14e-41a4-8555-f59017a57085"
          ],
          "display_name": false
        },
        {
          "uuid": "7ca43533-af3b-43bb-a5f2-3b65a11fdc01",
          "name": "SALACOS 913",
          "stdName": "SALACOS 913",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bb777d61-741a-4536-897f-aa5bbf1f6db3",
            "498e8bec-e14e-41a4-8555-f59017a57085"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "bb777d61-741a-4536-897f-aa5bbf1f6db3",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ab089758-e6f3-49f8-9548-9121cec5a703",
          "citation": "DL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "498e8bec-e14e-41a4-8555-f59017a57085",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6cdb5eca-268b-4753-83ba-ce5a00a2d926",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2808032c-6765-42d3-b0f9-2de52b3c98ec",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390977000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f862b475-2821-45a9-b972-d55231972eed",
          "citation": "SRS import [WEF51750MT]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=WEF51750MT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390977000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9793b36d-049e-4c3e-ab5e-238c2905f019",
          "citation": "ISOTRIDECYL ISONONANOATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a08f1e2d-dcb2-4787-86b9-d25a27f72b26",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1402d606-db4b-abb6-26c3-014e10f2a01f",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "ddc2f252-53c8-e0e8-3375-050b92b1d22e",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "083d4d7e-40fa-4814-90c3-d284e45caea4",
          "id": "083d4d7e-40fa-4814-90c3-d284e45caea4",
          "molfile": "\n  Marvin  01132100422D          \n\n 24 23  0  0  0  0            999 V2000\n    9.7810   -1.8393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0668   -2.2522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0668   -3.0772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3526   -1.8393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6384   -2.2522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9241   -1.8393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2099   -2.2522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4956   -1.8393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7815   -2.2522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0719   -1.8393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3578   -2.2522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6434   -1.8393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9245   -2.2522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2149   -1.8393    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4960   -2.2522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4960   -3.5145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2134   -1.8393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9277   -2.2522    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   -0.9277   -3.0743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6419   -1.8393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3562   -2.2522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1679   -3.0835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9502   -2.9015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.0704   -1.8393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  1  0  0  0  0\n 21 24  1  0  0  0  0\nM  END",
          "smiles": "CC(C)CCCCCCCCCCOC(=O)CC(C)CC(C)(C)C",
          "formula": "C22H44O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "95379690-8f93-4af8-a503-548b8660ac23"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "340.5844",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "INCOMPLETE",
      "uuid": "2c0ff91f-196a-4e41-9e91-a4f5b650424b",
      "version": "8",
      "structure": {
        "id": "eedeeb4d-3a34-4061-9b28-b97de26472a9",
        "molfile": "\n  Marvin  01132112232D          \n\n 24 23  0  0  0  0            999 V2000\n    0.4960   -3.5145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4960   -2.2522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2134   -1.8393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9277   -2.2522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9277   -3.0743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6419   -1.8393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3562   -2.2522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1679   -3.0835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9502   -2.9015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.0704   -1.8393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2149   -1.8393    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9245   -2.2522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6434   -1.8393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3578   -2.2522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0719   -1.8393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7815   -2.2522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4956   -1.8393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2099   -2.2522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9241   -1.8393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6384   -2.2522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3526   -1.8393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0668   -2.2522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7810   -1.8393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0668   -3.0772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  7 10  1  0  0  0  0\n 11  2  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 22 24  1  0  0  0  0\nM  END",
        "smiles": "CC(C)CCCCCCCCCCOC(=O)CC(C)CC(C)(C)C",
        "formula": "C22H44O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "340.5844",
        "optical_activity": "( + / - )",
        "references": [
          "bb777d61-741a-4536-897f-aa5bbf1f6db3",
          "f862b475-2821-45a9-b972-d55231972eed"
        ],
        "stereo_centers": 1
      },
      "unii": "WEF51750MT"
    }
  ]
}