{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "bbdd2527-af19-4a2a-905f-18c61411738a", "code": "WDP42UC5P4", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "289684f4-e78b-8a8d-1a70-b47d9f35f057", "code": "676246", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/676246", "code_system": "PUBCHEM", "references": [ "43d02b25-3855-a490-a7b6-5c4d68fa9e4a" ] }, { "uuid": "ae51c9f5-a2b7-42f0-ad17-9ca3b4bf581a", "code": "74124-79-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=74124-79-1", "code_system": "CAS", "references": [ "8592affd-1bdf-4d64-abce-a5f3216c9926" ] }, { "uuid": "3fc67651-5c32-8995-ef38-438df0a10ba3", "code": "DTXSID10225080", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10225080", "code_system": "EPA CompTox", "references": [ "49541c70-5d5f-39d3-e612-c54906876ce6" ] } ], "substance_class": "chemical", "names": [ { "uuid": "28a262eb-3fe4-4afb-96bd-db1e2af9bc45", "name": "Bis(N-succinimidyl) carbonate", "stdName": "BIS(N-SUCCINIMIDYL) CARBONATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "8592affd-1bdf-4d64-abce-a5f3216c9926" ], "display_name": false }, { "uuid": "c06e72be-3918-4de9-b0ec-e533adcde345", "name": "Carbonic acid, bis(2,5-dioxo-1-pyrrolidinyl) ester", "stdName": "CARBONIC ACID, BIS(2,5-DIOXO-1-PYRROLIDINYL) ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "8592affd-1bdf-4d64-abce-a5f3216c9926" ], "display_name": false }, { "uuid": "fc567068-60a4-4768-be7b-6cde12e53f67", "name": "N,N’-Disuccinimidyl carbonate", "stdName": "N,N'-DISUCCINIMIDYL CARBONATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "8592affd-1bdf-4d64-abce-a5f3216c9926" ], "display_name": true } ], "references": [ { "uuid": "8592affd-1bdf-4d64-abce-a5f3216c9926", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "43d02b25-3855-a490-a7b6-5c4d68fa9e4a", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "49541c70-5d5f-39d3-e612-c54906876ce6", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "b08b3f7d-39e6-49e1-9e4e-2ca960a1b374", "id": "b08b3f7d-39e6-49e1-9e4e-2ca960a1b374", "molfile": "\n Marvin 07132321512D \n\n 18 19 0 0 1 0 999 V2000\n 12.9321 -3.6456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1247 -4.0386 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8624 -3.4474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0142 -2.6162 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6966 -4.4855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8744 -4.7178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5169 -4.0386 0.0000 N 0 0 1 0 0 0 0 0 0 0 0 0\n 15.0078 -3.4103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4790 -3.9836 0.0000 N 0 0 2 0 0 0 0 0 0 0 0 0\n 9.0152 -4.6514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6769 -4.0386 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5884 -5.4686 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4612 -5.4136 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9976 -2.8232 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8923 -2.6712 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1563 -3.7512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7681 -3.7705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2993 -4.5735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 14 2 0 0 0 0\n 1 11 1 0 0 0 0\n 2 9 1 6 0 0 0\n 3 4 2 0 0 0 0\n 3 16 1 0 0 0 0\n 3 9 1 0 0 0 0\n 5 17 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 12 2 0 0 0 0\n 7 8 1 0 0 0 0\n 7 11 1 6 0 0 0\n 8 15 2 0 0 0 0\n 8 17 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 18 1 0 0 0 0\n 10 13 2 0 0 0 0\n 16 18 1 0 0 0 0\nM END", "smiles": "C1CC(=O)N(C1=O)OC(=O)ON2C(=O)CCC2=O", "formula": "C9H8N2O7", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "c311a476-8a7f-4ade-a823-3e752aeec42c" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "256.1694", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "496163e3-1205-4f4c-bda4-e6df2ac39c82", "version": "7", "structure": { "id": "4afca0b7-201a-4852-a534-7878b31621cc", "molfile": "Disuccinimidyl carbonate\n JSDraw208042315032D\n\n 18 19 0 0 0 0 0 V2000\n 23.8170 -8.6934 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1681 -7.9134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.5190 -8.6934 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1681 -6.3535 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 23.4623 -5.3181 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.7165 -10.0739 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.8737 -5.3181 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.6195 -10.0739 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.4659 -7.9134 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 22.3029 -6.3620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.0408 -8.5479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.7770 -6.0377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.9970 -7.3886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8701 -7.9134 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0331 -6.3620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2952 -8.5479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5590 -6.0377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.3390 -7.3886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 9 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 2 0 0 0 0\n 3 14 1 0 0 0 0\n 5 10 2 0 0 0 0\n 6 11 2 0 0 0 0\n 7 15 2 0 0 0 0\n 8 16 2 0 0 0 0\n 9 10 1 0 0 0 0\n 9 11 1 0 0 0 0\n 10 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 16 1 0 0 0 0\n 15 17 1 0 0 0 0\n 16 18 1 0 0 0 0\n 17 18 1 0 0 0 0\nM END", "smiles": "C1CC(=O)N(C1=O)OC(=O)ON2C(=O)CCC2=O", "formula": "C9H8N2O7", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "256.1694", "optical_activity": "NONE", "references": [ "8592affd-1bdf-4d64-abce-a5f3216c9926" ], "stereo_centers": 0 }, "unii": "WDP42UC5P4" } ] }