{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "a7dba06d-1d06-4564-a3bc-1eaa4b20687f", "code": "WDC6Y5J7N7", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "ddc2cec4-0c5f-464a-a564-572713c9960b", "code": "68213-85-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=68213-85-4", "code_system": "CAS", "references": [ "5a0a09a6-2c91-4715-91a0-e30ebc5ca11e", "0219b295-faec-4a36-9c72-6e2e8d577241" ] }, { "uuid": "79eb61b3-72ce-472e-a6b9-9b4fc87aac57", "code": "269-268-6", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.062.952", "code_system": "ECHA (EC/EINECS)", "references": [ "5a0a09a6-2c91-4715-91a0-e30ebc5ca11e" ] }, { "uuid": "608fc600-ed3b-4ae5-99dd-bd4020eebfc0", "code": "109222", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/109222", "code_system": "PUBCHEM", "references": [ "5a0a09a6-2c91-4715-91a0-e30ebc5ca11e" ] }, { "uuid": "38a96788-6ecd-381e-28fd-3b9a2a812440", "code": "DTXSID50867529", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50867529", "code_system": "EPA CompTox", "references": [ "fdadbdd1-36df-7158-5753-75c7ac468fa3" ] } ], "substance_class": "chemical", "names": [ { "uuid": "cf8e92e8-6b66-4b8c-a87c-0db14595a929", "name": "2-Methoxy-1-(1-methoxyethoxy)-4-(2-propen-1-yl)benzene", "stdName": "2-METHOXY-1-(1-METHOXYETHOXY)-4-(2-PROPEN-1-YL)BENZENE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "0219b295-faec-4a36-9c72-6e2e8d577241" ], "display_name": true }, { "uuid": "fdfd225f-9826-45dc-99e0-08ca59bc03ce", "name": "Benzene, 2-methoxy-1-(1-methoxyethoxy)-4-(2-propen-1-yl)-", "stdName": "BENZENE, 2-METHOXY-1-(1-METHOXYETHOXY)-4-(2-PROPEN-1-YL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "0219b295-faec-4a36-9c72-6e2e8d577241" ], "display_name": false }, { "uuid": "d0444f3a-ee9b-448a-a8a5-3620ed4abdc4", "name": "Benzene, 2-methoxy-1-(1-methoxyethoxy)-4-(2-propenyl)-", "stdName": "BENZENE, 2-METHOXY-1-(1-METHOXYETHOXY)-4-(2-PROPENYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "df4ea814-b57b-4a24-9b58-b4dd386276b8" ], "display_name": false } ], "references": [ { "uuid": "df4ea814-b57b-4a24-9b58-b4dd386276b8", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5a0a09a6-2c91-4715-91a0-e30ebc5ca11e", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392085000, "tags": [ "NOMEN" ] }, { "uuid": "0219b295-faec-4a36-9c72-6e2e8d577241", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] }, { "uuid": "fdadbdd1-36df-7158-5753-75c7ac468fa3", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "ac6ef88f-45d3-4ee1-b581-dcad627fcc27", "id": "ac6ef88f-45d3-4ee1-b581-dcad627fcc27", "molfile": "\n Marvin 01132108572D \n\n 16 16 0 0 0 0 999 V2000\n 0.0000 -0.6231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5885 -1.2115 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5942 -2.0365 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 0.1731 -2.7518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4192 -2.0423 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1345 -1.6384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1345 -0.8076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8499 -0.3980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5653 -0.8076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1480 -0.2192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9441 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7691 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5653 -1.6384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8499 -2.0480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8442 -2.8730 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4268 -3.4557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 5 3 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 6 14 2 0 0 0 0\n 7 8 2 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 13 9 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 14 13 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\nM END", "smiles": "C=CCc1ccc(c(c1)OC)OC(C)OC", "formula": "C13H18O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "443335fe-0cff-4135-9e0c-3beb84f6d843" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "222.2807", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "a18ea80c-d158-41cf-be8d-4acd2d0009a0", "version": "7", "structure": { "id": "5d8f0958-10e9-46b4-bd6c-51c888529cfd", "molfile": "\n JSDraw212122418242D\n\n 16 16 0 0 0 0 0 V2000\n 28.1280 -3.7956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.7769 -4.5756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.7769 -6.1356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.4260 -6.9156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.0745 -6.1348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.7235 -6.9148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.7239 -8.4756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.0755 -9.2566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.4265 -8.4766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.0752 -10.8166 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.7242 -11.5964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.3730 -9.2556 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.0220 -8.4756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.0220 -6.9156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.6710 -9.2556 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3200 -8.4756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 4 9 1 0 0 0 0\n 8 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 7 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 1 0 0 0 0\n 15 16 1 0 0 0 0\nM END", "smiles": "C=CCc1ccc(c(c1)OC)OC(C)OC", "formula": "C13H18O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "222.2807", "optical_activity": "( + / - )", "references": [ "df4ea814-b57b-4a24-9b58-b4dd386276b8" ], "stereo_centers": 1 }, "unii": "WDC6Y5J7N7" } ] }