{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7ee803c7-bedd-465d-9c5b-1ec68074e368",
          "code": "335104-84-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=335104-84-2",
          "code_system": "CAS",
          "references": [
            "0095a59b-a162-4fd6-a13f-34ba70f620c7",
            "eed18607-a432-4e28-8177-90c7b99230ef"
          ]
        },
        {
          "uuid": "ef63a205-6990-4d8f-9fd0-0c922ac074f6",
          "code": "12801",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3989",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "0095a59b-a162-4fd6-a13f-34ba70f620c7"
          ]
        },
        {
          "uuid": "b8f026bd-8a5b-42f9-bc12-9ad565dd0591",
          "code": "m10546",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10546?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "0095a59b-a162-4fd6-a13f-34ba70f620c7"
          ]
        },
        {
          "uuid": "08f13c48-c0d8-42d8-8b11-5ec02f68fb92",
          "code": "11556911",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11556911",
          "code_system": "PUBCHEM",
          "references": [
            "0095a59b-a162-4fd6-a13f-34ba70f620c7"
          ]
        },
        {
          "uuid": "d416d7c3-8b91-c097-7d08-f0dd6aeadf54",
          "code": "7881",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7881",
          "code_system": "HSDB",
          "references": [
            "e1e52b0e-78f1-2746-683e-d112a4e85b04"
          ]
        },
        {
          "uuid": "736b1f74-a074-1885-0fa5-216d3d8e13ae",
          "code": "DTXSID5047037",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5047037",
          "code_system": "EPA CompTox",
          "references": [
            "09a4b1f3-7fcd-fdd4-f3ea-a3df20ec5612"
          ]
        },
        {
          "uuid": "4f2294d0-a05f-4a85-91eb-d0ad8653894f",
          "code": "WA5UZ202KS",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "9d1e51af-c05f-4e50-8886-2d47487004ef",
          "code": "263401-02-1",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=263401-02-1",
          "code_system": "CAS",
          "references": [
            "eed18607-a432-4e28-8177-90c7b99230ef"
          ]
        },
        {
          "uuid": "2a6817bf-4976-97c7-ac57-6e838c55cda8",
          "code": "tembotrione",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/tembotrione.html",
          "code_system": "ALANWOOD",
          "references": [
            "fd4ab70e-452a-2a22-beec-02cce4ae2ee4"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "73bd6cc7-6b90-4ee9-bf79-585d6064ff4a",
          "name": "2-(2-CHLORO-4-(METHYLSULFONYL)-3-((2,2,2-TRIFLUOROETHOXY)METHYL)BENZOYL)-1,3-CYCLOHEXANEDIONE",
          "stdName": "2-(2-CHLORO-4-(METHYLSULFONYL)-3-((2,2,2-TRIFLUOROETHOXY)METHYL)BENZOYL)-1,3-CYCLOHEXANEDIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "39b0843b-935d-4d67-9077-96c2d826222d",
            "271dcf37-4286-46e4-b88c-3346b15f5b37"
          ],
          "display_name": false
        },
        {
          "uuid": "f6c27bfb-060a-446c-98ae-8311586bcc18",
          "name": "2-(2-CHLORO-4-(METHYLSULFONYL)-3-((2,2,2-TRIFLUOROETHOXY)METHYL)BENZOYL)-3-HYDROXY-2-CYCLOHEXEN-1-ONE",
          "stdName": "2-(2-CHLORO-4-(METHYLSULFONYL)-3-((2,2,2-TRIFLUOROETHOXY)METHYL)BENZOYL)-3-HYDROXY-2-CYCLOHEXEN-1-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eed18607-a432-4e28-8177-90c7b99230ef"
          ],
          "display_name": false
        },
        {
          "uuid": "4908c38b-7b92-4d6c-b775-70820c46eed0",
          "name": "2-(2-CHLORO-4-MESYL-3-((2,2,2-TRIFLUOROETHOXY)METHYL)BENZOYL)CYCLOHEXANE-1,3-DIONE",
          "stdName": "2-(2-CHLORO-4-MESYL-3-((2,2,2-TRIFLUOROETHOXY)METHYL)BENZOYL)CYCLOHEXANE-1,3-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "39b0843b-935d-4d67-9077-96c2d826222d",
            "cd7f9e22-de41-4060-ad0e-cc52190bcbc3"
          ],
          "display_name": false
        },
        {
          "uuid": "cdcab09c-4b01-4219-9656-bd87703680e9",
          "name": "2-CYCLOHEXEN-1-ONE, 2-(2-CHLORO-4-(METHYLSULFONYL)-3-((2,2,2-TRIFLUOROETHOXY)METHYL)BENZOYL)-3-HYDROXY-",
          "stdName": "2-CYCLOHEXEN-1-ONE, 2-(2-CHLORO-4-(METHYLSULFONYL)-3-((2,2,2-TRIFLUOROETHOXY)METHYL)BENZOYL)-3-HYDROXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eed18607-a432-4e28-8177-90c7b99230ef"
          ],
          "display_name": false
        },
        {
          "uuid": "f24f043d-7c93-4f26-ac2a-4ebc8077db3a",
          "name": "AE-0172747",
          "stdName": "AE-0172747",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "997f147a-653e-4489-b920-739af7c08108",
            "87f38fd3-5a3c-4148-ae52-33a3ef9041ea"
          ],
          "display_name": false
        },
        {
          "uuid": "8ce5d63a-d037-4820-a31b-6c25d29cac61",
          "name": "TEMBOTRIONE",
          "stdName": "TEMBOTRIONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "997f147a-653e-4489-b920-739af7c08108",
            "bf04ed91-8dfc-449b-9725-2864e0362841",
            "a37310cd-fac4-4fef-9575-aacac7a3ca1f",
            "a385018e-f2c6-4342-aaab-4c721d7a6d9a",
            "11ff2eab-f59b-48aa-af88-96ed63798659",
            "b49ca160-a680-46c3-9908-ffbd2f4caa04"
          ],
          "display_name": true,
          "domains": [
            "Pesticide"
          ],
          "name_orgs": [
            {
              "uuid": "7e37f586-af35-4294-8ab4-d5d1c9a7c204",
              "name_org": "ISO"
            }
          ]
        },
        {
          "uuid": "e05d1339-0f29-443e-9813-9a54afb3adeb",
          "name": "TEMBOTRIONE [ISO]",
          "stdName": "TEMBOTRIONE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "997f147a-653e-4489-b920-739af7c08108",
            "b49ca160-a680-46c3-9908-ffbd2f4caa04"
          ],
          "display_name": false
        },
        {
          "uuid": "32bfcb15-efb5-4cf6-a927-9047f5d0b643",
          "name": "TEMBOTRIONE [MI]",
          "stdName": "TEMBOTRIONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "997f147a-653e-4489-b920-739af7c08108",
            "11ff2eab-f59b-48aa-af88-96ed63798659"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a37310cd-fac4-4fef-9575-aacac7a3ca1f",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "39b0843b-935d-4d67-9077-96c2d826222d",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cd7f9e22-de41-4060-ad0e-cc52190bcbc3",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "271dcf37-4286-46e4-b88c-3346b15f5b37",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "11ff2eab-f59b-48aa-af88-96ed63798659",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "997f147a-653e-4489-b920-739af7c08108",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "87f38fd3-5a3c-4148-ae52-33a3ef9041ea",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b49ca160-a680-46c3-9908-ffbd2f4caa04",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0095a59b-a162-4fd6-a13f-34ba70f620c7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390956000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "447998ca-3a8f-4fa8-acdb-24e33c3e269a",
          "citation": "SRS import [WA5UZ202KS]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=WA5UZ202KS",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390956000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3124c246-c322-4a09-8486-25423a4b68af",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a385018e-f2c6-4342-aaab-4c721d7a6d9a",
          "citation": "TEMBOTRIONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bf04ed91-8dfc-449b-9725-2864e0362841",
          "citation": "TEMBOTRIONE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e1e52b0e-78f1-2746-683e-d112a4e85b04",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+335104-84-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "09a4b1f3-7fcd-fdd4-f3ea-a3df20ec5612",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=335104-84-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fd4ab70e-452a-2a22-beec-02cce4ae2ee4",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "eed18607-a432-4e28-8177-90c7b99230ef",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2fcc63a9-8c3e-40e0-bd7a-1c1fc3a9d1db",
          "id": "2fcc63a9-8c3e-40e0-bd7a-1c1fc3a9d1db",
          "molfile": "\n  Marvin  01132102342D          \n\n 28 29  0  0  0  0            999 V2000\n    8.9480   -6.0735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2328   -5.6614    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9485   -5.2544    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2328   -6.4855    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5266   -5.2466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8092   -5.6571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0960   -5.2467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0960   -4.4203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3795   -4.0068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3795   -3.1827    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6693   -4.4225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6693   -5.2466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3852   -5.6596    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9568   -5.6540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2443   -5.2466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2443   -4.4225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9568   -4.0057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9568   -3.1816    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8085   -4.0044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8085   -3.1803    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.5266   -4.4198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2372   -4.0078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9531   -4.4277    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6710   -4.0157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3835   -4.4372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1014   -4.0251    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3835   -5.2613    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1746   -3.6381    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  2  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n 21  5  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 19  2  0  0  0  0\n  9 10  2  0  0  0  0\n 11  9  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 17  1  0  0  0  0\n 12 13  2  0  0  0  0\n 14 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 19 20  1  0  0  0  0\n 21 19  1  0  0  0  0\n 21 22  1  0  0  0  0\n 23 22  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 25 27  1  0  0  0  0\n 25 28  1  0  0  0  0\nM  END",
          "smiles": "CS(=O)(=O)c1ccc(c(c1COCC(F)(F)F)Cl)C(=O)C2C(=O)CCCC2=O",
          "formula": "C17H16ClF3O6S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "dd654fb4-8a04-466e-a5f8-c493a3a3a180"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "440.8202",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "73ac6144-dcfc-4ffe-8b97-ec538c57195c",
      "version": "7",
      "structure": {
        "id": "d455e8c8-5daa-441d-b567-2d9b0597dc51",
        "molfile": "\n  Marvin  01132111002D          \n\n 28 29  0  0  0  0            999 V2000\n    8.9480   -6.0735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2328   -5.6614    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5266   -5.2466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5266   -4.4198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2372   -4.0078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9531   -4.4277    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6710   -4.0157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3835   -4.4372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1014   -4.0251    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3835   -5.2613    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1746   -3.6381    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8085   -4.0044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8085   -3.1803    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.0960   -4.4203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3795   -4.0068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6693   -4.4225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6693   -5.2466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3852   -5.6596    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9568   -5.6540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2443   -5.2466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2443   -4.4225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9568   -4.0057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9568   -3.1816    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3795   -3.1827    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0960   -5.2467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8092   -5.6571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9485   -5.2544    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2328   -6.4855    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  8 11  1  0  0  0  0\n  4 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 12  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 19 17  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 16 22  1  0  0  0  0\n 15 24  2  0  0  0  0\n 14 25  1  0  0  0  0\n 25 26  2  0  0  0  0\n 26  3  1  0  0  0  0\n  2 27  2  0  0  0  0\n  2 28  2  0  0  0  0\nM  END",
        "smiles": "CS(=O)(=O)c1ccc(c(c1COCC(F)(F)F)Cl)C(=O)C2C(=O)CCCC2=O",
        "formula": "C17H16ClF3O6S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "440.8202",
        "optical_activity": "NONE",
        "references": [
          "447998ca-3a8f-4fa8-acdb-24e33c3e269a",
          "3124c246-c322-4a09-8486-25423a4b68af"
        ],
        "stereo_centers": 0
      },
      "unii": "WA5UZ202KS"
    }
  ]
}