{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "75412126-5ad1-4b97-a981-cfd45c390692",
          "code": "194284-52-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=194284-52-1",
          "code_system": "CAS",
          "references": [
            "cd1eaf8e-6e2a-4e57-8fd4-b5e68691199d",
            "8c0c1cb6-191c-4633-b42f-6ee388b53899"
          ]
        },
        {
          "uuid": "d8e29430-87f3-45bb-85d0-0e45b94f385f",
          "code": "C107456",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67107456",
          "code_system": "MESH",
          "references": [
            "cd1eaf8e-6e2a-4e57-8fd4-b5e68691199d"
          ]
        },
        {
          "uuid": "2109e94b-fac3-4bb7-b8cd-26e52c48381b",
          "code": "44424646",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/44424646",
          "code_system": "PUBCHEM",
          "references": [
            "cd1eaf8e-6e2a-4e57-8fd4-b5e68691199d"
          ]
        },
        {
          "uuid": "51abf249-18a3-4b8c-92fd-287e96b1e9f7",
          "code": "W9G684D74R",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "27ed90c7-7b38-4fe0-8213-b7ed6d628bad",
          "name": "1H,6H-PYRANO(4,3-C)(2)BENZOPYRAN-7-CARBOXALDEHYDE, 9,10-DIHYDROXY-6,8-DIMETHOXY-1-OXO-3-(1-PROPENYL)-, (E)-",
          "stdName": "1H,6H-PYRANO(4,3-C)(2)BENZOPYRAN-7-CARBOXALDEHYDE, 9,10-DIHYDROXY-6,8-DIMETHOXY-1-OXO-3-(1-PROPENYL)-, (E)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "71fe5d34-c5bc-4bc6-923f-143c82395ec7",
            "4087cc12-1b5e-4518-919e-937cdebe6ea5"
          ],
          "display_name": false
        },
        {
          "uuid": "312edcae-45e2-4e60-b2fb-fe89a9c4089e",
          "name": "1H,6H-PYRANO(4,3-C)(2)BENZOPYRAN-7-CARBOXALDEHYDE, 9,10-DIHYDROXY-6,8-DIMETHOXY-1-OXO-3-(1E)-1-PROPEN-1-YL-",
          "stdName": "1H,6H-PYRANO(4,3-C)(2)BENZOPYRAN-7-CARBOXALDEHYDE, 9,10-DIHYDROXY-6,8-DIMETHOXY-1-OXO-3-(1E)-1-PROPEN-1-YL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "71fe5d34-c5bc-4bc6-923f-143c82395ec7",
            "4087cc12-1b5e-4518-919e-937cdebe6ea5"
          ],
          "display_name": false
        },
        {
          "uuid": "7b17b682-559b-4387-8431-059d871a75d4",
          "name": "1H,6H-PYRANO(4,3-C)(2)BENZOPYRAN-7-CARBOXALDEHYDE, 9,10-DIHYDROXY-6,8-DIMETHOXY-1-OXO-3-(1E)-1-PROPENYL-",
          "stdName": "1H,6H-PYRANO(4,3-C)(2)BENZOPYRAN-7-CARBOXALDEHYDE, 9,10-DIHYDROXY-6,8-DIMETHOXY-1-OXO-3-(1E)-1-PROPENYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "71fe5d34-c5bc-4bc6-923f-143c82395ec7",
            "4087cc12-1b5e-4518-919e-937cdebe6ea5"
          ],
          "display_name": false
        },
        {
          "uuid": "f991b19d-efda-46c5-b5fb-cf670c965e25",
          "name": "PULVINATAL",
          "stdName": "PULVINATAL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "27c3785e-58ec-4b56-af8b-627ae43a5d53",
            "4087cc12-1b5e-4518-919e-937cdebe6ea5",
            "c27f7e3a-a73c-49f3-858c-8aebb07fcf95"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "082bae25-6a71-44c5-927b-2d9d5ac6cb5f",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "c27f7e3a-a73c-49f3-858c-8aebb07fcf95",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4087cc12-1b5e-4518-919e-937cdebe6ea5",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "71fe5d34-c5bc-4bc6-923f-143c82395ec7",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cd1eaf8e-6e2a-4e57-8fd4-b5e68691199d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391588000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4e693e30-5b10-40b0-932e-9f08face74ca",
          "citation": "SRS import [W9G684D74R]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=W9G684D74R",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391588000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "27c3785e-58ec-4b56-af8b-627ae43a5d53",
          "citation": "PULVINATAL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8c0c1cb6-191c-4633-b42f-6ee388b53899",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "508139e0-93d4-494f-8d78-781ea8c86fcf",
          "id": "508139e0-93d4-494f-8d78-781ea8c86fcf",
          "molfile": "\n  Marvin  01132104122D          \n\n 26 28  0  0  0  0            999 V2000\n    8.5129   -7.4144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7159   -7.2008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5024   -6.4039    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    6.6780   -6.2223    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4324   -5.4346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6329   -5.2584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3873   -4.4708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5879   -4.2946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0355   -4.8988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2360   -4.7227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9412   -3.8593    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7407   -4.0355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3196   -3.4566    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9863   -4.8231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8107   -5.0048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3646   -4.3933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1527   -3.6026    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1641   -4.5696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7430   -3.9907    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4097   -5.3572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2175   -5.5086    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7525   -4.8847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8558   -5.9687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0677   -6.7594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8585   -6.9713    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0563   -5.7925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3 26  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 14  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  7 11  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 26 15  2  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 23  2  0  0  0  0\n 21 22  1  0  0  0  0\n 23 24  1  0  0  0  0\n 23 26  1  0  0  0  0\n 24 25  2  0  0  0  0\nM  END",
          "smiles": "C/C=C/c1cc2c(-c3c(c(C=O)c(c(c3O)O)OC)C(OC)O2)c(=O)o1",
          "formula": "C18H16O8",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "96e4d126-387f-4d6d-8839-6995bb0a17b8"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "360.3155",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0bcee8a0-b9d7-4348-8d6d-c75ba77bbd02",
      "version": "3",
      "structure": {
        "id": "416e72f9-a646-4e97-bd46-0310bdc9404f",
        "molfile": "\n  Marvin  01132103272D          \n\n 26 28  0  0  0  0            999 V2000\n    6.9863   -4.8231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7407   -4.0355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9412   -3.8593    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5879   -4.2946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3873   -4.4708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6329   -5.2584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4324   -5.4346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6780   -6.2223    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8107   -5.0048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0563   -5.7925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5024   -6.4039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8558   -5.9687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2175   -5.5086    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4097   -5.3572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1641   -4.5696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3646   -4.3933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0355   -4.8988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2360   -4.7227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3196   -3.4566    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7159   -7.2008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1527   -3.6026    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7430   -3.9907    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0677   -6.7594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8585   -6.9713    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5129   -7.4144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7525   -4.8847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  9  1  1  0  0  0  0\n 11  8  1  0  0  0  0\n  7  1  2  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  5  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n 16  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n 12 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 14 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n  4 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n  2 19  2  0  0  0  0\n 11 20  1  0  0  0  0\n 16 21  1  0  0  0  0\n 15 22  1  0  0  0  0\n 12 23  1  0  0  0  0\n 23 24  2  0  0  0  0\n 20 25  1  0  0  0  0\n 13 26  1  0  0  0  0\nM  END",
        "smiles": "C/C=C/c1cc2c(-c3c(c(C=O)c(c(c3O)O)OC)C(OC)O2)c(=O)o1",
        "formula": "C18H16O8",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "360.3155",
        "optical_activity": "( + / - )",
        "references": [
          "71fe5d34-c5bc-4bc6-923f-143c82395ec7",
          "4e693e30-5b10-40b0-932e-9f08face74ca"
        ],
        "stereo_centers": 1
      },
      "unii": "W9G684D74R"
    }
  ]
}