{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "501674bd-4f1b-4813-85fd-45678ee2e8b7",
          "code": "1001350-96-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1001350-96-4",
          "code_system": "CAS",
          "references": [
            "cc8ef533-9ff4-4809-b17d-7975fb852a7b",
            "020c4dd8-9062-4bc3-932f-3af6a057fcd5"
          ]
        },
        {
          "uuid": "571a5e6d-d8a2-4bdc-8825-f8131233fdba",
          "code": "C74043",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C74043",
          "code_system": "NCI_THESAURUS",
          "references": [
            "cc8ef533-9ff4-4809-b17d-7975fb852a7b"
          ]
        },
        {
          "uuid": "a45cf08a-6b33-4115-8c60-00d19bbaea29",
          "code": "CHEMBL575448",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL575448",
          "code_system": "ChEMBL",
          "references": [
            "cc8ef533-9ff4-4809-b17d-7975fb852a7b"
          ]
        },
        {
          "uuid": "0daeab84-77c8-4c66-b04e-da2543e36635",
          "code": "24785538",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/24785538",
          "code_system": "PUBCHEM",
          "references": [
            "cc8ef533-9ff4-4809-b17d-7975fb852a7b"
          ]
        },
        {
          "uuid": "7402fb3b-42ff-036c-e7a9-e30779be1bb2",
          "code": "DB15399",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB15399",
          "code_system": "DRUG BANK",
          "references": [
            "d9056b9e-01d6-6023-f553-59e23cbdd950"
          ]
        },
        {
          "uuid": "fa8acdd7-0846-4114-be02-3807fb979d54",
          "code": "W9E3353E8J",
          "type": "PRIMARY",
          "code_system": "FDA UNII",
          "references": [
            "cf6d3534-64c8-4bf3-a3db-68587bbb9f65"
          ]
        },
        {
          "uuid": "cd10a32c-0099-60de-c20e-9050272f241b",
          "code": "100000175499",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "8a6e8255-c1e7-c78b-5c25-5ee1920c4590"
          ]
        },
        {
          "uuid": "923f8ec1-d013-7093-917c-f3b52b249b65",
          "code": "DTXSID601351850",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID601351850",
          "code_system": "EPA CompTox",
          "references": [
            "decd34d8-8e01-1ee5-6e50-de042b1ed168"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "e7bdca4e-9e99-48ad-b489-36f746bea57f",
          "amount": {
            "uuid": "d428b573-f3c4-4b0e-8a0e-710692376ce9"
          },
          "type": "LABELED->NON-LABELED",
          "related_substance": {
            "uuid": "749a41bc-5adb-4120-8315-51854245f395",
            "refuuid": "5b6d4a28-4a12-4ee8-8431-0b93cb6014fc",
            "name": "BMS-754807 F-18",
            "unii": "0S131V9ZZZ",
            "linking_id": "0S131V9ZZZ",
            "ref_pname": "BMS-754807 F-18",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ce190284-ae8a-42b1-8583-9bbec62900f7",
          "amount": {
            "uuid": "db68cb5d-c4d2-42cc-8b10-65f7d1db7bcd",
            "average": 9,
            "units": "NANOMOLAR"
          },
          "qualification": "IC50",
          "type": "OFF-TARGET->INHIBITOR",
          "references": [
            "cf6d3534-64c8-4bf3-a3db-68587bbb9f65"
          ],
          "related_substance": {
            "uuid": "8b873aa8-fdd8-4d05-9865-7bacef239883",
            "refuuid": "2bff29ba-9769-4ab3-98de-4d3110181527",
            "name": "AURORA KINASE A",
            "unii": "OD27Q24FJ4",
            "linking_id": "OD27Q24FJ4",
            "ref_pname": "AURORA KINASE A",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "071ed3fe-d1b5-41b5-8af1-bd689f45b67b",
          "amount": {
            "uuid": "aca81a7f-c73a-49d1-94fe-0f34f8c78c47",
            "average": 25,
            "units": "NANOMOLAR"
          },
          "type": "OFF-TARGET->INHIBITOR",
          "references": [
            "cf6d3534-64c8-4bf3-a3db-68587bbb9f65"
          ],
          "related_substance": {
            "uuid": "0b4a7966-c84b-44dd-812d-96dd392f045b",
            "refuuid": "e37df70d-3718-4805-8bb0-ee6982579f7d",
            "name": "AURORA KINASE B",
            "unii": "24G10E0ZRR",
            "linking_id": "24G10E0ZRR",
            "ref_pname": "AURORA KINASE B",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "cddab849-8e5c-44da-afe5-e1dc0ec8e2cc",
          "amount": {
            "uuid": "28c86cc8-8d23-46bc-8cb1-cb6616725a59",
            "average": 4,
            "units": "NANOMOLAR"
          },
          "type": "OFF-TARGET->INHIBITOR",
          "references": [
            "cf6d3534-64c8-4bf3-a3db-68587bbb9f65"
          ],
          "related_substance": {
            "uuid": "235459b1-65d1-4e32-aa47-a13dc722809d",
            "refuuid": "4ca6a0e3-e610-49bd-80bf-8d758bbf77ae",
            "name": "BDNF/NT-3 GROWTH FACTORS RECEPTOR",
            "unii": "M4PJ7V12VY",
            "linking_id": "M4PJ7V12VY",
            "ref_pname": "BDNF/NT-3 GROWTH FACTORS RECEPTOR",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8cdacd83-c226-47ef-bb7f-b020dba5e5d3",
          "amount": {
            "uuid": "84b82132-3a26-435c-bf01-5531e3dca6fe",
            "average": 7,
            "units": "NANOMOLAR"
          },
          "qualification": "IC50",
          "type": "OFF-TARGET->INHIBITOR",
          "references": [
            "cf6d3534-64c8-4bf3-a3db-68587bbb9f65"
          ],
          "related_substance": {
            "uuid": "fe4e4f3f-2382-456b-8b1b-296db9b6f189",
            "refuuid": "7984584b-c5f4-4945-b833-a3c96c2f611c",
            "name": "HIGH AFFINITY NERVE GROWTH FACTOR RECEPTOR",
            "unii": "1L68U00N7O",
            "linking_id": "1L68U00N7O",
            "ref_pname": "HIGH AFFINITY NERVE GROWTH FACTOR RECEPTOR",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7cda404c-401e-4b27-a00c-4e558cc06b28",
          "amount": {
            "uuid": "87858a38-49f1-490b-ad78-77a0724301a6",
            "average": 44,
            "units": "NANOMOLAR"
          },
          "qualification": "IC50",
          "type": "OFF-TARGET->INHIBITOR",
          "references": [
            "cf6d3534-64c8-4bf3-a3db-68587bbb9f65"
          ],
          "related_substance": {
            "uuid": "dc0820c6-44f4-44a2-a0ea-2a5d981595c4",
            "refuuid": "b8d32ef9-7fd1-4ad4-ae06-335986cc1280",
            "name": "MACROPHAGE-STIMULATING PROTEIN RECEPTOR",
            "unii": "HR7SSL4L4D",
            "linking_id": "HR7SSL4L4D",
            "ref_pname": "MACROPHAGE-STIMULATING PROTEIN RECEPTOR",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "bc6bab43-19f3-4f66-acda-81e55f9c11ea",
          "amount": {
            "uuid": "57965ace-2c92-47aa-99e8-aa323cbbae4c",
            "average": 6,
            "units": "NANOMOLAR"
          },
          "qualification": "IC50",
          "type": "OFF-TARGET->INHIBITOR",
          "references": [
            "cf6d3534-64c8-4bf3-a3db-68587bbb9f65"
          ],
          "related_substance": {
            "uuid": "27749f26-a7e0-43e7-82bd-ac3299811d13",
            "refuuid": "4ca67aeb-4fd0-4b76-824d-e3d37ea039c6",
            "name": "HEPATOCYTE GROWTH FACTOR RECEPTOR",
            "unii": "QA085PMU8Q",
            "linking_id": "QA085PMU8Q",
            "ref_pname": "HEPATOCYTE GROWTH FACTOR RECEPTOR",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c16e7e10-a49c-4dd1-9aa5-56d5f0cb93f7",
          "amount": {
            "uuid": "a777db64-87f3-4cc4-9461-27038f23aa26",
            "average": 1.7,
            "units": "NANOMOLAR"
          },
          "qualification": "IC50",
          "type": "TARGET->INHIBITOR",
          "references": [
            "cf6d3534-64c8-4bf3-a3db-68587bbb9f65"
          ],
          "related_substance": {
            "uuid": "9dc3ad94-d42b-46d3-bd78-df6ce75493dc",
            "refuuid": "58d88f27-cd23-43fa-96fa-b4aa46886419",
            "name": "INSULIN RECEPTOR",
            "unii": "4CH8636GFF",
            "linking_id": "4CH8636GFF",
            "ref_pname": "INSULIN RECEPTOR",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c1f4f82d-7eb8-4351-bd61-2edc21297992",
          "amount": {
            "uuid": "97d5e844-97a9-40b6-8cc9-82fdfb7e27e2",
            "average": 1.8,
            "units": "NANOMOLAR"
          },
          "qualification": "IC50",
          "type": "TARGET->INHIBITOR",
          "references": [
            "cf6d3534-64c8-4bf3-a3db-68587bbb9f65"
          ],
          "related_substance": {
            "uuid": "808cded6-14c8-4389-accb-8e7a68da080c",
            "refuuid": "11f17928-ccb4-4539-8684-17dbdd1fb1c0",
            "name": "INSULIN-LIKE GROWTH FACTOR 1 RECEPTOR",
            "unii": "DK7PL4F3TT",
            "linking_id": "DK7PL4F3TT",
            "ref_pname": "INSULIN-LIKE GROWTH FACTOR 1 RECEPTOR",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "fb5392cd-6cdb-445a-b7cd-560c5542c91f",
          "amount": {
            "uuid": "c3831753-c2c2-4ad3-a069-dba7c107d2b2"
          },
          "comments": "Active against a variety of tumor cell lines.",
          "type": "ACTIVE MOIETY",
          "references": [
            "cf6d3534-64c8-4bf3-a3db-68587bbb9f65"
          ],
          "related_substance": {
            "uuid": "23c82d63-43b9-45c1-abf3-98f2fc47867e",
            "refuuid": "4027a105-8634-492d-9bdb-f1ce143d6273",
            "name": "BMS-754807",
            "unii": "W9E3353E8J",
            "linking_id": "W9E3353E8J",
            "ref_pname": "BMS-754807",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f30bf863-4982-4b84-8ce3-daae1f0925ab",
          "name": "(S)-1-(4-((5-CYCLOPROPYL-1H-PYRAZOL-3-YL)AMINO)PYRROLO(2,1-F)(1,2,4)TRIAZIN-2-YL)-N-(6-FLUOROPYRIDIN-3-YL)-2-METHYLPYRROLIDINE-2-CARBOXAMIDE",
          "stdName": "(S)-1-(4-((5-CYCLOPROPYL-1H-PYRAZOL-3-YL)AMINO)PYRROLO(2,1-F)(1,2,4)TRIAZIN-2-YL)-N-(6-FLUOROPYRIDIN-3-YL)-2-METHYLPYRROLIDINE-2-CARBOXAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cb5aa234-b151-48e5-abae-363b8392f752",
            "476ee7a9-4f6c-4750-95b0-4bca675974d2"
          ],
          "display_name": false
        },
        {
          "uuid": "b563e97f-5d51-4026-8630-b1db5be53970",
          "name": "2-PYRROLIDINECARBOXAMIDE, 1-(4-((5-CYCLOPROPYL-1H-PYRAZOL-3-YL)AMINO)PYRROLO(2,1-F)(1,2,4)TRIAZIN-2-YL)-N-(6-FLUORO-3-PYRIDINYL)-2-METHYL-, (2S)-",
          "stdName": "2-PYRROLIDINECARBOXAMIDE, 1-(4-((5-CYCLOPROPYL-1H-PYRAZOL-3-YL)AMINO)PYRROLO(2,1-F)(1,2,4)TRIAZIN-2-YL)-N-(6-FLUORO-3-PYRIDINYL)-2-METHYL-, (2S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9b05dd60-20a6-42fe-a862-8455cd77bef2",
            "476ee7a9-4f6c-4750-95b0-4bca675974d2"
          ],
          "display_name": false
        },
        {
          "uuid": "d695df7b-cd74-51cc-b5d5-373f69e482d6",
          "name": "BMS 754807 [WHO-DD]",
          "stdName": "BMS 754807 [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9b275a25-d063-4a1b-9de8-603285e27682"
          ],
          "display_name": false
        },
        {
          "uuid": "a70018e7-d256-4aa6-bd62-c22c9000192a",
          "name": "BMS-754807",
          "stdName": "BMS-754807",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "476ee7a9-4f6c-4750-95b0-4bca675974d2",
            "aceed34e-6f25-48e3-a83c-95d2e05e131f",
            "9b275a25-d063-4a1b-9de8-603285e27682"
          ],
          "display_name": true
        },
        {
          "uuid": "16514d9e-7aac-4963-a46a-1cceb8892b45",
          "name": "BMS-754807-01",
          "stdName": "BMS-754807-01",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a91b78f2-a3b8-4090-a9f2-9ed5f57fd19a"
          ],
          "display_name": false
        },
        {
          "uuid": "b12ac76d-b152-44b6-9afd-6164594f8184",
          "name": "BMS754807",
          "stdName": "BMS754807",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9b275a25-d063-4a1b-9de8-603285e27682"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "aceed34e-6f25-48e3-a83c-95d2e05e131f",
          "citation": "CLINICALTRIALS.GOV",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "476ee7a9-4f6c-4750-95b0-4bca675974d2",
          "citation": "CLINICALTRIALS",
          "doc_type": "CLINICALTRIALS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9b05dd60-20a6-42fe-a862-8455cd77bef2",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cb5aa234-b151-48e5-abae-363b8392f752",
          "citation": "http://www.medkoo.com/Anticancer-trials/BMS-754807.htm",
          "url": "http://www.medkoo.com/Anticancer-trials/BMS-754807.htm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cc8ef533-9ff4-4809-b17d-7975fb852a7b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390899000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7efb4620-b6cc-467f-9f61-e7e112667d61",
          "citation": "SRS import [W9E3353E8J]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=W9E3353E8J",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390899000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9b275a25-d063-4a1b-9de8-603285e27682",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d9056b9e-01d6-6023-f553-59e23cbdd950",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "020c4dd8-9062-4bc3-932f-3af6a057fcd5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "8a6e8255-c1e7-c78b-5c25-5ee1920c4590",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "a91b78f2-a3b8-4090-a9f2-9ed5f57fd19a",
          "citation": "MHRA",
          "doc_type": "MHRSA",
          "public_domain": true
        },
        {
          "uuid": "decd34d8-8e01-1ee5-6e50-de042b1ed168",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "cf6d3534-64c8-4bf3-a3db-68587bbb9f65",
          "citation": "Carboni, Joan M., et al. \"BMS-754807, a small molecule inhibitor of insulin-like growth factor-1R/IR.\" Molecular cancer therapeutics 8.12 (2009): 3341-3349.",
          "url": "https://watermark.silverchair.com/3341.pdf?token=AQECAHi208BE49Ooan9kkhW_Ercy7Dm3ZL_9Cf3qfKAc485ysgAAA1cwggNTBgkqhkiG9w0BBwagggNEMIIDQAIBADCCAzkGCSqGSIb3DQEHATAeBglghkgBZQMEAS4wEQQMBEqB1dt7IpFPQC7UAgEQgIIDCpRZGIaE_g4UXq48Y5JKULSOvbF8_VusnG_9io-mao44nO1tP4ZwoKgjprMG1aRPjmSCqYlXHq508Itdbo6haWxT1P868yzPqIKMx5aAfsvwdeLiu9dRsS8cQX3cD0kZMKdokNFWdLN652OBk-jb6rEnEvQxTFQn8iIxDEVEVXivQxEn1hk9O3Fkdi-9AaQ3sCNLJruCG8Rrmr6iyZfAkud7RAAQF-AHcc19mtNxO_XMnQtfnsOf2T--mo8r4Ib9hFOlHzHWDwqks5VMkaRebacsZVi0Rh4etMrDCxTCaewU_gAE9o0KM1fity6ubZlSzMCHgBj4RpJNyw9upaW3rTN3HDlER_j5y1jh4Ur2S4Fbd08EZfDuGkmYM2QxcMolOzT2UaCBkL9gO6cdaP59y8AVuKDX2Rq_ihHmMtHt5JZ02-_O4E0Jb3SvqLotua37s_2rEnc8bVEtQQTXX-7UZJiAgM0bUTABpkI2130NVZlrpw_v3C6y8p6Oo86HiQWYqrBLDsJ4iLWLjMWfB76jehk39vORvZP3eIZ-UWlZOhGnMi9Gbz981aXRDFwWB6EYkJfil6Rk2bFOj3rw-CA5g329Atunjt5ehVGWnge-8dMffhQ-UoVDEn1HcTls493kJKqVqJT6yIUZ0f94HHOip2q6mOuBBxGHCD_Y-Cml296jbDal8DVu66gJpOomfn8fvVLPYwfZZ2Ku0sIr4JA2fnJe2PtDcv3h-TitmbO0JmXKjhbvUqa45eW915hwr4Xxjcmh5MXaoYPwTrFrrqHqrxEuPpMcbxRVwApooEiRPlTT6r6L8gGNEaetCtoKvXD5cd_crUK1INbklis2BYLfHaeeRcl9UaXtSItma1RU_xmLwNu3jBG5P3N1pgtBqGjsH8vdUKzfwIrmJdvrUeLMwM6WyeGQdckmEeTq6Vz_Il9xOzPrilfIx4CSNXFkpl9SsKAAglsU54PZQTY3tZiB-pUdFzXpeMJbi5BD9poSloeROVOQ0SXgX8wp7xl02W87ltOjLukRw3DIjok",
          "doc_type": "JA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "73ca8ab3-f741-40ef-a7ae-4ca987bb975b",
          "id": "73ca8ab3-f741-40ef-a7ae-4ca987bb975b",
          "molfile": "\n  Marvin  01132106002D          \n\n 34 39  0  0  1  0            999 V2000\n    8.7496   -7.1719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3371   -7.8863    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.7850   -8.4994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1975   -9.2138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0045   -9.0424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0908   -8.2218    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8052   -7.8094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8052   -6.9844    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5197   -6.5719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5197   -5.7469    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8052   -5.3344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7189   -4.5139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9120   -4.3424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4995   -5.0568    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0515   -5.6700    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5765   -3.5887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9090   -3.1038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6627   -2.7683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2341   -6.9844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0187   -6.7294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5037   -7.3968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0187   -8.0643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2341   -7.8094    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5197   -8.2218    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6696   -7.4014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7559   -6.5809    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9159   -7.7369    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8297   -8.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4971   -9.0424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4110   -9.8628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6573  -10.1984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5710  -11.0188    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9898   -9.7135    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0761   -8.8930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  6  0  0  0\n  2  3  1  0  0  0  0\n  2  6  1  0  0  0  0\n 25  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 24  2  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n  9 19  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 15  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 16  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 20  2  0  0  0  0\n 23 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 26  2  0  0  0  0\n 25 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 28 34  2  0  0  0  0\n 29 30  2  0  0  0  0\n 30 31  1  0  0  0  0\n 31 32  1  0  0  0  0\n 33 31  2  0  0  0  0\n 34 33  1  0  0  0  0\nM  END",
          "smiles": "C[C@]1(CCCN1c2nc(c3cccn3n2)Nc4cc(C5CC5)n[nH]4)C(=O)Nc6ccc(F)nc6",
          "formula": "C23H24FN9O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0c8a5300-7254-411c-9f92-96b451563d97"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "461.4956",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4027a105-8634-492d-9bdb-f1ce143d6273",
      "version": "14",
      "structure": {
        "id": "904af3df-9075-4483-aaee-19c75f7ad16a",
        "molfile": "\n  Marvin  01132107292D          \n\n 34 39  0  0  1  0            999 V2000\n    7.6696   -7.4014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9159   -7.7369    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8297   -8.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4971   -9.0424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4110   -9.8628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6573  -10.1984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9898   -9.7135    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0761   -8.8930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5710  -11.0188    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7559   -6.5809    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3371   -7.8863    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.7496   -7.1719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0908   -8.2218    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8052   -7.8094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8052   -6.9844    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5197   -6.5719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5197   -5.7469    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8052   -5.3344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7189   -4.5139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9120   -4.3424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4995   -5.0568    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0515   -5.6700    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5765   -3.5887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9090   -3.1038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6627   -2.7683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2341   -6.9844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2341   -7.8094    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5197   -8.2218    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0187   -8.0643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5037   -7.3968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0187   -6.7294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0045   -9.0424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1975   -9.2138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7850   -8.4994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  3  8  2  0  0  0  0\n  6  9  1  0  0  0  0\n  1 10  2  0  0  0  0\n  1 11  1  0  0  0  0\n 11 12  1  6  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 22 21  1  0  0  0  0\n 18 22  2  0  0  0  0\n 20 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 23 25  1  0  0  0  0\n 16 26  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 27  1  0  0  0  0\n 14 28  2  0  0  0  0\n 27 29  1  0  0  0  0\n 29 30  2  0  0  0  0\n 31 30  1  0  0  0  0\n 26 31  2  0  0  0  0\n 13 32  1  0  0  0  0\n 32 33  1  0  0  0  0\n 34 33  1  0  0  0  0\n 11 34  1  0  0  0  0\nM  END",
        "smiles": "C[C@]1(CCCN1c2nc(c3cccn3n2)Nc4cc(C5CC5)[nH]n4)C(=O)Nc6ccc(F)nc6",
        "formula": "C23H24FN9O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "461.4956",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "9b05dd60-20a6-42fe-a862-8455cd77bef2",
          "9b275a25-d063-4a1b-9de8-603285e27682"
        ],
        "stereo_centers": 1
      },
      "unii": "W9E3353E8J"
    }
  ]
}