{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "434c48fb-8641-483a-8b8a-aa0eb3388794",
          "code": "6106-04-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6106-04-3",
          "code_system": "CAS",
          "references": [
            "60d95476-f4f1-41ba-9fe9-4184b9eed51a",
            "eac46228-15ce-4c2d-9d93-df234179a74a"
          ]
        },
        {
          "uuid": "39c15e5c-b838-4aa1-a2f9-da21bdfc8750",
          "code": "C82288",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C82288",
          "code_system": "NCI_THESAURUS",
          "references": [
            "60d95476-f4f1-41ba-9fe9-4184b9eed51a"
          ]
        },
        {
          "uuid": "308ad4f0-4163-4b18-a449-0a47163de2e2",
          "code": "D012970",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68012970",
          "code_system": "MESH",
          "references": [
            "60d95476-f4f1-41ba-9fe9-4184b9eed51a"
          ]
        },
        {
          "uuid": "836ee068-842e-4dc9-86b2-bcac58d1d48d",
          "code": "MONOSODIUM GLUTAMATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Monosodium_glutamate",
          "code_system": "WIKIPEDIA",
          "references": [
            "60d95476-f4f1-41ba-9fe9-4184b9eed51a"
          ]
        },
        {
          "uuid": "d5aefc1d-86ed-42cf-93b9-652f8b288a6e",
          "code": "INS-621",
          "comments": "Codex Alimentarius|Functional Classification|Flavour enhancer",
          "type": "PRIMARY",
          "url": "http://www.fao.org/gsfaonline/additives/details.html?id=276",
          "code_system": "CODEX ALIMENTARIUS (GSFA)",
          "references": [
            "60d95476-f4f1-41ba-9fe9-4184b9eed51a"
          ]
        },
        {
          "uuid": "23d1a2f3-5851-4790-833a-6fdb5d521dda",
          "code": "INS-621",
          "comments": "JECFA|Functional Classification|FLAVOUR ENHANCERCAS# 142-47-2 given in JECFA is for anhydrous form, not for mono hydrate form as called for in JECFA code.",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemINS=621",
          "code_system": "JECFA EVALUATION",
          "references": [
            "60d95476-f4f1-41ba-9fe9-4184b9eed51a"
          ]
        },
        {
          "uuid": "9eca131c-75ed-4513-95b9-d9f03889346a",
          "code": "1311588",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1311588/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "60d95476-f4f1-41ba-9fe9-4184b9eed51a"
          ]
        },
        {
          "uuid": "496a5040-d289-4623-b1cd-7a25ee694d64",
          "code": "SUB21151",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "60d95476-f4f1-41ba-9fe9-4184b9eed51a"
          ]
        },
        {
          "uuid": "9be0c55b-27f4-40f2-8c11-aad9aab345da",
          "code": "SUB49895",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "60d95476-f4f1-41ba-9fe9-4184b9eed51a"
          ]
        },
        {
          "uuid": "6e45b5c5-b106-452d-b713-929d4a4e57de",
          "code": "SUB20604",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "60d95476-f4f1-41ba-9fe9-4184b9eed51a"
          ]
        },
        {
          "uuid": "56d2cdf6-125a-4c37-b3f1-c6dbaa73f96b",
          "code": "SUB21636",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "60d95476-f4f1-41ba-9fe9-4184b9eed51a"
          ]
        },
        {
          "uuid": "7cf0eb08-7e01-43e3-8fc9-916059888cd6",
          "code": "CHEMBL2106738",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2106738",
          "code_system": "ChEMBL",
          "references": [
            "60d95476-f4f1-41ba-9fe9-4184b9eed51a"
          ]
        },
        {
          "uuid": "9c6ae8b1-d4c1-a933-c65b-09806252412a",
          "code": "DTXSID0047240",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0047240",
          "code_system": "EPA CompTox",
          "references": [
            "ccceefc9-8e2c-8b98-3e79-5ea09c6c5d8a"
          ]
        },
        {
          "uuid": "8290f404-fbd6-8724-a2c1-d8ed2c5b83f3",
          "code": "C45678",
          "comments": "Industrial Aid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C45678",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7de1597d-d23c-6df8-efa1-25000e4e90e5"
          ]
        },
        {
          "uuid": "3795b3ec-727e-443d-7159-dd8825e096f0",
          "code": "23666328",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/23666328",
          "code_system": "PUBCHEM",
          "references": [
            "7af9edc4-32ce-2aeb-b74c-ad77a556a5a7"
          ]
        },
        {
          "uuid": "a0ed1480-6b77-1620-7037-f5be3bfeb2ea",
          "code": "2181 (Number of products:2)",
          "comments": "Dietary Supplement Label Database|Chemical|Monosodium Glutamate",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=2181&item=Monosodium Glutamate",
          "code_system": "DSLD",
          "references": [
            "7de1597d-d23c-6df8-efa1-25000e4e90e5"
          ]
        },
        {
          "uuid": "9e52346d-aa3e-4d61-a0d1-1daf5915c0d1",
          "code": "W81N5U6R6U",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0c6f3155-f603-1e4d-d29d-0ef4d80651e3",
          "code": "64243",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:64243",
          "code_system": "CHEBI",
          "references": [
            "7de1597d-d23c-6df8-efa1-25000e4e90e5"
          ]
        },
        {
          "uuid": "4480c96b-94b0-60b6-4dc7-fbecf5cc0ee4",
          "code": "64220",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:64220",
          "code_system": "CHEBI",
          "references": [
            "7de1597d-d23c-6df8-efa1-25000e4e90e5"
          ]
        },
        {
          "uuid": "6eac29fd-9a62-1247-1059-a8442723973e",
          "code": "1446600",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1446600",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "7de1597d-d23c-6df8-efa1-25000e4e90e5"
          ]
        },
        {
          "uuid": "41a71460-b66e-e15b-72e8-2ce89a00f498",
          "code": "W81N5U6R6U",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=W81N5U6R6U",
          "code_system": "DAILYMED",
          "references": [
            "4798262d-a97c-9512-6396-f3df13ed00a1"
          ]
        },
        {
          "uuid": "cee352d4-6e3f-00b2-ca74-5bba0fd3c4e6",
          "code": "100000130222",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "8833d12f-ce14-9d08-1779-eae2c95b9729"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "3491219b-8d57-491a-9abe-cd5cc9fe5150",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "8d262fbb-ed2e-4b98-a357-9ec796a845e4",
            "refuuid": "c1a85f3b-7e72-4564-8f18-461f9b6f8aa5",
            "name": "Glutamic Acid",
            "unii": "3KX376GY7L",
            "linking_id": "3KX376GY7L",
            "ref_pname": "Glutamic Acid",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1e293a64-f7e9-4f4c-9ae2-5b012dddf1bc",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "df45036b-d0fb-4179-88c9-cc03dc85fc5c",
            "refuuid": "c1a85f3b-7e72-4564-8f18-461f9b6f8aa5",
            "name": "Glutamic Acid",
            "unii": "3KX376GY7L",
            "linking_id": "3KX376GY7L",
            "ref_pname": "Glutamic Acid",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0a354bb7-d982-4407-a61b-c75cdb898ba4",
          "amount": {
            "uuid": "a0559b5c-ad96-4857-b9f8-171dadd45652",
            "average": 10
          },
          "qualification": "USP",
          "type": "PARENT->IMPURITY",
          "references": [
            "c76e626a-b36b-1731-7f88-bfc512a5e483"
          ],
          "related_substance": {
            "uuid": "b430070c-29cd-4404-b5ee-6563f936425b",
            "refuuid": "3888779a-1171-41af-bd6a-b5a5c2c39880",
            "name": "LEAD",
            "unii": "2P299V784P",
            "linking_id": "2P299V784P",
            "ref_pname": "LEAD",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e124491a-62d6-4219-2ead-7f36b1f63818",
          "type": "ANHYDROUS->SOLVATE",
          "references": [
            "eac46228-15ce-4c2d-9d93-df234179a74a"
          ],
          "related_substance": {
            "uuid": "ed794e06-402e-4664-a0a7-d89189c1bdf9",
            "refuuid": "e55331f0-c0b4-4745-ae7d-2e1e3e94b80e",
            "name": "MONOSODIUM GLUTAMATE ANHYDROUS",
            "unii": "C3C196L9FG",
            "linking_id": "C3C196L9FG",
            "ref_pname": "MONOSODIUM GLUTAMATE ANHYDROUS"
          }
        },
        {
          "uuid": "49bd1700-7891-4008-bf1f-050ecfa7f07d",
          "amount": {
            "uuid": "4f958095-b000-452a-9741-60be401e7bb5"
          },
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "bbcf29ca-31dd-4ab3-8c28-702daa269434",
            "refuuid": "c1a85f3b-7e72-4564-8f18-461f9b6f8aa5",
            "name": "Glutamic Acid",
            "unii": "3KX376GY7L",
            "linking_id": "3KX376GY7L",
            "ref_pname": "Glutamic Acid",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e79621c4-491e-4c2e-ba5b-db57894b0e0f",
          "name": "B1652 [LANGUAL]",
          "stdName": "B1652 [LANGUAL]",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e75cd5f1-2993-4915-b492-8c5b4b0a9e56",
            "79a5b897-6f13-49a5-91d4-8e8756dedd1c"
          ],
          "display_name": false
        },
        {
          "uuid": "27cfb4a2-f5b6-4417-a951-94c6970b7deb",
          "name": "CHINESE SEASONING",
          "stdName": "CHINESE SEASONING",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "79a5b897-6f13-49a5-91d4-8e8756dedd1c",
            "11003a5a-bbe7-4381-8377-d9adeeff54fa"
          ],
          "display_name": false
        },
        {
          "uuid": "bf510c7c-2393-4577-b1f1-156dfbb76b2a",
          "name": "E-621",
          "stdName": "E-621",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "47b84d82-e9ac-4e0c-a46e-314e4ec8c897",
            "79a5b897-6f13-49a5-91d4-8e8756dedd1c"
          ],
          "display_name": false
        },
        {
          "uuid": "1b28491f-7b65-4529-9a47-3fd850a0147b",
          "name": "INS NO.621",
          "stdName": "INS NO.621",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "47b84d82-e9ac-4e0c-a46e-314e4ec8c897",
            "79a5b897-6f13-49a5-91d4-8e8756dedd1c"
          ],
          "display_name": false
        },
        {
          "uuid": "0ac129ba-f2c6-4dd6-ad4f-14aae4f200c9",
          "name": "INS-621",
          "stdName": "INS-621",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "47b84d82-e9ac-4e0c-a46e-314e4ec8c897",
            "79a5b897-6f13-49a5-91d4-8e8756dedd1c"
          ],
          "display_name": false
        },
        {
          "uuid": "c8f4c210-7d44-4bad-aa32-caa400ae645d",
          "name": "MONOSODIUM GLUTAMATE",
          "stdName": "MONOSODIUM GLUTAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f4b33e4-6887-497d-90cb-e2f54a04b99a",
            "79a5b897-6f13-49a5-91d4-8e8756dedd1c",
            "3165f6b4-730a-49c0-bfea-1fdc56cba8b8",
            "e46381b0-395a-49c8-968e-b0c027d62b25",
            "df0a1285-abbe-4253-9add-aad22304616a",
            "fc6854a6-987c-457d-bff8-0ef310b1c508"
          ],
          "display_name": true
        },
        {
          "uuid": "8625da1a-0f5d-466a-9554-9797866e5d56",
          "name": "MONOSODIUM GLUTAMATE MONOHYDRATE",
          "stdName": "MONOSODIUM GLUTAMATE MONOHYDRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "33acabab-155e-44e0-bd86-63bcf20a47da"
          ],
          "display_name": false
        },
        {
          "uuid": "4b50bc85-6f0a-49d8-9dc4-b85444eed0d7",
          "name": "MONOSODIUM GLUTAMATE [USP-RS]",
          "stdName": "MONOSODIUM GLUTAMATE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f4b33e4-6887-497d-90cb-e2f54a04b99a",
            "79a5b897-6f13-49a5-91d4-8e8756dedd1c"
          ],
          "display_name": false
        },
        {
          "uuid": "eed574b7-29e9-47e9-9f6d-c56c9162ae8c",
          "name": "MONOSODIUM GLUTAMATE [VANDF]",
          "stdName": "MONOSODIUM GLUTAMATE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "79a5b897-6f13-49a5-91d4-8e8756dedd1c",
            "3165f6b4-730a-49c0-bfea-1fdc56cba8b8"
          ],
          "display_name": false
        },
        {
          "uuid": "031c4ce4-58cf-4912-bb00-87481c7456fa",
          "name": "MONOSODIUM L-GLUTAMATE",
          "stdName": "MONOSODIUM L-GLUTAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "79a5b897-6f13-49a5-91d4-8e8756dedd1c",
            "d68c3616-c8a2-429e-9dbb-3e458629cb92",
            "89f29a1c-6fad-4e89-8423-a585a01c2817"
          ],
          "display_name": false
        },
        {
          "uuid": "b45e5d9a-b616-455f-8f3a-69d24678cb9c",
          "name": "MONOSODIUM L-GLUTAMATE [FCC]",
          "stdName": "MONOSODIUM L-GLUTAMATE [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "79a5b897-6f13-49a5-91d4-8e8756dedd1c",
            "89f29a1c-6fad-4e89-8423-a585a01c2817"
          ],
          "display_name": false
        },
        {
          "uuid": "3b1cc373-b7fd-4bc9-b9ea-5a67688a0718",
          "name": "MSG",
          "stdName": "MSG",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "79a5b897-6f13-49a5-91d4-8e8756dedd1c",
            "11003a5a-bbe7-4381-8377-d9adeeff54fa"
          ],
          "display_name": false
        },
        {
          "uuid": "356c4e44-0aa4-4d12-93cc-fcc6459a4f44",
          "name": "RL-50",
          "stdName": "RL-50",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "79a5b897-6f13-49a5-91d4-8e8756dedd1c",
            "11003a5a-bbe7-4381-8377-d9adeeff54fa"
          ],
          "display_name": false
        },
        {
          "uuid": "285f6ac6-f121-4145-bfca-455f74539cef",
          "name": "SODIUM GLUTAMATE",
          "stdName": "SODIUM GLUTAMATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "1c97447e-0ad6-4d6a-843f-8507b0ea99f0",
            "79a5b897-6f13-49a5-91d4-8e8756dedd1c",
            "11003a5a-bbe7-4381-8377-d9adeeff54fa",
            "b7b48780-cb2b-4e17-a041-a4f44c7ba233"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "7f8789f4-d747-45c9-896d-5d8c990211a5",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "4822ac50-894f-483b-ba9a-f01c1ea1cf31",
          "name": "SODIUM L-GLUTAMATE HYDRATE",
          "stdName": "SODIUM L-GLUTAMATE HYDRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "79a5b897-6f13-49a5-91d4-8e8756dedd1c",
            "8e20be22-b133-4778-a67e-842b341ff17a",
            "88a1a111-ca09-4cce-8a81-73b875d673e6"
          ],
          "display_name": false
        },
        {
          "uuid": "6ad7f50b-cd84-4392-b8ce-d4c68f4c7185",
          "name": "SODIUM L-GLUTAMATE HYDRATE [JAN]",
          "stdName": "SODIUM L-GLUTAMATE HYDRATE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "79a5b897-6f13-49a5-91d4-8e8756dedd1c",
            "88a1a111-ca09-4cce-8a81-73b875d673e6"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "11003a5a-bbe7-4381-8377-d9adeeff54fa",
          "citation": "Merck Index 14th Edition",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "79a5b897-6f13-49a5-91d4-8e8756dedd1c",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e46381b0-395a-49c8-968e-b0c027d62b25",
          "citation": "NF 27",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "33acabab-155e-44e0-bd86-63bcf20a47da",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "89f29a1c-6fad-4e89-8423-a585a01c2817",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1c97447e-0ad6-4d6a-843f-8507b0ea99f0",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e75cd5f1-2993-4915-b492-8c5b4b0a9e56",
          "citation": "LANGUAL",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4f4b33e4-6887-497d-90cb-e2f54a04b99a",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "88a1a111-ca09-4cce-8a81-73b875d673e6",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3165f6b4-730a-49c0-bfea-1fdc56cba8b8",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "47b84d82-e9ac-4e0c-a46e-314e4ec8c897",
          "citation": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=276",
          "url": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=276",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "60d95476-f4f1-41ba-9fe9-4184b9eed51a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390556000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dfc120c9-0a26-4666-8433-65c3b1409358",
          "citation": "SRS import [W81N5U6R6U]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=W81N5U6R6U",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390556000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b7b48780-cb2b-4e17-a041-a4f44c7ba233",
          "citation": "SODIUM GLUTAMATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d68c3616-c8a2-429e-9dbb-3e458629cb92",
          "citation": "MONOSODIUM L-GLUTAMATE [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fc6854a6-987c-457d-bff8-0ef310b1c508",
          "citation": "MONOSODIUM GLUTAMATE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8e20be22-b133-4778-a67e-842b341ff17a",
          "citation": "SODIUM L-GLUTAMATE HYDRATE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "df0a1285-abbe-4253-9add-aad22304616a",
          "citation": "MONOSODIUM GLUTAMATE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ccceefc9-8e2c-8b98-3e79-5ea09c6c5d8a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=6106-04-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c76e626a-b36b-1731-7f88-bfc512a5e483",
          "citation": "Monograph 54750 USP41-NF36 S1",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "7de1597d-d23c-6df8-efa1-25000e4e90e5",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "7af9edc4-32ce-2aeb-b74c-ad77a556a5a7",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "eac46228-15ce-4c2d-9d93-df234179a74a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4798262d-a97c-9512-6396-f3df13ed00a1",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "8833d12f-ce14-9d08-1779-eae2c95b9729",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1f444d55-3a18-45aa-a193-18ba233fc2d3",
          "id": "1f444d55-3a18-45aa-a193-18ba233fc2d3",
          "molfile": "\n  Marvin  01132101472D          \n\n 10  9  0  0  1  0            999 V2000\n    6.0485   -3.3006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3695   -3.7113    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.0485   -2.4601    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7552   -3.7113    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.4706   -3.3006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1912   -3.7113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9070   -3.3190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9070   -2.4923    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6184   -3.7667    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.7552   -4.5473    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  1  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4 10  1  6  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  7  1  0  0  0  0\nM  CHG  2   2  -1   9  -1\nM  END",
          "smiles": "C(CC(=O)[O-])[C@@H](C(=O)[O-])N",
          "formula": "C5H7NO4",
          "atropisomerism": "No",
          "charge": -2,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6560bae9-4b3b-41b7-a507-b8e7ed4bdece"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "145.1136",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        },
        {
          "uuid": "5a289914-b194-4414-b416-450f0749ed0b",
          "id": "5a289914-b194-4414-b416-450f0749ed0b",
          "molfile": "\n  Marvin  01132104402D          \n\n  1  0  0  0  1  0            999 V2000\n   10.1769   -3.7452    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "65e83efb-ff03-47d8-abca-d4da491f16de"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "29223b78-3aeb-41cf-baec-daa3967075fe",
          "id": "29223b78-3aeb-41cf-baec-daa3967075fe",
          "molfile": "\n  Marvin  01132102152D          \n\n  1  0  0  0  1  0            999 V2000\n   10.5139   -4.8717    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "O",
          "formula": "H2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3859430e-e08e-4d91-9dad-4509abf2ce06"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "18.0153",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "2d262023-2988-4581-9ccd-a618c3de6592",
          "id": "2d262023-2988-4581-9ccd-a618c3de6592",
          "molfile": "\n  Marvin  01132102262D          \n\n  1  0  0  0  1  0            999 V2000\n    3.8090   -4.5016    0.0000 H   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "formula": "H",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3af02cff-72a0-4f36-b0ae-6816e450da62"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "1.0079",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "04d4b131-c1d5-483e-bbcf-85cac16d8a0e",
      "version": "20",
      "structure": {
        "id": "7933015d-19b2-42ae-85ca-c5379a2cc69e",
        "molfile": "\n  Marvin  01132106182D          \n\n 13  9  0  0  1  0            999 V2000\n    6.0478   -3.3002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3689   -3.7109    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.0478   -2.4598    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7544   -3.7109    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.4698   -3.3002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1903   -3.7109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9060   -3.3186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9060   -2.4920    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6173   -3.7663    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.7544   -4.5468    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1780   -3.7456    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n   10.5151   -4.8722    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8094   -4.5021    0.0000 H   0  3  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  1  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  7  1  0  0  0  0\n  4 10  1  6  0  0  0\nM  CHG  4   2  -1   9  -1  11   1  13   1\nM  END",
        "smiles": "C(CC(=O)[O-])[C@@H](C(=O)[O-])N.[Na+].O.[H+]",
        "formula": "C5H7NO4.Na.H.H2O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "187.1266",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "e46381b0-395a-49c8-968e-b0c027d62b25",
          "dfc120c9-0a26-4666-8433-65c3b1409358"
        ],
        "stereo_centers": 1
      },
      "unii": "W81N5U6R6U"
    }
  ]
}