{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "bae800d6-9896-4d80-b471-6e4b874613d2",
          "code": "7128-64-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=7128-64-5",
          "code_system": "CAS",
          "references": [
            "ab9a93c3-4363-4a68-b098-75e4f710adf6",
            "82478300-980c-446f-bf97-f36d90ce4cba"
          ]
        },
        {
          "uuid": "311010ed-4132-4ad9-b4f4-b7cb79386f2a",
          "code": "21 CFR 175.125",
          "comments": "PART 175 -- INDIRECT FOOD ADDITIVES: ADHESIVES AND COMPONENTS OF COATINGS|Subpart B--Substances for Use Only as Components of Adhesives|Sec. 175.125 Pressure-sensitive adhesives.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=175.125",
          "code_system": "CFR",
          "references": [
            "ab9a93c3-4363-4a68-b098-75e4f710adf6"
          ]
        },
        {
          "uuid": "64a4c41f-fc6c-4ced-a3a5-6a6e0fc5ea6b",
          "code": "21 CFR 178.3297",
          "comments": "PART 178 -- INDIRECT FOOD ADDITIVES: ADJUVANTS, PRODUCTION AIDS, AND SANITIZERS|Subpart D--Certain Adjuvants and Production Aids|Sec. 178.3297 Colorants for polymers.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/cfrsearch.cfm?fr=178.3297",
          "code_system": "CFR",
          "references": [
            "ab9a93c3-4363-4a68-b098-75e4f710adf6"
          ]
        },
        {
          "uuid": "56527e92-797e-4c0c-8583-9428c488c649",
          "code": "21 CFR 176.170",
          "comments": "PART 176 -- INDIRECT FOOD ADDITIVES: PAPER AND PAPERBOARD COMPONENTS|Subpart B--Substances for Use Only as Components of Paper and Paperboard|Sec. 176.170 Components of paper and paperboard in contact with aqueous and fatty foods.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/cfrsearch.cfm?fr=176.170",
          "code_system": "CFR",
          "references": [
            "ab9a93c3-4363-4a68-b098-75e4f710adf6"
          ]
        },
        {
          "uuid": "58997773-8c06-43b6-b066-657f3ac31048",
          "code": "21 CFR 175.105",
          "comments": "PART 175 -- INDIRECT FOOD ADDITIVES: ADHESIVES AND COMPONENTS OF COATINGS|Subpart B--Substances for Use Only as Components of Adhesives|Sec. 175.105 Adhesives.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/cfrsearch.cfm?fr=175.105",
          "code_system": "CFR",
          "references": [
            "ab9a93c3-4363-4a68-b098-75e4f710adf6"
          ]
        },
        {
          "uuid": "d1081912-a898-4a16-9c95-0597298dbd1d",
          "code": "230-426-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.027.661",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "ab9a93c3-4363-4a68-b098-75e4f710adf6"
          ]
        },
        {
          "uuid": "b5d7cae6-dec8-430c-8a45-10ee6279df63",
          "code": "m2282",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2282?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "ab9a93c3-4363-4a68-b098-75e4f710adf6"
          ]
        },
        {
          "uuid": "ba3525a2-a288-4460-9ea2-59fc2c596cac",
          "code": "292429",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/292429",
          "code_system": "PUBCHEM",
          "references": [
            "ab9a93c3-4363-4a68-b098-75e4f710adf6"
          ]
        },
        {
          "uuid": "c533f420-7aef-ecdb-8034-a400b0b8146b",
          "code": "DTXSID1048205",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1048205",
          "code_system": "EPA CompTox",
          "references": [
            "99d2dd87-8cf5-b3c3-2871-4c93d6230e3a"
          ]
        },
        {
          "uuid": "da69f318-52a7-4ec0-b276-a13a3c4ac92e",
          "code": "W7UR9129GP",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e0931eca-d652-8ddb-acf6-a924b4091756",
          "code": "158163",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=158163",
          "code_system": "NSC",
          "references": [
            "9393d04c-9d93-0e53-c7b0-9e9ff73bbbb6"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "80e177fa-775f-4b41-a5c9-963e184e9a75",
          "name": "2,2'-(2,5-THIOPHENEDIYL)BIS(5-(1,1-DIMETHYLETHYL))BENZOXAZOLE",
          "stdName": "2,2'-(2,5-THIOPHENEDIYL)BIS(5-(1,1-DIMETHYLETHYL))BENZOXAZOLE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "77ae6520-8613-443a-8027-38cb90e34e8a",
            "a27e3124-34fc-4cb6-9baf-da6646cc14d9"
          ],
          "display_name": false
        },
        {
          "uuid": "c17318bc-7c0e-49b3-8bc2-8bec437c1ccf",
          "name": "2,5-BIS(5'-TERT-BUTYL-2-BENZOXAZOLYL)THIOPHENE",
          "stdName": "2,5-BIS(5'-TERT-BUTYL-2-BENZOXAZOLYL)THIOPHENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "77ae6520-8613-443a-8027-38cb90e34e8a",
            "a27e3124-34fc-4cb6-9baf-da6646cc14d9"
          ],
          "display_name": false
        },
        {
          "uuid": "f92e37d3-ae55-41e7-9d57-afd70ffed233",
          "name": "2,5-BIS(5-TERT-BUTYL-2-BENZOXAZOLYL)THIOPHENE",
          "stdName": "2,5-BIS(5-TERT-BUTYL-2-BENZOXAZOLYL)THIOPHENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "77ae6520-8613-443a-8027-38cb90e34e8a",
            "a27e3124-34fc-4cb6-9baf-da6646cc14d9"
          ],
          "display_name": false
        },
        {
          "uuid": "5824ea3a-ed9c-464b-92e0-36b0efc4b93c",
          "name": "2,5-DI(5-TERT-BUTYLBENZOXAZOL-2-YL)THIOPHENE",
          "stdName": "2,5-DI(5-TERT-BUTYLBENZOXAZOL-2-YL)THIOPHENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "77ae6520-8613-443a-8027-38cb90e34e8a",
            "a27e3124-34fc-4cb6-9baf-da6646cc14d9"
          ],
          "display_name": false
        },
        {
          "uuid": "f646baab-e5dc-4dcc-a847-6e6071ed97c1",
          "name": "BBOT [MI]",
          "stdName": "BBOT [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "77ae6520-8613-443a-8027-38cb90e34e8a",
            "e24457c9-2f4f-4873-93f7-2119eafb56d1"
          ],
          "display_name": false
        },
        {
          "uuid": "174be71e-4d4c-4ac8-9aaa-7e9067d21ea6",
          "name": "BENZOXAZOLE, 2,2'-(2,5-THIOPHENEDIYL)BIS(5-(1,1-DIMETHYLETHYL))-",
          "stdName": "BENZOXAZOLE, 2,2'-(2,5-THIOPHENEDIYL)BIS(5-(1,1-DIMETHYLETHYL))-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "77ae6520-8613-443a-8027-38cb90e34e8a",
            "a27e3124-34fc-4cb6-9baf-da6646cc14d9"
          ],
          "display_name": false
        },
        {
          "uuid": "f414dc36-a775-4ca9-afd7-36ca762c86e7",
          "name": "BENZOXAZOLE, 2,2'-(2,5-THIOPHENEDIYL)BIS(5-TERT-BUTYL-",
          "stdName": "BENZOXAZOLE, 2,2'-(2,5-THIOPHENEDIYL)BIS(5-TERT-BUTYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "77ae6520-8613-443a-8027-38cb90e34e8a",
            "a27e3124-34fc-4cb6-9baf-da6646cc14d9"
          ],
          "display_name": false
        },
        {
          "uuid": "c40d0af1-80b4-458a-a9a4-5a101c2f3aa4",
          "name": "BIS(T-BUTYL BENZOXAZOLYL) THIOPHENE",
          "stdName": "BIS(T-BUTYL BENZOXAZOLYL) THIOPHENE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "77ae6520-8613-443a-8027-38cb90e34e8a",
            "9ed0dbe6-a4c4-4e9f-a686-3767151986aa",
            "5ad291c2-6373-4586-9599-39448b30b014"
          ],
          "display_name": false,
          "name_orgs": [
            {
              "uuid": "560f4be7-ccaf-41d7-9083-d7f3d181874f",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "2c80730f-4714-4ca9-b1d8-910146d6bfab",
          "name": "BIS(TERT-BUTYL BENZOXAZOLYL) THIOPHENE",
          "stdName": "BIS(TERT-BUTYL BENZOXAZOLYL) THIOPHENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "77ae6520-8613-443a-8027-38cb90e34e8a",
            "0d7ce223-0fed-4b0e-bab9-da36ac665d0b"
          ],
          "display_name": false
        },
        {
          "uuid": "90d5b17b-3f14-4412-9d79-e0fdb838e977",
          "name": "BRIGHTENER OB",
          "stdName": "BRIGHTENER OB",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "77ae6520-8613-443a-8027-38cb90e34e8a",
            "93909e31-b7f9-404d-87e9-b30a143f9c99"
          ],
          "display_name": false
        },
        {
          "uuid": "2ad25afd-a5f3-405f-9168-c6dfac5b2805",
          "name": "C.I. 515245",
          "stdName": "C.I. 515245",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "77ae6520-8613-443a-8027-38cb90e34e8a",
            "a27e3124-34fc-4cb6-9baf-da6646cc14d9"
          ],
          "display_name": false
        },
        {
          "uuid": "31f47207-0208-4497-9113-ead8349e6df2",
          "name": "C.I. FLUORESCENT BRIGHTENER 184BENZOXAZOLE",
          "stdName": "C.I. FLUORESCENT BRIGHTENER 184BENZOXAZOLE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "77ae6520-8613-443a-8027-38cb90e34e8a",
            "a27e3124-34fc-4cb6-9baf-da6646cc14d9"
          ],
          "display_name": false
        },
        {
          "uuid": "84ce7806-2350-4e6e-8899-99644fd71793",
          "name": "C.I. FLUORESCENT BRIGHTENING AGENT 184",
          "stdName": "C.I. FLUORESCENT BRIGHTENING AGENT 184",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "77ae6520-8613-443a-8027-38cb90e34e8a",
            "93909e31-b7f9-404d-87e9-b30a143f9c99"
          ],
          "display_name": false
        },
        {
          "uuid": "abc65275-66e7-4cc9-8c85-3a8982e28b6b",
          "name": "CI 515245",
          "stdName": "CI 515245",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "77ae6520-8613-443a-8027-38cb90e34e8a",
            "0d7ce223-0fed-4b0e-bab9-da36ac665d0b"
          ],
          "display_name": false
        },
        {
          "uuid": "64c2c642-8212-4f63-bea3-b741d7d4be42",
          "name": "FLUORESCENT BRIGHTENER 184",
          "stdName": "FLUORESCENT BRIGHTENER 184",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "77ae6520-8613-443a-8027-38cb90e34e8a",
            "0d7ce223-0fed-4b0e-bab9-da36ac665d0b"
          ],
          "display_name": true
        },
        {
          "uuid": "e1f8cf3d-a86a-467a-8ae2-91e372f35869",
          "name": "KEYFLUOR WHITE PL",
          "stdName": "KEYFLUOR WHITE PL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "77ae6520-8613-443a-8027-38cb90e34e8a",
            "93909e31-b7f9-404d-87e9-b30a143f9c99"
          ],
          "display_name": false
        },
        {
          "uuid": "aa402ae5-8ce5-4a85-a344-597f20b0f24f",
          "name": "NSC-158163",
          "stdName": "NSC-158163",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "77ae6520-8613-443a-8027-38cb90e34e8a",
            "a27e3124-34fc-4cb6-9baf-da6646cc14d9"
          ],
          "display_name": false
        },
        {
          "uuid": "66d381da-0df0-4958-8a97-80179d151aa1",
          "name": "TINOPAL OB",
          "stdName": "TINOPAL OB",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "77ae6520-8613-443a-8027-38cb90e34e8a",
            "93909e31-b7f9-404d-87e9-b30a143f9c99"
          ],
          "display_name": false
        },
        {
          "uuid": "42299772-0e5d-4945-83db-86bd8be21623",
          "name": "UVITEX 3BSA",
          "stdName": "UVITEX 3BSA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "77ae6520-8613-443a-8027-38cb90e34e8a",
            "93909e31-b7f9-404d-87e9-b30a143f9c99"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "77ae6520-8613-443a-8027-38cb90e34e8a",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a27e3124-34fc-4cb6-9baf-da6646cc14d9",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0d7ce223-0fed-4b0e-bab9-da36ac665d0b",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "93909e31-b7f9-404d-87e9-b30a143f9c99",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e24457c9-2f4f-4873-93f7-2119eafb56d1",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ab9a93c3-4363-4a68-b098-75e4f710adf6",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391601000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a39c876-4daf-4ce1-a2ce-be4b9b96b2fe",
          "citation": "SRS import [W7UR9129GP]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=W7UR9129GP",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391601000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5ad291c2-6373-4586-9599-39448b30b014",
          "citation": "BIS(T-BUTYL BENZOXAZOLYL) THIOPHENE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9ed0dbe6-a4c4-4e9f-a686-3767151986aa",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "99d2dd87-8cf5-b3c3-2871-4c93d6230e3a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=7128-64-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "82478300-980c-446f-bf97-f36d90ce4cba",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "9393d04c-9d93-0e53-c7b0-9e9ff73bbbb6",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6d862af3-18a8-4716-bfd5-7c7ca4f313a6",
          "id": "6d862af3-18a8-4716-bfd5-7c7ca4f313a6",
          "molfile": "\n  Marvin  01132105412D          \n\n 31 35  0  0  0  0            999 V2000\n    7.1208   -5.9904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7443   -5.2596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2412   -4.6027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0442   -5.7013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3530   -4.6991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1691   -3.9114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7821   -3.3508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5699   -3.6005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2875   -3.1845    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9006   -3.7318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5678   -4.4670    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7494   -4.3926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1407   -4.9486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7146   -3.5522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0388   -2.7952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8483   -2.8739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0234   -3.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3321   -4.0997    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7761   -4.0077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4942   -3.5917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1157   -4.1391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9345   -4.0471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4289   -4.6947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0964   -5.4518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2732   -5.5438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7790   -4.8787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9557   -4.7954    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2478   -4.5940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0749   -4.6466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3699   -3.7932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2478   -5.4260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  2  1  0  0  0  0\n  5  6  1  0  0  0  0\n 13  5  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 12  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 14 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 15  2  0  0  0  0\n 18 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 17 18  1  0  0  0  0\n 19 17  1  0  0  0  0\n 19 20  2  0  0  0  0\n 19 27  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 26  2  0  0  0  0\n 22 23  2  0  0  0  0\n 23 24  1  0  0  0  0\n 23 28  1  0  0  0  0\n 25 24  2  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 29  1  0  0  0  0\n 28 30  1  0  0  0  0\n 28 31  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(C)c1ccc2c(c1)nc(-c3ccc(-c4nc5cc(ccc5o4)C(C)(C)C)s3)o2",
          "formula": "C26H26N2O2S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "003e45e2-ce41-4699-ad7c-47a41123e645"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "430.5639",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "17513590-0a3d-43e2-a3c6-3e8af2715d55",
      "version": "4",
      "structure": {
        "id": "137a6ce7-53c4-4523-9921-318c6b4ad7a4",
        "molfile": "\n  Marvin  01132101132D          \n\n 31 35  0  0  0  0            999 V2000\n   12.7772   -4.0080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0244   -3.6795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3330   -4.1000    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7155   -3.5525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9014   -3.7321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5686   -4.4674    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7501   -4.3930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1414   -4.9490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3536   -4.6995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7449   -5.2600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1214   -5.9909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2417   -4.6031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0447   -5.7018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1697   -3.9117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7827   -3.3511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5706   -3.6008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2883   -3.1848    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0397   -2.7954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8493   -2.8741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4953   -3.5920    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1169   -4.1394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9357   -4.0474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4302   -4.6951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2491   -4.5944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0763   -4.6470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3713   -3.7935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2491   -5.4264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0976   -5.4523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2744   -5.5443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7801   -4.8791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9568   -4.7958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 10 13  1  0  0  0  0\n  9 14  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n  7 16  2  0  0  0  0\n  5 17  1  0  0  0  0\n 17 16  1  0  0  0  0\n  4 18  2  0  0  0  0\n  2 19  2  0  0  0  0\n 19 18  1  0  0  0  0\n  1 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  1  0  0  0  0\n 24 27  1  0  0  0  0\n 23 28  1  0  0  0  0\n 29 28  2  0  0  0  0\n 30 29  1  0  0  0  0\n 21 30  2  0  0  0  0\n  1 31  1  0  0  0  0\n 31 30  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(C)c1ccc2c(c1)nc(-c3ccc(-c4nc5cc(ccc5o4)C(C)(C)C)s3)o2",
        "formula": "C26H26N2O2S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "430.5639",
        "optical_activity": "NONE",
        "references": [
          "4a39c876-4daf-4ce1-a2ce-be4b9b96b2fe",
          "a27e3124-34fc-4cb6-9baf-da6646cc14d9"
        ],
        "stereo_centers": 0
      },
      "unii": "W7UR9129GP"
    }
  ]
}