{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "7d95c828-c871-48b8-9d72-02b4365a36ca", "code": "2140-71-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=2140-71-8", "code_system": "CAS", "references": [ "be4c2d06-dcdc-4d6f-a56a-f0fd02c81b11", "90fca0be-03fb-44fc-917d-b0737008937b" ] }, { "uuid": "1c6ecf19-e732-41e0-a8c6-50f0495e8c59", "code": "C024900", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67024900", "code_system": "MESH", "references": [ "be4c2d06-dcdc-4d6f-a56a-f0fd02c81b11" ] }, { "uuid": "bd5d6216-887d-d0fb-e439-8e92f9c11e34", "code": "DTXSID80175669", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80175669", "code_system": "EPA CompTox", "references": [ "a97084a3-1177-2e44-490b-89f79ef9a33b" ] }, { "uuid": "28717c36-7684-dcdf-0cb6-a88a95213c78", "code": "135406950", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135406950", "code_system": "PUBCHEM", "references": [ "ca3d1a03-adc6-0ebe-6280-82a08ac0e561" ] }, { "uuid": "cc044e72-6e95-466c-b089-38c34f1d084b", "code": "W722H4PA1S", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "b4ec0086-ddfc-43c3-d9f4-a9e5dea5392e", "code": "19229", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:19229", "code_system": "CHEBI", "references": [ "b6eb3a4f-8b9c-e8ff-ddc6-378183026fca" ] } ], "substance_class": "chemical", "names": [ { "uuid": "4b0aded4-a4e4-4fe4-b888-8a355220b90e", "name": "2'-O-METHYLGUANOSINE", "stdName": "2'-O-METHYLGUANOSINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "a14a1c7c-dab2-49fe-9003-0efe14e3ce79", "962bcfd6-c1a9-4100-8f4d-cebdc05eb809" ], "display_name": true }, { "uuid": "53eb7d20-fe25-4ee8-9598-81421db63531", "name": "GUANOSINE, 2'-O-METHYL-", "stdName": "GUANOSINE, 2'-O-METHYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "a14a1c7c-dab2-49fe-9003-0efe14e3ce79", "962bcfd6-c1a9-4100-8f4d-cebdc05eb809" ], "display_name": false } ], "references": [ { "uuid": "962bcfd6-c1a9-4100-8f4d-cebdc05eb809", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "a14a1c7c-dab2-49fe-9003-0efe14e3ce79", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "be4c2d06-dcdc-4d6f-a56a-f0fd02c81b11", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390918000, "tags": [ "NOMEN" ] }, { "uuid": "59dd3e5f-d634-46d5-8799-8b9b600c7edd", "citation": "SRS import [W722H4PA1S]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=W722H4PA1S", "doc_type": "SRS", "public_domain": true, "document_date": 1493390918000, "tags": [ "NOMEN" ] }, { "uuid": "a97084a3-1177-2e44-490b-89f79ef9a33b", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2140-71-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "90fca0be-03fb-44fc-917d-b0737008937b", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "ca3d1a03-adc6-0ebe-6280-82a08ac0e561", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "b6eb3a4f-8b9c-e8ff-ddc6-378183026fca", "doc_type": "SYSTEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "df668d59-c6c4-4571-9b5f-6e2796b401fc", "id": "df668d59-c6c4-4571-9b5f-6e2796b401fc", "molfile": "\n Marvin 01132111342D \n\n 21 23 0 0 1 0 999 V2000\n 8.5227 -5.0607 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 7.8932 -4.5265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0636 -4.5265 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3142 -4.6170 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1010 -5.0607 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 10.1010 -3.8875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6195 -3.2199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1010 -2.5572 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8830 -2.8052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8830 -3.6302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5983 -4.0402 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3089 -3.6302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0240 -4.0402 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3089 -2.8004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5983 -2.3903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5983 -1.5701 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7959 -5.6614 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 10.1201 -6.4196 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1630 -6.8343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8183 -5.6614 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 8.4941 -6.4196 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 1 4 1 0 0 0 0\n 20 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 5 4 1 6 0 0 0\n 5 6 1 0 0 0 0\n 17 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 6 10 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 15 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 12 2 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 2 0 0 0 0\n 17 18 1 6 0 0 0\n 17 20 1 0 0 0 0\n 18 19 1 0 0 0 0\n 20 21 1 6 0 0 0\nM END", "smiles": "CO[C@@H]1[C@@H]([C@@H](CO)O[C@H]1n2cnc3c2[nH]c(N)nc3=O)O", "formula": "C11H15N5O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "3f1a2bf5-1623-4a76-a6a2-a1243b4f638c" }, "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "297.2677", "optical_activity": "UNSPECIFIED", "stereo_centers": 4 } ], "definition_level": "COMPLETE", "uuid": "294004f3-ebfe-4603-9466-95e05a92a3f3", "version": "8", "structure": { "id": "e15c0365-d081-4587-9fec-d436878d42c5", "molfile": "\n Marvin 01132111402D \n\n 21 23 0 0 1 0 999 V2000\n 7.0636 -4.5265 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8932 -4.5265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5227 -5.0607 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 8.8183 -5.6614 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.4941 -6.4196 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7959 -5.6614 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 10.1201 -6.4196 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1630 -6.8343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1010 -5.0607 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.3142 -4.6170 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1010 -3.8875 0.0000 N 0 0 2 0 0 0 0 0 0 0 0 0\n 9.6195 -3.2199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1010 -2.5572 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8830 -2.8052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5983 -2.3903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3089 -2.8004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3089 -3.6302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0240 -4.0402 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5983 -4.0402 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8830 -3.6302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5983 -1.5701 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 1 1 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 6 0 0 0\n 4 6 1 0 0 0 0\n 6 7 1 6 0 0 0\n 7 8 1 0 0 0 0\n 6 9 1 0 0 0 0\n 10 9 1 0 0 0 0\n 3 10 1 0 0 0 0\n 9 11 1 1 0 0 0\n 12 11 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 15 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 18 17 1 0 0 0 0\n 17 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 14 20 2 0 0 0 0\n 11 20 1 0 0 0 0\n 21 15 2 0 0 0 0\nM END", "smiles": "CO[C@@H]1[C@@H]([C@@H](CO)O[C@H]1n2cnc3c2nc(N)[nH]c3=O)O", "formula": "C11H15N5O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "297.2677", "optical_activity": "UNSPECIFIED", "references": [ "59dd3e5f-d634-46d5-8799-8b9b600c7edd", "962bcfd6-c1a9-4100-8f4d-cebdc05eb809" ], "stereo_centers": 4 }, "unii": "W722H4PA1S" } ] }