{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "ee1fdfeb-4dae-4622-bdad-f397eea354df", "code": "1238449-42-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1238449-42-7", "code_system": "CAS", "references": [ "64e7e6de-8b04-44b4-b14e-22757de5a988", "3b6cdd56-82da-4731-af7b-5f986e4c5565" ] }, { "uuid": "92d85d6f-9c30-4adb-94b2-a2d9aa1978f0", "code": "87573553", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/87573553", "code_system": "PUBCHEM", "references": [ "64e7e6de-8b04-44b4-b14e-22757de5a988" ] }, { "uuid": "cb9aa978-28d3-4a11-bd83-d0d5dad8772d", "code": "W6KRW1503I", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "d78a33a7-74fb-3ad6-2d32-67371cb87230", "code": "DTXSID00893676", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00893676", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "5d453e37-b1c1-449c-b774-122fcffbddec", "name": "1-HEPTANOL, 2-PROPYL-, 1,1'-CARBONATE", "stdName": "1-HEPTANOL, 2-PROPYL-, 1,1'-CARBONATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "44557611-8c30-4505-ab3f-aa3af1e23c65", "d4e9a3cf-68f8-4797-935d-2bc5a4ae31a6" ], "display_name": false }, { "uuid": "d144f088-3d67-476b-b28c-be7e5600090d", "name": "BIS-PROPYLHEPTYL CARBONATE", "stdName": "BIS-PROPYLHEPTYL CARBONATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "d4e9a3cf-68f8-4797-935d-2bc5a4ae31a6", "e92e1400-9e2f-4429-9049-f356eb91924d" ], "display_name": true }, { "uuid": "5a4550fb-633f-438c-8346-2590fd10e490", "name": "CETIOL KE 4664", "stdName": "CETIOL KE 4664", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "d4e9a3cf-68f8-4797-935d-2bc5a4ae31a6", "e92e1400-9e2f-4429-9049-f356eb91924d" ], "display_name": false } ], "references": [ { "uuid": "d4e9a3cf-68f8-4797-935d-2bc5a4ae31a6", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "44557611-8c30-4505-ab3f-aa3af1e23c65", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "64e7e6de-8b04-44b4-b14e-22757de5a988", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393333000, "tags": [ "NOMEN" ] }, { "uuid": "eadcb896-80e2-46d7-b12f-bbbd7eb82128", "citation": "SRS import [W6KRW1503I]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=W6KRW1503I", "doc_type": "SRS", "public_domain": true, "document_date": 1493393333000, "tags": [ "NOMEN" ] }, { "uuid": "e92e1400-9e2f-4429-9049-f356eb91924d", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "3b6cdd56-82da-4731-af7b-5f986e4c5565", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "4d46442f-6e7a-4c93-90eb-3cc1112a2c9a", "id": "4d46442f-6e7a-4c93-90eb-3cc1112a2c9a", "molfile": "\n Marvin 01132104022D \n\n 24 23 0 0 0 0 999 V2000\n 13.0078 -12.4235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6019 -11.7053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7770 -11.6978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3710 -10.9795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5460 -10.9720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1400 -10.2538 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 9.3150 -10.2462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9092 -9.5280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3282 -8.8173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5591 -9.5431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1531 -8.8248 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5721 -8.1142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1663 -7.3959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3971 -8.1217 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8162 -7.4111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6411 -7.4186 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 13.0471 -8.1369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6281 -8.8476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8031 -8.8399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0602 -6.7079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6542 -5.9897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0732 -5.2790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6673 -4.5608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0863 -3.8502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 10 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 2 0 0 0 0\n 12 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 20 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\nM END", "smiles": "CCCCCC(CCC)COC(=O)OCC(CCC)CCCCC", "formula": "C21H42O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "3d793f71-0416-4ee8-bd00-07d1163a3c2e" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "342.5572", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "2c8369c4-7b36-418b-b6b6-23d40516278b", "version": "3", "structure": { "id": "17a719d8-2db5-4442-bf61-41ba50994cc4", "molfile": "\n Marvin 01132101252D \n\n 24 23 0 0 0 0 999 V2000\n 11.3971 -8.1217 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5721 -8.1142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1663 -7.3959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1531 -8.8248 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5591 -9.5431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1400 -10.2538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3150 -10.2462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9092 -9.5280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3282 -8.8173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5460 -10.9720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3710 -10.9795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7770 -11.6978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6019 -11.7053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0078 -12.4235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8162 -7.4111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6411 -7.4186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0471 -8.1369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6281 -8.8476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8031 -8.8399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0602 -6.7079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6542 -5.9897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0732 -5.2790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6673 -4.5608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0863 -3.8502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 2 0 0 0 0\n 2 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 6 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 1 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 16 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\nM END", "smiles": "CCCCCC(CCC)COC(=O)OCC(CCC)CCCCC", "formula": "C21H42O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "342.5572", "optical_activity": "UNSPECIFIED", "references": [ "44557611-8c30-4505-ab3f-aa3af1e23c65", "eadcb896-80e2-46d7-b12f-bbbd7eb82128" ], "stereo_centers": 2 }, "unii": "W6KRW1503I" } ] }