{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "30d64d67-d763-4fd1-a54b-b9294a3e4ee5",
          "code": "m805",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m805?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "33659f96-de70-43ff-b36f-d982077d7ba4"
          ]
        },
        {
          "uuid": "8f79c29e-e64a-4f01-a3ea-fd6dca250110",
          "code": "15954436",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/15954436",
          "code_system": "PUBCHEM",
          "references": [
            "33659f96-de70-43ff-b36f-d982077d7ba4"
          ]
        },
        {
          "uuid": "669eb7b7-fdcc-4e1b-9c46-fa5bf18bc67e",
          "code": "840-50-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=840-50-6",
          "code_system": "CAS",
          "references": [
            "33659f96-de70-43ff-b36f-d982077d7ba4",
            "76d380e5-764c-44dd-8c8e-048b5084a708"
          ]
        },
        {
          "uuid": "7b453220-a354-1208-11e3-c46c6982ca4f",
          "code": "DTXSID30580466",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30580466",
          "code_system": "EPA CompTox",
          "references": [
            "0737e311-06cf-8eee-b9a4-a3dfdf69e06b"
          ]
        },
        {
          "uuid": "24d28a01-c804-4a22-9433-687379f56c4e",
          "code": "W60MVE2G8N",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e0cbe768-b24d-41c2-9b21-85cc79be5bfa",
          "name": "2-DEOXY-5-(METHYLAMINO)URIDINE",
          "stdName": "2-DEOXY-5-(METHYLAMINO)URIDINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5ffd8408-4125-4b39-b678-257dc5c9e037",
            "1d675e1e-d9a3-4836-875f-64ddb14f5d5a"
          ],
          "display_name": true
        },
        {
          "uuid": "8ef5545f-d776-43d7-aaec-f94d45214d93",
          "name": "5-METHYLAMINO-2'-DEOXYURIDINE",
          "stdName": "5-METHYLAMINO-2'-DEOXYURIDINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d675e1e-d9a3-4836-875f-64ddb14f5d5a",
            "0d8776e0-2024-449f-aece-a19e9c306675"
          ],
          "display_name": false
        },
        {
          "uuid": "5228074f-d0a9-48e2-83a4-38e6f26b5503",
          "name": "MADU",
          "stdName": "MADU",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5ffd8408-4125-4b39-b678-257dc5c9e037",
            "0347f98e-9044-4504-ac10-0d04393187e7",
            "1d675e1e-d9a3-4836-875f-64ddb14f5d5a",
            "0d8776e0-2024-449f-aece-a19e9c306675"
          ],
          "display_name": false
        },
        {
          "uuid": "9a9dee99-15db-4e1e-bd5a-d8b701874cc9",
          "name": "MADU [MI]",
          "stdName": "MADU [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5ffd8408-4125-4b39-b678-257dc5c9e037",
            "1d675e1e-d9a3-4836-875f-64ddb14f5d5a"
          ],
          "display_name": false
        },
        {
          "uuid": "c423c5ed-b80d-45e7-8838-2e34e9ac9f2e",
          "name": "URIDINE, 2'-DEOXY-5-(METHYLAMINO)-",
          "stdName": "URIDINE, 2'-DEOXY-5-(METHYLAMINO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d675e1e-d9a3-4836-875f-64ddb14f5d5a",
            "0d8776e0-2024-449f-aece-a19e9c306675"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5ffd8408-4125-4b39-b678-257dc5c9e037",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1d675e1e-d9a3-4836-875f-64ddb14f5d5a",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0d8776e0-2024-449f-aece-a19e9c306675",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "33659f96-de70-43ff-b36f-d982077d7ba4",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392724000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fc83167d-02f3-4ba3-afbf-6715cfb46b64",
          "citation": "SRS import [W60MVE2G8N]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=W60MVE2G8N",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392724000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0347f98e-9044-4504-ac10-0d04393187e7",
          "citation": "MADU [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0737e311-06cf-8eee-b9a4-a3dfdf69e06b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=840-50-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "76d380e5-764c-44dd-8c8e-048b5084a708",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "aa3e27e9-d6f3-4c3c-9c1a-c006e65bd04b",
          "id": "aa3e27e9-d6f3-4c3c-9c1a-c006e65bd04b",
          "molfile": "\n  Marvin  01132108502D          \n\n 18 19  0  0  1  0            999 V2000\n    9.1839   -3.5540    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    9.5195   -2.8003    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3769   -3.7255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2907   -4.5460    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    9.0443   -4.8815    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5964   -4.2685    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   10.4169   -4.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9018   -3.6872    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5762   -4.9585    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5762   -5.7835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8617   -6.1960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8617   -7.0210    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1473   -7.4335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1473   -5.7835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4328   -6.1960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1473   -4.9585    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8617   -4.5460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8617   -3.7210    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  6  1  0  0  0  0\n  4  3  1  1  0  0  0\n  4  5  1  0  0  0  0\n  4  9  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  1  0  0  0\n  7  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 17  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 14 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 15  2  0  0  0  0\n 16 14  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\nM  END",
          "smiles": "CNc1cn([C@H]2C[C@@H]([C@@H](CO)O2)O)c(=O)[nH]c1=O",
          "formula": "C10H15N3O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3c404853-1524-46f7-a4a5-d4a746d653c9"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "257.2436",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f795455e-f6e8-435c-b951-7a8d98612e54",
      "version": "3",
      "structure": {
        "id": "363c1cbe-4f6f-4cb9-ae7f-6ce5af34981a",
        "molfile": "\n  Marvin  01132102532D          \n\n 18 19  0  0  1  0            999 V2000\n    6.8617   -3.7210    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8617   -4.5460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1473   -4.9585    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1473   -5.7835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4328   -6.1960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8617   -6.1960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8617   -7.0210    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1473   -7.4335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5762   -5.7835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5762   -4.9585    0.0000 N   0  0  1  0  0  0  0  0  0  0  0  0\n    8.2907   -4.5460    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.3769   -3.7255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1839   -3.5540    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.5195   -2.8003    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5964   -4.2685    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.4169   -4.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9018   -3.6872    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0443   -4.8815    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  6  2  0  0  0  0\n 10  9  1  0  0  0  0\n  2 10  1  0  0  0  0\n 11 10  1  1  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  6  0  0  0\n 15 13  1  0  0  0  0\n 15 16  1  1  0  0  0\n 16 17  1  0  0  0  0\n 18 15  1  0  0  0  0\n 11 18  1  0  0  0  0\nM  END",
        "smiles": "CNc1cn([C@H]2C[C@@H]([C@@H](CO)O2)O)c(=O)[nH]c1=O",
        "formula": "C10H15N3O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "257.2436",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "fc83167d-02f3-4ba3-afbf-6715cfb46b64",
          "0d8776e0-2024-449f-aece-a19e9c306675"
        ],
        "stereo_centers": 3
      },
      "unii": "W60MVE2G8N"
    }
  ]
}