{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "2bfc642d-fce4-4067-9c34-4028a109f02c", "code": "60241-53-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=60241-53-4", "code_system": "CAS", "references": [ "7ed901d5-e9de-4f28-ba8f-6bdb06ddc4bf", "b9e64baa-9b7a-4af6-a561-45d5c5971a39" ] }, { "uuid": "297df99c-c847-464c-8d5d-7d8b5c50be2a", "code": "262-117-5", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.056.452", "code_system": "ECHA (EC/EINECS)", "references": [ "7ed901d5-e9de-4f28-ba8f-6bdb06ddc4bf" ] }, { "uuid": "c9a8cc12-4713-415e-84e8-479d85432e7b", "code": "108425", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/108425", "code_system": "PUBCHEM", "references": [ "7ed901d5-e9de-4f28-ba8f-6bdb06ddc4bf" ] }, { "uuid": "138420e4-29a7-4f8e-8516-1fd3b3703f44", "code": "W5L6ZT39B7", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "a6f49a57-2ca4-828e-226d-3008743cbb6c", "code": "DTXSID90866798", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90866798", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "4a09c5da-547b-423a-bf74-fe0589d7b0f1", "name": ".ALPHA.,.BETA.,2,2,6-PENTAMETHYLCYCLOHEXANEPROPANOL", "stdName": ".ALPHA.,.BETA.,2,2,6-PENTAMETHYLCYCLOHEXANEPROPANOL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "945e9f75-7bcd-468e-a359-6d0b520782d7" ], "display_name": true }, { "uuid": "0ab7777a-f3f7-4313-b2b1-eec90aeacc25", "name": "CYCLOHEXANEPROPANOL, .ALPHA.,.BETA.,2,2,6-PENTAMETHYL-", "stdName": "CYCLOHEXANEPROPANOL, .ALPHA.,.BETA.,2,2,6-PENTAMETHYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "e1247210-dc98-4d94-8027-a88cb928cecd" ], "display_name": false }, { "uuid": "ca78ef53-f876-450f-b0ef-2d85fb83c8cf", "name": "TIMBRANOL", "stdName": "TIMBRANOL", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "945e9f75-7bcd-468e-a359-6d0b520782d7" ], "display_name": false }, { "uuid": "a1bc261e-6857-4505-957f-55c2aac48992", "name": "VIOLET PROPANOL", "stdName": "VIOLET PROPANOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "6f375297-787f-4708-9947-562a81eb6a08" ], "display_name": false } ], "references": [ { "uuid": "e1247210-dc98-4d94-8027-a88cb928cecd", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "945e9f75-7bcd-468e-a359-6d0b520782d7", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6f375297-787f-4708-9947-562a81eb6a08", "citation": "http://www.thegoodscentscompany.com/data/rw1047361.html", "url": "http://www.thegoodscentscompany.com/data/rw1047361.html", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "7ed901d5-e9de-4f28-ba8f-6bdb06ddc4bf", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393610000, "tags": [ "NOMEN" ] }, { "uuid": "c112ac83-099d-47b0-9809-cbc74bf4a3f1", "citation": "SRS import [W5L6ZT39B7]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=W5L6ZT39B7", "doc_type": "SRS", "public_domain": true, "document_date": 1493393610000, "tags": [ "NOMEN" ] }, { "uuid": "b9e64baa-9b7a-4af6-a561-45d5c5971a39", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "3f407171-ad2d-4d2b-bacf-764231472389", "id": "3f407171-ad2d-4d2b-bacf-764231472389", "molfile": "\n Marvin 01132103212D \n\n 15 15 0 0 0 0 999 V2000\n 4.2745 -1.2396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5649 -0.8293 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 3.5649 -0.0043 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8468 -1.2396 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 2.8468 -2.0646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1372 -0.8293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4234 -1.2396 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 0.7095 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 0.7095 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.2396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.0646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7095 -2.4749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4234 -2.0646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2056 -2.3339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4234 -2.8896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 2 1 0 0 0 0\n 4 5 1 0 0 0 0\n 6 4 1 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 13 7 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 8 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 1 0 0 0 0\nM END", "smiles": "CC1CCCC(C)(C)C1CC(C)C(C)O", "formula": "C14H28O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "b7f8b3a9-d13e-4712-af49-1e1aeb16cc62" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "212.372", "optical_activity": "UNSPECIFIED", "stereo_centers": 4 } ], "definition_level": "COMPLETE", "uuid": "9c8c3460-cf0b-4bf8-b08d-9561ae252533", "version": "4", "structure": { "id": "b13858fc-6cd9-47d0-9652-b2274467ac45", "molfile": "\n Marvin 01132109112D \n\n 15 15 0 0 0 0 999 V2000\n 0.0000 -1.2396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.0646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7095 -2.4749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4234 -2.0646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4234 -1.2396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7095 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7095 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2056 -2.3339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4234 -2.8896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1372 -0.8293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8468 -1.2396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5649 -0.8293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2745 -1.2396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5649 -0.0043 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8468 -2.0646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 6 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 4 8 1 0 0 0 0\n 4 9 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 10 1 0 0 0 0\n 6 7 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 15 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 1 0 0 0 0\nM END", "smiles": "CC1CCCC(C)(C)C1CC(C)C(C)O", "formula": "C14H28O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "212.372", "optical_activity": "UNSPECIFIED", "references": [ "e1247210-dc98-4d94-8027-a88cb928cecd", "c112ac83-099d-47b0-9809-cbc74bf4a3f1" ], "stereo_centers": 4 }, "unii": "W5L6ZT39B7" } ] }