{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "bdfa4ee8-2fe1-4cb9-8b1f-1ffab672bf13", "code": "28231-03-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=28231-03-0", "code_system": "CAS", "references": [ "c831eef8-c494-4fa7-8bdd-4b972aba590a", "13f64aa1-8e6b-4443-ae69-b6d0eedc2a58" ] }, { "uuid": "0e3b1bde-fb30-4d72-aaea-7cbde979a782", "code": "248-917-7", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.044.455", "code_system": "ECHA (EC/EINECS)", "references": [ "c831eef8-c494-4fa7-8bdd-4b972aba590a" ] }, { "uuid": "2cec2ac6-575e-4379-85e0-2d4991d8d192", "code": "119831", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/119831", "code_system": "PUBCHEM", "references": [ "c831eef8-c494-4fa7-8bdd-4b972aba590a" ] }, { "uuid": "351e46d2-696b-67fb-652e-f2d7d4f6cd21", "code": "DTXSID3051961", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3051961", "code_system": "EPA CompTox", "references": [ "6fe08efb-672f-7377-8627-9028d024931b" ] }, { "uuid": "5ae052ed-3be4-4f45-99c1-ffded9c2c576", "code": "W4QN7VCD15", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "f053e4b8-6bce-4c01-aafc-54189c9a756a", "name": "CEDRENOL", "stdName": "CEDRENOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ca1ff25c-681e-4b33-b9a4-55dcafb70be8" ], "display_name": true } ], "references": [ { "uuid": "ca1ff25c-681e-4b33-b9a4-55dcafb70be8", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c831eef8-c494-4fa7-8bdd-4b972aba590a", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392002000, "tags": [ "NOMEN" ] }, { "uuid": "6fe08efb-672f-7377-8627-9028d024931b", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=28231-03-0", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "81f07670-c8d5-a753-bf70-460cd94516eb", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "13f64aa1-8e6b-4443-ae69-b6d0eedc2a58", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "e6f09de3-1050-41b8-a7e0-23fd66bf45af", "id": "e6f09de3-1050-41b8-a7e0-23fd66bf45af", "molfile": "\n Marvin 01132111572D \n\n 16 18 0 0 0 0 999 V2000\n 4.5370 -2.2776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9064 -1.6515 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 3.7748 -0.8666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0307 -0.5853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4228 -1.0934 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 1.6877 -0.7168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0961 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2704 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9301 -1.0662 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 1.5562 -1.6968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5543 -1.8783 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 2.0734 -2.3547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2613 -2.3547 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 1.0208 -3.2122 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7804 -1.8466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.2821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 11 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 5 11 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 8 1 0 0 0 0\n 6 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 9 15 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 1 0 0 0 0\n 15 16 2 0 0 0 0\nM END", "smiles": "CC1CCC2C(C)(C)C3CC12CC(C3=C)O", "formula": "C15H24O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "7ed36d38-562f-4bca-87f8-1b984ee64df7" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "220.351", "optical_activity": "UNSPECIFIED", "stereo_centers": 5 } ], "definition_level": "INCOMPLETE", "uuid": "ea19cb3d-fc4a-4f6d-b60e-558179bd6e5b", "version": "7", "structure": { "id": "59c1a59b-551d-4531-b179-472f8692649d", "molfile": "\n Marvin 01132104392D \n\n 16 18 0 0 0 0 999 V2000\n 1.2613 -2.3547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0734 -2.3547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6877 -0.7168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9301 -1.0662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7804 -1.8466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4228 -1.0934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5543 -1.8783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9064 -1.6515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7748 -0.8666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0307 -0.5853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0961 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2704 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5562 -1.6968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5370 -2.2776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.2821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0208 -3.2122 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 5 1 0 0 0 0\n 1 16 1 0 0 0 0\n 2 7 1 0 0 0 0\n 3 6 1 0 0 0 0\n 3 4 1 0 0 0 0\n 3 11 1 0 0 0 0\n 3 12 1 0 0 0 0\n 4 5 1 0 0 0 0\n 4 13 1 0 0 0 0\n 5 15 2 0 0 0 0\n 6 7 1 0 0 0 0\n 6 10 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 13 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 14 1 0 0 0 0\n 9 10 1 0 0 0 0\nM END", "smiles": "CC1CCC2C(C)(C)C3CC12CC(C3=C)O", "formula": "C15H24O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "220.351", "optical_activity": "UNSPECIFIED", "references": [ "ca1ff25c-681e-4b33-b9a4-55dcafb70be8" ], "stereo_centers": 5 }, "unii": "W4QN7VCD15" } ] }