{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "849ca005-4774-4b75-9b0a-5cf5c9ecf02f",
          "code": "3741-80-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3741-80-8",
          "code_system": "CAS",
          "references": [
            "caf8e9df-0422-44ca-ab91-92ab1b4bd7df",
            "38425617-35c7-4ee4-8303-79e132307bea"
          ]
        },
        {
          "uuid": "123ab5eb-5c82-4438-9a25-1093d15fa931",
          "code": "407-430-1",
          "type": "PRIMARY",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "caf8e9df-0422-44ca-ab91-92ab1b4bd7df"
          ]
        },
        {
          "uuid": "95a763e7-7e25-450e-b3cd-0ab3614cf0be",
          "code": "77344",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/77344",
          "code_system": "PUBCHEM",
          "references": [
            "caf8e9df-0422-44ca-ab91-92ab1b4bd7df"
          ]
        },
        {
          "uuid": "7ee647ed-fd35-3941-97e1-45504ba07c83",
          "code": "DTXSID1041394",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1041394",
          "code_system": "EPA CompTox",
          "references": [
            "8d5d36d5-649b-061a-3b9d-2e169e241e0b"
          ]
        },
        {
          "uuid": "cc68bbe5-4617-4a3f-a9c6-88e03539eaad",
          "code": "W472RVB1NU",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "556fabaf-3860-44dd-b252-887add6f14b8",
          "name": "2-BENZOTHIAZOLESULFENAMIDE, N-(2-BENZOTHIAZOLYLTHIO)-N-(1,1-DIMETHYLETHYL)-",
          "stdName": "2-BENZOTHIAZOLESULFENAMIDE, N-(2-BENZOTHIAZOLYLTHIO)-N-(1,1-DIMETHYLETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e635264d-cd9d-492c-94da-7d3e84bab4dd",
            "66dc9758-85c7-4f19-a141-b599ec9d6fc4"
          ],
          "display_name": false
        },
        {
          "uuid": "023f5f4e-5723-4fb9-99bb-340520da5f1c",
          "name": "DI(2-BENZOTHIAZOLESULFEN)AMIDE, N-TERT-BUTYL-",
          "stdName": "DI(2-BENZOTHIAZOLESULFEN)AMIDE, N-TERT-BUTYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e635264d-cd9d-492c-94da-7d3e84bab4dd",
            "d1304922-6199-429d-a815-fb6c4c57c375"
          ],
          "display_name": false
        },
        {
          "uuid": "f8447004-a74f-4b39-b111-120b091b9d72",
          "name": "J668.657E",
          "stdName": "J668.657E",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e635264d-cd9d-492c-94da-7d3e84bab4dd",
            "9a3d25e1-27d1-44e9-a527-c613edf4784f"
          ],
          "display_name": false
        },
        {
          "uuid": "16a31d01-32d4-4dcb-a24e-4ad5dc4548c1",
          "name": "N-(1,1-DIMETHYLETHYL)BIS(2-BENZOTHIAZOLESULFEN)AMIDE",
          "stdName": "N-(1,1-DIMETHYLETHYL)BIS(2-BENZOTHIAZOLESULFEN)AMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e635264d-cd9d-492c-94da-7d3e84bab4dd",
            "153cc603-9cc6-4305-9902-b05afab1b6bc"
          ],
          "display_name": false
        },
        {
          "uuid": "6ed0c9ec-8039-47eb-8640-9a1db99f566b",
          "name": "N-TERT-BUTYL-DI(2-BENZOTHIAZOLESULFEN)AMIDE",
          "stdName": "N-TERT-BUTYL-DI(2-BENZOTHIAZOLESULFEN)AMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e635264d-cd9d-492c-94da-7d3e84bab4dd",
            "0fefef78-10fb-4ea6-a731-5dc391d8e401"
          ],
          "display_name": true
        },
        {
          "uuid": "e6473ee4-19eb-4cce-8a4a-3f4738c5997a",
          "name": "SANTOCURE TBSI",
          "stdName": "SANTOCURE TBSI",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e635264d-cd9d-492c-94da-7d3e84bab4dd",
            "d1304922-6199-429d-a815-fb6c4c57c375"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0fefef78-10fb-4ea6-a731-5dc391d8e401",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e635264d-cd9d-492c-94da-7d3e84bab4dd",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "66dc9758-85c7-4f19-a141-b599ec9d6fc4",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d1304922-6199-429d-a815-fb6c4c57c375",
          "citation": "SciFinder",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9a3d25e1-27d1-44e9-a527-c613edf4784f",
          "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J668.657E",
          "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J668.657E",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "153cc603-9cc6-4305-9902-b05afab1b6bc",
          "citation": "http://chem.sis.nlm.nih.gov/chemidplus/rn/3741-80-8",
          "url": "http://chem.sis.nlm.nih.gov/chemidplus/rn/3741-80-8",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "caf8e9df-0422-44ca-ab91-92ab1b4bd7df",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393331000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22b238dd-1613-485c-bd70-1005fdba3b8c",
          "citation": "SRS import [W472RVB1NU]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=W472RVB1NU",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393331000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8d5d36d5-649b-061a-3b9d-2e169e241e0b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3741-80-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "38425617-35c7-4ee4-8303-79e132307bea",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "aef6e00b-9038-4178-90ea-0ae735114da1",
          "id": "aef6e00b-9038-4178-90ea-0ae735114da1",
          "molfile": "\n  Marvin  01132109052D          \n\n 25 28  0  0  0  0            999 V2000\n    3.3097   -0.5184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0355   -0.9092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7373   -0.4865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0355   -0.0798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0355   -1.7306    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3097   -2.1692    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5840   -1.7625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4883   -0.9331    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6668   -0.7736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2361   -0.0479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4067   -0.0718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.7896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4227   -1.5153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2601   -1.4993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8263   -2.1134    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7373   -2.1373    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4471   -1.7227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5268   -0.9012    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3323   -0.7337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7390   -0.0080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5605    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9752   -0.7098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5685   -1.4275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7470   -1.4355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2047   -2.0496    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 16  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n 15  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 14  2  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  2  0  0  0  0\n 25 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 24  2  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  2  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(C)N(Sc1nc2ccccc2s1)Sc3nc4ccccc4s3",
          "formula": "C18H17N3S4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ebc00e0d-b3aa-4e42-b7b1-2c49ff6f8839"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "403.6127",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "dbca8363-5da6-4ab4-aa7a-17e2497c76c9",
      "version": "3",
      "structure": {
        "id": "69720ada-071e-49b3-905f-d05136b3e1e7",
        "molfile": "\n  Marvin  01132105292D          \n\n 25 28  0  0  0  0            999 V2000\n    2.4883   -0.9331    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8263   -2.1134    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5840   -1.7625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6668   -0.7736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2601   -1.4993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4227   -1.5153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.7896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4067   -0.0718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2361   -0.0479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3097   -2.1692    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0355   -1.7306    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7373   -2.1373    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5268   -0.9012    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2047   -2.0496    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4471   -1.7227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3323   -0.7337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7470   -1.4355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5685   -1.4275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9752   -0.7098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5605    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7390   -0.0080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0355   -0.9092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3097   -0.5184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7373   -0.4865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0355   -0.0798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  3  2  0  0  0  0\n  1  4  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  5  1  0  0  0  0\n  3 10  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  9  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 22  1  0  0  0  0\n 12 15  1  0  0  0  0\n 13 15  2  0  0  0  0\n 13 16  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 17  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 21  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 22 25  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(C)N(Sc1nc2ccccc2s1)Sc3nc4ccccc4s3",
        "formula": "C18H17N3S4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "403.6127",
        "optical_activity": "NONE",
        "references": [
          "66dc9758-85c7-4f19-a141-b599ec9d6fc4",
          "22b238dd-1613-485c-bd70-1005fdba3b8c"
        ],
        "stereo_centers": 0
      },
      "unii": "W472RVB1NU"
    }
  ]
}