{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1e08af44-a555-4cdb-9891-cf6d014d85e9",
          "code": "3417-91-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3417-91-2",
          "code_system": "CAS",
          "references": [
            "d31857c6-ec27-4c0c-a9bc-624099810fed",
            "a8b57954-1dfd-4336-8ab1-a095a03a0cec"
          ]
        },
        {
          "uuid": "846af3fc-1f72-48ca-8525-a6a44125c6ff",
          "code": "222-313-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.020.286",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "d31857c6-ec27-4c0c-a9bc-624099810fed"
          ]
        },
        {
          "uuid": "73c50941-d275-4f3a-b32f-4baca15c89d3",
          "code": "76956",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/76956",
          "code_system": "PUBCHEM",
          "references": [
            "d31857c6-ec27-4c0c-a9bc-624099810fed"
          ]
        },
        {
          "uuid": "12aea5c8-ecd8-4640-bd3b-a7dbf99d2ace",
          "code": "W42M0MI271",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3b955fe8-5be2-7713-5d57-4b571cd34864",
          "code": "65609",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=65609",
          "code_system": "NSC",
          "references": [
            "431a15cc-2379-b18c-2d16-8abc0ce4fe7b"
          ]
        },
        {
          "uuid": "605ac64e-b794-fc89-0eb8-a66bbfb3fd57",
          "code": "DTXSID20883973",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20883973",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7cd696b9-c3e1-427f-be74-19d68fe95074",
          "name": "(2S)-METHYL 2-AMMONIO-3-(4-HYDROXYPHENYL)PROPIONATE CHLORIDE",
          "stdName": "(2S)-METHYL 2-AMMONIO-3-(4-HYDROXYPHENYL)PROPIONATE CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a96023ca-24b8-4309-9856-7b7a40e68d2f",
            "6ee495cf-5a8a-4005-a787-c42621a22e11"
          ],
          "display_name": false
        },
        {
          "uuid": "02bd84d5-77fc-46e0-9966-ac6dc0961fcb",
          "name": "(S)-TYROSINE METHYL ESTER HYDROCHLORIDE",
          "stdName": "(S)-TYROSINE METHYL ESTER HYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a96023ca-24b8-4309-9856-7b7a40e68d2f",
            "6ee495cf-5a8a-4005-a787-c42621a22e11"
          ],
          "display_name": false
        },
        {
          "uuid": "2904d3fe-c324-4a19-bb2b-af21fe50526f",
          "name": "L-TYROSINE, METHYL ESTER, HYDROCHLORIDE",
          "stdName": "L-TYROSINE, METHYL ESTER, HYDROCHLORIDE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ae3f1501-4c84-429d-8e14-709b128d8837",
            "6ee495cf-5a8a-4005-a787-c42621a22e11"
          ],
          "display_name": false
        },
        {
          "uuid": "9689a6a4-cca2-44fe-8a06-5de30f090b28",
          "name": "L-TYROSINE, METHYL ESTER, HYDROCHLORIDE (1:1)",
          "stdName": "L-TYROSINE, METHYL ESTER, HYDROCHLORIDE (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a96023ca-24b8-4309-9856-7b7a40e68d2f",
            "6ee495cf-5a8a-4005-a787-c42621a22e11"
          ],
          "display_name": false
        },
        {
          "uuid": "28d69d7a-5440-4a98-b564-40aed2fc8256",
          "name": "METHYL L-TYROSINATE HYDROCHLORIDE",
          "stdName": "METHYL L-TYROSINATE HYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "11479fa9-4ed4-4c6b-98d4-8d3ffcbad52e"
          ],
          "display_name": false
        },
        {
          "uuid": "407f9b97-42d5-4118-a180-0cdf07968430",
          "name": "METHYL TYROSINATE HCL",
          "stdName": "METHYL TYROSINATE HCL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "ae3f1501-4c84-429d-8e14-709b128d8837",
            "6ee495cf-5a8a-4005-a787-c42621a22e11",
            "0d6cc1fe-4f1e-4d53-a1dd-92c521b070cb"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "7717a6ea-0cd5-4ce5-b21f-806989e92b30",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "400551f7-8813-4ace-a9e1-5ac85ae32e40",
          "name": "METHYL TYROSINATE HYDROCHLORIDE",
          "stdName": "METHYL TYROSINATE HYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c7069bfd-48bc-4113-a244-3414f8246897",
            "6ee495cf-5a8a-4005-a787-c42621a22e11"
          ],
          "display_name": true
        },
        {
          "uuid": "1c1ea594-f686-4b6d-a096-67bd84802a42",
          "name": "Methyl (2S)-2-amino-3-(4-hydroxyphenyl)propionate",
          "stdName": "METHYL (2S)-2-AMINO-3-(4-HYDROXYPHENYL)PROPIONATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "933b6359-5f19-42ce-9885-1c9c1de83837"
          ],
          "display_name": false
        },
        {
          "uuid": "65a34174-7d18-4e9b-ab32-28d788285646",
          "name": "NSC-65609",
          "stdName": "NSC-65609",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "11479fa9-4ed4-4c6b-98d4-8d3ffcbad52e",
            "6ee495cf-5a8a-4005-a787-c42621a22e11"
          ],
          "display_name": false
        },
        {
          "uuid": "26cc1c73-69bc-4944-825b-6e384908e6a3",
          "name": "TYROSINE METHYL ESTER HYDROCHLORIDE",
          "stdName": "TYROSINE METHYL ESTER HYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a96023ca-24b8-4309-9856-7b7a40e68d2f",
            "6ee495cf-5a8a-4005-a787-c42621a22e11"
          ],
          "display_name": false
        },
        {
          "uuid": "05ed6074-d00e-455c-a7a5-375e8ca7ac50",
          "name": "TYROSINE, METHYL ESTER, HYDROCHLORIDE, L-",
          "stdName": "TYROSINE, METHYL ESTER, HYDROCHLORIDE, L-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a96023ca-24b8-4309-9856-7b7a40e68d2f",
            "6ee495cf-5a8a-4005-a787-c42621a22e11"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "11479fa9-4ed4-4c6b-98d4-8d3ffcbad52e",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c7069bfd-48bc-4113-a244-3414f8246897",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6ee495cf-5a8a-4005-a787-c42621a22e11",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae3f1501-4c84-429d-8e14-709b128d8837",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a96023ca-24b8-4309-9856-7b7a40e68d2f",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d31857c6-ec27-4c0c-a9bc-624099810fed",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391035000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "56b36e83-6f8f-4531-bb2f-f480eebcca4f",
          "citation": "SRS import [W42M0MI271]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=W42M0MI271",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391035000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fb126697-7e79-4888-8479-3d6d52d17c0c",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0d6cc1fe-4f1e-4d53-a1dd-92c521b070cb",
          "citation": "METHYL TYROSINATE HCL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "933b6359-5f19-42ce-9885-1c9c1de83837",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a8b57954-1dfd-4336-8ab1-a095a03a0cec",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "431a15cc-2379-b18c-2d16-8abc0ce4fe7b",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "6627aee4-f0df-4b7e-924b-039edc75d4e9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "cdb592eb-635d-400b-baa3-f07b340d3e4b",
          "id": "cdb592eb-635d-400b-baa3-f07b340d3e4b",
          "molfile": "\n  Marvin  01132110372D          \n\n  1  0  0  0  1  0            999 V2000\n    8.7280   -8.4625    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "38233ffa-24a9-40b3-b304-808b5e61fed7"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "2607ca8e-9c2b-4f6c-8e01-4cb639e63b31",
          "id": "2607ca8e-9c2b-4f6c-8e01-4cb639e63b31",
          "molfile": "\n  Marvin  01132102062D          \n\n 14 14  0  0  1  0            999 V2000\n    7.7384   -7.4707    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.0244   -7.0560    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7384   -8.2957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0244   -8.7060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3101   -8.2957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5913   -8.7060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5913   -9.5310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8772   -9.9457    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3101   -9.9457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0244   -9.5310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4526   -7.0560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4526   -6.2310    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1669   -7.4707    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8809   -7.0560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 11  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n 10  4  2  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 11  1  0  0  0  0\n 14 13  1  0  0  0  0\nM  END",
          "smiles": "COC(=O)[C@H](Cc1ccc(cc1)O)N",
          "formula": "C10H13NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f2acb522-ae2e-494a-80ad-089975b5cfab"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "195.2155",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "dccc42d7-fa35-46e1-9bc0-5582437d88e4",
      "version": "9",
      "structure": {
        "id": "9bb77e9a-9c73-4fc7-a821-e98b81680c3c",
        "molfile": "\n  Marvin  01132108052D          \n\n 15 14  0  0  1  0            999 V2000\n    8.7280   -8.4625    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.7384   -7.4707    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.4526   -7.0560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4526   -6.2310    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1669   -7.4707    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8809   -7.0560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7384   -8.2957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0244   -8.7060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3101   -8.2957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5913   -8.7060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5913   -9.5310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8772   -9.9457    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3101   -9.9457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0244   -9.5310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0244   -7.0560    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  3  1  0  0  0  0\n  6  5  1  0  0  0  0\n  2  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14  8  1  0  0  0  0\n  2 15  1  6  0  0  0\nM  END",
        "smiles": "COC(=O)[C@H](Cc1ccc(cc1)O)N.Cl",
        "formula": "C10H13NO3.ClH",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "231.6764",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "fb126697-7e79-4888-8479-3d6d52d17c0c",
          "56b36e83-6f8f-4531-bb2f-f480eebcca4f"
        ],
        "stereo_centers": 1
      },
      "unii": "W42M0MI271"
    }
  ]
}