{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "daa15aad-56ce-482c-bfab-53ea09ca40cc",
          "code": "38963-94-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=38963-94-9",
          "code_system": "CAS",
          "references": [
            "01785520-dfd9-44fa-bc10-3787df6aa7c3",
            "4b3689d1-e943-4116-aefd-a00d7cf29353"
          ]
        },
        {
          "uuid": "7afe77e7-1adc-43a0-bc10-2297f097143d",
          "code": "5320521",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5320521",
          "code_system": "PUBCHEM",
          "references": [
            "01785520-dfd9-44fa-bc10-3787df6aa7c3"
          ]
        },
        {
          "uuid": "dd494ebf-7278-d72b-2063-7d14c1ef1f70",
          "code": "m12000",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m12000",
          "code_system": "MERCK INDEX",
          "references": [
            "cc64e514-8081-9d84-d817-11f3e22863cc"
          ]
        },
        {
          "uuid": "ce067682-ef8d-4797-92e2-2f37cb9f11e6",
          "code": "W3LCK69N6O",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "fed4c8e1-239a-e427-7698-8f7d4344275a",
          "code": "DTXSID80192255",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80192255",
          "code_system": "EPA CompTox",
          "references": [
            "e594874e-98c9-36e1-71fd-76b0632c2be7"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3f1d2fe3-3d9f-48e8-8406-69d4b783fc55",
          "name": "(4-HYDROXYPHENYL)-2-BUTANONE .BETA.-D-GLUCOSIDE",
          "stdName": "(4-HYDROXYPHENYL)-2-BUTANONE .BETA.-D-GLUCOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66b88d29-58eb-49ba-8f5e-ef8acf3c3a6f",
            "085676fa-1e0f-40fd-afae-53194f1fb4db"
          ],
          "display_name": false
        },
        {
          "uuid": "b65224b3-4f14-4d0d-8872-5a3d480223f3",
          "name": "2-BUTANONE, 4-(4-(.BETA.-D-GLUCOPYRANOSYLOXY)PHENYL)-",
          "stdName": "2-BUTANONE, 4-(4-(.BETA.-D-GLUCOPYRANOSYLOXY)PHENYL)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66b88d29-58eb-49ba-8f5e-ef8acf3c3a6f",
            "085676fa-1e0f-40fd-afae-53194f1fb4db"
          ],
          "display_name": false
        },
        {
          "uuid": "b45eab08-b039-45ac-9a69-051ef576c612",
          "name": "4-(4'-HYDROXYLPHENYL)-2-BUTANONE 4'-O-GLUCOPYRANOSIDE",
          "stdName": "4-(4'-HYDROXYLPHENYL)-2-BUTANONE 4'-O-GLUCOPYRANOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66b88d29-58eb-49ba-8f5e-ef8acf3c3a6f",
            "085676fa-1e0f-40fd-afae-53194f1fb4db"
          ],
          "display_name": false
        },
        {
          "uuid": "ede41dd4-9ec1-4761-865d-8b4bd42be668",
          "name": "4-(4-HYDROXYPHENYL)-2-BUTANONE .BETA.-D-GLUCOSIDE",
          "stdName": "4-(4-HYDROXYPHENYL)-2-BUTANONE .BETA.-D-GLUCOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d496c9d4-9b1b-486a-bee1-987b045cc112",
            "66b88d29-58eb-49ba-8f5e-ef8acf3c3a6f"
          ],
          "display_name": false
        },
        {
          "uuid": "2438ae11-bb24-4384-8a8d-72f373e38292",
          "name": "4-(P-HYDROXYPHENYL)-2-BUTANONE .BETA.-D-GLUCOSIDE",
          "stdName": "4-(P-HYDROXYPHENYL)-2-BUTANONE .BETA.-D-GLUCOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d496c9d4-9b1b-486a-bee1-987b045cc112",
            "66b88d29-58eb-49ba-8f5e-ef8acf3c3a6f"
          ],
          "display_name": false
        },
        {
          "uuid": "0f307fb8-ec8d-48bb-ad44-5d9239006445",
          "name": "ORISTAR RKG",
          "stdName": "ORISTAR RKG",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "006e7a38-dbca-4e50-ae30-dd6a2cd2b70a",
            "66b88d29-58eb-49ba-8f5e-ef8acf3c3a6f"
          ],
          "display_name": false
        },
        {
          "uuid": "c3034aa4-efb1-479f-8ea8-ba5fe034f7ef",
          "name": "RASPBERRY KETONE .BETA.-D-GLUCOPYRANOSIDE",
          "stdName": "RASPBERRY KETONE .BETA.-D-GLUCOPYRANOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66b88d29-58eb-49ba-8f5e-ef8acf3c3a6f",
            "085676fa-1e0f-40fd-afae-53194f1fb4db"
          ],
          "display_name": false
        },
        {
          "uuid": "794dd9f0-9931-42f1-ab51-b1e307382086",
          "name": "RASPBERRY KETONE .BETA.-D-GLUCOSIDE",
          "stdName": "RASPBERRY KETONE .BETA.-D-GLUCOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66b88d29-58eb-49ba-8f5e-ef8acf3c3a6f",
            "085676fa-1e0f-40fd-afae-53194f1fb4db"
          ],
          "display_name": false
        },
        {
          "uuid": "38677525-3543-6e33-9f9e-9748a12a972e",
          "name": "RASPBERRY KETONE GLUCOSIDE",
          "stdName": "RASPBERRY KETONE GLUCOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "384bf5f8-be1b-8892-04ee-7f87cc3f5b52"
          ],
          "display_name": false
        },
        {
          "uuid": "9d636191-91ae-612b-2fb2-2fb3892ff2be",
          "name": "RASPBERRY KETONE GLUCOSIDE [MI]",
          "stdName": "RASPBERRY KETONE GLUCOSIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d462b43c-a24e-da1c-accf-90580b19da0f"
          ],
          "display_name": false
        },
        {
          "uuid": "83b38787-d0ff-4293-b93c-a3a1e29ff3ba",
          "name": "RASPBERRYKETONE GLUCOSIDE",
          "stdName": "RASPBERRYKETONE GLUCOSIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "006e7a38-dbca-4e50-ae30-dd6a2cd2b70a",
            "66b88d29-58eb-49ba-8f5e-ef8acf3c3a6f",
            "52659e7a-ef73-425f-8fb4-374536fb05b4"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "7a424bce-ea8c-4ca2-bf1a-c4f7ac41615a",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "d28364af-d877-461c-afaa-3b5324c1d46c",
          "name": "RASPBERRYKETONE GLUCOSIDE TH",
          "stdName": "RASPBERRYKETONE GLUCOSIDE TH",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "006e7a38-dbca-4e50-ae30-dd6a2cd2b70a",
            "66b88d29-58eb-49ba-8f5e-ef8acf3c3a6f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "006e7a38-dbca-4e50-ae30-dd6a2cd2b70a",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "66b88d29-58eb-49ba-8f5e-ef8acf3c3a6f",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "085676fa-1e0f-40fd-afae-53194f1fb4db",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d496c9d4-9b1b-486a-bee1-987b045cc112",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "01785520-dfd9-44fa-bc10-3787df6aa7c3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391590000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "251aa799-526f-4534-8957-748cc21845f4",
          "citation": "SRS import [W3LCK69N6O]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=W3LCK69N6O",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391590000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "52659e7a-ef73-425f-8fb4-374536fb05b4",
          "citation": "RASPBERRYKETONE GLUCOSIDE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "384bf5f8-be1b-8892-04ee-7f87cc3f5b52",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=38963-94-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d462b43c-a24e-da1c-accf-90580b19da0f",
          "citation": "MI",
          "doc_type": "MERCK INDEX",
          "public_domain": true
        },
        {
          "uuid": "cc64e514-8081-9d84-d817-11f3e22863cc",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "4b3689d1-e943-4116-aefd-a00d7cf29353",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "de5d1070-71a8-22d9-7a9a-5e14a1e8cafa",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "e594874e-98c9-36e1-71fd-76b0632c2be7",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6a4d9ad9-3282-4ef0-a02f-9ee65d6faf90",
          "id": "6a4d9ad9-3282-4ef0-a02f-9ee65d6faf90",
          "molfile": "\n  Marvin  01132105322D          \n\n 23 24  0  0  1  0            999 V2000\n    8.1485   -5.5048    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.4228   -5.0891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7064   -5.4959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8736   -5.0891    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5905   -5.5048    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   10.3068   -5.0715    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3068   -4.2485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9970   -3.8240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9970   -3.0188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2979   -2.6032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2979   -1.7713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0147   -1.3557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7310   -1.7713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4479   -1.3557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7310   -2.5855    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5905   -3.0276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5905   -3.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5905   -6.3272    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   10.3068   -6.7611    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8736   -6.7434    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.8736   -7.5659    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1485   -6.3272    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.4139   -6.7346    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  4  1  0  0  0  0\n 22  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n 18  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n 17  7  2  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10 16  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  2  0  0  0  0\n 16 17  1  0  0  0  0\n 18 19  1  6  0  0  0\n 20 18  1  0  0  0  0\n 20 21  1  1  0  0  0\n 22 20  1  0  0  0  0\n 22 23  1  6  0  0  0\nM  END",
          "smiles": "CC(=O)CCc1ccc(cc1)O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O",
          "formula": "C16H22O7",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "daca9b2f-2145-42e0-833b-ec208e47b86b"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "326.3423",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2fa83435-fdb4-49f2-8f01-fd49b1da8724",
      "version": "12",
      "structure": {
        "id": "80fde951-ba88-4992-bbcb-ab8526b339ab",
        "molfile": "\n  Marvin  01132106422D          \n\n 23 24  0  0  1  0            999 V2000\n    9.5898   -5.5044    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.5898   -6.3268    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.8730   -6.7429    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.1479   -6.3268    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.1479   -5.5044    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.8730   -7.5654    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8730   -5.0887    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4223   -5.0887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7059   -5.4955    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4134   -6.7341    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3061   -6.7606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3061   -5.0711    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3061   -4.2482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9962   -3.8237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9962   -3.0186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2972   -2.6030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5898   -3.0274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5898   -3.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2972   -1.7712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0139   -1.3556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7302   -1.7712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7302   -2.5853    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4470   -1.3556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  3  6  1  1  0  0  0\n  7  1  1  0  0  0  0\n  5  7  1  0  0  0  0\n  5  8  1  1  0  0  0\n  9  8  1  0  0  0  0\n  4 10  1  6  0  0  0\n  2 11  1  6  0  0  0\n  1 12  1  1  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 16 17  1  0  0  0  0\n 18 13  1  0  0  0  0\n 17 18  2  0  0  0  0\n 19 16  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  2  0  0  0  0\n 23 21  1  0  0  0  0\nM  END",
        "smiles": "CC(=O)CCc1ccc(cc1)O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O",
        "formula": "C16H22O7",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 0,
        "molecular_weight": "326.3423",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "251aa799-526f-4534-8957-748cc21845f4",
          "085676fa-1e0f-40fd-afae-53194f1fb4db"
        ],
        "stereo_centers": 5
      },
      "unii": "W3LCK69N6O"
    }
  ]
}