{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "f32090d2-50f3-4947-b444-a50582230aa3", "code": "169682-22-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=169682-22-8", "code_system": "CAS", "references": [ "7d1e699d-c6e6-439a-9fbe-1f6187c96d63", "8d3e8c65-1d6c-428c-8186-1fdea84f5bf8" ] }, { "uuid": "7f160f29-a574-4c9b-8ca7-c61a49cdadd4", "code": "15332725", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/15332725", "code_system": "PUBCHEM", "references": [ "7d1e699d-c6e6-439a-9fbe-1f6187c96d63" ] }, { "uuid": "a998b339-b558-422e-8213-a89affc4ce2c", "code": "W32N9R5ET0", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "933ca195-15f7-080a-7991-423f8f56621d", "code": "DTXSID401021247", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID401021247", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "10084ad4-2a39-4786-9502-78c5dc73ead4", "name": "2,2-DIPHENYL-5-CARBOMETHOXY-6-ACETOXY-2H-NAPHTHOPYRAN", "stdName": "2,2-DIPHENYL-5-CARBOMETHOXY-6-ACETOXY-2H-NAPHTHOPYRAN", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "122d873a-fb83-4358-bea7-46678a97aa10" ], "display_name": false }, { "uuid": "e471c2fc-819f-44cb-b6bc-2b174989abcd", "name": "2H-NAPHTHO(1,2-B)PYRAN-5-CARBOXYLIC ACID, 6-(ACETYLOXY)-2,2-DIPHENYL-, METHYL ESTER", "stdName": "2H-NAPHTHO(1,2-B)PYRAN-5-CARBOXYLIC ACID, 6-(ACETYLOXY)-2,2-DIPHENYL-, METHYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8d68354a-cad3-49da-af83-be2cc59858ac" ], "display_name": false }, { "uuid": "77cd5137-961b-4106-afd3-ae62b552da17", "name": "DIPHENYL CARBOMETHOXY ACETOXY NAPHTHOPYRAN", "stdName": "DIPHENYL CARBOMETHOXY ACETOXY NAPHTHOPYRAN", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "122d873a-fb83-4358-bea7-46678a97aa10", "1df50ee8-a733-4e69-ae91-90ecf635ae3c" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "a75d2dfe-4676-4622-9973-108736f20ccc", "name_org": "INCI" } ] }, { "uuid": "bf90ac99-e291-46f1-8798-2625f685e93e", "name": "PHOTOSOL (R)5-3 PHOTOCHROMIC DYE", "stdName": "PHOTOSOL (R)5-3 PHOTOCHROMIC DYE", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "122d873a-fb83-4358-bea7-46678a97aa10" ], "display_name": false } ], "references": [ { "uuid": "8d68354a-cad3-49da-af83-be2cc59858ac", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "122d873a-fb83-4358-bea7-46678a97aa10", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "7d1e699d-c6e6-439a-9fbe-1f6187c96d63", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392238000, "tags": [ "NOMEN" ] }, { "uuid": "97d596d5-07ea-4000-80fa-a44a01e9f6d9", "citation": "SRS import [W32N9R5ET0]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=W32N9R5ET0", "doc_type": "SRS", "public_domain": true, "document_date": 1493392238000, "tags": [ "NOMEN" ] }, { "uuid": "1df50ee8-a733-4e69-ae91-90ecf635ae3c", "citation": "DIPHENYL CARBOMETHOXY ACETOXY NAPHTHOPYRAN [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "8d3e8c65-1d6c-428c-8186-1fdea84f5bf8", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "08638f3e-08e8-4c3d-8859-f864041c44f2", "id": "08638f3e-08e8-4c3d-8859-f864041c44f2", "molfile": "\n Marvin 01132100422D \n\n 34 38 0 0 0 0 999 V2000\n 4.2938 -0.4131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5781 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8699 -0.4131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1468 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8699 -1.2394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1542 -1.6525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4313 -1.2394 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7156 -1.6452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7156 -2.4715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.2321 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1542 -2.4715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4386 -2.8920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4386 -3.7183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1542 -4.1240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8625 -3.7183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8699 -2.8920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5781 -2.4789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2790 -2.8994 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9946 -2.5010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0094 -1.6747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3011 -1.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5855 -1.6599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7914 -2.2796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3742 -2.8625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1710 -2.6485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3776 -1.8518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7874 -1.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9979 -1.4903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2085 -3.2978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6183 -3.8732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8323 -4.6700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6291 -4.8839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2119 -4.3011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9979 -3.5043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 2 0 0 0 0\n 5 3 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 22 2 0 0 0 0\n 6 7 1 0 0 0 0\n 11 6 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 10 2 0 0 0 0\n 12 11 1 0 0 0 0\n 11 16 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 22 17 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 19 23 1 0 0 0 0\n 19 29 1 0 0 0 0\n 20 21 2 0 0 0 0\n 22 21 1 0 0 0 0\n 23 24 1 0 0 0 0\n 23 28 2 0 0 0 0\n 24 25 2 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 2 0 0 0 0\n 27 28 1 0 0 0 0\n 29 30 1 0 0 0 0\n 29 34 2 0 0 0 0\n 30 31 2 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 2 0 0 0 0\n 33 34 1 0 0 0 0\nM END", "smiles": "CC(=O)Oc1c2ccccc2c3c(C=CC(c4ccccc4)(c5ccccc5)O3)c1C(=O)OC", "formula": "C29H22O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "a7240ce7-c4d0-4bd3-830c-94f08816989a" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "450.4831", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "67bf5252-8e10-43aa-b35f-5eb20afd0d60", "version": "4", "structure": { "id": "9d66c870-1eae-40d7-a8de-7e345afe2928", "molfile": "\n Marvin 01132108112D \n\n 34 38 0 0 0 0 999 V2000\n 1.4386 -2.8920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4386 -3.7183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1542 -4.1240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8625 -3.7183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1542 -2.4715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8699 -2.8920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8699 -1.2394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1542 -1.6525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5855 -1.6599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5781 -2.4789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2790 -2.8994 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9946 -2.5010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0094 -1.6747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3011 -1.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7914 -2.2796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2085 -3.2978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3742 -2.8625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1710 -2.6485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3776 -1.8518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7874 -1.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9979 -1.4903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6183 -3.8732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8323 -4.6700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6291 -4.8839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2119 -4.3011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9979 -3.5043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8699 -0.4131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4313 -1.2394 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5781 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2938 -0.4131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1468 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7156 -1.6452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7156 -2.4715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.2321 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 1 5 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 6 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 8 2 0 0 0 0\n 6 10 2 0 0 0 0\n 7 9 2 0 0 0 0\n 7 8 1 0 0 0 0\n 7 27 1 0 0 0 0\n 8 28 1 0 0 0 0\n 9 10 1 0 0 0 0\n 9 14 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 16 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 15 1 0 0 0 0\n 13 14 2 0 0 0 0\n 15 17 2 0 0 0 0\n 15 21 1 0 0 0 0\n 16 22 2 0 0 0 0\n 16 26 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 2 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 27 29 1 0 0 0 0\n 27 31 2 0 0 0 0\n 28 32 1 0 0 0 0\n 29 30 1 0 0 0 0\n 32 33 1 0 0 0 0\n 32 34 2 0 0 0 0\nM END", "smiles": "CC(=O)Oc1c2ccccc2c3c(C=CC(c4ccccc4)(c5ccccc5)O3)c1C(=O)OC", "formula": "C29H22O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "450.4831", "optical_activity": "NONE", "references": [ "97d596d5-07ea-4000-80fa-a44a01e9f6d9", "8d68354a-cad3-49da-af83-be2cc59858ac" ], "stereo_centers": 0 }, "unii": "W32N9R5ET0" } ] }