{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "f8694820-f4b6-4023-b085-81acb9f3f7ac", "code": "28302-36-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=28302-36-5", "code_system": "CAS", "references": [ "785ee01e-8339-41f0-bc54-b17a80a65b63", "1ee1494d-b894-407c-a20d-d7019ea1f802" ] }, { "uuid": "e9543386-015a-46b5-9724-37976b266f5f", "code": "248-950-7", "type": "PRIMARY", "code_system": "ECHA (EC/EINECS)", "references": [ "785ee01e-8339-41f0-bc54-b17a80a65b63" ] }, { "uuid": "d869943a-54ca-4def-d6bd-2ebf3330b83d", "code": "9987554", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9987554", "code_system": "PUBCHEM", "references": [ "8a13cf2a-857d-7700-e058-3b613d4f9b0c" ] }, { "uuid": "75e49e34-48d4-3790-a93c-541752e983c2", "code": "DTXSID3021273", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3021273", "code_system": "EPA CompTox", "references": [ "620d7bf9-046f-5fcc-b074-4f84c6cf3af6" ] }, { "uuid": "610ecae8-b089-49dd-86ef-e8b3e3653540", "code": "W291NWW1C0", "type": "PRIMARY", "code_system": "FDA UNII" } ], "relationships": [ { "uuid": "47d80768-ff2d-48b5-8c21-0259ecdef041", "type": "PARENT->SALT/SOLVATE", "related_substance": { "uuid": "b9e2592e-ecdf-45be-872f-0e5f36c323a8", "refuuid": "fb2b9b51-d768-4c6f-99e7-99071d83a4fb", "name": "CUPRIC CATION", "unii": "8CBV67279L", "linking_id": "8CBV67279L", "ref_pname": "CUPRIC CATION", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "d4a2b33a-5148-4574-ac88-68fd14985372", "name": "CUPRATE(3-), ((7S,8S)-3-CARBOXY-5-(CARBOXYMETHYL)-13-ETHENYL-18-ETHYL-17-FORMYL-7,8-DIHYDRO-2,8,12-TRIMETHYL-21H,23H-PORPHINE-7-PROPANOATO(5-)-.KAPPA.N21,.KAPPA.N22,.KAPPA.N23,.KAPPA.N24)-, SODIUM (1:3), (SP-4-2)-", "stdName": "CUPRATE(3-), ((7S,8S)-3-CARBOXY-5-(CARBOXYMETHYL)-13-ETHENYL-18-ETHYL-17-FORMYL-7,8-DIHYDRO-2,8,12-TRIMETHYL-21H,23H-PORPHINE-7-PROPANOATO(5-)-.KAPPA.N21,.KAPPA.N22,.KAPPA.N23,.KAPPA.N24)-, SODIUM (1:3), (SP-4-2)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "431e11ce-7234-4b3d-b9ca-c507ba9a0662" ], "display_name": false }, { "uuid": "f58f1ed2-1252-4815-a6b3-504cba2db88f", "name": "SODIUM COPPER CHLOROPHYLLIN B", "stdName": "SODIUM COPPER CHLOROPHYLLIN B", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b37732bb-1803-4873-8f85-2082c630fbab" ], "display_name": true } ], "references": [ { "uuid": "b37732bb-1803-4873-8f85-2082c630fbab", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "431e11ce-7234-4b3d-b9ca-c507ba9a0662", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "785ee01e-8339-41f0-bc54-b17a80a65b63", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390907000, "tags": [ "NOMEN" ] }, { "uuid": "1d852f60-e5e7-40d4-89ae-896b1b934ae1", "citation": "SRS import [W291NWW1C0]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=W291NWW1C0", "doc_type": "SRS", "public_domain": true, "document_date": 1493390907000, "tags": [ "NOMEN" ] }, { "uuid": "620d7bf9-046f-5fcc-b074-4f84c6cf3af6", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=28302-36-5", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "8a13cf2a-857d-7700-e058-3b613d4f9b0c", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "1ee1494d-b894-407c-a20d-d7019ea1f802", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "c186e1b0-cbea-45a4-a612-5cb08bd862a9", "id": "c186e1b0-cbea-45a4-a612-5cb08bd862a9", "molfile": "\n Marvin 01132110002D \n\n 1 0 0 0 1 0 999 V2000\n 5.8702 -10.5542 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 1\nM END", "smiles": "[Na+]", "formula": "Na", "atropisomerism": "No", "charge": 1, "count": 3, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 3, "units": "MOL RATIO", "uuid": "3b45c79c-5e09-484a-afda-4f5c75109ada" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "22.9898", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "f073a82f-467f-42ff-85d8-27af90e6c869", "id": "f073a82f-467f-42ff-85d8-27af90e6c869", "molfile": "\n Marvin 01132112292D \n\n 1 0 0 0 1 0 999 V2000\n 6.8340 -4.0014 0.0000 Cu 0 2 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 2\nM END", "smiles": "[Cu+2]", "formula": "Cu", "atropisomerism": "No", "charge": 2, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "1e5cd40a-797e-4d10-8a3c-eb55440a2cf2" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "63.5456", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "22eaabee-2a04-4d08-aefe-84b26892e6e1", "id": "22eaabee-2a04-4d08-aefe-84b26892e6e1", "molfile": "\n Marvin 01132101572D \n\n 45 49 0 0 1 0 999 V2000\n 5.1351 -5.3911 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 4.3101 -5.3911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5077 -4.6268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1225 -3.9225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4951 -3.1535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2876 -3.0038 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4592 -2.2018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1947 -1.8162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9058 -2.1897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0559 -3.0136 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8257 -3.1276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2426 -3.8582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8691 -4.5643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0458 -4.7505 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9056 -5.5473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7012 -5.9195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0464 -6.7831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1629 -7.9597 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 10.0430 -6.5508 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2556 -5.3580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0747 -5.3580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2012 -5.9324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3600 -6.7736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1199 -7.3982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3544 -7.9017 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 7.9191 -7.9055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4585 -5.5328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3311 -4.7617 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7061 -5.9500 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 5.7061 -6.7665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9752 -7.1768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2630 -6.7618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5413 -7.1722 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 4.2630 -5.9409 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2297 -2.3535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0464 -2.3535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4568 -3.0634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6633 -1.7990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6633 -0.9690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6183 -0.3522 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7267 -1.8554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7267 -1.0304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9989 -0.6199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1368 -2.4488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3149 -2.4488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 3 1 0 0 0 0\n 1 29 1 0 0 0 0\n 3 4 1 0 0 0 0\n 28 3 2 0 0 0 0\n 5 4 2 0 0 0 0\n 5 6 1 0 0 0 0\n 44 5 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 41 7 1 0 0 0 0\n 9 8 2 0 0 0 0\n 9 10 1 0 0 0 0\n 38 9 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 35 11 1 0 0 0 0\n 13 12 2 0 0 0 0\n 13 14 1 0 0 0 0\n 20 13 1 0 0 0 0\n 14 15 2 0 0 0 0\n 16 15 1 0 0 0 0\n 15 22 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 20 2 0 0 0 0\n 17 18 1 0 0 0 0\n 17 19 2 0 0 0 0\n 20 21 1 0 0 0 0\n 22 23 1 0 0 0 0\n 27 22 2 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 24 26 2 0 0 0 0\n 27 28 1 0 0 0 0\n 29 27 1 0 0 0 0\n 29 30 1 1 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 32 34 2 0 0 0 0\n 35 36 1 0 0 0 0\n 35 38 2 0 0 0 0\n 36 37 1 0 0 0 0\n 38 39 1 0 0 0 0\n 39 40 2 0 0 0 0\n 41 42 1 0 0 0 0\n 41 44 2 0 0 0 0\n 42 43 2 0 0 0 0\n 44 45 1 0 0 0 0\nM CHG 3 18 -1 25 -1 33 -1\nM END", "smiles": "C=Cc1c(C)c2cc3[C@@H](C)[C@H](CCC(=O)[O-])c(c(CC(=O)[O-])c4c(c(C)c(cc5c(CC)c(C=O)c(cc1n2)n5)n4)C(=O)[O-])n3", "formula": "C34H29N4O7", "atropisomerism": "No", "charge": -3, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "da8dbb73-e0c8-41d3-b43a-3615a15ac7c8" }, "defined_stereo": 2, "ez_centers": 4, "molecular_weight": "605.6179", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "9c43d935-a7dc-4432-917a-6f75a182fe92", "version": "5", "structure": { "id": "9da6c3d4-a839-47f3-b295-2fd867b9d0ad", "molfile": "\n Marvin 01132108112D \n\n 49 49 0 0 1 0 999 V2000\n 9.1629 -7.9597 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 9.0464 -6.7831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0430 -6.5508 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7012 -5.9195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9056 -5.5473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2012 -5.9324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4585 -5.5328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3311 -4.7617 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5077 -4.6268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1225 -3.9225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4951 -3.1535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2876 -3.0038 0.0000 N 0 5 0 0 0 0 0 0 0 0 0 0\n 6.4592 -2.2018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1947 -1.8162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9058 -2.1897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0559 -3.0136 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8257 -3.1276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2426 -3.8582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8691 -4.5643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0458 -4.7505 0.0000 N 0 5 0 0 0 0 0 0 0 0 0 0\n 9.2556 -5.3580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0747 -5.3580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2297 -2.3535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0464 -2.3535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4568 -3.0634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6633 -1.7990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6633 -0.9690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6183 -0.3522 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7267 -1.8554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7267 -1.0304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9989 -0.6199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1368 -2.4488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3149 -2.4488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1351 -5.3911 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 4.3101 -5.3911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7061 -5.9500 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 5.7061 -6.7665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9752 -7.1768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2630 -6.7618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5413 -7.1722 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 4.2630 -5.9409 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3600 -6.7736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1199 -7.3982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3544 -7.9017 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 7.9191 -7.9055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8340 -4.0014 0.0000 Cu 0 2 0 0 0 0 0 0 0 0 0 0\n 5.8702 -10.5542 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 5.8702 -10.5542 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 5.8702 -10.5542 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 4 2 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 11 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 14 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 19 18 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 5 1 0 0 0 0\n 21 19 1 0 0 0 0\n 21 22 1 0 0 0 0\n 4 21 2 0 0 0 0\n 23 17 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 23 26 2 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 2 0 0 0 0\n 26 15 1 0 0 0 0\n 29 13 2 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 2 0 0 0 0\n 29 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 32 11 2 0 0 0 0\n 34 9 1 0 0 0 0\n 34 35 1 6 0 0 0\n 34 36 1 0 0 0 0\n 36 37 1 1 0 0 0\n 37 38 1 0 0 0 0\n 38 39 1 0 0 0 0\n 39 40 1 0 0 0 0\n 39 41 2 0 0 0 0\n 36 7 1 0 0 0 0\n 6 42 1 0 0 0 0\n 42 43 1 0 0 0 0\n 43 44 1 0 0 0 0\n 43 45 2 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 2 0 0 0 0\nM CHG 8 1 -1 12 -1 20 -1 40 -1 44 -1 46 2 47 1 48 1\nM CHG 1 49 1\nM STY 1 1 MUL\nM SCN 1 1 HT \nM SAL 1 3 47 48 49\nM SPA 1 1 47\nM SDI 1 4 5.4502 -10.9742 5.4502 -10.1342\nM SDI 1 4 6.2902 -10.1342 6.2902 -10.9742\nM SMT 1 3\nM END", "smiles": "C=Cc1c(C)c2cc3[C@@H](C)[C@H](CCC(=O)[O-])c(c(CC(=O)[O-])c4c(c(C)c(cc5C(=C(C=O)c(cc1[n-]2)n5)CC)[n-]4)C(=O)[O-])n3.[Cu+2].[Na+].[Na+].[Na+]", "formula": "C34H29N4O7.Cu.3Na", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 2, "ez_centers": 4, "molecular_weight": "738.1329", "optical_activity": "UNSPECIFIED", "references": [ "431e11ce-7234-4b3d-b9ca-c507ba9a0662", "1d852f60-e5e7-40d4-89ae-896b1b934ae1" ], "stereo_centers": 2 }, "unii": "W291NWW1C0" } ] }